diff --git a/go.mod b/go.mod index a41c05382..2e8f9227e 100644 --- a/go.mod +++ b/go.mod @@ -3,7 +3,7 @@ module github.com/Mirantis/cri-dockerd go 1.21 require ( - github.com/Microsoft/hcsshim v0.8.25 + github.com/Microsoft/hcsshim v0.11.4 github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e github.com/blang/semver v3.5.1+incompatible github.com/containernetworking/cni v1.1.2 @@ -22,17 +22,17 @@ require ( github.com/spf13/cobra v1.8.0 github.com/spf13/pflag v1.0.5 github.com/stretchr/testify v1.8.4 - github.com/vishvananda/netlink v1.1.0 + github.com/vishvananda/netlink v1.2.1-beta.2 golang.org/x/sync v0.5.0 - golang.org/x/sys v0.14.0 - google.golang.org/grpc v1.59.0 + golang.org/x/sys v0.15.0 + google.golang.org/grpc v1.60.0 k8s.io/api v0.27.8 k8s.io/apimachinery v0.27.8 k8s.io/apiserver v0.22.8 k8s.io/client-go v0.27.8 k8s.io/component-base v0.27.8 k8s.io/component-helpers v0.26.0 - k8s.io/cri-api v0.22.8 + k8s.io/cri-api v0.25.0 k8s.io/kubernetes v1.27.8 k8s.io/utils v0.0.0-20230209194617-a36077c30491 ) @@ -40,7 +40,7 @@ require ( require ( github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1 // indirect github.com/JeffAshton/win_pdh v0.0.0-20161109143554-76bb4ee9f0ab // indirect - github.com/Microsoft/go-winio v0.4.17 // indirect + github.com/Microsoft/go-winio v0.6.1 // indirect github.com/NYTimes/gziphandler v1.1.1 // indirect github.com/antlr/antlr4/runtime/Go/antlr v1.4.10 // indirect github.com/asaskevich/govalidator v0.0.0-20190424111038-f61b66f89f4a // indirect @@ -48,12 +48,13 @@ require ( github.com/blang/semver/v4 v4.0.0 // indirect github.com/cenkalti/backoff/v4 v4.2.1 // indirect github.com/cespare/xxhash/v2 v2.2.0 // indirect - github.com/containerd/cgroups v1.0.1 // indirect + github.com/containerd/cgroups v1.1.0 // indirect + github.com/containerd/containerd v1.6.23 // indirect github.com/coreos/go-semver v0.3.0 // indirect github.com/cyphar/filepath-securejoin v0.2.4 // indirect github.com/distribution/reference v0.5.0 // indirect github.com/docker/go-units v0.5.0 // indirect - github.com/emicklei/go-restful/v3 v3.9.0 // indirect + github.com/emicklei/go-restful/v3 v3.10.1 // indirect github.com/evanphx/json-patch v4.12.0+incompatible // indirect github.com/felixge/httpsnoop v1.0.3 // indirect github.com/fsnotify/fsnotify v1.6.0 // indirect @@ -72,12 +73,12 @@ require ( github.com/google/gnostic v0.7.0 // indirect github.com/google/gnostic-models v0.6.9-0.20230804172637-c7be7c783f49 // indirect github.com/google/go-cmp v0.6.0 // indirect - github.com/google/gofuzz v1.1.0 // indirect + github.com/google/gofuzz v1.2.0 // indirect github.com/google/uuid v1.3.1 // indirect github.com/gorilla/websocket v1.5.0 // indirect github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0 // indirect github.com/grpc-ecosystem/grpc-gateway/v2 v2.16.0 // indirect - github.com/imdario/mergo v0.3.7 // indirect + github.com/imdario/mergo v0.3.12 // indirect github.com/inconshreveable/mousetrap v1.1.0 // indirect github.com/jonboulle/clockwork v0.3.0 // indirect github.com/josharian/intern v1.0.0 // indirect @@ -93,7 +94,7 @@ require ( github.com/morikuni/aec v1.0.0 // indirect github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822 // indirect github.com/opencontainers/runtime-spec v1.0.3-0.20220909204839-494a5a6aca78 // indirect - github.com/opencontainers/selinux v1.10.0 // indirect + github.com/opencontainers/selinux v1.10.1 // indirect github.com/pmezard/go-difflib v1.0.0 // indirect github.com/prometheus/client_golang v1.14.0 // indirect github.com/prometheus/client_model v0.3.0 // indirect @@ -120,15 +121,17 @@ require ( go.uber.org/multierr v1.9.0 // indirect go.uber.org/zap v1.24.0 // indirect golang.org/x/crypto v0.14.0 // indirect + golang.org/x/mod v0.12.0 // indirect golang.org/x/net v0.17.0 // indirect - golang.org/x/oauth2 v0.11.0 // indirect + golang.org/x/oauth2 v0.13.0 // indirect golang.org/x/term v0.13.0 // indirect golang.org/x/text v0.13.0 // indirect golang.org/x/time v0.3.0 // indirect - google.golang.org/appengine v1.6.7 // indirect - google.golang.org/genproto v0.0.0-20230822172742-b8732ec3820d // indirect - google.golang.org/genproto/googleapis/api v0.0.0-20230822172742-b8732ec3820d // indirect - google.golang.org/genproto/googleapis/rpc v0.0.0-20230822172742-b8732ec3820d // indirect + golang.org/x/tools v0.12.0 // indirect + google.golang.org/appengine v1.6.8 // indirect + google.golang.org/genproto v0.0.0-20231002182017-d307bd883b97 // indirect + google.golang.org/genproto/googleapis/api v0.0.0-20231002182017-d307bd883b97 // indirect + google.golang.org/genproto/googleapis/rpc v0.0.0-20231002182017-d307bd883b97 // indirect google.golang.org/protobuf v1.31.0 // indirect gopkg.in/inf.v0 v0.9.1 // indirect gopkg.in/yaml.v2 v2.4.0 // indirect diff --git a/go.sum b/go.sum index dfc7ec782..eff44dbed 100644 --- a/go.sum +++ b/go.sum @@ -1,4 +1,3 @@ -bazil.org/fuse v0.0.0-20160811212531-371fbbdaa898/go.mod h1:Xbm+BRKSBEpa4q4hTSxohYNQpsxXPbPry4JJWOB3LB8= cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= cloud.google.com/go v0.38.0/go.mod h1:990N+gfupTy94rShfmMCWGDn0LpTmnzTp2qbd1dvSRU= @@ -37,7 +36,7 @@ cloud.google.com/go v0.104.0/go.mod h1:OO6xxXdJyvuJPcEPBLN9BJPD+jep5G1+2U5B5gkRY cloud.google.com/go v0.105.0/go.mod h1:PrLgOJNe5nfE9UMxKxgXj4mD3voiP+YQ6gdt6KMFOKM= cloud.google.com/go v0.107.0/go.mod h1:wpc2eNrD7hXUTy8EKS10jkxpZBjASrORK7goS+3YX2I= cloud.google.com/go v0.110.0/go.mod h1:SJnCLqQ0FCFGSZMUNUf84MV3Aia54kn7pi8st7tMzaY= -cloud.google.com/go v0.110.7 h1:rJyC7nWRg2jWGZ4wSJ5nY65GTdYJkg0cd/uXb+ACI6o= +cloud.google.com/go v0.110.8 h1:tyNdfIxjzaWctIiLYOTalaLKZ17SI44SKFW26QbOhME= cloud.google.com/go/accessapproval v1.4.0/go.mod h1:zybIuC3KpDOvotz59lFe5qxRZx6C75OtwbisN56xYB4= cloud.google.com/go/accessapproval v1.5.0/go.mod h1:HFy3tuiGvMdcd/u+Cu5b9NkO1pEICJ46IR82PoUdplw= cloud.google.com/go/accessapproval v1.6.0/go.mod h1:R0EiYnwV5fsRFiKZkPHr6mwyk2wxUJ30nL4j2pcFY2E= @@ -609,10 +608,10 @@ github.com/JeffAshton/win_pdh v0.0.0-20161109143554-76bb4ee9f0ab h1:UKkYhof1njT1 github.com/JeffAshton/win_pdh v0.0.0-20161109143554-76bb4ee9f0ab/go.mod h1:3VYc5hodBMJ5+l/7J4xAyMeuM2PNuepvHlGs8yilUCA= github.com/JohnCGriffin/overflow v0.0.0-20211019200055-46fa312c352c/go.mod h1:X0CRv0ky0k6m906ixxpzmDRLvX58TFUKS2eePweuyxk= github.com/Microsoft/go-winio v0.4.15/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= -github.com/Microsoft/go-winio v0.4.17 h1:iT12IBVClFevaf8PuVyi3UmZOVh4OqnaLxDTW2O6j3w= -github.com/Microsoft/go-winio v0.4.17/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= -github.com/Microsoft/hcsshim v0.8.25 h1:fRMwXiwk3qDwc0P05eHnh+y2v07JdtsfQ1fuAc69m9g= -github.com/Microsoft/hcsshim v0.8.25/go.mod h1:4zegtUJth7lAvFyc6cH2gGQ5B3OFQim01nnU2M8jKDg= +github.com/Microsoft/go-winio v0.6.1 h1:9/kr64B9VUZrLm5YYwbGtUJnMgqWVOdUAXu6Migciow= +github.com/Microsoft/go-winio v0.6.1/go.mod h1:LRdKpFKfdobln8UmuiYcKPot9D2v6svN5+sAH+4kjUM= +github.com/Microsoft/hcsshim v0.11.4 h1:68vKo2VN8DE9AdN4tnkWnmdhqdbpUFM8OF3Airm7fz8= +github.com/Microsoft/hcsshim v0.11.4/go.mod h1:smjE4dvqPX9Zldna+t5FG3rnoHhaB7QYxPRqGcpAD9w= github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= github.com/NYTimes/gziphandler v1.1.1 h1:ZUDjpQae29j0ryrS0u/B8HZfJBtBQHjqw2rQ2cqUQ3I= github.com/NYTimes/gziphandler v1.1.1/go.mod h1:n/CVRwUEOgIxrgPvAQhUUr9oeUtvrhMomdKFjzJNB0c= @@ -636,7 +635,6 @@ github.com/apache/arrow/go/v11 v11.0.0/go.mod h1:Eg5OsL5H+e299f7u5ssuXsuHQVEGC4x github.com/apache/thrift v0.16.0/go.mod h1:PHK3hniurgQaNMZYaCLEqXKsYK8upmhPbmdP2FXSqgU= github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e h1:QEF07wC0T1rKkctt1RINW/+RMTVmiwxETico2l3gxJA= github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e/go.mod h1:3U/XgcO3hCbHZ8TKRvWD2dDTCfh9M9ya+I9JpbB7O8o= -github.com/armon/consul-api v0.0.0-20180202201655-eb2c6b5be1b6/go.mod h1:grANhF5doyWs3UAsr3K4I6qtAmlQcZDesFNEHPZAzj8= github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da/go.mod h1:Q73ZrmVTwzkszR9V5SSuryQ31EELlFMUz1kKyl939pY= github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8= github.com/armon/go-socks5 v0.0.0-20160902184237-e75332964ef5 h1:0CwZNZbxp69SHPdPJAN/hZIm0C4OItdklCFmMRWYpio= @@ -677,7 +675,6 @@ github.com/checkpoint-restore/go-criu/v5 v5.3.0/go.mod h1:E/eQpaFtUKGOOSEBZgmKAc github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI= github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI= github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU= -github.com/cilium/ebpf v0.4.0/go.mod h1:4tRaxcgiL706VnOzHOdBlY8IEAIdxINsQBcU4xJJXRs= github.com/cilium/ebpf v0.7.0/go.mod h1:/oI2+1shJiTGAMgl6/RgJr36Eo1jzrRcAWbcXO2usCA= github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGXZJjfX53e64911xZQV5JYwmTeXPW+k8Sc= @@ -697,28 +694,21 @@ github.com/cncf/xds/go v0.0.0-20230607035331-e9ce68804cb4/go.mod h1:eXthEFrGJvWH github.com/cockroachdb/datadriven v0.0.0-20200714090401-bf6692d28da5/go.mod h1:h6jFvWxBdQXxjopDMZyH2UVceIRfR84bdzbkoKrsWNo= github.com/cockroachdb/errors v1.2.4/go.mod h1:rQD95gz6FARkaKkQXUksEje/d9a6wBJoCr5oaCLELYA= github.com/cockroachdb/logtags v0.0.0-20190617123548-eb05cc24525f/go.mod h1:i/u985jwjWRlyHXQbwatDASoW0RMlZ/3i9yJHE2xLkI= -github.com/containerd/cgroups v1.0.1 h1:iJnMvco9XGvKUvNQkv88bE4uJXxRQH18efbKo9w5vHQ= -github.com/containerd/cgroups v1.0.1/go.mod h1:0SJrPIenamHDcZhEcJMNBB85rHcUsw4f25ZfBiPYRkU= -github.com/containerd/console v1.0.1/go.mod h1:XUsP6YE/mKtz6bxc+I8UiKKTP04qjQL4qcS3XoQ5xkw= -github.com/containerd/console v1.0.2/go.mod h1:ytZPjGgY2oeTkAONYafi2kSj0aYggsf8acV1PGKCbzQ= +github.com/containerd/cgroups v1.1.0 h1:v8rEWFl6EoqHB+swVNjVoCJE8o3jX7e8nqBGPLaDFBM= +github.com/containerd/cgroups v1.1.0/go.mod h1:6ppBcbh/NOOUU+dMKrykgaBnK9lCIBxHqJDGwsa1mIw= github.com/containerd/console v1.0.3/go.mod h1:7LqA/THxQ86k76b8c/EMSiaJ3h1eZkMkXar0TQ1gf3U= -github.com/containerd/containerd v1.4.9/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= -github.com/containerd/continuity v0.1.0/go.mod h1:ICJu0PwR54nI0yPEnJ6jcS+J7CZAUXrLh8lPo2knzsM= -github.com/containerd/fifo v1.0.0/go.mod h1:ocF/ME1SX5b1AOlWi9r677YJmCPSwwWnQ9O123vzpE4= -github.com/containerd/go-runc v1.0.0/go.mod h1:cNU0ZbCgCQVZK4lgG3P+9tn9/PaJNmoDXPpoJhDR+Ok= +github.com/containerd/containerd v1.6.23 h1:KYJd6UJhKHzwMhiD70iTtSmU+k4565ac22GOTI3AuTA= +github.com/containerd/containerd v1.6.23/go.mod h1:UrQOiyzrLi3n4aezYJbQH6Il+YzTvnHFbEuO3yfDrM4= github.com/containerd/ttrpc v1.1.0/go.mod h1:XX4ZTnoOId4HklF4edwc4DcqskFZuvXB1Evzy5KFQpQ= github.com/containerd/typeurl v1.0.2/go.mod h1:9trJWW2sRlGub4wZJRTW83VtbOLS6hwcDZXTn6oPz9s= github.com/containernetworking/cni v1.1.2 h1:wtRGZVv7olUHMOqouPpn3cXJWpJgM6+EUl31EQbXALQ= github.com/containernetworking/cni v1.1.2/go.mod h1:sDpYKmGVENF3s6uvMvGgldDWeG8dMxakj/u+i9ht9vw= github.com/coreos/bbolt v1.3.2/go.mod h1:iRUV2dpdMOn7Bo10OQBFzIJO9kkE559Wcmn+qkEiiKk= -github.com/coreos/etcd v3.3.10+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= github.com/coreos/etcd v3.3.13+incompatible/go.mod h1:uF7uidLiAD3TWHmW31ZFd/JWoc32PjwdhPthX9715RE= github.com/coreos/go-oidc v2.1.0+incompatible/go.mod h1:CgnwVTmzoESiwO9qyAFEMiHoZ1nMCKZlZ9V6mm3/LKc= -github.com/coreos/go-semver v0.2.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= github.com/coreos/go-semver v0.3.0 h1:wkHLiw0WNATZnSG7epLsujiMCgPAc9xhjJ4tgnAxmfM= github.com/coreos/go-semver v0.3.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk= github.com/coreos/go-systemd v0.0.0-20190321100706-95778dfbb74e/go.mod h1:F5haX7vjVVG0kc13fIWeqUViNPyEJxv/OmvnBo0Yme4= -github.com/coreos/go-systemd/v22 v22.1.0/go.mod h1:xO0FLkIi5MaZafQlIrOotqXZ90ih+1atmu1JpKERPPk= github.com/coreos/go-systemd/v22 v22.3.2/go.mod h1:Y58oyj3AT4RCenI/lSvhwexgC+NSVTIJ3seZv2GcEnc= github.com/coreos/go-systemd/v22 v22.4.0/go.mod h1:Y58oyj3AT4RCenI/lSvhwexgC+NSVTIJ3seZv2GcEnc= github.com/coreos/go-systemd/v22 v22.5.0 h1:RrqgGjYQKalulkV8NGVIfkXQf6YYmOyiJKk8iXXhfZs= @@ -759,8 +749,9 @@ github.com/dustin/go-humanize v1.0.0/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25Kn github.com/emicklei/go-restful v2.16.0+incompatible h1:rgqiKNjTnFQA6kkhFe16D8epTksy9HQ1MyrbDXSdYhM= github.com/emicklei/go-restful v2.16.0+incompatible/go.mod h1:otzb+WCGbkyDHkqmQmT5YD2WR4BBwUdeQoFo8l/7tVs= github.com/emicklei/go-restful/v3 v3.8.0/go.mod h1:6n3XBCmQQb25CM2LCACGz8ukIrRry+4bhvbpWn3mrbc= -github.com/emicklei/go-restful/v3 v3.9.0 h1:XwGDlfxEnQZzuopoqxwSEllNcCOM9DhhFyhFIIGKwxE= github.com/emicklei/go-restful/v3 v3.9.0/go.mod h1:6n3XBCmQQb25CM2LCACGz8ukIrRry+4bhvbpWn3mrbc= +github.com/emicklei/go-restful/v3 v3.10.1 h1:rc42Y5YTp7Am7CS630D7JmhRjq4UlEUuEKfrDac4bSQ= +github.com/emicklei/go-restful/v3 v3.10.1/go.mod h1:6n3XBCmQQb25CM2LCACGz8ukIrRry+4bhvbpWn3mrbc= github.com/envoyproxy/go-control-plane v0.9.0/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4= github.com/envoyproxy/go-control-plane v0.9.1-0.20191026205805-5f8ba28d4473/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4= github.com/envoyproxy/go-control-plane v0.9.4/go.mod h1:6rpuAdCZL397s3pYoYcLgu1mIlRU8Am5FuJP05cCM98= @@ -836,7 +827,6 @@ github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/me github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0 h1:p104kn46Q8WdvHunIJ9dAyjPVtrBPhSr3KT2yUst43I= github.com/go-task/slim-sprig v0.0.0-20210107165309-348f09dbbbc0/go.mod h1:fyg7847qk6SyHyPtNmDHnmrv/HOrqktSC+C9fM+CJOE= github.com/goccy/go-json v0.9.11/go.mod h1:6MelG93GURQebXPDq3khkgXZkazVtN9CRI+MGFi0w8I= -github.com/godbus/dbus/v5 v5.0.3/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= github.com/godbus/dbus/v5 v5.0.4/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= github.com/godbus/dbus/v5 v5.0.6/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= github.com/godbus/dbus/v5 v5.1.0 h1:4KLkAxT3aOY8Li4FRJe/KvhoNFFxo0m6fNuFUO8QJUk= @@ -925,8 +915,9 @@ github.com/google/go-cmp v0.5.9/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeN github.com/google/go-cmp v0.6.0 h1:ofyhxvXcZhMsU5ulbFiLKl/XBFqE1GSq7atu8tAmTRI= github.com/google/go-cmp v0.6.0/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= github.com/google/gofuzz v1.0.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= -github.com/google/gofuzz v1.1.0 h1:Hsa8mG0dQ46ij8Sl2AYJDUv1oA9/d6Vk+3LG99Oe02g= github.com/google/gofuzz v1.1.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= +github.com/google/gofuzz v1.2.0 h1:xRy4A+RhZaiKjJ1bPfwQ8sedCA+YS2YcCHW6ec7JMi0= +github.com/google/gofuzz v1.2.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= github.com/google/martian v2.1.0+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXiIaQGbYVAs8BPL6v8lEs= github.com/google/martian/v3 v3.0.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0= github.com/google/martian/v3 v3.1.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0= @@ -973,7 +964,6 @@ github.com/googleapis/gax-go/v2 v2.7.1/go.mod h1:4orTrqY6hXxxaUL4LHIPl6lGo8vAE38 github.com/googleapis/go-type-adapters v1.0.0/go.mod h1:zHW75FOG2aur7gAO2B+MLby+cLsWGBF62rFAi7WjWO4= github.com/googleapis/google-cloud-go-testing v0.0.0-20200911160855-bcd43fbb19e8/go.mod h1:dvDLG8qkwmyD9a/MJJN3XJcT3xFxOKAvTZGvuZmac9g= github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= -github.com/gorilla/websocket v1.4.0/go.mod h1:E7qHFY5m1UJ88s3WnNqhKjPHQ0heANvMoAMk2YaljkQ= github.com/gorilla/websocket v1.4.2/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE= github.com/gorilla/websocket v1.5.0 h1:PPwGk2jz7EePpoHN/+ClbZu8SPxiqlu12wZP/3sWmnc= github.com/gorilla/websocket v1.5.0/go.mod h1:YR8l580nyteQvAITg2hZ9XVh4b55+EU/adAjf1fMHhE= @@ -1015,8 +1005,8 @@ github.com/iancoleman/strcase v0.2.0/go.mod h1:iwCmte+B7n89clKwxIoIXy/HfoL7AsD47 github.com/ianlancetaylor/demangle v0.0.0-20181102032728-5e5cf60278f6/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc= github.com/ianlancetaylor/demangle v0.0.0-20200824232613-28f6c0f3b639/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc= github.com/imdario/mergo v0.3.6/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA= -github.com/imdario/mergo v0.3.7 h1:Y+UAYTZ7gDEuOfhxKWy+dvb5dRQ6rJjFSdX2HZY1/gI= -github.com/imdario/mergo v0.3.7/go.mod h1:2EnlNZ0deacrJVfApfmtdGgDfMuh/nq6Ok1EcJh5FfA= +github.com/imdario/mergo v0.3.12 h1:b6R2BslTbIEToALKP7LxUvijTsNI9TAe80pLWN2g/HU= +github.com/imdario/mergo v0.3.12/go.mod h1:jmQim1M+e3UYxmgPu/WyfjB3N3VflVyUjjjwH0dnCYA= github.com/inconshreveable/mousetrap v1.0.0/go.mod h1:PxqpIevigyE2G7u3NXJIT2ANytuPF1OarO4DADm73n8= github.com/inconshreveable/mousetrap v1.0.1/go.mod h1:vpF70FUmC8bwa3OWnCshd2FqLfsEA9PFc4w1p2J65bw= github.com/inconshreveable/mousetrap v1.1.0 h1:wN+x4NVGpMsO7ErUn/mUI3vEoE6Jt13X2s0bqwp9tc8= @@ -1070,7 +1060,6 @@ github.com/lithammer/dedent v1.1.0/go.mod h1:jrXYCQtgg0nJiN+StA2KgR7w6CiQNv9Fd/Z github.com/lyft/protoc-gen-star v0.6.0/go.mod h1:TGAoBVkt8w7MPG72TrKIu85MIdXwDuzJYeZuUPFPNwA= github.com/lyft/protoc-gen-star v0.6.1/go.mod h1:TGAoBVkt8w7MPG72TrKIu85MIdXwDuzJYeZuUPFPNwA= github.com/lyft/protoc-gen-star/v2 v2.0.1/go.mod h1:RcCdONR2ScXaYnQC5tUzxzlpA3WVYF7/opLeUgcQs/o= -github.com/magiconair/properties v1.8.0/go.mod h1:PppfXfuXeibc/6YijjN8zIbojt8czPbwD3XqdrwzmxQ= github.com/magiconair/properties v1.8.1/go.mod h1:PppfXfuXeibc/6YijjN8zIbojt8czPbwD3XqdrwzmxQ= github.com/mailru/easyjson v0.7.7 h1:UGYAvKxe3sBsEDzO8ZeWOSlIQfWFlxbzLZe7hwFURr0= github.com/mailru/easyjson v0.7.7/go.mod h1:xzfreul335JAWq5oZzymOObrkdz5UnU4kGfJJLY9Nlc= @@ -1161,13 +1150,12 @@ github.com/opencontainers/image-spec v1.1.0-rc5/go.mod h1:X4pATf0uXsnn3g5aiGIsVn github.com/opencontainers/runc v1.1.4/go.mod h1:1J5XiS+vdZ3wCyZybsuxXZWGrgSr8fFJHLXuG2PsnNg= github.com/opencontainers/runc v1.1.10 h1:EaL5WeO9lv9wmS6SASjszOeQdSctvpbu0DdBQBizE40= github.com/opencontainers/runc v1.1.10/go.mod h1:+/R6+KmDlh+hOO8NkjmgkG9Qzvypzk0yXxAPYYR65+M= -github.com/opencontainers/runtime-spec v1.0.2/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= -github.com/opencontainers/runtime-spec v1.0.3-0.20200929063507-e6143ca7d51d/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v1.0.3-0.20210326190908-1c3f411f0417/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/opencontainers/runtime-spec v1.0.3-0.20220909204839-494a5a6aca78 h1:R5M2qXZiK/mWPMT4VldCOiSL9HIAMuxQZWdG0CSM5+4= github.com/opencontainers/runtime-spec v1.0.3-0.20220909204839-494a5a6aca78/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= -github.com/opencontainers/selinux v1.10.0 h1:rAiKF8hTcgLI3w0DHm6i0ylVVcOrlgR1kK99DRLDhyU= github.com/opencontainers/selinux v1.10.0/go.mod h1:2i0OySw99QjzBBQByd1Gr9gSjvuho1lHsJxIJ3gGbJI= +github.com/opencontainers/selinux v1.10.1 h1:09LIPVRP3uuZGQvgR+SgMSNBd1Eb3vlRbGqQpoHsF8w= +github.com/opencontainers/selinux v1.10.1/go.mod h1:2i0OySw99QjzBBQByd1Gr9gSjvuho1lHsJxIJ3gGbJI= github.com/opentracing/opentracing-go v1.1.0/go.mod h1:UkNAQd3GIcIGf0SeVgPpRdFStlNbqXla1AfSYxPUl2o= github.com/pascaldekloe/goe v0.0.0-20180627143212-57f6aae5913c/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc= github.com/pelletier/go-toml v1.2.0/go.mod h1:5z9KED0ma1S8pY6P1sdut58dfprrGBbd/94hg7ilaic= @@ -1258,7 +1246,6 @@ github.com/spf13/afero v1.3.3/go.mod h1:5KUK8ByomD5Ti5Artl0RtHeI5pTF7MIDuXL3yY52 github.com/spf13/afero v1.6.0/go.mod h1:Ai8FlHk4v/PARR026UzYexafAt9roJ7LcLMAmO6Z93I= github.com/spf13/afero v1.9.2/go.mod h1:iUV7ddyEEZPO5gA3zD4fJt6iStLlL+Lg4m2cihcDf8Y= github.com/spf13/cast v1.3.0/go.mod h1:Qx5cxh0v+4UWYiBimWS+eyWzqEqokIECu5etghLkUJE= -github.com/spf13/cobra v1.0.0/go.mod h1:/6GTrnGXV9HjY+aR4k0oJ5tcvakLuG6EuKReYlHNrgE= github.com/spf13/cobra v1.1.3/go.mod h1:pGADOWyqRD/YMrPZigI/zbliZ2wVD/23d+is3pSWzOo= github.com/spf13/cobra v1.6.0/go.mod h1:IOw/AERYS7UzyrGinqmz6HLUo219MORXGxhbaJUqzrY= github.com/spf13/cobra v1.8.0 h1:7aJaZx1B85qltLMc546zn58BxxfZdR/W22ej9CFoEf0= @@ -1267,7 +1254,6 @@ github.com/spf13/jwalterweatherman v1.0.0/go.mod h1:cQK4TGJAtQXfYWX+Ddv3mKDzgVb6 github.com/spf13/pflag v1.0.3/go.mod h1:DYY7MBk1bdzusC3SYhjObp+wFpr4gzcvqqNjLnInEg4= github.com/spf13/pflag v1.0.5 h1:iy+VFUOCP1a+8yFto/drg2CJ5u0yRoB7fZw3DKv/JXA= github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg= -github.com/spf13/viper v1.4.0/go.mod h1:PTJ7Z/lr49W6bUbkmS1V3by4uWynFiR9p7+dSq/yZzE= github.com/spf13/viper v1.7.0/go.mod h1:8WkrPz2fc9jxqZNCJI/76HCieCp4Q8HaLFoCha5qpdg= github.com/stoewer/go-strcase v1.2.0 h1:Z2iHWqGXH00XYgqDmNgQbIBxf3wrNq0F3feEy0ainaU= github.com/stoewer/go-strcase v1.2.0/go.mod h1:IBiWB2sKIp3wVVQ3Y035++gc+knqhUQag1KpM8ahLw8= @@ -1294,12 +1280,12 @@ github.com/tmc/grpc-websocket-proxy v0.0.0-20190109142713-0ad062ec5ee5/go.mod h1 github.com/tmc/grpc-websocket-proxy v0.0.0-20201229170055-e5319fda7802/go.mod h1:ncp9v5uamzpCO7NfCPTXjqaC+bZgJeR0sMTm6dMHP7U= github.com/tmc/grpc-websocket-proxy v0.0.0-20220101234140-673ab2c3ae75 h1:6fotK7otjonDflCTK0BCfls4SPy3NcCVb5dqqmbRknE= github.com/tmc/grpc-websocket-proxy v0.0.0-20220101234140-673ab2c3ae75/go.mod h1:KO6IkyS8Y3j8OdNO85qEYBsRPuteD+YciPomcXdrMnk= -github.com/ugorji/go v1.1.4/go.mod h1:uQMGLiO92mf5W77hV/PUCpI3pbzQx3CRekS0kk+RGrc= github.com/urfave/cli v1.22.1/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= -github.com/urfave/cli v1.22.2/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= -github.com/vishvananda/netlink v1.1.0 h1:1iyaYNBLmP6L0220aDnYQpo1QEV4t4hJ+xEEhhJH8j0= github.com/vishvananda/netlink v1.1.0/go.mod h1:cTgwzPIzzgDAYoQrMm0EdrjRUBkTqKYppBueQtXaqoE= +github.com/vishvananda/netlink v1.2.1-beta.2 h1:Llsql0lnQEbHj0I1OuKyp8otXp0r3q0mPkuhwHfStVs= +github.com/vishvananda/netlink v1.2.1-beta.2/go.mod h1:twkDnbuQxJYemMlGd4JFIcuhgX83tXhKS2B/PRMpOho= github.com/vishvananda/netns v0.0.0-20191106174202-0a2b9b5464df/go.mod h1:JP3t17pCcGlemwknint6hfoeCVQrEMVwxRLRjXpq+BU= +github.com/vishvananda/netns v0.0.0-20200728191858-db3c7e526aae/go.mod h1:DD4vA1DwXk04H54A1oHXtwZmA0grkVMdPxx/VGLCah0= github.com/vishvananda/netns v0.0.2 h1:Cn05BRLm+iRP/DZxyVSsfVyrzgjDbwHwkVt38qvXnNI= github.com/vishvananda/netns v0.0.2/go.mod h1:yitZXdAVI+yPFSb4QUe+VW3vOVl4PZPNcBgbPxAtJxw= github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f/go.mod h1:N2zxlSyiKSe5eX1tZViRH5QA0qijqEDrYZiPEAiq3wU= @@ -1308,7 +1294,6 @@ github.com/xeipuuv/gojsonschema v1.2.0/go.mod h1:anYRn/JVcOK2ZgGU+IjEV4nwlhoK5sQ github.com/xiang90/probing v0.0.0-20190116061207-43a291ad63a2/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU= github.com/xiang90/probing v0.0.0-20221125231312-a49e3df8f510 h1:S2dVYn90KE98chqDkyE9Z4N61UnQd+KOfgp5Iu53llk= github.com/xiang90/probing v0.0.0-20221125231312-a49e3df8f510/go.mod h1:UETIi67q53MR2AWcXfiuqkDkRtnGDLqkBTpCHuJHxtU= -github.com/xordataexchange/crypt v0.0.3-0.20170626215501-b2862e3d0a77/go.mod h1:aYKd//L2LvnjZzWKhF00oedf4jCCReLcmhLdhm1A27Q= github.com/yuin/goldmark v1.1.25/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= github.com/yuin/goldmark v1.1.32/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= @@ -1319,8 +1304,9 @@ github.com/yuin/goldmark v1.4.13/go.mod h1:6yULJ656Px+3vBD8DxQVa3kxgyrAnzto9xy5t github.com/zeebo/assert v1.3.0/go.mod h1:Pq9JiuJQpG8JLJdtkwrJESF0Foym2/D9XMU5ciN/wJ0= github.com/zeebo/xxh3 v1.0.2/go.mod h1:5NWz9Sef7zIDm2JHfFlcQvNekmcEl9ekUZQQKCYaDcA= go.etcd.io/bbolt v1.3.2/go.mod h1:IbVyRI1SCnLcuJnV2u8VeU0CEYM7e686BmAb1XKL+uU= -go.etcd.io/bbolt v1.3.6 h1:/ecaJf0sk1l4l6V4awd65v2C3ILy7MSj+s/x1ADCIMU= go.etcd.io/bbolt v1.3.6/go.mod h1:qXsaaIqmgQH0T+OPdb99Bf+PKfBBQVAdyD6TY9G8XM4= +go.etcd.io/bbolt v1.3.7 h1:j+zJOnnEjF/kyHlDDgGnVL/AIqIJPq8UoB2GSNfkUfQ= +go.etcd.io/bbolt v1.3.7/go.mod h1:N9Mkw9X8x5fupy0IKsmuqVtoGDyxsaDlbk4Rd05IAQw= go.etcd.io/etcd/api/v3 v3.5.7 h1:sbcmosSVesNrWOJ58ZQFitHMdncusIifYcrBfwrlJSY= go.etcd.io/etcd/api/v3 v3.5.7/go.mod h1:9qew1gCdDDLu+VwmeG+iFpL+QlpHTo7iubavdVDgCAA= go.etcd.io/etcd/client/pkg/v3 v3.5.7 h1:y3kf5Gbp4e4q7egZdn5T7W9TSHUvkClN6u+Rq9mEOmg= @@ -1477,6 +1463,7 @@ golang.org/x/mod v0.6.0/go.mod h1:4mET923SAdbXp2ki8ey+zGs1SLqsuM2Y0uvdZR/fUNI= golang.org/x/mod v0.7.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= golang.org/x/mod v0.8.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= golang.org/x/mod v0.9.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= +golang.org/x/mod v0.12.0 h1:rmsUpXtvNzj340zd98LZ4KntptpfRHwpFOHG188oHXc= golang.org/x/mod v0.12.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= @@ -1491,7 +1478,6 @@ golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190503192946-f4e77d36d62c/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= -golang.org/x/net v0.0.0-20190522155817-f3200d17e092/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks= golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks= golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= @@ -1585,8 +1571,8 @@ golang.org/x/oauth2 v0.4.0/go.mod h1:RznEsdpjGAINPTOF0UH/t+xJ75L18YO3Ho6Pyn+uRec golang.org/x/oauth2 v0.5.0/go.mod h1:9/XBHVqLaWO3/BRHs5jbpYCnOZVjj5V0ndyaAM7KB4I= golang.org/x/oauth2 v0.6.0/go.mod h1:ycmewcwgD4Rpr3eZJLSB4Kyyljb3qDh40vJ8STE5HKw= golang.org/x/oauth2 v0.7.0/go.mod h1:hPLQkd9LyjfXTiRohC/41GhcFqxisoUQ99sCUOHO9x4= -golang.org/x/oauth2 v0.11.0 h1:vPL4xzxBM4niKCW6g9whtaWVXTJf1U5e4aZxxFx/gbU= -golang.org/x/oauth2 v0.11.0/go.mod h1:LdF7O/8bLR/qWK9DrpXmbHLTouvRHK0SgJl0GmDBchk= +golang.org/x/oauth2 v0.13.0 h1:jDDenyj+WgFtmV3zYVoi8aE2BwtXFLWOA67ZfNWftiY= +golang.org/x/oauth2 v0.13.0/go.mod h1:/JMhi4ZRXAf4HG9LiNmxvk+45+96RUlVThiH8FzNBn0= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= @@ -1638,6 +1624,7 @@ golang.org/x/sys v0.0.0-20200116001909-b77594299b42/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20200122134326-e047566fdf82/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200202164722-d101bd2416d5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200212091648-12a6c2dcc1e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200217220822-9197077df867/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200302150141-5c8b2ff67527/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -1648,9 +1635,9 @@ golang.org/x/sys v0.0.0-20200515095857-1151b9dac4a9/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20200523222454-059865788121/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200615200032-f1bc736245b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200625212154-ddb9806d33ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20200728102440-3e129f6d46b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200803210538-64077c9b5642/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200905004654-be1d3432aa8f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20200916030750-2334cc1a136f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200923182605-d9f96fdee20d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -1665,7 +1652,6 @@ golang.org/x/sys v0.0.0-20210304124612-50617c2ba197/go.mod h1:h1NjWce9XRLGQEsW7w golang.org/x/sys v0.0.0-20210305230114-8fe3ee5dd75b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210315160823-c6e025ad8005/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210320140829-1e4c9ba3b0c4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= -golang.org/x/sys v0.0.0-20210324051608-47abb6519492/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210330210617-4fbd30eecc44/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210403161142-5e06dd20ab57/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20210423082822-04245dca01da/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= @@ -1719,8 +1705,8 @@ golang.org/x/sys v0.7.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.8.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.11.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.13.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.14.0 h1:Vz7Qs629MkJkGyHxUlRHizWJRG2j8fbQKjELVSNhy7Q= -golang.org/x/sys v0.14.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= +golang.org/x/sys v0.15.0 h1:h48lPFYpsTvQJZF4EKyI4aLHaev3CxivZmv7yZig9pc= +golang.org/x/sys v0.15.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= golang.org/x/term v0.1.0/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= @@ -1916,8 +1902,9 @@ google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7 google.golang.org/appengine v1.6.1/go.mod h1:i06prIuMbXzDqacNJfV5OdTW448YApPu5ww/cMBSeb0= google.golang.org/appengine v1.6.5/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc= google.golang.org/appengine v1.6.6/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc= -google.golang.org/appengine v1.6.7 h1:FZR1q0exgwxzPzp/aF+VccGrSfxfPpkBqjIIEq3ru6c= google.golang.org/appengine v1.6.7/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc= +google.golang.org/appengine v1.6.8 h1:IhEN5q69dyKagZPYMSdIjS2HqprW324FRQZJcGqPAsM= +google.golang.org/appengine v1.6.8/go.mod h1:1jJ3jBArFh5pcgW8gCtRJnepW8FzD1V44FJffLiz/Ds= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= google.golang.org/genproto v0.0.0-20190418145605-e7d98fc518a7/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= @@ -2054,19 +2041,18 @@ google.golang.org/genproto v0.0.0-20230331144136-dcfb400f0633/go.mod h1:UUQDJDOl google.golang.org/genproto v0.0.0-20230410155749-daa745c078e1/go.mod h1:nKE/iIaLqn2bQwXBg8f1g2Ylh6r5MN5CmZvuzZCgsCU= google.golang.org/genproto v0.0.0-20230525234025-438c736192d0/go.mod h1:9ExIQyXL5hZrHzQceCwuSYwZZ5QZBazOcprJ5rgs3lY= google.golang.org/genproto v0.0.0-20230526161137-0005af68ea54/go.mod h1:zqTuNwFlFRsw5zIts5VnzLQxSRqh+CGOTVMlYbY0Eyk= -google.golang.org/genproto v0.0.0-20230822172742-b8732ec3820d h1:VBu5YqKPv6XiJ199exd8Br+Aetz+o08F+PLMnwJQHAY= -google.golang.org/genproto v0.0.0-20230822172742-b8732ec3820d/go.mod h1:yZTlhN0tQnXo3h00fuXNCxJdLdIdnVFVBaRJ5LWBbw4= +google.golang.org/genproto v0.0.0-20231002182017-d307bd883b97 h1:SeZZZx0cP0fqUyA+oRzP9k7cSwJlvDFiROO72uwD6i0= +google.golang.org/genproto v0.0.0-20231002182017-d307bd883b97/go.mod h1:t1VqOqqvce95G3hIDCT5FeO3YUc6Q4Oe24L/+rNMxRk= google.golang.org/genproto/googleapis/api v0.0.0-20230525234020-1aefcd67740a/go.mod h1:ts19tUU+Z0ZShN1y3aPyq2+O3d5FUNNgT6FtOzmrNn8= google.golang.org/genproto/googleapis/api v0.0.0-20230525234035-dd9d682886f9/go.mod h1:vHYtlOoi6TsQ3Uk2yxR7NI5z8uoV+3pZtR4jmHIkRig= -google.golang.org/genproto/googleapis/api v0.0.0-20230822172742-b8732ec3820d h1:DoPTO70H+bcDXcd39vOqb2viZxgqeBeSGtZ55yZU4/Q= -google.golang.org/genproto/googleapis/api v0.0.0-20230822172742-b8732ec3820d/go.mod h1:KjSP20unUpOx5kyQUFa7k4OJg0qeJ7DEZflGDu2p6Bk= +google.golang.org/genproto/googleapis/api v0.0.0-20231002182017-d307bd883b97 h1:W18sezcAYs+3tDZX4F80yctqa12jcP1PUS2gQu1zTPU= +google.golang.org/genproto/googleapis/api v0.0.0-20231002182017-d307bd883b97/go.mod h1:iargEX0SFPm3xcfMI0d1domjg0ZF4Aa0p2awqyxhvF0= google.golang.org/genproto/googleapis/rpc v0.0.0-20230525234015-3fc162c6f38a/go.mod h1:xURIpW9ES5+/GZhnV6beoEtxQrnkRGIfP5VQG2tCBLc= google.golang.org/genproto/googleapis/rpc v0.0.0-20230525234030-28d5490b6b19/go.mod h1:66JfowdXAEgad5O9NnYcsNPLCPZJD++2L9X0PCMODrA= -google.golang.org/genproto/googleapis/rpc v0.0.0-20230822172742-b8732ec3820d h1:uvYuEyMHKNt+lT4K3bN6fGswmK8qSvcreM3BwjDh+y4= -google.golang.org/genproto/googleapis/rpc v0.0.0-20230822172742-b8732ec3820d/go.mod h1:+Bk1OCOj40wS2hwAMA+aCW9ypzm63QTBBHp6lQ3p+9M= +google.golang.org/genproto/googleapis/rpc v0.0.0-20231002182017-d307bd883b97 h1:6GQBEOdGkX6MMTLT9V+TjtIRZCw9VPD5Z+yHY9wMgS0= +google.golang.org/genproto/googleapis/rpc v0.0.0-20231002182017-d307bd883b97/go.mod h1:v7nGkzlmW8P3n/bKmWBn2WpBjpOEx8Q6gMueudAmKfY= google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= -google.golang.org/grpc v1.21.0/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM= google.golang.org/grpc v1.21.1/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM= google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= google.golang.org/grpc v1.25.1/go.mod h1:c3i+UQWmh7LiEpx4sFZnkU36qjEYZ0imhYfXVyQciAY= @@ -2107,8 +2093,8 @@ google.golang.org/grpc v1.52.3/go.mod h1:pu6fVzoFb+NBYNAvQL08ic+lvB2IojljRYuun5v google.golang.org/grpc v1.53.0/go.mod h1:OnIrk0ipVdj4N5d9IUoFUx72/VlD7+jUsHwZgwSMQpw= google.golang.org/grpc v1.54.0/go.mod h1:PUSEXI6iWghWaB6lXM4knEgpJNu2qUcKfDtNci3EC2g= google.golang.org/grpc v1.56.3/go.mod h1:I9bI3vqKfayGqPUAwGdOSu7kt6oIJLixfffKrpXqQ9s= -google.golang.org/grpc v1.59.0 h1:Z5Iec2pjwb+LEOqzpB2MR12/eKFhDPhuqW91O+4bwUk= -google.golang.org/grpc v1.59.0/go.mod h1:aUPDwccQo6OTjy7Hct4AfBPD1GptF4fyUjIkQ9YtF98= +google.golang.org/grpc v1.60.0 h1:6FQAR0kM31P6MRdeluor2w2gPaS4SVNrD/DNTxrQ15k= +google.golang.org/grpc v1.60.0/go.mod h1:OlCHIeLYqSSsLi6i49B5QGdzaMZK9+M7LXN2FKz4eGM= google.golang.org/grpc/cmd/protoc-gen-go-grpc v1.1.0/go.mod h1:6Kw0yEErY5E/yWrBtf03jp27GLLJujG4z/JK95pnjjw= google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8= google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0= @@ -2162,8 +2148,8 @@ gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b/go.mod h1:K4uyk7z7BCEPqu6E+C gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA= gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= gotest.tools/v3 v3.0.2/go.mod h1:3SzNCllyD9/Y+b5r9JIKQ474KzkZyqLqEfYqMsX94Bk= -gotest.tools/v3 v3.0.3 h1:4AuOwCGf4lLR9u3YOe2awrHygurzhO/HeQ6laiA6Sx0= -gotest.tools/v3 v3.0.3/go.mod h1:Z7Lb0S5l+klDB31fvDQX8ss/FlKDxtlFlw3Oa8Ymbl8= +gotest.tools/v3 v3.5.0 h1:Ljk6PdHdOhAb5aDMWXjDLMMhph+BpztA4v1QdqEW2eY= +gotest.tools/v3 v3.5.0/go.mod h1:isy3WKz7GK6uNw/sbHzfKBLvlvXwUyV06n6brMxxopU= honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= honnef.co/go/tools v0.0.0-20190106161140-3f1c8253044a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= honnef.co/go/tools v0.0.0-20190418001031-e561f6794a2a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= diff --git a/vendor/github.com/Microsoft/go-winio/.gitattributes b/vendor/github.com/Microsoft/go-winio/.gitattributes new file mode 100644 index 000000000..94f480de9 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/.gitattributes @@ -0,0 +1 @@ +* text=auto eol=lf \ No newline at end of file diff --git a/vendor/github.com/Microsoft/go-winio/.gitignore b/vendor/github.com/Microsoft/go-winio/.gitignore index b883f1fdc..815e20660 100644 --- a/vendor/github.com/Microsoft/go-winio/.gitignore +++ b/vendor/github.com/Microsoft/go-winio/.gitignore @@ -1 +1,10 @@ +.vscode/ + *.exe + +# testing +testdata + +# go workspaces +go.work +go.work.sum diff --git a/vendor/github.com/Microsoft/go-winio/.golangci.yml b/vendor/github.com/Microsoft/go-winio/.golangci.yml new file mode 100644 index 000000000..7b503d26a --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/.golangci.yml @@ -0,0 +1,149 @@ +run: + skip-dirs: + - pkg/etw/sample + +linters: + enable: + # style + - containedctx # struct contains a context + - dupl # duplicate code + - errname # erorrs are named correctly + - nolintlint # "//nolint" directives are properly explained + - revive # golint replacement + - unconvert # unnecessary conversions + - wastedassign + + # bugs, performance, unused, etc ... + - contextcheck # function uses a non-inherited context + - errorlint # errors not wrapped for 1.13 + - exhaustive # check exhaustiveness of enum switch statements + - gofmt # files are gofmt'ed + - gosec # security + - nilerr # returns nil even with non-nil error + - unparam # unused function params + +issues: + exclude-rules: + # err is very often shadowed in nested scopes + - linters: + - govet + text: '^shadow: declaration of "err" shadows declaration' + + # ignore long lines for skip autogen directives + - linters: + - revive + text: "^line-length-limit: " + source: "^//(go:generate|sys) " + + #TODO: remove after upgrading to go1.18 + # ignore comment spacing for nolint and sys directives + - linters: + - revive + text: "^comment-spacings: no space between comment delimiter and comment text" + source: "//(cspell:|nolint:|sys |todo)" + + # not on go 1.18 yet, so no any + - linters: + - revive + text: "^use-any: since GO 1.18 'interface{}' can be replaced by 'any'" + + # allow unjustified ignores of error checks in defer statements + - linters: + - nolintlint + text: "^directive `//nolint:errcheck` should provide explanation" + source: '^\s*defer ' + + # allow unjustified ignores of error lints for io.EOF + - linters: + - nolintlint + text: "^directive `//nolint:errorlint` should provide explanation" + source: '[=|!]= io.EOF' + + +linters-settings: + exhaustive: + default-signifies-exhaustive: true + govet: + enable-all: true + disable: + # struct order is often for Win32 compat + # also, ignore pointer bytes/GC issues for now until performance becomes an issue + - fieldalignment + check-shadowing: true + nolintlint: + allow-leading-space: false + require-explanation: true + require-specific: true + revive: + # revive is more configurable than static check, so likely the preferred alternative to static-check + # (once the perf issue is solved: https://github.com/golangci/golangci-lint/issues/2997) + enable-all-rules: + true + # https://github.com/mgechev/revive/blob/master/RULES_DESCRIPTIONS.md + rules: + # rules with required arguments + - name: argument-limit + disabled: true + - name: banned-characters + disabled: true + - name: cognitive-complexity + disabled: true + - name: cyclomatic + disabled: true + - name: file-header + disabled: true + - name: function-length + disabled: true + - name: function-result-limit + disabled: true + - name: max-public-structs + disabled: true + # geneally annoying rules + - name: add-constant # complains about any and all strings and integers + disabled: true + - name: confusing-naming # we frequently use "Foo()" and "foo()" together + disabled: true + - name: flag-parameter # excessive, and a common idiom we use + disabled: true + - name: unhandled-error # warns over common fmt.Print* and io.Close; rely on errcheck instead + disabled: true + # general config + - name: line-length-limit + arguments: + - 140 + - name: var-naming + arguments: + - [] + - - CID + - CRI + - CTRD + - DACL + - DLL + - DOS + - ETW + - FSCTL + - GCS + - GMSA + - HCS + - HV + - IO + - LCOW + - LDAP + - LPAC + - LTSC + - MMIO + - NT + - OCI + - PMEM + - PWSH + - RX + - SACl + - SID + - SMB + - TX + - VHD + - VHDX + - VMID + - VPCI + - WCOW + - WIM diff --git a/vendor/github.com/Microsoft/go-winio/README.md b/vendor/github.com/Microsoft/go-winio/README.md index 568001057..7474b4f0b 100644 --- a/vendor/github.com/Microsoft/go-winio/README.md +++ b/vendor/github.com/Microsoft/go-winio/README.md @@ -1,4 +1,4 @@ -# go-winio +# go-winio [![Build Status](https://github.com/microsoft/go-winio/actions/workflows/ci.yml/badge.svg)](https://github.com/microsoft/go-winio/actions/workflows/ci.yml) This repository contains utilities for efficiently performing Win32 IO operations in Go. Currently, this is focused on accessing named pipes and other file handles, and @@ -11,12 +11,79 @@ package. Please see the LICENSE file for licensing information. -This project has adopted the [Microsoft Open Source Code of -Conduct](https://opensource.microsoft.com/codeofconduct/). For more information -see the [Code of Conduct -FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact -[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional -questions or comments. +## Contributing -Thanks to natefinch for the inspiration for this library. See https://github.com/natefinch/npipe -for another named pipe implementation. +This project welcomes contributions and suggestions. +Most contributions require you to agree to a Contributor License Agreement (CLA) declaring that +you have the right to, and actually do, grant us the rights to use your contribution. +For details, visit [Microsoft CLA](https://cla.microsoft.com). + +When you submit a pull request, a CLA-bot will automatically determine whether you need to +provide a CLA and decorate the PR appropriately (e.g., label, comment). +Simply follow the instructions provided by the bot. +You will only need to do this once across all repos using our CLA. + +Additionally, the pull request pipeline requires the following steps to be performed before +mergining. + +### Code Sign-Off + +We require that contributors sign their commits using [`git commit --signoff`][git-commit-s] +to certify they either authored the work themselves or otherwise have permission to use it in this project. + +A range of commits can be signed off using [`git rebase --signoff`][git-rebase-s]. + +Please see [the developer certificate](https://developercertificate.org) for more info, +as well as to make sure that you can attest to the rules listed. +Our CI uses the DCO Github app to ensure that all commits in a given PR are signed-off. + +### Linting + +Code must pass a linting stage, which uses [`golangci-lint`][lint]. +The linting settings are stored in [`.golangci.yaml`](./.golangci.yaml), and can be run +automatically with VSCode by adding the following to your workspace or folder settings: + +```json + "go.lintTool": "golangci-lint", + "go.lintOnSave": "package", +``` + +Additional editor [integrations options are also available][lint-ide]. + +Alternatively, `golangci-lint` can be [installed locally][lint-install] and run from the repo root: + +```shell +# use . or specify a path to only lint a package +# to show all lint errors, use flags "--max-issues-per-linter=0 --max-same-issues=0" +> golangci-lint run ./... +``` + +### Go Generate + +The pipeline checks that auto-generated code, via `go generate`, are up to date. + +This can be done for the entire repo: + +```shell +> go generate ./... +``` + +## Code of Conduct + +This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/). +For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or +contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments. + +## Special Thanks + +Thanks to [natefinch][natefinch] for the inspiration for this library. +See [npipe](https://github.com/natefinch/npipe) for another named pipe implementation. + +[lint]: https://golangci-lint.run/ +[lint-ide]: https://golangci-lint.run/usage/integrations/#editor-integration +[lint-install]: https://golangci-lint.run/usage/install/#local-installation + +[git-commit-s]: https://git-scm.com/docs/git-commit#Documentation/git-commit.txt--s +[git-rebase-s]: https://git-scm.com/docs/git-rebase#Documentation/git-rebase.txt---signoff + +[natefinch]: https://github.com/natefinch diff --git a/vendor/github.com/Microsoft/go-winio/SECURITY.md b/vendor/github.com/Microsoft/go-winio/SECURITY.md new file mode 100644 index 000000000..869fdfe2b --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/SECURITY.md @@ -0,0 +1,41 @@ + + +## Security + +Microsoft takes the security of our software products and services seriously, which includes all source code repositories managed through our GitHub organizations, which include [Microsoft](https://github.com/Microsoft), [Azure](https://github.com/Azure), [DotNet](https://github.com/dotnet), [AspNet](https://github.com/aspnet), [Xamarin](https://github.com/xamarin), and [our GitHub organizations](https://opensource.microsoft.com/). + +If you believe you have found a security vulnerability in any Microsoft-owned repository that meets [Microsoft's definition of a security vulnerability](https://aka.ms/opensource/security/definition), please report it to us as described below. + +## Reporting Security Issues + +**Please do not report security vulnerabilities through public GitHub issues.** + +Instead, please report them to the Microsoft Security Response Center (MSRC) at [https://msrc.microsoft.com/create-report](https://aka.ms/opensource/security/create-report). + +If you prefer to submit without logging in, send email to [secure@microsoft.com](mailto:secure@microsoft.com). If possible, encrypt your message with our PGP key; please download it from the [Microsoft Security Response Center PGP Key page](https://aka.ms/opensource/security/pgpkey). + +You should receive a response within 24 hours. If for some reason you do not, please follow up via email to ensure we received your original message. Additional information can be found at [microsoft.com/msrc](https://aka.ms/opensource/security/msrc). + +Please include the requested information listed below (as much as you can provide) to help us better understand the nature and scope of the possible issue: + + * Type of issue (e.g. buffer overflow, SQL injection, cross-site scripting, etc.) + * Full paths of source file(s) related to the manifestation of the issue + * The location of the affected source code (tag/branch/commit or direct URL) + * Any special configuration required to reproduce the issue + * Step-by-step instructions to reproduce the issue + * Proof-of-concept or exploit code (if possible) + * Impact of the issue, including how an attacker might exploit the issue + +This information will help us triage your report more quickly. + +If you are reporting for a bug bounty, more complete reports can contribute to a higher bounty award. Please visit our [Microsoft Bug Bounty Program](https://aka.ms/opensource/security/bounty) page for more details about our active programs. + +## Preferred Languages + +We prefer all communications to be in English. + +## Policy + +Microsoft follows the principle of [Coordinated Vulnerability Disclosure](https://aka.ms/opensource/security/cvd). + + diff --git a/vendor/github.com/Microsoft/go-winio/backup.go b/vendor/github.com/Microsoft/go-winio/backup.go index 2be34af43..09621c884 100644 --- a/vendor/github.com/Microsoft/go-winio/backup.go +++ b/vendor/github.com/Microsoft/go-winio/backup.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package winio @@ -7,11 +8,12 @@ import ( "errors" "fmt" "io" - "io/ioutil" "os" "runtime" "syscall" "unicode/utf16" + + "golang.org/x/sys/windows" ) //sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead @@ -24,7 +26,7 @@ const ( BackupAlternateData BackupLink BackupPropertyData - BackupObjectId + BackupObjectId //revive:disable-line:var-naming ID, not Id BackupReparseData BackupSparseBlock BackupTxfsData @@ -34,14 +36,16 @@ const ( StreamSparseAttributes = uint32(8) ) +//nolint:revive // var-naming: ALL_CAPS const ( - WRITE_DAC = 0x40000 - WRITE_OWNER = 0x80000 - ACCESS_SYSTEM_SECURITY = 0x1000000 + WRITE_DAC = windows.WRITE_DAC + WRITE_OWNER = windows.WRITE_OWNER + ACCESS_SYSTEM_SECURITY = windows.ACCESS_SYSTEM_SECURITY ) // BackupHeader represents a backup stream of a file. type BackupHeader struct { + //revive:disable-next-line:var-naming ID, not Id Id uint32 // The backup stream ID Attributes uint32 // Stream attributes Size int64 // The size of the stream in bytes @@ -49,8 +53,8 @@ type BackupHeader struct { Offset int64 // The offset of the stream in the file (for BackupSparseBlock only). } -type win32StreamId struct { - StreamId uint32 +type win32StreamID struct { + StreamID uint32 Attributes uint32 Size uint64 NameSize uint32 @@ -71,7 +75,7 @@ func NewBackupStreamReader(r io.Reader) *BackupStreamReader { // Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if // it was not completely read. func (r *BackupStreamReader) Next() (*BackupHeader, error) { - if r.bytesLeft > 0 { + if r.bytesLeft > 0 { //nolint:nestif // todo: flatten this if s, ok := r.r.(io.Seeker); ok { // Make sure Seek on io.SeekCurrent sometimes succeeds // before trying the actual seek. @@ -82,16 +86,16 @@ func (r *BackupStreamReader) Next() (*BackupHeader, error) { r.bytesLeft = 0 } } - if _, err := io.Copy(ioutil.Discard, r); err != nil { + if _, err := io.Copy(io.Discard, r); err != nil { return nil, err } } - var wsi win32StreamId + var wsi win32StreamID if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil { return nil, err } hdr := &BackupHeader{ - Id: wsi.StreamId, + Id: wsi.StreamID, Attributes: wsi.Attributes, Size: int64(wsi.Size), } @@ -102,7 +106,7 @@ func (r *BackupStreamReader) Next() (*BackupHeader, error) { } hdr.Name = syscall.UTF16ToString(name) } - if wsi.StreamId == BackupSparseBlock { + if wsi.StreamID == BackupSparseBlock { if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil { return nil, err } @@ -147,8 +151,8 @@ func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error { return fmt.Errorf("missing %d bytes", w.bytesLeft) } name := utf16.Encode([]rune(hdr.Name)) - wsi := win32StreamId{ - StreamId: hdr.Id, + wsi := win32StreamID{ + StreamID: hdr.Id, Attributes: hdr.Attributes, Size: uint64(hdr.Size), NameSize: uint32(len(name) * 2), @@ -203,7 +207,7 @@ func (r *BackupFileReader) Read(b []byte) (int, error) { var bytesRead uint32 err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx) if err != nil { - return 0, &os.PathError{"BackupRead", r.f.Name(), err} + return 0, &os.PathError{Op: "BackupRead", Path: r.f.Name(), Err: err} } runtime.KeepAlive(r.f) if bytesRead == 0 { @@ -216,7 +220,7 @@ func (r *BackupFileReader) Read(b []byte) (int, error) { // the underlying file. func (r *BackupFileReader) Close() error { if r.ctx != 0 { - backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx) + _ = backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx) runtime.KeepAlive(r.f) r.ctx = 0 } @@ -242,7 +246,7 @@ func (w *BackupFileWriter) Write(b []byte) (int, error) { var bytesWritten uint32 err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx) if err != nil { - return 0, &os.PathError{"BackupWrite", w.f.Name(), err} + return 0, &os.PathError{Op: "BackupWrite", Path: w.f.Name(), Err: err} } runtime.KeepAlive(w.f) if int(bytesWritten) != len(b) { @@ -255,7 +259,7 @@ func (w *BackupFileWriter) Write(b []byte) (int, error) { // close the underlying file. func (w *BackupFileWriter) Close() error { if w.ctx != 0 { - backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx) + _ = backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx) runtime.KeepAlive(w.f) w.ctx = 0 } @@ -271,7 +275,13 @@ func OpenForBackup(path string, access uint32, share uint32, createmode uint32) if err != nil { return nil, err } - h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0) + h, err := syscall.CreateFile(&winPath[0], + access, + share, + nil, + createmode, + syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, + 0) if err != nil { err = &os.PathError{Op: "open", Path: path, Err: err} return nil, err diff --git a/vendor/github.com/Microsoft/go-winio/doc.go b/vendor/github.com/Microsoft/go-winio/doc.go new file mode 100644 index 000000000..1f5bfe2d5 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/doc.go @@ -0,0 +1,22 @@ +// This package provides utilities for efficiently performing Win32 IO operations in Go. +// Currently, this package is provides support for genreal IO and management of +// - named pipes +// - files +// - [Hyper-V sockets] +// +// This code is similar to Go's [net] package, and uses IO completion ports to avoid +// blocking IO on system threads, allowing Go to reuse the thread to schedule other goroutines. +// +// This limits support to Windows Vista and newer operating systems. +// +// Additionally, this package provides support for: +// - creating and managing GUIDs +// - writing to [ETW] +// - opening and manageing VHDs +// - parsing [Windows Image files] +// - auto-generating Win32 API code +// +// [Hyper-V sockets]: https://docs.microsoft.com/en-us/virtualization/hyper-v-on-windows/user-guide/make-integration-service +// [ETW]: https://docs.microsoft.com/en-us/windows-hardware/drivers/devtest/event-tracing-for-windows--etw- +// [Windows Image files]: https://docs.microsoft.com/en-us/windows-hardware/manufacture/desktop/work-with-windows-images +package winio diff --git a/vendor/github.com/Microsoft/go-winio/ea.go b/vendor/github.com/Microsoft/go-winio/ea.go index 4051c1b33..e104dbdfd 100644 --- a/vendor/github.com/Microsoft/go-winio/ea.go +++ b/vendor/github.com/Microsoft/go-winio/ea.go @@ -33,7 +33,7 @@ func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info) if err != nil { err = errInvalidEaBuffer - return + return ea, nb, err } nameOffset := fileFullEaInformationSize @@ -43,7 +43,7 @@ func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { nextOffset := int(info.NextEntryOffset) if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) { err = errInvalidEaBuffer - return + return ea, nb, err } ea.Name = string(b[nameOffset : nameOffset+nameLen]) @@ -52,7 +52,7 @@ func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { if info.NextEntryOffset != 0 { nb = b[info.NextEntryOffset:] } - return + return ea, nb, err } // DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION @@ -67,7 +67,7 @@ func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) { eas = append(eas, ea) b = nb } - return + return eas, err } func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error { diff --git a/vendor/github.com/Microsoft/go-winio/file.go b/vendor/github.com/Microsoft/go-winio/file.go index 0385e4108..175a99d3f 100644 --- a/vendor/github.com/Microsoft/go-winio/file.go +++ b/vendor/github.com/Microsoft/go-winio/file.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package winio @@ -10,6 +11,8 @@ import ( "sync/atomic" "syscall" "time" + + "golang.org/x/sys/windows" ) //sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx @@ -23,6 +26,8 @@ type atomicBool int32 func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 } func (b *atomicBool) setFalse() { atomic.StoreInt32((*int32)(b), 0) } func (b *atomicBool) setTrue() { atomic.StoreInt32((*int32)(b), 1) } + +//revive:disable-next-line:predeclared Keep "new" to maintain consistency with "atomic" pkg func (b *atomicBool) swap(new bool) bool { var newInt int32 if new { @@ -31,11 +36,6 @@ func (b *atomicBool) swap(new bool) bool { return atomic.SwapInt32((*int32)(b), newInt) == 1 } -const ( - cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1 - cFILE_SKIP_SET_EVENT_ON_HANDLE = 2 -) - var ( ErrFileClosed = errors.New("file has already been closed") ErrTimeout = &timeoutError{} @@ -43,28 +43,28 @@ var ( type timeoutError struct{} -func (e *timeoutError) Error() string { return "i/o timeout" } -func (e *timeoutError) Timeout() bool { return true } -func (e *timeoutError) Temporary() bool { return true } +func (*timeoutError) Error() string { return "i/o timeout" } +func (*timeoutError) Timeout() bool { return true } +func (*timeoutError) Temporary() bool { return true } type timeoutChan chan struct{} var ioInitOnce sync.Once var ioCompletionPort syscall.Handle -// ioResult contains the result of an asynchronous IO operation +// ioResult contains the result of an asynchronous IO operation. type ioResult struct { bytes uint32 err error } -// ioOperation represents an outstanding asynchronous Win32 IO +// ioOperation represents an outstanding asynchronous Win32 IO. type ioOperation struct { o syscall.Overlapped ch chan ioResult } -func initIo() { +func initIO() { h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff) if err != nil { panic(err) @@ -93,15 +93,15 @@ type deadlineHandler struct { timedout atomicBool } -// makeWin32File makes a new win32File from an existing file handle +// makeWin32File makes a new win32File from an existing file handle. func makeWin32File(h syscall.Handle) (*win32File, error) { f := &win32File{handle: h} - ioInitOnce.Do(initIo) + ioInitOnce.Do(initIO) _, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff) if err != nil { return nil, err } - err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE) + err = setFileCompletionNotificationModes(h, windows.FILE_SKIP_COMPLETION_PORT_ON_SUCCESS|windows.FILE_SKIP_SET_EVENT_ON_HANDLE) if err != nil { return nil, err } @@ -120,14 +120,14 @@ func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) { return f, nil } -// closeHandle closes the resources associated with a Win32 handle +// closeHandle closes the resources associated with a Win32 handle. func (f *win32File) closeHandle() { f.wgLock.Lock() // Atomically set that we are closing, releasing the resources only once. if !f.closing.swap(true) { f.wgLock.Unlock() // cancel all IO and wait for it to complete - cancelIoEx(f.handle, nil) + _ = cancelIoEx(f.handle, nil) f.wg.Wait() // at this point, no new IO can start syscall.Close(f.handle) @@ -143,9 +143,14 @@ func (f *win32File) Close() error { return nil } -// prepareIo prepares for a new IO operation. +// IsClosed checks if the file has been closed. +func (f *win32File) IsClosed() bool { + return f.closing.isSet() +} + +// prepareIO prepares for a new IO operation. // The caller must call f.wg.Done() when the IO is finished, prior to Close() returning. -func (f *win32File) prepareIo() (*ioOperation, error) { +func (f *win32File) prepareIO() (*ioOperation, error) { f.wgLock.RLock() if f.closing.isSet() { f.wgLock.RUnlock() @@ -158,7 +163,7 @@ func (f *win32File) prepareIo() (*ioOperation, error) { return c, nil } -// ioCompletionProcessor processes completed async IOs forever +// ioCompletionProcessor processes completed async IOs forever. func ioCompletionProcessor(h syscall.Handle) { for { var bytes uint32 @@ -172,15 +177,17 @@ func ioCompletionProcessor(h syscall.Handle) { } } -// asyncIo processes the return value from ReadFile or WriteFile, blocking until +// todo: helsaawy - create an asyncIO version that takes a context + +// asyncIO processes the return value from ReadFile or WriteFile, blocking until // the operation has actually completed. -func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) { - if err != syscall.ERROR_IO_PENDING { +func (f *win32File) asyncIO(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) { + if err != syscall.ERROR_IO_PENDING { //nolint:errorlint // err is Errno return int(bytes), err } if f.closing.isSet() { - cancelIoEx(f.handle, &c.o) + _ = cancelIoEx(f.handle, &c.o) } var timeout timeoutChan @@ -194,7 +201,7 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er select { case r = <-c.ch: err = r.err - if err == syscall.ERROR_OPERATION_ABORTED { + if err == syscall.ERROR_OPERATION_ABORTED { //nolint:errorlint // err is Errno if f.closing.isSet() { err = ErrFileClosed } @@ -204,10 +211,10 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er err = wsaGetOverlappedResult(f.handle, &c.o, &bytes, false, &flags) } case <-timeout: - cancelIoEx(f.handle, &c.o) + _ = cancelIoEx(f.handle, &c.o) r = <-c.ch err = r.err - if err == syscall.ERROR_OPERATION_ABORTED { + if err == syscall.ERROR_OPERATION_ABORTED { //nolint:errorlint // err is Errno err = ErrTimeout } } @@ -215,13 +222,14 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er // runtime.KeepAlive is needed, as c is passed via native // code to ioCompletionProcessor, c must remain alive // until the channel read is complete. + // todo: (de)allocate *ioOperation via win32 heap functions, instead of needing to KeepAlive? runtime.KeepAlive(c) return int(r.bytes), err } // Read reads from a file handle. func (f *win32File) Read(b []byte) (int, error) { - c, err := f.prepareIo() + c, err := f.prepareIO() if err != nil { return 0, err } @@ -233,13 +241,13 @@ func (f *win32File) Read(b []byte) (int, error) { var bytes uint32 err = syscall.ReadFile(f.handle, b, &bytes, &c.o) - n, err := f.asyncIo(c, &f.readDeadline, bytes, err) + n, err := f.asyncIO(c, &f.readDeadline, bytes, err) runtime.KeepAlive(b) // Handle EOF conditions. if err == nil && n == 0 && len(b) != 0 { return 0, io.EOF - } else if err == syscall.ERROR_BROKEN_PIPE { + } else if err == syscall.ERROR_BROKEN_PIPE { //nolint:errorlint // err is Errno return 0, io.EOF } else { return n, err @@ -248,7 +256,7 @@ func (f *win32File) Read(b []byte) (int, error) { // Write writes to a file handle. func (f *win32File) Write(b []byte) (int, error) { - c, err := f.prepareIo() + c, err := f.prepareIO() if err != nil { return 0, err } @@ -260,7 +268,7 @@ func (f *win32File) Write(b []byte) (int, error) { var bytes uint32 err = syscall.WriteFile(f.handle, b, &bytes, &c.o) - n, err := f.asyncIo(c, &f.writeDeadline, bytes, err) + n, err := f.asyncIO(c, &f.writeDeadline, bytes, err) runtime.KeepAlive(b) return n, err } diff --git a/vendor/github.com/Microsoft/go-winio/fileinfo.go b/vendor/github.com/Microsoft/go-winio/fileinfo.go index 3ab6bff69..702950e72 100644 --- a/vendor/github.com/Microsoft/go-winio/fileinfo.go +++ b/vendor/github.com/Microsoft/go-winio/fileinfo.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package winio @@ -14,13 +15,18 @@ import ( type FileBasicInfo struct { CreationTime, LastAccessTime, LastWriteTime, ChangeTime windows.Filetime FileAttributes uint32 - pad uint32 // padding + _ uint32 // padding } // GetFileBasicInfo retrieves times and attributes for a file. func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) { bi := &FileBasicInfo{} - if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), windows.FileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + if err := windows.GetFileInformationByHandleEx( + windows.Handle(f.Fd()), + windows.FileBasicInfo, + (*byte)(unsafe.Pointer(bi)), + uint32(unsafe.Sizeof(*bi)), + ); err != nil { return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} } runtime.KeepAlive(f) @@ -29,7 +35,12 @@ func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) { // SetFileBasicInfo sets times and attributes for a file. func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error { - if err := windows.SetFileInformationByHandle(windows.Handle(f.Fd()), windows.FileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + if err := windows.SetFileInformationByHandle( + windows.Handle(f.Fd()), + windows.FileBasicInfo, + (*byte)(unsafe.Pointer(bi)), + uint32(unsafe.Sizeof(*bi)), + ); err != nil { return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err} } runtime.KeepAlive(f) @@ -48,7 +59,10 @@ type FileStandardInfo struct { // GetFileStandardInfo retrieves ended information for the file. func GetFileStandardInfo(f *os.File) (*FileStandardInfo, error) { si := &FileStandardInfo{} - if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), windows.FileStandardInfo, (*byte)(unsafe.Pointer(si)), uint32(unsafe.Sizeof(*si))); err != nil { + if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), + windows.FileStandardInfo, + (*byte)(unsafe.Pointer(si)), + uint32(unsafe.Sizeof(*si))); err != nil { return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} } runtime.KeepAlive(f) @@ -65,7 +79,12 @@ type FileIDInfo struct { // GetFileID retrieves the unique (volume, file ID) pair for a file. func GetFileID(f *os.File) (*FileIDInfo, error) { fileID := &FileIDInfo{} - if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), windows.FileIdInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil { + if err := windows.GetFileInformationByHandleEx( + windows.Handle(f.Fd()), + windows.FileIdInfo, + (*byte)(unsafe.Pointer(fileID)), + uint32(unsafe.Sizeof(*fileID)), + ); err != nil { return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} } runtime.KeepAlive(f) diff --git a/vendor/github.com/Microsoft/go-winio/hvsock.go b/vendor/github.com/Microsoft/go-winio/hvsock.go index b632f8f8b..c88191658 100644 --- a/vendor/github.com/Microsoft/go-winio/hvsock.go +++ b/vendor/github.com/Microsoft/go-winio/hvsock.go @@ -1,8 +1,11 @@ +//go:build windows // +build windows package winio import ( + "context" + "errors" "fmt" "io" "net" @@ -11,16 +14,87 @@ import ( "time" "unsafe" + "golang.org/x/sys/windows" + + "github.com/Microsoft/go-winio/internal/socket" "github.com/Microsoft/go-winio/pkg/guid" ) -//sys bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) [failretval==socketError] = ws2_32.bind +const afHVSock = 34 // AF_HYPERV -const ( - afHvSock = 34 // AF_HYPERV +// Well known Service and VM IDs +// https://docs.microsoft.com/en-us/virtualization/hyper-v-on-windows/user-guide/make-integration-service#vmid-wildcards - socketError = ^uintptr(0) -) +// HvsockGUIDWildcard is the wildcard VmId for accepting connections from all partitions. +func HvsockGUIDWildcard() guid.GUID { // 00000000-0000-0000-0000-000000000000 + return guid.GUID{} +} + +// HvsockGUIDBroadcast is the wildcard VmId for broadcasting sends to all partitions. +func HvsockGUIDBroadcast() guid.GUID { // ffffffff-ffff-ffff-ffff-ffffffffffff + return guid.GUID{ + Data1: 0xffffffff, + Data2: 0xffff, + Data3: 0xffff, + Data4: [8]uint8{0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}, + } +} + +// HvsockGUIDLoopback is the Loopback VmId for accepting connections to the same partition as the connector. +func HvsockGUIDLoopback() guid.GUID { // e0e16197-dd56-4a10-9195-5ee7a155a838 + return guid.GUID{ + Data1: 0xe0e16197, + Data2: 0xdd56, + Data3: 0x4a10, + Data4: [8]uint8{0x91, 0x95, 0x5e, 0xe7, 0xa1, 0x55, 0xa8, 0x38}, + } +} + +// HvsockGUIDSiloHost is the address of a silo's host partition: +// - The silo host of a hosted silo is the utility VM. +// - The silo host of a silo on a physical host is the physical host. +func HvsockGUIDSiloHost() guid.GUID { // 36bd0c5c-7276-4223-88ba-7d03b654c568 + return guid.GUID{ + Data1: 0x36bd0c5c, + Data2: 0x7276, + Data3: 0x4223, + Data4: [8]byte{0x88, 0xba, 0x7d, 0x03, 0xb6, 0x54, 0xc5, 0x68}, + } +} + +// HvsockGUIDChildren is the wildcard VmId for accepting connections from the connector's child partitions. +func HvsockGUIDChildren() guid.GUID { // 90db8b89-0d35-4f79-8ce9-49ea0ac8b7cd + return guid.GUID{ + Data1: 0x90db8b89, + Data2: 0xd35, + Data3: 0x4f79, + Data4: [8]uint8{0x8c, 0xe9, 0x49, 0xea, 0xa, 0xc8, 0xb7, 0xcd}, + } +} + +// HvsockGUIDParent is the wildcard VmId for accepting connections from the connector's parent partition. +// Listening on this VmId accepts connection from: +// - Inside silos: silo host partition. +// - Inside hosted silo: host of the VM. +// - Inside VM: VM host. +// - Physical host: Not supported. +func HvsockGUIDParent() guid.GUID { // a42e7cda-d03f-480c-9cc2-a4de20abb878 + return guid.GUID{ + Data1: 0xa42e7cda, + Data2: 0xd03f, + Data3: 0x480c, + Data4: [8]uint8{0x9c, 0xc2, 0xa4, 0xde, 0x20, 0xab, 0xb8, 0x78}, + } +} + +// hvsockVsockServiceTemplate is the Service GUID used for the VSOCK protocol. +func hvsockVsockServiceTemplate() guid.GUID { // 00000000-facb-11e6-bd58-64006a7986d3 + return guid.GUID{ + Data2: 0xfacb, + Data3: 0x11e6, + Data4: [8]uint8{0xbd, 0x58, 0x64, 0x00, 0x6a, 0x79, 0x86, 0xd3}, + } +} // An HvsockAddr is an address for a AF_HYPERV socket. type HvsockAddr struct { @@ -35,8 +109,10 @@ type rawHvsockAddr struct { ServiceID guid.GUID } +var _ socket.RawSockaddr = &rawHvsockAddr{} + // Network returns the address's network name, "hvsock". -func (addr *HvsockAddr) Network() string { +func (*HvsockAddr) Network() string { return "hvsock" } @@ -46,14 +122,14 @@ func (addr *HvsockAddr) String() string { // VsockServiceID returns an hvsock service ID corresponding to the specified AF_VSOCK port. func VsockServiceID(port uint32) guid.GUID { - g, _ := guid.FromString("00000000-facb-11e6-bd58-64006a7986d3") + g := hvsockVsockServiceTemplate() // make a copy g.Data1 = port return g } func (addr *HvsockAddr) raw() rawHvsockAddr { return rawHvsockAddr{ - Family: afHvSock, + Family: afHVSock, VMID: addr.VMID, ServiceID: addr.ServiceID, } @@ -64,20 +140,48 @@ func (addr *HvsockAddr) fromRaw(raw *rawHvsockAddr) { addr.ServiceID = raw.ServiceID } +// Sockaddr returns a pointer to and the size of this struct. +// +// Implements the [socket.RawSockaddr] interface, and allows use in +// [socket.Bind] and [socket.ConnectEx]. +func (r *rawHvsockAddr) Sockaddr() (unsafe.Pointer, int32, error) { + return unsafe.Pointer(r), int32(unsafe.Sizeof(rawHvsockAddr{})), nil +} + +// Sockaddr interface allows use with `sockets.Bind()` and `.ConnectEx()`. +func (r *rawHvsockAddr) FromBytes(b []byte) error { + n := int(unsafe.Sizeof(rawHvsockAddr{})) + + if len(b) < n { + return fmt.Errorf("got %d, want %d: %w", len(b), n, socket.ErrBufferSize) + } + + copy(unsafe.Slice((*byte)(unsafe.Pointer(r)), n), b[:n]) + if r.Family != afHVSock { + return fmt.Errorf("got %d, want %d: %w", r.Family, afHVSock, socket.ErrAddrFamily) + } + + return nil +} + // HvsockListener is a socket listener for the AF_HYPERV address family. type HvsockListener struct { sock *win32File addr HvsockAddr } +var _ net.Listener = &HvsockListener{} + // HvsockConn is a connected socket of the AF_HYPERV address family. type HvsockConn struct { sock *win32File local, remote HvsockAddr } -func newHvSocket() (*win32File, error) { - fd, err := syscall.Socket(afHvSock, syscall.SOCK_STREAM, 1) +var _ net.Conn = &HvsockConn{} + +func newHVSocket() (*win32File, error) { + fd, err := syscall.Socket(afHVSock, syscall.SOCK_STREAM, 1) if err != nil { return nil, os.NewSyscallError("socket", err) } @@ -93,12 +197,12 @@ func newHvSocket() (*win32File, error) { // ListenHvsock listens for connections on the specified hvsock address. func ListenHvsock(addr *HvsockAddr) (_ *HvsockListener, err error) { l := &HvsockListener{addr: *addr} - sock, err := newHvSocket() + sock, err := newHVSocket() if err != nil { return nil, l.opErr("listen", err) } sa := addr.raw() - err = bind(sock.handle, unsafe.Pointer(&sa), int32(unsafe.Sizeof(sa))) + err = socket.Bind(windows.Handle(sock.handle), &sa) if err != nil { return nil, l.opErr("listen", os.NewSyscallError("socket", err)) } @@ -120,7 +224,7 @@ func (l *HvsockListener) Addr() net.Addr { // Accept waits for the next connection and returns it. func (l *HvsockListener) Accept() (_ net.Conn, err error) { - sock, err := newHvSocket() + sock, err := newHVSocket() if err != nil { return nil, l.opErr("accept", err) } @@ -129,27 +233,42 @@ func (l *HvsockListener) Accept() (_ net.Conn, err error) { sock.Close() } }() - c, err := l.sock.prepareIo() + c, err := l.sock.prepareIO() if err != nil { return nil, l.opErr("accept", err) } defer l.sock.wg.Done() // AcceptEx, per documentation, requires an extra 16 bytes per address. + // + // https://docs.microsoft.com/en-us/windows/win32/api/mswsock/nf-mswsock-acceptex const addrlen = uint32(16 + unsafe.Sizeof(rawHvsockAddr{})) var addrbuf [addrlen * 2]byte var bytes uint32 - err = syscall.AcceptEx(l.sock.handle, sock.handle, &addrbuf[0], 0, addrlen, addrlen, &bytes, &c.o) - _, err = l.sock.asyncIo(c, nil, bytes, err) - if err != nil { + err = syscall.AcceptEx(l.sock.handle, sock.handle, &addrbuf[0], 0 /* rxdatalen */, addrlen, addrlen, &bytes, &c.o) + if _, err = l.sock.asyncIO(c, nil, bytes, err); err != nil { return nil, l.opErr("accept", os.NewSyscallError("acceptex", err)) } + conn := &HvsockConn{ sock: sock, } + // The local address returned in the AcceptEx buffer is the same as the Listener socket's + // address. However, the service GUID reported by GetSockName is different from the Listeners + // socket, and is sometimes the same as the local address of the socket that dialed the + // address, with the service GUID.Data1 incremented, but othertimes is different. + // todo: does the local address matter? is the listener's address or the actual address appropriate? conn.local.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[0]))) conn.remote.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[addrlen]))) + + // initialize the accepted socket and update its properties with those of the listening socket + if err = windows.Setsockopt(windows.Handle(sock.handle), + windows.SOL_SOCKET, windows.SO_UPDATE_ACCEPT_CONTEXT, + (*byte)(unsafe.Pointer(&l.sock.handle)), int32(unsafe.Sizeof(l.sock.handle))); err != nil { + return nil, conn.opErr("accept", os.NewSyscallError("setsockopt", err)) + } + sock = nil return conn, nil } @@ -159,43 +278,171 @@ func (l *HvsockListener) Close() error { return l.sock.Close() } -/* Need to finish ConnectEx handling -func DialHvsock(ctx context.Context, addr *HvsockAddr) (*HvsockConn, error) { - sock, err := newHvSocket() +// HvsockDialer configures and dials a Hyper-V Socket (ie, [HvsockConn]). +type HvsockDialer struct { + // Deadline is the time the Dial operation must connect before erroring. + Deadline time.Time + + // Retries is the number of additional connects to try if the connection times out, is refused, + // or the host is unreachable + Retries uint + + // RetryWait is the time to wait after a connection error to retry + RetryWait time.Duration + + rt *time.Timer // redial wait timer +} + +// Dial the Hyper-V socket at addr. +// +// See [HvsockDialer.Dial] for more information. +func Dial(ctx context.Context, addr *HvsockAddr) (conn *HvsockConn, err error) { + return (&HvsockDialer{}).Dial(ctx, addr) +} + +// Dial attempts to connect to the Hyper-V socket at addr, and returns a connection if successful. +// Will attempt (HvsockDialer).Retries if dialing fails, waiting (HvsockDialer).RetryWait between +// retries. +// +// Dialing can be cancelled either by providing (HvsockDialer).Deadline, or cancelling ctx. +func (d *HvsockDialer) Dial(ctx context.Context, addr *HvsockAddr) (conn *HvsockConn, err error) { + op := "dial" + // create the conn early to use opErr() + conn = &HvsockConn{ + remote: *addr, + } + + if !d.Deadline.IsZero() { + var cancel context.CancelFunc + ctx, cancel = context.WithDeadline(ctx, d.Deadline) + defer cancel() + } + + // preemptive timeout/cancellation check + if err = ctx.Err(); err != nil { + return nil, conn.opErr(op, err) + } + + sock, err := newHVSocket() if err != nil { - return nil, err + return nil, conn.opErr(op, err) } defer func() { if sock != nil { sock.Close() } }() - c, err := sock.prepareIo() + + sa := addr.raw() + err = socket.Bind(windows.Handle(sock.handle), &sa) if err != nil { - return nil, err + return nil, conn.opErr(op, os.NewSyscallError("bind", err)) + } + + c, err := sock.prepareIO() + if err != nil { + return nil, conn.opErr(op, err) } defer sock.wg.Done() var bytes uint32 - err = windows.ConnectEx(windows.Handle(sock.handle), sa, nil, 0, &bytes, &c.o) - _, err = sock.asyncIo(ctx, c, nil, bytes, err) + for i := uint(0); i <= d.Retries; i++ { + err = socket.ConnectEx( + windows.Handle(sock.handle), + &sa, + nil, // sendBuf + 0, // sendDataLen + &bytes, + (*windows.Overlapped)(unsafe.Pointer(&c.o))) + _, err = sock.asyncIO(c, nil, bytes, err) + if i < d.Retries && canRedial(err) { + if err = d.redialWait(ctx); err == nil { + continue + } + } + break + } if err != nil { - return nil, err + return nil, conn.opErr(op, os.NewSyscallError("connectex", err)) } - conn := &HvsockConn{ - sock: sock, - remote: *addr, + + // update the connection properties, so shutdown can be used + if err = windows.Setsockopt( + windows.Handle(sock.handle), + windows.SOL_SOCKET, + windows.SO_UPDATE_CONNECT_CONTEXT, + nil, // optvalue + 0, // optlen + ); err != nil { + return nil, conn.opErr(op, os.NewSyscallError("setsockopt", err)) + } + + // get the local name + var sal rawHvsockAddr + err = socket.GetSockName(windows.Handle(sock.handle), &sal) + if err != nil { + return nil, conn.opErr(op, os.NewSyscallError("getsockname", err)) + } + conn.local.fromRaw(&sal) + + // one last check for timeout, since asyncIO doesn't check the context + if err = ctx.Err(); err != nil { + return nil, conn.opErr(op, err) } + + conn.sock = sock sock = nil + return conn, nil } -*/ + +// redialWait waits before attempting to redial, resetting the timer as appropriate. +func (d *HvsockDialer) redialWait(ctx context.Context) (err error) { + if d.RetryWait == 0 { + return nil + } + + if d.rt == nil { + d.rt = time.NewTimer(d.RetryWait) + } else { + // should already be stopped and drained + d.rt.Reset(d.RetryWait) + } + + select { + case <-ctx.Done(): + case <-d.rt.C: + return nil + } + + // stop and drain the timer + if !d.rt.Stop() { + <-d.rt.C + } + return ctx.Err() +} + +// assumes error is a plain, unwrapped syscall.Errno provided by direct syscall. +func canRedial(err error) bool { + //nolint:errorlint // guaranteed to be an Errno + switch err { + case windows.WSAECONNREFUSED, windows.WSAENETUNREACH, windows.WSAETIMEDOUT, + windows.ERROR_CONNECTION_REFUSED, windows.ERROR_CONNECTION_UNAVAIL: + return true + default: + return false + } +} func (conn *HvsockConn) opErr(op string, err error) error { + // translate from "file closed" to "socket closed" + if errors.Is(err, ErrFileClosed) { + err = socket.ErrSocketClosed + } return &net.OpError{Op: op, Net: "hvsock", Source: &conn.local, Addr: &conn.remote, Err: err} } func (conn *HvsockConn) Read(b []byte) (int, error) { - c, err := conn.sock.prepareIo() + c, err := conn.sock.prepareIO() if err != nil { return 0, conn.opErr("read", err) } @@ -203,10 +450,11 @@ func (conn *HvsockConn) Read(b []byte) (int, error) { buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))} var flags, bytes uint32 err = syscall.WSARecv(conn.sock.handle, &buf, 1, &bytes, &flags, &c.o, nil) - n, err := conn.sock.asyncIo(c, &conn.sock.readDeadline, bytes, err) + n, err := conn.sock.asyncIO(c, &conn.sock.readDeadline, bytes, err) if err != nil { - if _, ok := err.(syscall.Errno); ok { - err = os.NewSyscallError("wsarecv", err) + var eno windows.Errno + if errors.As(err, &eno) { + err = os.NewSyscallError("wsarecv", eno) } return 0, conn.opErr("read", err) } else if n == 0 { @@ -229,7 +477,7 @@ func (conn *HvsockConn) Write(b []byte) (int, error) { } func (conn *HvsockConn) write(b []byte) (int, error) { - c, err := conn.sock.prepareIo() + c, err := conn.sock.prepareIO() if err != nil { return 0, conn.opErr("write", err) } @@ -237,10 +485,11 @@ func (conn *HvsockConn) write(b []byte) (int, error) { buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))} var bytes uint32 err = syscall.WSASend(conn.sock.handle, &buf, 1, &bytes, 0, &c.o, nil) - n, err := conn.sock.asyncIo(c, &conn.sock.writeDeadline, bytes, err) + n, err := conn.sock.asyncIO(c, &conn.sock.writeDeadline, bytes, err) if err != nil { - if _, ok := err.(syscall.Errno); ok { - err = os.NewSyscallError("wsasend", err) + var eno windows.Errno + if errors.As(err, &eno) { + err = os.NewSyscallError("wsasend", eno) } return 0, conn.opErr("write", err) } @@ -252,29 +501,43 @@ func (conn *HvsockConn) Close() error { return conn.sock.Close() } +func (conn *HvsockConn) IsClosed() bool { + return conn.sock.IsClosed() +} + +// shutdown disables sending or receiving on a socket. func (conn *HvsockConn) shutdown(how int) error { - err := syscall.Shutdown(conn.sock.handle, syscall.SHUT_RD) + if conn.IsClosed() { + return socket.ErrSocketClosed + } + + err := syscall.Shutdown(conn.sock.handle, how) if err != nil { + // If the connection was closed, shutdowns fail with "not connected" + if errors.Is(err, windows.WSAENOTCONN) || + errors.Is(err, windows.WSAESHUTDOWN) { + err = socket.ErrSocketClosed + } return os.NewSyscallError("shutdown", err) } return nil } -// CloseRead shuts down the read end of the socket. +// CloseRead shuts down the read end of the socket, preventing future read operations. func (conn *HvsockConn) CloseRead() error { err := conn.shutdown(syscall.SHUT_RD) if err != nil { - return conn.opErr("close", err) + return conn.opErr("closeread", err) } return nil } -// CloseWrite shuts down the write end of the socket, notifying the other endpoint that -// no more data will be written. +// CloseWrite shuts down the write end of the socket, preventing future write operations and +// notifying the other endpoint that no more data will be written. func (conn *HvsockConn) CloseWrite() error { err := conn.shutdown(syscall.SHUT_WR) if err != nil { - return conn.opErr("close", err) + return conn.opErr("closewrite", err) } return nil } @@ -291,8 +554,13 @@ func (conn *HvsockConn) RemoteAddr() net.Addr { // SetDeadline implements the net.Conn SetDeadline method. func (conn *HvsockConn) SetDeadline(t time.Time) error { - conn.SetReadDeadline(t) - conn.SetWriteDeadline(t) + // todo: implement `SetDeadline` for `win32File` + if err := conn.SetReadDeadline(t); err != nil { + return fmt.Errorf("set read deadline: %w", err) + } + if err := conn.SetWriteDeadline(t); err != nil { + return fmt.Errorf("set write deadline: %w", err) + } return nil } diff --git a/vendor/github.com/Microsoft/go-winio/internal/fs/doc.go b/vendor/github.com/Microsoft/go-winio/internal/fs/doc.go new file mode 100644 index 000000000..1f6538817 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/fs/doc.go @@ -0,0 +1,2 @@ +// This package contains Win32 filesystem functionality. +package fs diff --git a/vendor/github.com/Microsoft/go-winio/internal/fs/fs.go b/vendor/github.com/Microsoft/go-winio/internal/fs/fs.go new file mode 100644 index 000000000..509b3ec64 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/fs/fs.go @@ -0,0 +1,202 @@ +//go:build windows + +package fs + +import ( + "golang.org/x/sys/windows" + + "github.com/Microsoft/go-winio/internal/stringbuffer" +) + +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go fs.go + +// https://learn.microsoft.com/en-us/windows/win32/api/fileapi/nf-fileapi-createfilew +//sys CreateFile(name string, access AccessMask, mode FileShareMode, sa *syscall.SecurityAttributes, createmode FileCreationDisposition, attrs FileFlagOrAttribute, templatefile windows.Handle) (handle windows.Handle, err error) [failretval==windows.InvalidHandle] = CreateFileW + +const NullHandle windows.Handle = 0 + +// AccessMask defines standard, specific, and generic rights. +// +// Bitmask: +// 3 3 2 2 2 2 2 2 2 2 2 2 1 1 1 1 1 1 1 1 1 1 +// 1 0 9 8 7 6 5 4 3 2 1 0 9 8 7 6 5 4 3 2 1 0 9 8 7 6 5 4 3 2 1 0 +// +---------------+---------------+-------------------------------+ +// |G|G|G|G|Resvd|A| StandardRights| SpecificRights | +// |R|W|E|A| |S| | | +// +-+-------------+---------------+-------------------------------+ +// +// GR Generic Read +// GW Generic Write +// GE Generic Exectue +// GA Generic All +// Resvd Reserved +// AS Access Security System +// +// https://learn.microsoft.com/en-us/windows/win32/secauthz/access-mask +// +// https://learn.microsoft.com/en-us/windows/win32/secauthz/generic-access-rights +// +// https://learn.microsoft.com/en-us/windows/win32/fileio/file-access-rights-constants +type AccessMask = windows.ACCESS_MASK + +//nolint:revive // SNAKE_CASE is not idiomatic in Go, but aligned with Win32 API. +const ( + // Not actually any. + // + // For CreateFile: "query certain metadata such as file, directory, or device attributes without accessing that file or device" + // https://learn.microsoft.com/en-us/windows/win32/api/fileapi/nf-fileapi-createfilew#parameters + FILE_ANY_ACCESS AccessMask = 0 + + // Specific Object Access + // from ntioapi.h + + FILE_READ_DATA AccessMask = (0x0001) // file & pipe + FILE_LIST_DIRECTORY AccessMask = (0x0001) // directory + + FILE_WRITE_DATA AccessMask = (0x0002) // file & pipe + FILE_ADD_FILE AccessMask = (0x0002) // directory + + FILE_APPEND_DATA AccessMask = (0x0004) // file + FILE_ADD_SUBDIRECTORY AccessMask = (0x0004) // directory + FILE_CREATE_PIPE_INSTANCE AccessMask = (0x0004) // named pipe + + FILE_READ_EA AccessMask = (0x0008) // file & directory + FILE_READ_PROPERTIES AccessMask = FILE_READ_EA + + FILE_WRITE_EA AccessMask = (0x0010) // file & directory + FILE_WRITE_PROPERTIES AccessMask = FILE_WRITE_EA + + FILE_EXECUTE AccessMask = (0x0020) // file + FILE_TRAVERSE AccessMask = (0x0020) // directory + + FILE_DELETE_CHILD AccessMask = (0x0040) // directory + + FILE_READ_ATTRIBUTES AccessMask = (0x0080) // all + + FILE_WRITE_ATTRIBUTES AccessMask = (0x0100) // all + + FILE_ALL_ACCESS AccessMask = (STANDARD_RIGHTS_REQUIRED | SYNCHRONIZE | 0x1FF) + FILE_GENERIC_READ AccessMask = (STANDARD_RIGHTS_READ | FILE_READ_DATA | FILE_READ_ATTRIBUTES | FILE_READ_EA | SYNCHRONIZE) + FILE_GENERIC_WRITE AccessMask = (STANDARD_RIGHTS_WRITE | FILE_WRITE_DATA | FILE_WRITE_ATTRIBUTES | FILE_WRITE_EA | FILE_APPEND_DATA | SYNCHRONIZE) + FILE_GENERIC_EXECUTE AccessMask = (STANDARD_RIGHTS_EXECUTE | FILE_READ_ATTRIBUTES | FILE_EXECUTE | SYNCHRONIZE) + + SPECIFIC_RIGHTS_ALL AccessMask = 0x0000FFFF + + // Standard Access + // from ntseapi.h + + DELETE AccessMask = 0x0001_0000 + READ_CONTROL AccessMask = 0x0002_0000 + WRITE_DAC AccessMask = 0x0004_0000 + WRITE_OWNER AccessMask = 0x0008_0000 + SYNCHRONIZE AccessMask = 0x0010_0000 + + STANDARD_RIGHTS_REQUIRED AccessMask = 0x000F_0000 + + STANDARD_RIGHTS_READ AccessMask = READ_CONTROL + STANDARD_RIGHTS_WRITE AccessMask = READ_CONTROL + STANDARD_RIGHTS_EXECUTE AccessMask = READ_CONTROL + + STANDARD_RIGHTS_ALL AccessMask = 0x001F_0000 +) + +type FileShareMode uint32 + +//nolint:revive // SNAKE_CASE is not idiomatic in Go, but aligned with Win32 API. +const ( + FILE_SHARE_NONE FileShareMode = 0x00 + FILE_SHARE_READ FileShareMode = 0x01 + FILE_SHARE_WRITE FileShareMode = 0x02 + FILE_SHARE_DELETE FileShareMode = 0x04 + FILE_SHARE_VALID_FLAGS FileShareMode = 0x07 +) + +type FileCreationDisposition uint32 + +//nolint:revive // SNAKE_CASE is not idiomatic in Go, but aligned with Win32 API. +const ( + // from winbase.h + + CREATE_NEW FileCreationDisposition = 0x01 + CREATE_ALWAYS FileCreationDisposition = 0x02 + OPEN_EXISTING FileCreationDisposition = 0x03 + OPEN_ALWAYS FileCreationDisposition = 0x04 + TRUNCATE_EXISTING FileCreationDisposition = 0x05 +) + +// CreateFile and co. take flags or attributes together as one parameter. +// Define alias until we can use generics to allow both + +// https://learn.microsoft.com/en-us/windows/win32/fileio/file-attribute-constants +type FileFlagOrAttribute uint32 + +//nolint:revive // SNAKE_CASE is not idiomatic in Go, but aligned with Win32 API. +const ( // from winnt.h + FILE_FLAG_WRITE_THROUGH FileFlagOrAttribute = 0x8000_0000 + FILE_FLAG_OVERLAPPED FileFlagOrAttribute = 0x4000_0000 + FILE_FLAG_NO_BUFFERING FileFlagOrAttribute = 0x2000_0000 + FILE_FLAG_RANDOM_ACCESS FileFlagOrAttribute = 0x1000_0000 + FILE_FLAG_SEQUENTIAL_SCAN FileFlagOrAttribute = 0x0800_0000 + FILE_FLAG_DELETE_ON_CLOSE FileFlagOrAttribute = 0x0400_0000 + FILE_FLAG_BACKUP_SEMANTICS FileFlagOrAttribute = 0x0200_0000 + FILE_FLAG_POSIX_SEMANTICS FileFlagOrAttribute = 0x0100_0000 + FILE_FLAG_OPEN_REPARSE_POINT FileFlagOrAttribute = 0x0020_0000 + FILE_FLAG_OPEN_NO_RECALL FileFlagOrAttribute = 0x0010_0000 + FILE_FLAG_FIRST_PIPE_INSTANCE FileFlagOrAttribute = 0x0008_0000 +) + +type FileSQSFlag = FileFlagOrAttribute + +//nolint:revive // SNAKE_CASE is not idiomatic in Go, but aligned with Win32 API. +const ( // from winbase.h + SECURITY_ANONYMOUS FileSQSFlag = FileSQSFlag(SecurityAnonymous << 16) + SECURITY_IDENTIFICATION FileSQSFlag = FileSQSFlag(SecurityIdentification << 16) + SECURITY_IMPERSONATION FileSQSFlag = FileSQSFlag(SecurityImpersonation << 16) + SECURITY_DELEGATION FileSQSFlag = FileSQSFlag(SecurityDelegation << 16) + + SECURITY_SQOS_PRESENT FileSQSFlag = 0x00100000 + SECURITY_VALID_SQOS_FLAGS FileSQSFlag = 0x001F0000 +) + +// GetFinalPathNameByHandle flags +// +// https://learn.microsoft.com/en-us/windows/win32/api/fileapi/nf-fileapi-getfinalpathnamebyhandlew#parameters +type GetFinalPathFlag uint32 + +//nolint:revive // SNAKE_CASE is not idiomatic in Go, but aligned with Win32 API. +const ( + GetFinalPathDefaultFlag GetFinalPathFlag = 0x0 + + FILE_NAME_NORMALIZED GetFinalPathFlag = 0x0 + FILE_NAME_OPENED GetFinalPathFlag = 0x8 + + VOLUME_NAME_DOS GetFinalPathFlag = 0x0 + VOLUME_NAME_GUID GetFinalPathFlag = 0x1 + VOLUME_NAME_NT GetFinalPathFlag = 0x2 + VOLUME_NAME_NONE GetFinalPathFlag = 0x4 +) + +// getFinalPathNameByHandle facilitates calling the Windows API GetFinalPathNameByHandle +// with the given handle and flags. It transparently takes care of creating a buffer of the +// correct size for the call. +// +// https://learn.microsoft.com/en-us/windows/win32/api/fileapi/nf-fileapi-getfinalpathnamebyhandlew +func GetFinalPathNameByHandle(h windows.Handle, flags GetFinalPathFlag) (string, error) { + b := stringbuffer.NewWString() + //TODO: can loop infinitely if Win32 keeps returning the same (or a larger) n? + for { + n, err := windows.GetFinalPathNameByHandle(h, b.Pointer(), b.Cap(), uint32(flags)) + if err != nil { + return "", err + } + // If the buffer wasn't large enough, n will be the total size needed (including null terminator). + // Resize and try again. + if n > b.Cap() { + b.ResizeTo(n) + continue + } + // If the buffer is large enough, n will be the size not including the null terminator. + // Convert to a Go string and return. + return b.String(), nil + } +} diff --git a/vendor/github.com/Microsoft/go-winio/internal/fs/security.go b/vendor/github.com/Microsoft/go-winio/internal/fs/security.go new file mode 100644 index 000000000..81760ac67 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/fs/security.go @@ -0,0 +1,12 @@ +package fs + +// https://learn.microsoft.com/en-us/windows/win32/api/winnt/ne-winnt-security_impersonation_level +type SecurityImpersonationLevel int32 // C default enums underlying type is `int`, which is Go `int32` + +// Impersonation levels +const ( + SecurityAnonymous SecurityImpersonationLevel = 0 + SecurityIdentification SecurityImpersonationLevel = 1 + SecurityImpersonation SecurityImpersonationLevel = 2 + SecurityDelegation SecurityImpersonationLevel = 3 +) diff --git a/vendor/github.com/Microsoft/go-winio/internal/fs/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/internal/fs/zsyscall_windows.go new file mode 100644 index 000000000..e2f7bb24e --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/fs/zsyscall_windows.go @@ -0,0 +1,64 @@ +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. + +package fs + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return errERROR_EINVAL + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + + procCreateFileW = modkernel32.NewProc("CreateFileW") +) + +func CreateFile(name string, access AccessMask, mode FileShareMode, sa *syscall.SecurityAttributes, createmode FileCreationDisposition, attrs FileFlagOrAttribute, templatefile windows.Handle) (handle windows.Handle, err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(name) + if err != nil { + return + } + return _CreateFile(_p0, access, mode, sa, createmode, attrs, templatefile) +} + +func _CreateFile(name *uint16, access AccessMask, mode FileShareMode, sa *syscall.SecurityAttributes, createmode FileCreationDisposition, attrs FileFlagOrAttribute, templatefile windows.Handle) (handle windows.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0) + handle = windows.Handle(r0) + if handle == windows.InvalidHandle { + err = errnoErr(e1) + } + return +} diff --git a/vendor/github.com/Microsoft/go-winio/internal/socket/rawaddr.go b/vendor/github.com/Microsoft/go-winio/internal/socket/rawaddr.go new file mode 100644 index 000000000..7e82f9afa --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/socket/rawaddr.go @@ -0,0 +1,20 @@ +package socket + +import ( + "unsafe" +) + +// RawSockaddr allows structs to be used with [Bind] and [ConnectEx]. The +// struct must meet the Win32 sockaddr requirements specified here: +// https://docs.microsoft.com/en-us/windows/win32/winsock/sockaddr-2 +// +// Specifically, the struct size must be least larger than an int16 (unsigned short) +// for the address family. +type RawSockaddr interface { + // Sockaddr returns a pointer to the RawSockaddr and its struct size, allowing + // for the RawSockaddr's data to be overwritten by syscalls (if necessary). + // + // It is the callers responsibility to validate that the values are valid; invalid + // pointers or size can cause a panic. + Sockaddr() (unsafe.Pointer, int32, error) +} diff --git a/vendor/github.com/Microsoft/go-winio/internal/socket/socket.go b/vendor/github.com/Microsoft/go-winio/internal/socket/socket.go new file mode 100644 index 000000000..aeb7b7250 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/socket/socket.go @@ -0,0 +1,179 @@ +//go:build windows + +package socket + +import ( + "errors" + "fmt" + "net" + "sync" + "syscall" + "unsafe" + + "github.com/Microsoft/go-winio/pkg/guid" + "golang.org/x/sys/windows" +) + +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go socket.go + +//sys getsockname(s windows.Handle, name unsafe.Pointer, namelen *int32) (err error) [failretval==socketError] = ws2_32.getsockname +//sys getpeername(s windows.Handle, name unsafe.Pointer, namelen *int32) (err error) [failretval==socketError] = ws2_32.getpeername +//sys bind(s windows.Handle, name unsafe.Pointer, namelen int32) (err error) [failretval==socketError] = ws2_32.bind + +const socketError = uintptr(^uint32(0)) + +var ( + // todo(helsaawy): create custom error types to store the desired vs actual size and addr family? + + ErrBufferSize = errors.New("buffer size") + ErrAddrFamily = errors.New("address family") + ErrInvalidPointer = errors.New("invalid pointer") + ErrSocketClosed = fmt.Errorf("socket closed: %w", net.ErrClosed) +) + +// todo(helsaawy): replace these with generics, ie: GetSockName[S RawSockaddr](s windows.Handle) (S, error) + +// GetSockName writes the local address of socket s to the [RawSockaddr] rsa. +// If rsa is not large enough, the [windows.WSAEFAULT] is returned. +func GetSockName(s windows.Handle, rsa RawSockaddr) error { + ptr, l, err := rsa.Sockaddr() + if err != nil { + return fmt.Errorf("could not retrieve socket pointer and size: %w", err) + } + + // although getsockname returns WSAEFAULT if the buffer is too small, it does not set + // &l to the correct size, so--apart from doubling the buffer repeatedly--there is no remedy + return getsockname(s, ptr, &l) +} + +// GetPeerName returns the remote address the socket is connected to. +// +// See [GetSockName] for more information. +func GetPeerName(s windows.Handle, rsa RawSockaddr) error { + ptr, l, err := rsa.Sockaddr() + if err != nil { + return fmt.Errorf("could not retrieve socket pointer and size: %w", err) + } + + return getpeername(s, ptr, &l) +} + +func Bind(s windows.Handle, rsa RawSockaddr) (err error) { + ptr, l, err := rsa.Sockaddr() + if err != nil { + return fmt.Errorf("could not retrieve socket pointer and size: %w", err) + } + + return bind(s, ptr, l) +} + +// "golang.org/x/sys/windows".ConnectEx and .Bind only accept internal implementations of the +// their sockaddr interface, so they cannot be used with HvsockAddr +// Replicate functionality here from +// https://cs.opensource.google/go/x/sys/+/master:windows/syscall_windows.go + +// The function pointers to `AcceptEx`, `ConnectEx` and `GetAcceptExSockaddrs` must be loaded at +// runtime via a WSAIoctl call: +// https://docs.microsoft.com/en-us/windows/win32/api/Mswsock/nc-mswsock-lpfn_connectex#remarks + +type runtimeFunc struct { + id guid.GUID + once sync.Once + addr uintptr + err error +} + +func (f *runtimeFunc) Load() error { + f.once.Do(func() { + var s windows.Handle + s, f.err = windows.Socket(windows.AF_INET, windows.SOCK_STREAM, windows.IPPROTO_TCP) + if f.err != nil { + return + } + defer windows.CloseHandle(s) //nolint:errcheck + + var n uint32 + f.err = windows.WSAIoctl(s, + windows.SIO_GET_EXTENSION_FUNCTION_POINTER, + (*byte)(unsafe.Pointer(&f.id)), + uint32(unsafe.Sizeof(f.id)), + (*byte)(unsafe.Pointer(&f.addr)), + uint32(unsafe.Sizeof(f.addr)), + &n, + nil, // overlapped + 0, // completionRoutine + ) + }) + return f.err +} + +var ( + // todo: add `AcceptEx` and `GetAcceptExSockaddrs` + WSAID_CONNECTEX = guid.GUID{ //revive:disable-line:var-naming ALL_CAPS + Data1: 0x25a207b9, + Data2: 0xddf3, + Data3: 0x4660, + Data4: [8]byte{0x8e, 0xe9, 0x76, 0xe5, 0x8c, 0x74, 0x06, 0x3e}, + } + + connectExFunc = runtimeFunc{id: WSAID_CONNECTEX} +) + +func ConnectEx( + fd windows.Handle, + rsa RawSockaddr, + sendBuf *byte, + sendDataLen uint32, + bytesSent *uint32, + overlapped *windows.Overlapped, +) error { + if err := connectExFunc.Load(); err != nil { + return fmt.Errorf("failed to load ConnectEx function pointer: %w", err) + } + ptr, n, err := rsa.Sockaddr() + if err != nil { + return err + } + return connectEx(fd, ptr, n, sendBuf, sendDataLen, bytesSent, overlapped) +} + +// BOOL LpfnConnectex( +// [in] SOCKET s, +// [in] const sockaddr *name, +// [in] int namelen, +// [in, optional] PVOID lpSendBuffer, +// [in] DWORD dwSendDataLength, +// [out] LPDWORD lpdwBytesSent, +// [in] LPOVERLAPPED lpOverlapped +// ) + +func connectEx( + s windows.Handle, + name unsafe.Pointer, + namelen int32, + sendBuf *byte, + sendDataLen uint32, + bytesSent *uint32, + overlapped *windows.Overlapped, +) (err error) { + // todo: after upgrading to 1.18, switch from syscall.Syscall9 to syscall.SyscallN + r1, _, e1 := syscall.Syscall9(connectExFunc.addr, + 7, + uintptr(s), + uintptr(name), + uintptr(namelen), + uintptr(unsafe.Pointer(sendBuf)), + uintptr(sendDataLen), + uintptr(unsafe.Pointer(bytesSent)), + uintptr(unsafe.Pointer(overlapped)), + 0, + 0) + if r1 == 0 { + if e1 != 0 { + err = error(e1) + } else { + err = syscall.EINVAL + } + } + return err +} diff --git a/vendor/github.com/Microsoft/go-winio/internal/socket/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/internal/socket/zsyscall_windows.go new file mode 100644 index 000000000..6d2e1a9e4 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/socket/zsyscall_windows.go @@ -0,0 +1,72 @@ +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. + +package socket + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return errERROR_EINVAL + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modws2_32 = windows.NewLazySystemDLL("ws2_32.dll") + + procbind = modws2_32.NewProc("bind") + procgetpeername = modws2_32.NewProc("getpeername") + procgetsockname = modws2_32.NewProc("getsockname") +) + +func bind(s windows.Handle, name unsafe.Pointer, namelen int32) (err error) { + r1, _, e1 := syscall.Syscall(procbind.Addr(), 3, uintptr(s), uintptr(name), uintptr(namelen)) + if r1 == socketError { + err = errnoErr(e1) + } + return +} + +func getpeername(s windows.Handle, name unsafe.Pointer, namelen *int32) (err error) { + r1, _, e1 := syscall.Syscall(procgetpeername.Addr(), 3, uintptr(s), uintptr(name), uintptr(unsafe.Pointer(namelen))) + if r1 == socketError { + err = errnoErr(e1) + } + return +} + +func getsockname(s windows.Handle, name unsafe.Pointer, namelen *int32) (err error) { + r1, _, e1 := syscall.Syscall(procgetsockname.Addr(), 3, uintptr(s), uintptr(name), uintptr(unsafe.Pointer(namelen))) + if r1 == socketError { + err = errnoErr(e1) + } + return +} diff --git a/vendor/github.com/Microsoft/go-winio/internal/stringbuffer/wstring.go b/vendor/github.com/Microsoft/go-winio/internal/stringbuffer/wstring.go new file mode 100644 index 000000000..7ad505702 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/stringbuffer/wstring.go @@ -0,0 +1,132 @@ +package stringbuffer + +import ( + "sync" + "unicode/utf16" +) + +// TODO: worth exporting and using in mkwinsyscall? + +// Uint16BufferSize is the buffer size in the pool, chosen somewhat arbitrarily to accommodate +// large path strings: +// MAX_PATH (260) + size of volume GUID prefix (49) + null terminator = 310. +const MinWStringCap = 310 + +// use *[]uint16 since []uint16 creates an extra allocation where the slice header +// is copied to heap and then referenced via pointer in the interface header that sync.Pool +// stores. +var pathPool = sync.Pool{ // if go1.18+ adds Pool[T], use that to store []uint16 directly + New: func() interface{} { + b := make([]uint16, MinWStringCap) + return &b + }, +} + +func newBuffer() []uint16 { return *(pathPool.Get().(*[]uint16)) } + +// freeBuffer copies the slice header data, and puts a pointer to that in the pool. +// This avoids taking a pointer to the slice header in WString, which can be set to nil. +func freeBuffer(b []uint16) { pathPool.Put(&b) } + +// WString is a wide string buffer ([]uint16) meant for storing UTF-16 encoded strings +// for interacting with Win32 APIs. +// Sizes are specified as uint32 and not int. +// +// It is not thread safe. +type WString struct { + // type-def allows casting to []uint16 directly, use struct to prevent that and allow adding fields in the future. + + // raw buffer + b []uint16 +} + +// NewWString returns a [WString] allocated from a shared pool with an +// initial capacity of at least [MinWStringCap]. +// Since the buffer may have been previously used, its contents are not guaranteed to be empty. +// +// The buffer should be freed via [WString.Free] +func NewWString() *WString { + return &WString{ + b: newBuffer(), + } +} + +func (b *WString) Free() { + if b.empty() { + return + } + freeBuffer(b.b) + b.b = nil +} + +// ResizeTo grows the buffer to at least c and returns the new capacity, freeing the +// previous buffer back into pool. +func (b *WString) ResizeTo(c uint32) uint32 { + // allready sufficient (or n is 0) + if c <= b.Cap() { + return b.Cap() + } + + if c <= MinWStringCap { + c = MinWStringCap + } + // allocate at-least double buffer size, as is done in [bytes.Buffer] and other places + if c <= 2*b.Cap() { + c = 2 * b.Cap() + } + + b2 := make([]uint16, c) + if !b.empty() { + copy(b2, b.b) + freeBuffer(b.b) + } + b.b = b2 + return c +} + +// Buffer returns the underlying []uint16 buffer. +func (b *WString) Buffer() []uint16 { + if b.empty() { + return nil + } + return b.b +} + +// Pointer returns a pointer to the first uint16 in the buffer. +// If the [WString.Free] has already been called, the pointer will be nil. +func (b *WString) Pointer() *uint16 { + if b.empty() { + return nil + } + return &b.b[0] +} + +// String returns the returns the UTF-8 encoding of the UTF-16 string in the buffer. +// +// It assumes that the data is null-terminated. +func (b *WString) String() string { + // Using [windows.UTF16ToString] would require importing "golang.org/x/sys/windows" + // and would make this code Windows-only, which makes no sense. + // So copy UTF16ToString code into here. + // If other windows-specific code is added, switch to [windows.UTF16ToString] + + s := b.b + for i, v := range s { + if v == 0 { + s = s[:i] + break + } + } + return string(utf16.Decode(s)) +} + +// Cap returns the underlying buffer capacity. +func (b *WString) Cap() uint32 { + if b.empty() { + return 0 + } + return b.cap() +} + +func (b *WString) cap() uint32 { return uint32(cap(b.b)) } +func (b *WString) empty() bool { return b == nil || b.cap() == 0 } diff --git a/vendor/github.com/Microsoft/go-winio/pipe.go b/vendor/github.com/Microsoft/go-winio/pipe.go index 96700a73d..25cc81103 100644 --- a/vendor/github.com/Microsoft/go-winio/pipe.go +++ b/vendor/github.com/Microsoft/go-winio/pipe.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package winio @@ -13,18 +14,21 @@ import ( "syscall" "time" "unsafe" + + "golang.org/x/sys/windows" + + "github.com/Microsoft/go-winio/internal/fs" ) //sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe //sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW -//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW //sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo //sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW //sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc -//sys ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) = ntdll.NtCreateNamedPipeFile -//sys rtlNtStatusToDosError(status ntstatus) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb -//sys rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) = ntdll.RtlDosPathNameToNtPathName_U -//sys rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) = ntdll.RtlDefaultNpAcl +//sys ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntStatus) = ntdll.NtCreateNamedPipeFile +//sys rtlNtStatusToDosError(status ntStatus) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb +//sys rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntStatus) = ntdll.RtlDosPathNameToNtPathName_U +//sys rtlDefaultNpAcl(dacl *uintptr) (status ntStatus) = ntdll.RtlDefaultNpAcl type ioStatusBlock struct { Status, Information uintptr @@ -51,45 +55,22 @@ type securityDescriptor struct { Control uint16 Owner uintptr Group uintptr - Sacl uintptr - Dacl uintptr + Sacl uintptr //revive:disable-line:var-naming SACL, not Sacl + Dacl uintptr //revive:disable-line:var-naming DACL, not Dacl } -type ntstatus int32 +type ntStatus int32 -func (status ntstatus) Err() error { +func (status ntStatus) Err() error { if status >= 0 { return nil } return rtlNtStatusToDosError(status) } -const ( - cERROR_PIPE_BUSY = syscall.Errno(231) - cERROR_NO_DATA = syscall.Errno(232) - cERROR_PIPE_CONNECTED = syscall.Errno(535) - cERROR_SEM_TIMEOUT = syscall.Errno(121) - - cSECURITY_SQOS_PRESENT = 0x100000 - cSECURITY_ANONYMOUS = 0 - - cPIPE_TYPE_MESSAGE = 4 - - cPIPE_READMODE_MESSAGE = 2 - - cFILE_OPEN = 1 - cFILE_CREATE = 2 - - cFILE_PIPE_MESSAGE_TYPE = 1 - cFILE_PIPE_REJECT_REMOTE_CLIENTS = 2 - - cSE_DACL_PRESENT = 4 -) - var ( // ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed. - // This error should match net.errClosing since docker takes a dependency on its text. - ErrPipeListenerClosed = errors.New("use of closed network connection") + ErrPipeListenerClosed = net.ErrClosed errPipeWriteClosed = errors.New("pipe has been closed for write") ) @@ -116,9 +97,10 @@ func (f *win32Pipe) RemoteAddr() net.Addr { } func (f *win32Pipe) SetDeadline(t time.Time) error { - f.SetReadDeadline(t) - f.SetWriteDeadline(t) - return nil + if err := f.SetReadDeadline(t); err != nil { + return err + } + return f.SetWriteDeadline(t) } // CloseWrite closes the write side of a message pipe in byte mode. @@ -157,14 +139,14 @@ func (f *win32MessageBytePipe) Read(b []byte) (int, error) { return 0, io.EOF } n, err := f.win32File.Read(b) - if err == io.EOF { + if err == io.EOF { //nolint:errorlint // If this was the result of a zero-byte read, then // it is possible that the read was due to a zero-size // message. Since we are simulating CloseWrite with a // zero-byte message, ensure that all future Read() calls // also return EOF. f.readEOF = true - } else if err == syscall.ERROR_MORE_DATA { + } else if err == syscall.ERROR_MORE_DATA { //nolint:errorlint // err is Errno // ERROR_MORE_DATA indicates that the pipe's read mode is message mode // and the message still has more bytes. Treat this as a success, since // this package presents all named pipes as byte streams. @@ -173,7 +155,7 @@ func (f *win32MessageBytePipe) Read(b []byte) (int, error) { return n, err } -func (s pipeAddress) Network() string { +func (pipeAddress) Network() string { return "pipe" } @@ -182,18 +164,25 @@ func (s pipeAddress) String() string { } // tryDialPipe attempts to dial the pipe at `path` until `ctx` cancellation or timeout. -func tryDialPipe(ctx context.Context, path *string, access uint32) (syscall.Handle, error) { +func tryDialPipe(ctx context.Context, path *string, access fs.AccessMask) (syscall.Handle, error) { for { - select { case <-ctx.Done(): return syscall.Handle(0), ctx.Err() default: - h, err := createFile(*path, access, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) + wh, err := fs.CreateFile(*path, + access, + 0, // mode + nil, // security attributes + fs.OPEN_EXISTING, + fs.FILE_FLAG_OVERLAPPED|fs.SECURITY_SQOS_PRESENT|fs.SECURITY_ANONYMOUS, + 0, // template file handle + ) + h := syscall.Handle(wh) if err == nil { return h, nil } - if err != cERROR_PIPE_BUSY { + if err != windows.ERROR_PIPE_BUSY { //nolint:errorlint // err is Errno return h, &os.PathError{Err: err, Op: "open", Path: *path} } // Wait 10 msec and try again. This is a rather simplistic @@ -213,9 +202,10 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) { } else { absTimeout = time.Now().Add(2 * time.Second) } - ctx, _ := context.WithDeadline(context.Background(), absTimeout) + ctx, cancel := context.WithDeadline(context.Background(), absTimeout) + defer cancel() conn, err := DialPipeContext(ctx, path) - if err == context.DeadlineExceeded { + if errors.Is(err, context.DeadlineExceeded) { return nil, ErrTimeout } return conn, err @@ -232,7 +222,7 @@ func DialPipeContext(ctx context.Context, path string) (net.Conn, error) { func DialPipeAccess(ctx context.Context, path string, access uint32) (net.Conn, error) { var err error var h syscall.Handle - h, err = tryDialPipe(ctx, &path, access) + h, err = tryDialPipe(ctx, &path, fs.AccessMask(access)) if err != nil { return nil, err } @@ -251,7 +241,7 @@ func DialPipeAccess(ctx context.Context, path string, access uint32) (net.Conn, // If the pipe is in message mode, return a message byte pipe, which // supports CloseWrite(). - if flags&cPIPE_TYPE_MESSAGE != 0 { + if flags&windows.PIPE_TYPE_MESSAGE != 0 { return &win32MessageBytePipe{ win32Pipe: win32Pipe{win32File: f, path: path}, }, nil @@ -283,17 +273,22 @@ func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (sy oa.Length = unsafe.Sizeof(oa) var ntPath unicodeString - if err := rtlDosPathNameToNtPathName(&path16[0], &ntPath, 0, 0).Err(); err != nil { + if err := rtlDosPathNameToNtPathName(&path16[0], + &ntPath, + 0, + 0, + ).Err(); err != nil { return 0, &os.PathError{Op: "open", Path: path, Err: err} } defer localFree(ntPath.Buffer) oa.ObjectName = &ntPath + oa.Attributes = windows.OBJ_CASE_INSENSITIVE // The security descriptor is only needed for the first pipe. if first { if sd != nil { - len := uint32(len(sd)) - sdb := localAlloc(0, len) + l := uint32(len(sd)) + sdb := localAlloc(0, l) defer localFree(sdb) copy((*[0xffff]byte)(unsafe.Pointer(sdb))[:], sd) oa.SecurityDescriptor = (*securityDescriptor)(unsafe.Pointer(sdb)) @@ -301,28 +296,28 @@ func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (sy // Construct the default named pipe security descriptor. var dacl uintptr if err := rtlDefaultNpAcl(&dacl).Err(); err != nil { - return 0, fmt.Errorf("getting default named pipe ACL: %s", err) + return 0, fmt.Errorf("getting default named pipe ACL: %w", err) } defer localFree(dacl) sdb := &securityDescriptor{ Revision: 1, - Control: cSE_DACL_PRESENT, + Control: windows.SE_DACL_PRESENT, Dacl: dacl, } oa.SecurityDescriptor = sdb } } - typ := uint32(cFILE_PIPE_REJECT_REMOTE_CLIENTS) + typ := uint32(windows.FILE_PIPE_REJECT_REMOTE_CLIENTS) if c.MessageMode { - typ |= cFILE_PIPE_MESSAGE_TYPE + typ |= windows.FILE_PIPE_MESSAGE_TYPE } - disposition := uint32(cFILE_OPEN) + disposition := uint32(windows.FILE_OPEN) access := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | syscall.SYNCHRONIZE) if first { - disposition = cFILE_CREATE + disposition = windows.FILE_CREATE // By not asking for read or write access, the named pipe file system // will put this pipe into an initially disconnected state, blocking // client connections until the next call with first == false. @@ -335,7 +330,20 @@ func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (sy h syscall.Handle iosb ioStatusBlock ) - err = ntCreateNamedPipeFile(&h, access, &oa, &iosb, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE, disposition, 0, typ, 0, 0, 0xffffffff, uint32(c.InputBufferSize), uint32(c.OutputBufferSize), &timeout).Err() + err = ntCreateNamedPipeFile(&h, + access, + &oa, + &iosb, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE, + disposition, + 0, + typ, + 0, + 0, + 0xffffffff, + uint32(c.InputBufferSize), + uint32(c.OutputBufferSize), + &timeout).Err() if err != nil { return 0, &os.PathError{Op: "open", Path: path, Err: err} } @@ -380,7 +388,7 @@ func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) { p.Close() p = nil err = <-ch - if err == nil || err == ErrFileClosed { + if err == nil || err == ErrFileClosed { //nolint:errorlint // err is Errno err = ErrPipeListenerClosed } } @@ -402,12 +410,12 @@ func (l *win32PipeListener) listenerRoutine() { p, err = l.makeConnectedServerPipe() // If the connection was immediately closed by the client, try // again. - if err != cERROR_NO_DATA { + if err != windows.ERROR_NO_DATA { //nolint:errorlint // err is Errno break } } responseCh <- acceptResponse{p, err} - closed = err == ErrPipeListenerClosed + closed = err == ErrPipeListenerClosed //nolint:errorlint // err is Errno } } syscall.Close(l.firstHandle) @@ -469,15 +477,15 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) { } func connectPipe(p *win32File) error { - c, err := p.prepareIo() + c, err := p.prepareIO() if err != nil { return err } defer p.wg.Done() err = connectNamedPipe(p.handle, &c.o) - _, err = p.asyncIo(c, nil, 0, err) - if err != nil && err != cERROR_PIPE_CONNECTED { + _, err = p.asyncIO(c, nil, 0, err) + if err != nil && err != windows.ERROR_PIPE_CONNECTED { //nolint:errorlint // err is Errno return err } return nil diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go index f497c0e39..48ce4e924 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go @@ -1,5 +1,3 @@ -// +build windows - // Package guid provides a GUID type. The backing structure for a GUID is // identical to that used by the golang.org/x/sys/windows GUID type. // There are two main binary encodings used for a GUID, the big-endian encoding, @@ -9,26 +7,26 @@ package guid import ( "crypto/rand" - "crypto/sha1" + "crypto/sha1" //nolint:gosec // not used for secure application "encoding" "encoding/binary" "fmt" "strconv" - - "golang.org/x/sys/windows" ) +//go:generate go run golang.org/x/tools/cmd/stringer -type=Variant -trimprefix=Variant -linecomment + // Variant specifies which GUID variant (or "type") of the GUID. It determines // how the entirety of the rest of the GUID is interpreted. type Variant uint8 -// The variants specified by RFC 4122. +// The variants specified by RFC 4122 section 4.1.1. const ( // VariantUnknown specifies a GUID variant which does not conform to one of // the variant encodings specified in RFC 4122. VariantUnknown Variant = iota VariantNCS - VariantRFC4122 + VariantRFC4122 // RFC 4122 VariantMicrosoft VariantFuture ) @@ -38,16 +36,13 @@ const ( // hash of an input string. type Version uint8 +func (v Version) String() string { + return strconv.FormatUint(uint64(v), 10) +} + var _ = (encoding.TextMarshaler)(GUID{}) var _ = (encoding.TextUnmarshaler)(&GUID{}) -// GUID represents a GUID/UUID. It has the same structure as -// golang.org/x/sys/windows.GUID so that it can be used with functions expecting -// that type. It is defined as its own type so that stringification and -// marshaling can be supported. The representation matches that used by native -// Windows code. -type GUID windows.GUID - // NewV4 returns a new version 4 (pseudorandom) GUID, as defined by RFC 4122. func NewV4() (GUID, error) { var b [16]byte @@ -70,7 +65,7 @@ func NewV4() (GUID, error) { // big-endian UTF16 stream of bytes. If that is desired, the string can be // encoded as such before being passed to this function. func NewV5(namespace GUID, name []byte) (GUID, error) { - b := sha1.New() + b := sha1.New() //nolint:gosec // not used for secure application namespaceBytes := namespace.ToArray() b.Write(namespaceBytes[:]) b.Write(name) diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_nonwindows.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_nonwindows.go new file mode 100644 index 000000000..805bd3548 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_nonwindows.go @@ -0,0 +1,16 @@ +//go:build !windows +// +build !windows + +package guid + +// GUID represents a GUID/UUID. It has the same structure as +// golang.org/x/sys/windows.GUID so that it can be used with functions expecting +// that type. It is defined as its own type as that is only available to builds +// targeted at `windows`. The representation matches that used by native Windows +// code. +type GUID struct { + Data1 uint32 + Data2 uint16 + Data3 uint16 + Data4 [8]byte +} diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_windows.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_windows.go new file mode 100644 index 000000000..27e45ee5c --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_windows.go @@ -0,0 +1,13 @@ +//go:build windows +// +build windows + +package guid + +import "golang.org/x/sys/windows" + +// GUID represents a GUID/UUID. It has the same structure as +// golang.org/x/sys/windows.GUID so that it can be used with functions expecting +// that type. It is defined as its own type so that stringification and +// marshaling can be supported. The representation matches that used by native +// Windows code. +type GUID windows.GUID diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/variant_string.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/variant_string.go new file mode 100644 index 000000000..4076d3132 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/variant_string.go @@ -0,0 +1,27 @@ +// Code generated by "stringer -type=Variant -trimprefix=Variant -linecomment"; DO NOT EDIT. + +package guid + +import "strconv" + +func _() { + // An "invalid array index" compiler error signifies that the constant values have changed. + // Re-run the stringer command to generate them again. + var x [1]struct{} + _ = x[VariantUnknown-0] + _ = x[VariantNCS-1] + _ = x[VariantRFC4122-2] + _ = x[VariantMicrosoft-3] + _ = x[VariantFuture-4] +} + +const _Variant_name = "UnknownNCSRFC 4122MicrosoftFuture" + +var _Variant_index = [...]uint8{0, 7, 10, 18, 27, 33} + +func (i Variant) String() string { + if i >= Variant(len(_Variant_index)-1) { + return "Variant(" + strconv.FormatInt(int64(i), 10) + ")" + } + return _Variant_name[_Variant_index[i]:_Variant_index[i+1]] +} diff --git a/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go b/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go deleted file mode 100644 index c40c2739b..000000000 --- a/vendor/github.com/Microsoft/go-winio/pkg/security/syscall_windows.go +++ /dev/null @@ -1,7 +0,0 @@ -package security - -//go:generate go run mksyscall_windows.go -output zsyscall_windows.go syscall_windows.go - -//sys getSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, ppsidOwner **uintptr, ppsidGroup **uintptr, ppDacl *uintptr, ppSacl *uintptr, ppSecurityDescriptor *uintptr) (err error) [failretval!=0] = advapi32.GetSecurityInfo -//sys setSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, psidOwner uintptr, psidGroup uintptr, pDacl uintptr, pSacl uintptr) (err error) [failretval!=0] = advapi32.SetSecurityInfo -//sys setEntriesInAcl(count uintptr, pListOfEEs uintptr, oldAcl uintptr, newAcl *uintptr) (err error) [failretval!=0] = advapi32.SetEntriesInAclW diff --git a/vendor/github.com/Microsoft/go-winio/privilege.go b/vendor/github.com/Microsoft/go-winio/privilege.go index 9c83d36fe..0ff9dac90 100644 --- a/vendor/github.com/Microsoft/go-winio/privilege.go +++ b/vendor/github.com/Microsoft/go-winio/privilege.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package winio @@ -24,19 +25,15 @@ import ( //sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW const ( - SE_PRIVILEGE_ENABLED = 2 + //revive:disable-next-line:var-naming ALL_CAPS + SE_PRIVILEGE_ENABLED = windows.SE_PRIVILEGE_ENABLED - ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300 + //revive:disable-next-line:var-naming ALL_CAPS + ERROR_NOT_ALL_ASSIGNED syscall.Errno = windows.ERROR_NOT_ALL_ASSIGNED - SeBackupPrivilege = "SeBackupPrivilege" - SeRestorePrivilege = "SeRestorePrivilege" -) - -const ( - securityAnonymous = iota - securityIdentification - securityImpersonation - securityDelegation + SeBackupPrivilege = "SeBackupPrivilege" + SeRestorePrivilege = "SeRestorePrivilege" + SeSecurityPrivilege = "SeSecurityPrivilege" ) var ( @@ -50,11 +47,9 @@ type PrivilegeError struct { } func (e *PrivilegeError) Error() string { - s := "" + s := "Could not enable privilege " if len(e.privileges) > 1 { s = "Could not enable privileges " - } else { - s = "Could not enable privilege " } for i, p := range e.privileges { if i != 0 { @@ -93,7 +88,7 @@ func RunWithPrivileges(names []string, fn func() error) error { } func mapPrivileges(names []string) ([]uint64, error) { - var privileges []uint64 + privileges := make([]uint64, 0, len(names)) privNameMutex.Lock() defer privNameMutex.Unlock() for _, name := range names { @@ -126,7 +121,7 @@ func enableDisableProcessPrivilege(names []string, action uint32) error { return err } - p, _ := windows.GetCurrentProcess() + p := windows.CurrentProcess() var token windows.Token err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token) if err != nil { @@ -139,10 +134,10 @@ func enableDisableProcessPrivilege(names []string, action uint32) error { func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error { var b bytes.Buffer - binary.Write(&b, binary.LittleEndian, uint32(len(privileges))) + _ = binary.Write(&b, binary.LittleEndian, uint32(len(privileges))) for _, p := range privileges { - binary.Write(&b, binary.LittleEndian, p) - binary.Write(&b, binary.LittleEndian, action) + _ = binary.Write(&b, binary.LittleEndian, p) + _ = binary.Write(&b, binary.LittleEndian, action) } prevState := make([]byte, b.Len()) reqSize := uint32(0) @@ -150,7 +145,7 @@ func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) e if !success { return err } - if err == ERROR_NOT_ALL_ASSIGNED { + if err == ERROR_NOT_ALL_ASSIGNED { //nolint:errorlint // err is Errno return &PrivilegeError{privileges} } return nil @@ -176,7 +171,7 @@ func getPrivilegeName(luid uint64) string { } func newThreadToken() (windows.Token, error) { - err := impersonateSelf(securityImpersonation) + err := impersonateSelf(windows.SecurityImpersonation) if err != nil { return 0, err } diff --git a/vendor/github.com/Microsoft/go-winio/reparse.go b/vendor/github.com/Microsoft/go-winio/reparse.go index fc1ee4d3a..67d1a104a 100644 --- a/vendor/github.com/Microsoft/go-winio/reparse.go +++ b/vendor/github.com/Microsoft/go-winio/reparse.go @@ -1,3 +1,6 @@ +//go:build windows +// +build windows + package winio import ( @@ -113,16 +116,16 @@ func EncodeReparsePoint(rp *ReparsePoint) []byte { } var b bytes.Buffer - binary.Write(&b, binary.LittleEndian, &data) + _ = binary.Write(&b, binary.LittleEndian, &data) if !rp.IsMountPoint { flags := uint32(0) if relative { flags |= 1 } - binary.Write(&b, binary.LittleEndian, flags) + _ = binary.Write(&b, binary.LittleEndian, flags) } - binary.Write(&b, binary.LittleEndian, ntTarget16) - binary.Write(&b, binary.LittleEndian, target16) + _ = binary.Write(&b, binary.LittleEndian, ntTarget16) + _ = binary.Write(&b, binary.LittleEndian, target16) return b.Bytes() } diff --git a/vendor/github.com/Microsoft/go-winio/sd.go b/vendor/github.com/Microsoft/go-winio/sd.go index db1b370a1..5550ef6b6 100644 --- a/vendor/github.com/Microsoft/go-winio/sd.go +++ b/vendor/github.com/Microsoft/go-winio/sd.go @@ -1,23 +1,25 @@ +//go:build windows // +build windows package winio import ( + "errors" "syscall" "unsafe" + + "golang.org/x/sys/windows" ) //sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW +//sys lookupAccountSid(systemName *uint16, sid *byte, name *uint16, nameSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountSidW //sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW +//sys convertStringSidToSid(str *uint16, sid **byte) (err error) = advapi32.ConvertStringSidToSidW //sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW //sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW //sys localFree(mem uintptr) = LocalFree //sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength -const ( - cERROR_NONE_MAPPED = syscall.Errno(1332) -) - type AccountLookupError struct { Name string Err error @@ -28,8 +30,10 @@ func (e *AccountLookupError) Error() string { return "lookup account: empty account name specified" } var s string - switch e.Err { - case cERROR_NONE_MAPPED: + switch { + case errors.Is(e.Err, windows.ERROR_INVALID_SID): + s = "the security ID structure is invalid" + case errors.Is(e.Err, windows.ERROR_NONE_MAPPED): s = "not found" default: s = e.Err.Error() @@ -37,6 +41,8 @@ func (e *AccountLookupError) Error() string { return "lookup account " + e.Name + ": " + s } +func (e *AccountLookupError) Unwrap() error { return e.Err } + type SddlConversionError struct { Sddl string Err error @@ -46,15 +52,19 @@ func (e *SddlConversionError) Error() string { return "convert " + e.Sddl + ": " + e.Err.Error() } +func (e *SddlConversionError) Unwrap() error { return e.Err } + // LookupSidByName looks up the SID of an account by name +// +//revive:disable-next-line:var-naming SID, not Sid func LookupSidByName(name string) (sid string, err error) { if name == "" { - return "", &AccountLookupError{name, cERROR_NONE_MAPPED} + return "", &AccountLookupError{name, windows.ERROR_NONE_MAPPED} } var sidSize, sidNameUse, refDomainSize uint32 err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse) - if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER { + if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER { //nolint:errorlint // err is Errno return "", &AccountLookupError{name, err} } sidBuffer := make([]byte, sidSize) @@ -73,6 +83,42 @@ func LookupSidByName(name string) (sid string, err error) { return sid, nil } +// LookupNameBySid looks up the name of an account by SID +// +//revive:disable-next-line:var-naming SID, not Sid +func LookupNameBySid(sid string) (name string, err error) { + if sid == "" { + return "", &AccountLookupError{sid, windows.ERROR_NONE_MAPPED} + } + + sidBuffer, err := windows.UTF16PtrFromString(sid) + if err != nil { + return "", &AccountLookupError{sid, err} + } + + var sidPtr *byte + if err = convertStringSidToSid(sidBuffer, &sidPtr); err != nil { + return "", &AccountLookupError{sid, err} + } + defer localFree(uintptr(unsafe.Pointer(sidPtr))) + + var nameSize, refDomainSize, sidNameUse uint32 + err = lookupAccountSid(nil, sidPtr, nil, &nameSize, nil, &refDomainSize, &sidNameUse) + if err != nil && err != windows.ERROR_INSUFFICIENT_BUFFER { //nolint:errorlint // err is Errno + return "", &AccountLookupError{sid, err} + } + + nameBuffer := make([]uint16, nameSize) + refDomainBuffer := make([]uint16, refDomainSize) + err = lookupAccountSid(nil, sidPtr, &nameBuffer[0], &nameSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse) + if err != nil { + return "", &AccountLookupError{sid, err} + } + + name = windows.UTF16ToString(nameBuffer) + return name, nil +} + func SddlToSecurityDescriptor(sddl string) ([]byte, error) { var sdBuffer uintptr err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil) @@ -87,7 +133,7 @@ func SddlToSecurityDescriptor(sddl string) ([]byte, error) { func SecurityDescriptorToSddl(sd []byte) (string, error) { var sddl *uint16 - // The returned string length seems to including an aribtrary number of terminating NULs. + // The returned string length seems to include an arbitrary number of terminating NULs. // Don't use it. err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil) if err != nil { diff --git a/vendor/github.com/Microsoft/go-winio/syscall.go b/vendor/github.com/Microsoft/go-winio/syscall.go index 5955c99fd..a6ca111b3 100644 --- a/vendor/github.com/Microsoft/go-winio/syscall.go +++ b/vendor/github.com/Microsoft/go-winio/syscall.go @@ -1,3 +1,5 @@ +//go:build windows + package winio -//go:generate go run golang.org/x/sys/windows/mkwinsyscall -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go hvsock.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go ./*.go diff --git a/vendor/github.com/Microsoft/go-winio/tools.go b/vendor/github.com/Microsoft/go-winio/tools.go new file mode 100644 index 000000000..2aa045843 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/tools.go @@ -0,0 +1,5 @@ +//go:build tools + +package winio + +import _ "golang.org/x/tools/cmd/stringer" diff --git a/vendor/github.com/Microsoft/go-winio/vhd/vhd.go b/vendor/github.com/Microsoft/go-winio/vhd/vhd.go index b03b789e6..b54cad112 100644 --- a/vendor/github.com/Microsoft/go-winio/vhd/vhd.go +++ b/vendor/github.com/Microsoft/go-winio/vhd/vhd.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package vhd @@ -7,17 +8,16 @@ import ( "syscall" "github.com/Microsoft/go-winio/pkg/guid" - "github.com/pkg/errors" "golang.org/x/sys/windows" ) -//go:generate go run mksyscall_windows.go -output zvhd_windows.go vhd.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zvhd_windows.go vhd.go -//sys createVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.CreateVirtualDisk -//sys openVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *OpenVirtualDiskParameters, handle *syscall.Handle) (err error) [failretval != 0] = virtdisk.OpenVirtualDisk -//sys attachVirtualDisk(handle syscall.Handle, securityDescriptor *uintptr, attachVirtualDiskFlag uint32, providerSpecificFlags uint32, parameters *AttachVirtualDiskParameters, overlapped *syscall.Overlapped) (err error) [failretval != 0] = virtdisk.AttachVirtualDisk -//sys detachVirtualDisk(handle syscall.Handle, detachVirtualDiskFlags uint32, providerSpecificFlags uint32) (err error) [failretval != 0] = virtdisk.DetachVirtualDisk -//sys getVirtualDiskPhysicalPath(handle syscall.Handle, diskPathSizeInBytes *uint32, buffer *uint16) (err error) [failretval != 0] = virtdisk.GetVirtualDiskPhysicalPath +//sys createVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (win32err error) = virtdisk.CreateVirtualDisk +//sys openVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (win32err error) = virtdisk.OpenVirtualDisk +//sys attachVirtualDisk(handle syscall.Handle, securityDescriptor *uintptr, attachVirtualDiskFlag uint32, providerSpecificFlags uint32, parameters *AttachVirtualDiskParameters, overlapped *syscall.Overlapped) (win32err error) = virtdisk.AttachVirtualDisk +//sys detachVirtualDisk(handle syscall.Handle, detachVirtualDiskFlags uint32, providerSpecificFlags uint32) (win32err error) = virtdisk.DetachVirtualDisk +//sys getVirtualDiskPhysicalPath(handle syscall.Handle, diskPathSizeInBytes *uint32, buffer *uint16) (win32err error) = virtdisk.GetVirtualDiskPhysicalPath type ( CreateVirtualDiskFlag uint32 @@ -62,20 +62,35 @@ type OpenVirtualDiskParameters struct { Version2 OpenVersion2 } +// The higher level `OpenVersion2` struct uses `bool`s to refer to `GetInfoOnly` and `ReadOnly` for ease of use. However, +// the internal windows structure uses `BOOL`s aka int32s for these types. `openVersion2` is used for translating +// `OpenVersion2` fields to the correct windows internal field types on the `Open____` methods. +type openVersion2 struct { + getInfoOnly int32 + readOnly int32 + resiliencyGUID guid.GUID +} + +type openVirtualDiskParameters struct { + version uint32 + version2 openVersion2 +} + type AttachVersion2 struct { RestrictedOffset uint64 RestrictedLength uint64 } type AttachVirtualDiskParameters struct { - Version uint32 // Must always be set to 2 + Version uint32 Version2 AttachVersion2 } const ( + //revive:disable-next-line:var-naming ALL_CAPS VIRTUAL_STORAGE_TYPE_DEVICE_VHDX = 0x3 - // Access Mask for opening a VHD + // Access Mask for opening a VHD. VirtualDiskAccessNone VirtualDiskAccessMask = 0x00000000 VirtualDiskAccessAttachRO VirtualDiskAccessMask = 0x00010000 VirtualDiskAccessAttachRW VirtualDiskAccessMask = 0x00020000 @@ -87,7 +102,7 @@ const ( VirtualDiskAccessAll VirtualDiskAccessMask = 0x003f0000 VirtualDiskAccessWritable VirtualDiskAccessMask = 0x00320000 - // Flags for creating a VHD + // Flags for creating a VHD. CreateVirtualDiskFlagNone CreateVirtualDiskFlag = 0x0 CreateVirtualDiskFlagFullPhysicalAllocation CreateVirtualDiskFlag = 0x1 CreateVirtualDiskFlagPreventWritesToSourceDisk CreateVirtualDiskFlag = 0x2 @@ -95,12 +110,12 @@ const ( CreateVirtualDiskFlagCreateBackingStorage CreateVirtualDiskFlag = 0x8 CreateVirtualDiskFlagUseChangeTrackingSourceLimit CreateVirtualDiskFlag = 0x10 CreateVirtualDiskFlagPreserveParentChangeTrackingState CreateVirtualDiskFlag = 0x20 - CreateVirtualDiskFlagVhdSetUseOriginalBackingStorage CreateVirtualDiskFlag = 0x40 + CreateVirtualDiskFlagVhdSetUseOriginalBackingStorage CreateVirtualDiskFlag = 0x40 //revive:disable-line:var-naming VHD, not Vhd CreateVirtualDiskFlagSparseFile CreateVirtualDiskFlag = 0x80 - CreateVirtualDiskFlagPmemCompatible CreateVirtualDiskFlag = 0x100 + CreateVirtualDiskFlagPmemCompatible CreateVirtualDiskFlag = 0x100 //revive:disable-line:var-naming PMEM, not Pmem CreateVirtualDiskFlagSupportCompressedVolumes CreateVirtualDiskFlag = 0x200 - // Flags for opening a VHD + // Flags for opening a VHD. OpenVirtualDiskFlagNone VirtualDiskFlag = 0x00000000 OpenVirtualDiskFlagNoParents VirtualDiskFlag = 0x00000001 OpenVirtualDiskFlagBlankFile VirtualDiskFlag = 0x00000002 @@ -113,7 +128,7 @@ const ( OpenVirtualDiskFlagNoWriteHardening VirtualDiskFlag = 0x00000100 OpenVirtualDiskFlagSupportCompressedVolumes VirtualDiskFlag = 0x00000200 - // Flags for attaching a VHD + // Flags for attaching a VHD. AttachVirtualDiskFlagNone AttachVirtualDiskFlag = 0x00000000 AttachVirtualDiskFlagReadOnly AttachVirtualDiskFlag = 0x00000001 AttachVirtualDiskFlagNoDriveLetter AttachVirtualDiskFlag = 0x00000002 @@ -126,12 +141,14 @@ const ( AttachVirtualDiskFlagSinglePartition AttachVirtualDiskFlag = 0x00000100 AttachVirtualDiskFlagRegisterVolume AttachVirtualDiskFlag = 0x00000200 - // Flags for detaching a VHD + // Flags for detaching a VHD. DetachVirtualDiskFlagNone DetachVirtualDiskFlag = 0x0 ) // CreateVhdx is a helper function to create a simple vhdx file at the given path using // default values. +// +//revive:disable-next-line:var-naming VHDX, not Vhdx func CreateVhdx(path string, maxSizeInGb, blockSizeInMb uint32) error { params := CreateVirtualDiskParameters{ Version: 2, @@ -146,21 +163,20 @@ func CreateVhdx(path string, maxSizeInGb, blockSizeInMb uint32) error { return err } - if err := syscall.CloseHandle(handle); err != nil { - return err - } - return nil + return syscall.CloseHandle(handle) } // DetachVirtualDisk detaches a virtual hard disk by handle. func DetachVirtualDisk(handle syscall.Handle) (err error) { if err := detachVirtualDisk(handle, 0, 0); err != nil { - return errors.Wrap(err, "failed to detach virtual disk") + return fmt.Errorf("failed to detach virtual disk: %w", err) } return nil } // DetachVhd detaches a vhd found at `path`. +// +//revive:disable-next-line:var-naming VHD, not Vhd func DetachVhd(path string) error { handle, err := OpenVirtualDisk( path, @@ -170,12 +186,16 @@ func DetachVhd(path string) error { if err != nil { return err } - defer syscall.CloseHandle(handle) + defer syscall.CloseHandle(handle) //nolint:errcheck return DetachVirtualDisk(handle) } // AttachVirtualDisk attaches a virtual hard disk for use. -func AttachVirtualDisk(handle syscall.Handle, attachVirtualDiskFlag AttachVirtualDiskFlag, parameters *AttachVirtualDiskParameters) (err error) { +func AttachVirtualDisk( + handle syscall.Handle, + attachVirtualDiskFlag AttachVirtualDiskFlag, + parameters *AttachVirtualDiskParameters, +) (err error) { // Supports both version 1 and 2 of the attach parameters as version 2 wasn't present in RS5. if err := attachVirtualDisk( handle, @@ -185,13 +205,15 @@ func AttachVirtualDisk(handle syscall.Handle, attachVirtualDiskFlag AttachVirtua parameters, nil, ); err != nil { - return errors.Wrap(err, "failed to attach virtual disk") + return fmt.Errorf("failed to attach virtual disk: %w", err) } return nil } // AttachVhd attaches a virtual hard disk at `path` for use. Attaches using version 2 // of the ATTACH_VIRTUAL_DISK_PARAMETERS. +// +//revive:disable-next-line:var-naming VHD, not Vhd func AttachVhd(path string) (err error) { handle, err := OpenVirtualDisk( path, @@ -202,20 +224,24 @@ func AttachVhd(path string) (err error) { return err } - defer syscall.CloseHandle(handle) + defer syscall.CloseHandle(handle) //nolint:errcheck params := AttachVirtualDiskParameters{Version: 2} if err := AttachVirtualDisk( handle, AttachVirtualDiskFlagNone, ¶ms, ); err != nil { - return errors.Wrap(err, "failed to attach virtual disk") + return fmt.Errorf("failed to attach virtual disk: %w", err) } return nil } // OpenVirtualDisk obtains a handle to a VHD opened with supplied access mask and flags. -func OpenVirtualDisk(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask, openVirtualDiskFlags VirtualDiskFlag) (syscall.Handle, error) { +func OpenVirtualDisk( + vhdPath string, + virtualDiskAccessMask VirtualDiskAccessMask, + openVirtualDiskFlags VirtualDiskFlag, +) (syscall.Handle, error) { parameters := OpenVirtualDiskParameters{Version: 2} handle, err := OpenVirtualDiskWithParameters( vhdPath, @@ -230,29 +256,55 @@ func OpenVirtualDisk(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask } // OpenVirtualDiskWithParameters obtains a handle to a VHD opened with supplied access mask, flags and parameters. -func OpenVirtualDiskWithParameters(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask, openVirtualDiskFlags VirtualDiskFlag, parameters *OpenVirtualDiskParameters) (syscall.Handle, error) { +func OpenVirtualDiskWithParameters( + vhdPath string, + virtualDiskAccessMask VirtualDiskAccessMask, + openVirtualDiskFlags VirtualDiskFlag, + parameters *OpenVirtualDiskParameters, +) (syscall.Handle, error) { var ( handle syscall.Handle defaultType VirtualStorageType + getInfoOnly int32 + readOnly int32 ) if parameters.Version != 2 { return handle, fmt.Errorf("only version 2 VHDs are supported, found version: %d", parameters.Version) } + if parameters.Version2.GetInfoOnly { + getInfoOnly = 1 + } + if parameters.Version2.ReadOnly { + readOnly = 1 + } + params := &openVirtualDiskParameters{ + version: parameters.Version, + version2: openVersion2{ + getInfoOnly, + readOnly, + parameters.Version2.ResiliencyGUID, + }, + } if err := openVirtualDisk( &defaultType, vhdPath, uint32(virtualDiskAccessMask), uint32(openVirtualDiskFlags), - parameters, + params, &handle, ); err != nil { - return 0, errors.Wrap(err, "failed to open virtual disk") + return 0, fmt.Errorf("failed to open virtual disk: %w", err) } return handle, nil } // CreateVirtualDisk creates a virtual harddisk and returns a handle to the disk. -func CreateVirtualDisk(path string, virtualDiskAccessMask VirtualDiskAccessMask, createVirtualDiskFlags CreateVirtualDiskFlag, parameters *CreateVirtualDiskParameters) (syscall.Handle, error) { +func CreateVirtualDisk( + path string, + virtualDiskAccessMask VirtualDiskAccessMask, + createVirtualDiskFlags CreateVirtualDiskFlag, + parameters *CreateVirtualDiskParameters, +) (syscall.Handle, error) { var ( handle syscall.Handle defaultType VirtualStorageType @@ -272,7 +324,7 @@ func CreateVirtualDisk(path string, virtualDiskAccessMask VirtualDiskAccessMask, nil, &handle, ); err != nil { - return handle, errors.Wrap(err, "failed to create virtual disk") + return handle, fmt.Errorf("failed to create virtual disk: %w", err) } return handle, nil } @@ -290,12 +342,14 @@ func GetVirtualDiskPhysicalPath(handle syscall.Handle) (_ string, err error) { &diskPathSizeInBytes, &diskPhysicalPathBuf[0], ); err != nil { - return "", errors.Wrap(err, "failed to get disk physical path") + return "", fmt.Errorf("failed to get disk physical path: %w", err) } return windows.UTF16ToString(diskPhysicalPathBuf[:]), nil } // CreateDiffVhd is a helper function to create a differencing virtual disk. +// +//revive:disable-next-line:var-naming VHD, not Vhd func CreateDiffVhd(diffVhdPath, baseVhdPath string, blockSizeInMB uint32) error { // Setting `ParentPath` is how to signal to create a differencing disk. createParams := &CreateVirtualDiskParameters{ @@ -314,10 +368,10 @@ func CreateDiffVhd(diffVhdPath, baseVhdPath string, blockSizeInMB uint32) error createParams, ) if err != nil { - return fmt.Errorf("failed to create differencing vhd: %s", err) + return fmt.Errorf("failed to create differencing vhd: %w", err) } if err := syscall.CloseHandle(vhdHandle); err != nil { - return fmt.Errorf("failed to close differencing vhd handle: %s", err) + return fmt.Errorf("failed to close differencing vhd handle: %w", err) } return nil } diff --git a/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go b/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go index 572f7b42f..d0e917d2b 100644 --- a/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go +++ b/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go @@ -1,4 +1,6 @@ -// Code generated by 'go generate'; DO NOT EDIT. +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package vhd @@ -47,60 +49,60 @@ var ( procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") ) -func attachVirtualDisk(handle syscall.Handle, securityDescriptor *uintptr, attachVirtualDiskFlag uint32, providerSpecificFlags uint32, parameters *AttachVirtualDiskParameters, overlapped *syscall.Overlapped) (err error) { - r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(attachVirtualDiskFlag), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(overlapped))) - if r1 != 0 { - err = errnoErr(e1) +func attachVirtualDisk(handle syscall.Handle, securityDescriptor *uintptr, attachVirtualDiskFlag uint32, providerSpecificFlags uint32, parameters *AttachVirtualDiskParameters, overlapped *syscall.Overlapped) (win32err error) { + r0, _, _ := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(attachVirtualDiskFlag), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(overlapped))) + if r0 != 0 { + win32err = syscall.Errno(r0) } return } -func createVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (err error) { +func createVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (win32err error) { var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(path) - if err != nil { + _p0, win32err = syscall.UTF16PtrFromString(path) + if win32err != nil { return } return _createVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, securityDescriptor, createVirtualDiskFlags, providerSpecificFlags, parameters, overlapped, handle) } -func _createVirtualDisk(virtualStorageType *VirtualStorageType, path *uint16, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (err error) { - r1, _, e1 := syscall.Syscall9(procCreateVirtualDisk.Addr(), 9, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(createVirtualDiskFlags), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(overlapped)), uintptr(unsafe.Pointer(handle))) - if r1 != 0 { - err = errnoErr(e1) +func _createVirtualDisk(virtualStorageType *VirtualStorageType, path *uint16, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (win32err error) { + r0, _, _ := syscall.Syscall9(procCreateVirtualDisk.Addr(), 9, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(unsafe.Pointer(securityDescriptor)), uintptr(createVirtualDiskFlags), uintptr(providerSpecificFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(overlapped)), uintptr(unsafe.Pointer(handle))) + if r0 != 0 { + win32err = syscall.Errno(r0) } return } -func detachVirtualDisk(handle syscall.Handle, detachVirtualDiskFlags uint32, providerSpecificFlags uint32) (err error) { - r1, _, e1 := syscall.Syscall(procDetachVirtualDisk.Addr(), 3, uintptr(handle), uintptr(detachVirtualDiskFlags), uintptr(providerSpecificFlags)) - if r1 != 0 { - err = errnoErr(e1) +func detachVirtualDisk(handle syscall.Handle, detachVirtualDiskFlags uint32, providerSpecificFlags uint32) (win32err error) { + r0, _, _ := syscall.Syscall(procDetachVirtualDisk.Addr(), 3, uintptr(handle), uintptr(detachVirtualDiskFlags), uintptr(providerSpecificFlags)) + if r0 != 0 { + win32err = syscall.Errno(r0) } return } -func getVirtualDiskPhysicalPath(handle syscall.Handle, diskPathSizeInBytes *uint32, buffer *uint16) (err error) { - r1, _, e1 := syscall.Syscall(procGetVirtualDiskPhysicalPath.Addr(), 3, uintptr(handle), uintptr(unsafe.Pointer(diskPathSizeInBytes)), uintptr(unsafe.Pointer(buffer))) - if r1 != 0 { - err = errnoErr(e1) +func getVirtualDiskPhysicalPath(handle syscall.Handle, diskPathSizeInBytes *uint32, buffer *uint16) (win32err error) { + r0, _, _ := syscall.Syscall(procGetVirtualDiskPhysicalPath.Addr(), 3, uintptr(handle), uintptr(unsafe.Pointer(diskPathSizeInBytes)), uintptr(unsafe.Pointer(buffer))) + if r0 != 0 { + win32err = syscall.Errno(r0) } return } -func openVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *OpenVirtualDiskParameters, handle *syscall.Handle) (err error) { +func openVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (win32err error) { var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(path) - if err != nil { + _p0, win32err = syscall.UTF16PtrFromString(path) + if win32err != nil { return } return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, openVirtualDiskFlags, parameters, handle) } -func _openVirtualDisk(virtualStorageType *VirtualStorageType, path *uint16, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *OpenVirtualDiskParameters, handle *syscall.Handle) (err error) { - r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(openVirtualDiskFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) - if r1 != 0 { - err = errnoErr(e1) +func _openVirtualDisk(virtualStorageType *VirtualStorageType, path *uint16, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (win32err error) { + r0, _, _ := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(openVirtualDiskFlags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r0 != 0 { + win32err = syscall.Errno(r0) } return } diff --git a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go index 176ff75e3..469b16f63 100644 --- a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated by 'go generate'; DO NOT EDIT. +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package winio @@ -47,9 +49,11 @@ var ( procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW") procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW") procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW") + procConvertStringSidToSidW = modadvapi32.NewProc("ConvertStringSidToSidW") procGetSecurityDescriptorLength = modadvapi32.NewProc("GetSecurityDescriptorLength") procImpersonateSelf = modadvapi32.NewProc("ImpersonateSelf") procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW") + procLookupAccountSidW = modadvapi32.NewProc("LookupAccountSidW") procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW") procLookupPrivilegeNameW = modadvapi32.NewProc("LookupPrivilegeNameW") procLookupPrivilegeValueW = modadvapi32.NewProc("LookupPrivilegeValueW") @@ -59,7 +63,6 @@ var ( procBackupWrite = modkernel32.NewProc("BackupWrite") procCancelIoEx = modkernel32.NewProc("CancelIoEx") procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe") - procCreateFileW = modkernel32.NewProc("CreateFileW") procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort") procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW") procGetCurrentThread = modkernel32.NewProc("GetCurrentThread") @@ -74,7 +77,6 @@ var ( procRtlDosPathNameToNtPathName_U = modntdll.NewProc("RtlDosPathNameToNtPathName_U") procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb") procWSAGetOverlappedResult = modws2_32.NewProc("WSAGetOverlappedResult") - procbind = modws2_32.NewProc("bind") ) func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) { @@ -123,6 +125,14 @@ func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision return } +func convertStringSidToSid(str *uint16, sid **byte) (err error) { + r1, _, e1 := syscall.Syscall(procConvertStringSidToSidW.Addr(), 2, uintptr(unsafe.Pointer(str)), uintptr(unsafe.Pointer(sid)), 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + func getSecurityDescriptorLength(sd uintptr) (len uint32) { r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0) len = uint32(r0) @@ -154,6 +164,14 @@ func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidS return } +func lookupAccountSid(systemName *uint16, sid *byte, name *uint16, nameSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procLookupAccountSidW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(nameSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { var _p0 *uint16 _p0, err = syscall.UTF16PtrFromString(systemName) @@ -286,24 +304,6 @@ func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) { return } -func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(name) - if err != nil { - return - } - return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile) -} - -func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) { - r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0) - handle = syscall.Handle(r0) - if handle == syscall.InvalidHandle { - err = errnoErr(e1) - } - return -} - func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) { r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0) newport = syscall.Handle(r0) @@ -380,25 +380,25 @@ func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err erro return } -func ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) { +func ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntStatus) { r0, _, _ := syscall.Syscall15(procNtCreateNamedPipeFile.Addr(), 14, uintptr(unsafe.Pointer(pipe)), uintptr(access), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(share), uintptr(disposition), uintptr(options), uintptr(typ), uintptr(readMode), uintptr(completionMode), uintptr(maxInstances), uintptr(inboundQuota), uintptr(outputQuota), uintptr(unsafe.Pointer(timeout)), 0) - status = ntstatus(r0) + status = ntStatus(r0) return } -func rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) { +func rtlDefaultNpAcl(dacl *uintptr) (status ntStatus) { r0, _, _ := syscall.Syscall(procRtlDefaultNpAcl.Addr(), 1, uintptr(unsafe.Pointer(dacl)), 0, 0) - status = ntstatus(r0) + status = ntStatus(r0) return } -func rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) { +func rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntStatus) { r0, _, _ := syscall.Syscall6(procRtlDosPathNameToNtPathName_U.Addr(), 4, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(ntName)), uintptr(filePart), uintptr(reserved), 0, 0) - status = ntstatus(r0) + status = ntStatus(r0) return } -func rtlNtStatusToDosError(status ntstatus) (winerr error) { +func rtlNtStatusToDosError(status ntStatus) (winerr error) { r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0) if r0 != 0 { winerr = syscall.Errno(r0) @@ -417,11 +417,3 @@ func wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint } return } - -func bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) { - r1, _, e1 := syscall.Syscall(procbind.Addr(), 3, uintptr(s), uintptr(name), uintptr(namelen)) - if r1 == socketError { - err = errnoErr(e1) - } - return -} diff --git a/vendor/github.com/Microsoft/hcsshim/.gitattributes b/vendor/github.com/Microsoft/hcsshim/.gitattributes index 94f480de9..dd0d09faa 100644 --- a/vendor/github.com/Microsoft/hcsshim/.gitattributes +++ b/vendor/github.com/Microsoft/hcsshim/.gitattributes @@ -1 +1,3 @@ -* text=auto eol=lf \ No newline at end of file +* text=auto eol=lf +vendor/** -text +test/vendor/** -text \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/.gitignore b/vendor/github.com/Microsoft/hcsshim/.gitignore index aec9bd4bb..74b68f0ad 100644 --- a/vendor/github.com/Microsoft/hcsshim/.gitignore +++ b/vendor/github.com/Microsoft/hcsshim/.gitignore @@ -1,3 +1,53 @@ +# Binaries for programs and plugins *.exe -.idea -.vscode +*.dll +*.so +*.dylib + +# Ignore vscode setting files +.vscode/ +.idea/ + +# Test binary, build with `go test -c` +*.test + +# Output of the go coverage tool, specifically when used with LiteIDE +*.out + +# Project-local glide cache, RE: https://github.com/Masterminds/glide/issues/736 +.glide/ + +# Ignore gcs bin directory +service/bin/ +service/pkg/ + +*.img +*.vhd +*.tar.gz +*.tar + +# Make stuff +.rootfs-done +bin/* +rootfs/* +rootfs-conv/* +*.o +/build/ + +deps/* +out/* + +# protobuf files +# only files at root of the repo, otherwise this will cause issues with vendoring +/protobuf/* + +# test results +test/results + +# go workspace files +go.work +go.work.sum + +# keys and related artifacts +*.pem +*.cose diff --git a/vendor/github.com/Microsoft/hcsshim/.golangci.yml b/vendor/github.com/Microsoft/hcsshim/.golangci.yml new file mode 100644 index 000000000..a795dbaf1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/.golangci.yml @@ -0,0 +1,148 @@ +run: + timeout: 8m + tests: true + build-tags: + - admin + - functional + - integration + skip-dirs: + # paths are relative to module root + - cri-containerd/test-images + +linters: + enable: + # defaults: + # - errcheck + # - gosimple + # - govet + # - ineffassign + # - staticcheck + # - typecheck + # - unused + + - gofmt # whether code was gofmt-ed + - nolintlint # ill-formed or insufficient nolint directives + - stylecheck # golint replacement + - thelper # test helpers without t.Helper() + +linters-settings: + stylecheck: + # https://staticcheck.io/docs/checks + checks: ["all"] + +issues: + exclude-rules: + # path is relative to module root, which is ./test/ + - path: cri-containerd + linters: + - stylecheck + text: "^ST1003: should not use underscores in package names$" + source: "^package cri_containerd$" + + # This repo has a LOT of generated schema files, operating system bindings, and other + # things that ST1003 from stylecheck won't like (screaming case Windows api constants for example). + # There's also some structs that we *could* change the initialisms to be Go friendly + # (Id -> ID) but they're exported and it would be a breaking change. + # This makes it so that most new code, code that isn't supposed to be a pretty faithful + # mapping to an OS call/constants, or non-generated code still checks if we're following idioms, + # while ignoring the things that are just noise or would be more of a hassle than it'd be worth to change. + - path: layer.go + linters: + - stylecheck + Text: "ST1003:" + + - path: hcsshim.go + linters: + - stylecheck + Text: "ST1003:" + + - path: cmd\\ncproxy\\nodenetsvc\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: cmd\\ncproxy_mock\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\hcs\\schema2\\ + linters: + - stylecheck + - gofmt + + - path: internal\\wclayer\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: hcn\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\hcs\\schema1\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\hns\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: ext4\\internal\\compactext4\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: ext4\\internal\\format\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\guestrequest\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\guest\\prot\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\windevice\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\winapi\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\vmcompute\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\regstate\\ + linters: + - stylecheck + Text: "ST1003:" + + - path: internal\\hcserror\\ + linters: + - stylecheck + Text: "ST1003:" + + # v0 APIs are deprecated, but still retained for backwards compatability + - path: cmd\\ncproxy\\ + linters: + - staticcheck + text: "^SA1019: .*(ncproxygrpc|nodenetsvc)[/]?v0" + + - path: internal\\tools\\networkagent + linters: + - staticcheck + text: "^SA1019: .*nodenetsvc[/]?v0" diff --git a/vendor/github.com/Microsoft/hcsshim/Makefile b/vendor/github.com/Microsoft/hcsshim/Makefile new file mode 100644 index 000000000..d8eb30b86 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/Makefile @@ -0,0 +1,111 @@ +BASE:=base.tar.gz +DEV_BUILD:=0 + +GO:=go +GO_FLAGS:=-ldflags "-s -w" # strip Go binaries +CGO_ENABLED:=0 +GOMODVENDOR:= + +CFLAGS:=-O2 -Wall +LDFLAGS:=-static -s # strip C binaries + +GO_FLAGS_EXTRA:= +ifeq "$(GOMODVENDOR)" "1" +GO_FLAGS_EXTRA += -mod=vendor +endif +GO_BUILD_TAGS:= +ifneq ($(strip $(GO_BUILD_TAGS)),) +GO_FLAGS_EXTRA += -tags="$(GO_BUILD_TAGS)" +endif +GO_BUILD:=CGO_ENABLED=$(CGO_ENABLED) $(GO) build $(GO_FLAGS) $(GO_FLAGS_EXTRA) + +SRCROOT=$(dir $(abspath $(firstword $(MAKEFILE_LIST)))) +# additional directories to search for rule prerequisites and targets +VPATH=$(SRCROOT) + +DELTA_TARGET=out/delta.tar.gz + +ifeq "$(DEV_BUILD)" "1" +DELTA_TARGET=out/delta-dev.tar.gz +endif + +# The link aliases for gcstools +GCS_TOOLS=\ + generichook \ + install-drivers + +.PHONY: all always rootfs test + +.DEFAULT_GOAL := all + +all: out/initrd.img out/rootfs.tar.gz + +clean: + find -name '*.o' -print0 | xargs -0 -r rm + rm -rf bin deps rootfs out + +test: + cd $(SRCROOT) && $(GO) test -v ./internal/guest/... + +rootfs: out/rootfs.vhd + +out/rootfs.vhd: out/rootfs.tar.gz bin/cmd/tar2ext4 + gzip -f -d ./out/rootfs.tar.gz + bin/cmd/tar2ext4 -vhd -i ./out/rootfs.tar -o $@ + +out/rootfs.tar.gz: out/initrd.img + rm -rf rootfs-conv + mkdir rootfs-conv + gunzip -c out/initrd.img | (cd rootfs-conv && cpio -imd) + tar -zcf $@ -C rootfs-conv . + rm -rf rootfs-conv + +out/initrd.img: $(BASE) $(DELTA_TARGET) $(SRCROOT)/hack/catcpio.sh + $(SRCROOT)/hack/catcpio.sh "$(BASE)" $(DELTA_TARGET) > out/initrd.img.uncompressed + gzip -c out/initrd.img.uncompressed > $@ + rm out/initrd.img.uncompressed + +# This target includes utilities which may be useful for testing purposes. +out/delta-dev.tar.gz: out/delta.tar.gz bin/internal/tools/snp-report + rm -rf rootfs-dev + mkdir rootfs-dev + tar -xzf out/delta.tar.gz -C rootfs-dev + cp bin/internal/tools/snp-report rootfs-dev/bin/ + tar -zcf $@ -C rootfs-dev . + rm -rf rootfs-dev + +out/delta.tar.gz: bin/init bin/vsockexec bin/cmd/gcs bin/cmd/gcstools bin/cmd/hooks/wait-paths Makefile + @mkdir -p out + rm -rf rootfs + mkdir -p rootfs/bin/ + mkdir -p rootfs/info/ + cp bin/init rootfs/ + cp bin/vsockexec rootfs/bin/ + cp bin/cmd/gcs rootfs/bin/ + cp bin/cmd/gcstools rootfs/bin/ + cp bin/cmd/hooks/wait-paths rootfs/bin/ + for tool in $(GCS_TOOLS); do ln -s gcstools rootfs/bin/$$tool; done + git -C $(SRCROOT) rev-parse HEAD > rootfs/info/gcs.commit && \ + git -C $(SRCROOT) rev-parse --abbrev-ref HEAD > rootfs/info/gcs.branch && \ + date --iso-8601=minute --utc > rootfs/info/tar.date + $(if $(and $(realpath $(subst .tar,.testdata.json,$(BASE))), $(shell which jq)), \ + jq -r '.IMAGE_NAME' $(subst .tar,.testdata.json,$(BASE)) 2>/dev/null > rootfs/info/image.name && \ + jq -r '.DATETIME' $(subst .tar,.testdata.json,$(BASE)) 2>/dev/null > rootfs/info/build.date) + tar -zcf $@ -C rootfs . + rm -rf rootfs + +bin/cmd/gcs bin/cmd/gcstools bin/cmd/hooks/wait-paths bin/cmd/tar2ext4 bin/internal/tools/snp-report: + @mkdir -p $(dir $@) + GOOS=linux $(GO_BUILD) -o $@ $(SRCROOT)/$(@:bin/%=%) + +bin/vsockexec: vsockexec/vsockexec.o vsockexec/vsock.o + @mkdir -p bin + $(CC) $(LDFLAGS) -o $@ $^ + +bin/init: init/init.o vsockexec/vsock.o + @mkdir -p bin + $(CC) $(LDFLAGS) -o $@ $^ + +%.o: %.c + @mkdir -p $(dir $@) + $(CC) $(CFLAGS) $(CPPFLAGS) -c -o $@ $< diff --git a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml index ee18671aa..42ad2e185 100644 --- a/vendor/github.com/Microsoft/hcsshim/Protobuild.toml +++ b/vendor/github.com/Microsoft/hcsshim/Protobuild.toml @@ -1,4 +1,4 @@ -version = "unstable" +version = "1" generator = "gogoctrd" plugins = ["grpc", "fieldpath"] @@ -9,16 +9,15 @@ plugins = ["grpc", "fieldpath"] # treat the root of the project as an include, but this may not be necessary. before = ["./protobuf"] + # defaults are "/usr/local/include" and "/usr/include", which don't exist on Windows. + # override defaults to supress errors about non-existant directories. + after = [] + # Paths that should be treated as include roots in relation to the vendor # directory. These will be calculated with the vendor directory nearest the # target package. packages = ["github.com/gogo/protobuf"] - # Paths that will be added untouched to the end of the includes. We use - # `/usr/local/include` to pickup the common install location of protobuf. - # This is the default. - after = ["/usr/local/include"] - # This section maps protobuf imports to Go packages. These will become # `-M` directives in the call to the go protobuf generator. [packages] @@ -36,6 +35,10 @@ plugins = ["grpc", "fieldpath"] prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] plugins = ["ttrpc"] +[[overrides]] +prefixes = ["github.com/Microsoft/hcsshim/internal/extendedtask"] +plugins = ["ttrpc"] + [[overrides]] prefixes = ["github.com/Microsoft/hcsshim/internal/computeagent"] plugins = ["ttrpc"] diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md index 95c300365..5a1361539 100644 --- a/vendor/github.com/Microsoft/hcsshim/README.md +++ b/vendor/github.com/Microsoft/hcsshim/README.md @@ -2,13 +2,67 @@ [![Build status](https://github.com/microsoft/hcsshim/actions/workflows/ci.yml/badge.svg?branch=master)](https://github.com/microsoft/hcsshim/actions?query=branch%3Amaster) -This package contains the Golang interface for using the Windows [Host Compute Service](https://techcommunity.microsoft.com/t5/containers/introducing-the-host-compute-service-hcs/ba-p/382332) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS). +This package contains the Golang interface for using the Windows [Host Compute Service](https://techcommunity.microsoft.com/t5/containers/introducing-the-host-compute-service-hcs/ba-p/382332) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS), as well as code for the [guest agent](./internal/guest/README.md) (commonly referred to as the GCS or Guest Compute Service in the codebase) used to support running Linux Hyper-V containers. -It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well. +It is primarily used in the [Moby](https://github.com/moby/moby) and [Containerd](https://github.com/containerd/containerd) projects, but it can be freely used by other projects as well. + +## Building + +While this repository can be used as a library of sorts to call the HCS apis, there are a couple binaries built out of the repository as well. The main ones being the Linux guest agent, and an implementation of the [runtime v2 containerd shim api](https://github.com/containerd/containerd/blob/master/runtime/v2/README.md). +### Linux Hyper-V Container Guest Agent + +To build the Linux guest agent itself all that's needed is to set your GOOS to "Linux" and build out of ./cmd/gcs. +```powershell +C:\> $env:GOOS="linux" +C:\> go build .\cmd\gcs\ +``` + +or on a Linux machine +```sh +> go build ./cmd/gcs +``` + +If you want it to be packaged inside of a rootfs to boot with alongside all of the other tools then you'll need to provide a rootfs that it can be packaged inside of. An easy way is to export the rootfs of a container. + +```sh +docker pull busybox +docker run --name base_image_container busybox +docker export base_image_container | gzip > base.tar.gz +BASE=./base.tar.gz +make all +``` + +If the build is successful, in the `./out` folder you should see: +```sh +> ls ./out/ +delta.tar.gz initrd.img rootfs.tar.gz +``` + +### Containerd Shim +For info on the Runtime V2 API: https://github.com/containerd/containerd/blob/master/runtime/v2/README.md. + +Contrary to the typical Linux architecture of shim -> runc, the runhcs shim is used both to launch and manage the lifetime of containers. + +```powershell +C:\> $env:GOOS="windows" +C:\> go build .\cmd\containerd-shim-runhcs-v1 +``` + +Then place the binary in the same directory that Containerd is located at in your environment. A default Containerd configuration file can be generated by running: +```powershell +.\containerd.exe config default | Out-File "C:\Program Files\containerd\config.toml" -Encoding ascii +``` + +This config file will already have the shim set as the default runtime for cri interactions. + +To trial using the shim out with ctr.exe: +```powershell +C:\> ctr.exe run --runtime io.containerd.runhcs.v1 --rm mcr.microsoft.com/windows/nanoserver:2004 windows-test cmd /c "echo Hello World!" +``` ## Contributing -This project welcomes contributions and suggestions. Most contributions require you to agree to a +This project welcomes contributions and suggestions. Most contributions require you to agree to a Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us the rights to use your contribution. For details, visit https://cla.microsoft.com. @@ -16,8 +70,10 @@ When you submit a pull request, a CLA-bot will automatically determine whether y a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions provided by the bot. You will only need to do this once across all repos using our CLA. -We also ask that contributors [sign their commits](https://git-scm.com/docs/git-commit) using `git commit -s` or `git commit --signoff` to certify they either authored the work themselves or otherwise have permission to use it in this project. - +We also require that contributors [sign their commits](https://git-scm.com/docs/git-commit) using `git commit -s` or `git commit --signoff` to +certify they either authored the work themselves or otherwise have permission to use it in this project. Please see https://developercertificate.org/ for +more info, as well as to make sure that you can attest to the rules listed. Our CI uses the [DCO Github app](https://github.com/apps/dco) to ensure +that all commits in a given PR are signed-off. ## Code of Conduct @@ -27,7 +83,7 @@ contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additio ## Dependencies -This project requires Golang 1.9 or newer to build. +This project requires Golang 1.17 or newer to build. For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements). diff --git a/vendor/github.com/Microsoft/hcsshim/SECURITY.md b/vendor/github.com/Microsoft/hcsshim/SECURITY.md new file mode 100644 index 000000000..869fdfe2b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/SECURITY.md @@ -0,0 +1,41 @@ + + +## Security + +Microsoft takes the security of our software products and services seriously, which includes all source code repositories managed through our GitHub organizations, which include [Microsoft](https://github.com/Microsoft), [Azure](https://github.com/Azure), [DotNet](https://github.com/dotnet), [AspNet](https://github.com/aspnet), [Xamarin](https://github.com/xamarin), and [our GitHub organizations](https://opensource.microsoft.com/). + +If you believe you have found a security vulnerability in any Microsoft-owned repository that meets [Microsoft's definition of a security vulnerability](https://aka.ms/opensource/security/definition), please report it to us as described below. + +## Reporting Security Issues + +**Please do not report security vulnerabilities through public GitHub issues.** + +Instead, please report them to the Microsoft Security Response Center (MSRC) at [https://msrc.microsoft.com/create-report](https://aka.ms/opensource/security/create-report). + +If you prefer to submit without logging in, send email to [secure@microsoft.com](mailto:secure@microsoft.com). If possible, encrypt your message with our PGP key; please download it from the [Microsoft Security Response Center PGP Key page](https://aka.ms/opensource/security/pgpkey). + +You should receive a response within 24 hours. If for some reason you do not, please follow up via email to ensure we received your original message. Additional information can be found at [microsoft.com/msrc](https://aka.ms/opensource/security/msrc). + +Please include the requested information listed below (as much as you can provide) to help us better understand the nature and scope of the possible issue: + + * Type of issue (e.g. buffer overflow, SQL injection, cross-site scripting, etc.) + * Full paths of source file(s) related to the manifestation of the issue + * The location of the affected source code (tag/branch/commit or direct URL) + * Any special configuration required to reproduce the issue + * Step-by-step instructions to reproduce the issue + * Proof-of-concept or exploit code (if possible) + * Impact of the issue, including how an attacker might exploit the issue + +This information will help us triage your report more quickly. + +If you are reporting for a bug bounty, more complete reports can contribute to a higher bounty award. Please visit our [Microsoft Bug Bounty Program](https://aka.ms/opensource/security/bounty) page for more details about our active programs. + +## Preferred Languages + +We prefer all communications to be in English. + +## Policy + +Microsoft follows the principle of [Coordinated Vulnerability Disclosure](https://aka.ms/opensource/security/cvd). + + diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go b/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go index 7f1f2823d..54c4b3bc4 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -17,8 +19,8 @@ import ( // // `layerData` is the parent read-only layer data. func AttachLayerStorageFilter(ctx context.Context, layerPath string, layerData LayerData) (err error) { - title := "hcsshim.AttachLayerStorageFilter" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::AttachLayerStorageFilter" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go b/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go index 8e28e6c50..5058d3b55 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -12,8 +14,8 @@ import ( // // `layerPath` is a path to a directory containing the layer to export. func DestroyLayer(ctx context.Context, layerPath string) (err error) { - title := "hcsshim.DestroyLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::DestroyLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go b/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go index 435473257..daf1bfff2 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -12,8 +14,8 @@ import ( // // `layerPath` is a path to a directory containing the layer to export. func DetachLayerStorageFilter(ctx context.Context, layerPath string) (err error) { - title := "hcsshim.DetachLayerStorageFilter" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::DetachLayerStorageFilter" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/export.go b/vendor/github.com/Microsoft/hcsshim/computestorage/export.go index a1b12dd12..c6370a5c9 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/export.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/export.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -19,8 +21,8 @@ import ( // // `options` are the export options applied to the exported layer. func ExportLayer(ctx context.Context, layerPath, exportFolderPath string, layerData LayerData, options ExportLayerOptions) (err error) { - title := "hcsshim.ExportLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::ExportLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -28,17 +30,17 @@ func ExportLayer(ctx context.Context, layerPath, exportFolderPath string, layerD trace.StringAttribute("exportFolderPath", exportFolderPath), ) - ldbytes, err := json.Marshal(layerData) + ldBytes, err := json.Marshal(layerData) if err != nil { return err } - obytes, err := json.Marshal(options) + oBytes, err := json.Marshal(options) if err != nil { return err } - err = hcsExportLayer(layerPath, exportFolderPath, string(ldbytes), string(obytes)) + err = hcsExportLayer(layerPath, exportFolderPath, string(ldBytes), string(oBytes)) if err != nil { return errors.Wrap(err, "failed to export layer") } diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/format.go b/vendor/github.com/Microsoft/hcsshim/computestorage/format.go index 83c0fa33f..2140e5c9f 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/format.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/format.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -5,16 +7,20 @@ import ( "github.com/Microsoft/hcsshim/internal/oc" "github.com/pkg/errors" - "go.opencensus.io/trace" "golang.org/x/sys/windows" ) // FormatWritableLayerVhd formats a virtual disk for use as a writable container layer. // // If the VHD is not mounted it will be temporarily mounted. +// +// NOTE: This API had a breaking change in the operating system after Windows Server 2019. +// On ws2019 the API expects to get passed a file handle from CreateFile for the vhd that +// the caller wants to format. On > ws2019, its expected that the caller passes a vhd handle +// that can be obtained from the virtdisk APIs. func FormatWritableLayerVhd(ctx context.Context, vhdHandle windows.Handle) (err error) { - title := "hcsshim.FormatWritableLayerVhd" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::FormatWritableLayerVhd" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go b/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go index 87fee452c..c3608dcec 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -6,10 +8,12 @@ import ( "path/filepath" "syscall" - "github.com/Microsoft/go-winio/pkg/security" "github.com/Microsoft/go-winio/vhd" + "github.com/Microsoft/hcsshim/internal/memory" "github.com/pkg/errors" "golang.org/x/sys/windows" + + "github.com/Microsoft/hcsshim/internal/security" ) const defaultVHDXBlockSizeInMB = 1 @@ -59,8 +63,8 @@ func SetupContainerBaseLayer(ctx context.Context, layerPath, baseVhdPath, diffVh createParams := &vhd.CreateVirtualDiskParameters{ Version: 2, Version2: vhd.CreateVersion2{ - MaximumSize: sizeInGB * 1024 * 1024 * 1024, - BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, + MaximumSize: sizeInGB * memory.GiB, + BlockSizeInBytes: defaultVHDXBlockSizeInMB * memory.MiB, }, } handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) @@ -135,8 +139,8 @@ func SetupUtilityVMBaseLayer(ctx context.Context, uvmPath, baseVhdPath, diffVhdP createParams := &vhd.CreateVirtualDiskParameters{ Version: 2, Version2: vhd.CreateVersion2{ - MaximumSize: sizeInGB * 1024 * 1024 * 1024, - BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, + MaximumSize: sizeInGB * memory.GiB, + BlockSizeInBytes: defaultVHDXBlockSizeInMB * memory.MiB, }, } handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/import.go b/vendor/github.com/Microsoft/hcsshim/computestorage/import.go index 0c61dab32..e1c87416a 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/import.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/import.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -19,8 +21,8 @@ import ( // // `layerData` is the parent layer data. func ImportLayer(ctx context.Context, layerPath, sourceFolderPath string, layerData LayerData) (err error) { - title := "hcsshim.ImportLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::ImportLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go b/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go index 53ed8ea6e..d0c621605 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -16,8 +18,8 @@ import ( // // `layerData` is the parent read-only layer data. func InitializeWritableLayer(ctx context.Context, layerPath string, layerData LayerData) (err error) { - title := "hcsshim.InitializeWritableLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::InitializeWritableLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go b/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go index fcdbbef81..4f4d8ebf2 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -6,14 +8,13 @@ import ( "github.com/Microsoft/hcsshim/internal/interop" "github.com/Microsoft/hcsshim/internal/oc" "github.com/pkg/errors" - "go.opencensus.io/trace" "golang.org/x/sys/windows" ) // GetLayerVhdMountPath returns the volume path for a virtual disk of a writable container layer. func GetLayerVhdMountPath(ctx context.Context, vhdHandle windows.Handle) (path string, err error) { - title := "hcsshim.GetLayerVhdMountPath" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::GetLayerVhdMountPath" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go b/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go index 06aaf841e..1c685aed0 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go @@ -1,3 +1,5 @@ +//go:build windows + package computestorage import ( @@ -21,8 +23,8 @@ import ( // // `options` are the options applied while processing the layer. func SetupBaseOSLayer(ctx context.Context, layerPath string, vhdHandle windows.Handle, options OsLayerOptions) (err error) { - title := "hcsshim.SetupBaseOSLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::SetupBaseOSLayer" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -48,12 +50,16 @@ func SetupBaseOSLayer(ctx context.Context, layerPath string, vhdHandle windows.H // `volumePath` is the path to the volume to be used for setup. // // `options` are the options applied while processing the layer. +// +// NOTE: This API is only available on builds of Windows greater than 19645. Inside we +// check if the hosts build has the API available by using 'GetVersion' which requires +// the calling application to be manifested. https://docs.microsoft.com/en-us/windows/win32/sbscs/manifests func SetupBaseOSVolume(ctx context.Context, layerPath, volumePath string, options OsLayerOptions) (err error) { if osversion.Build() < 19645 { return errors.New("SetupBaseOSVolume is not present on builds older than 19645") } - title := "hcsshim.SetupBaseOSVolume" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + title := "hcsshim::SetupBaseOSVolume" + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go b/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go index 95aff9c18..82d68cb8b 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go @@ -7,7 +7,7 @@ import ( hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" ) -//go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go storage.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go storage.go //sys hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) = computestorage.HcsImportLayer? //sys hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) = computestorage.HcsExportLayer? @@ -20,10 +20,13 @@ import ( //sys hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) = computestorage.HcsGetLayerVhdMountPath? //sys hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) (hr error) = computestorage.HcsSetupBaseOSVolume? +type Version = hcsschema.Version +type Layer = hcsschema.Layer + // LayerData is the data used to describe parent layer information. type LayerData struct { - SchemaVersion hcsschema.Version `json:"SchemaVersion,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` + SchemaVersion Version `json:"SchemaVersion,omitempty"` + Layers []Layer `json:"Layers,omitempty"` } // ExportLayerOptions are the set of options that are used with the `computestorage.HcsExportLayer` syscall. diff --git a/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go index 4f9518067..9cf479181 100644 --- a/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package computestorage @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -39,42 +42,86 @@ func errnoErr(e syscall.Errno) error { var ( modcomputestorage = windows.NewLazySystemDLL("computestorage.dll") - procHcsImportLayer = modcomputestorage.NewProc("HcsImportLayer") - procHcsExportLayer = modcomputestorage.NewProc("HcsExportLayer") - procHcsDestoryLayer = modcomputestorage.NewProc("HcsDestoryLayer") - procHcsSetupBaseOSLayer = modcomputestorage.NewProc("HcsSetupBaseOSLayer") - procHcsInitializeWritableLayer = modcomputestorage.NewProc("HcsInitializeWritableLayer") procHcsAttachLayerStorageFilter = modcomputestorage.NewProc("HcsAttachLayerStorageFilter") + procHcsDestoryLayer = modcomputestorage.NewProc("HcsDestoryLayer") procHcsDetachLayerStorageFilter = modcomputestorage.NewProc("HcsDetachLayerStorageFilter") + procHcsExportLayer = modcomputestorage.NewProc("HcsExportLayer") procHcsFormatWritableLayerVhd = modcomputestorage.NewProc("HcsFormatWritableLayerVhd") procHcsGetLayerVhdMountPath = modcomputestorage.NewProc("HcsGetLayerVhdMountPath") + procHcsImportLayer = modcomputestorage.NewProc("HcsImportLayer") + procHcsInitializeWritableLayer = modcomputestorage.NewProc("HcsInitializeWritableLayer") + procHcsSetupBaseOSLayer = modcomputestorage.NewProc("HcsSetupBaseOSLayer") procHcsSetupBaseOSVolume = modcomputestorage.NewProc("HcsSetupBaseOSVolume") ) -func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) { +func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(sourceFolderPath) + _p1, hr = syscall.UTF16PtrFromString(layerData) if hr != nil { return } - var _p2 *uint16 - _p2, hr = syscall.UTF16PtrFromString(layerData) + return _hcsAttachLayerStorageFilter(_p0, _p1) +} + +func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { + hr = procHcsAttachLayerStorageFilter.Find() if hr != nil { return } - return _hcsImportLayer(_p0, _p1, _p2) + r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { - if hr = procHcsImportLayer.Find(); hr != nil { +func hcsDestroyLayer(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) + return _hcsDestroyLayer(_p0) +} + +func _hcsDestroyLayer(layerPath *uint16) (hr error) { + hr = procHcsDestoryLayer.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsDetachLayerStorageFilter(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + return _hcsDetachLayerStorageFilter(_p0) +} + +func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { + hr = procHcsDetachLayerStorageFilter.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -109,7 +156,8 @@ func hcsExportLayer(layerPath string, exportFolderPath string, layerData string, } func _hcsExportLayer(layerPath *uint16, exportFolderPath *uint16, layerData *uint16, options *uint16) (hr error) { - if hr = procHcsExportLayer.Find(); hr != nil { + hr = procHcsExportLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsExportLayer.Addr(), 4, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(exportFolderPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options)), 0, 0) @@ -122,20 +170,27 @@ func _hcsExportLayer(layerPath *uint16, exportFolderPath *uint16, layerData *uin return } -func hcsDestroyLayer(layerPath string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(layerPath) +func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { + hr = procHcsFormatWritableLayerVhd.Find() if hr != nil { return } - return _hcsDestroyLayer(_p0) + r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcsDestroyLayer(layerPath *uint16) (hr error) { - if hr = procHcsDestoryLayer.Find(); hr != nil { +func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { + hr = procHcsGetLayerVhdMountPath.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -145,25 +200,31 @@ func _hcsDestroyLayer(layerPath *uint16) (hr error) { return } -func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) { +func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(options) + _p1, hr = syscall.UTF16PtrFromString(sourceFolderPath) if hr != nil { return } - return _hcsSetupBaseOSLayer(_p0, handle, _p1) + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + return _hcsImportLayer(_p0, _p1, _p2) } -func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { - if hr = procHcsSetupBaseOSLayer.Find(); hr != nil { +func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { + hr = procHcsImportLayer.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) + r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -193,7 +254,8 @@ func hcsInitializeWritableLayer(writableLayerPath string, layerData string, opti } func _hcsInitializeWritableLayer(writableLayerPath *uint16, layerData *uint16, options *uint16) (hr error) { - if hr = procHcsInitializeWritableLayer.Find(); hr != nil { + hr = procHcsInitializeWritableLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsInitializeWritableLayer.Addr(), 3, uintptr(unsafe.Pointer(writableLayerPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options))) @@ -206,76 +268,26 @@ func _hcsInitializeWritableLayer(writableLayerPath *uint16, layerData *uint16, o return } -func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) { +func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(layerData) + _p1, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - return _hcsAttachLayerStorageFilter(_p0, _p1) -} - -func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { - if hr = procHcsAttachLayerStorageFilter.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return + return _hcsSetupBaseOSLayer(_p0, handle, _p1) } -func hcsDetachLayerStorageFilter(layerPath string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(layerPath) +func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { + hr = procHcsSetupBaseOSLayer.Find() if hr != nil { return } - return _hcsDetachLayerStorageFilter(_p0) -} - -func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { - if hr = procHcsDetachLayerStorageFilter.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { - if hr = procHcsFormatWritableLayerVhd.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { - if hr = procHcsGetLayerVhdMountPath.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) + r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -305,7 +317,8 @@ func hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) ( } func _hcsSetupBaseOSVolume(layerPath *uint16, volumePath *uint16, options *uint16) (hr error) { - if hr = procHcsSetupBaseOSVolume.Find(); hr != nil { + hr = procHcsSetupBaseOSVolume.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSetupBaseOSVolume.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(volumePath)), uintptr(unsafe.Pointer(options))) diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index bfd722898..c8f09f88b 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( @@ -60,7 +62,7 @@ type container struct { waitCh chan struct{} } -// createComputeSystemAdditionalJSON is read from the environment at initialisation +// createContainerAdditionalJSON is read from the environment at initialization // time. It allows an environment variable to define additional JSON which // is merged in the CreateComputeSystem call to HCS. var createContainerAdditionalJSON []byte diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go index f367022e7..594bbfb7a 100644 --- a/vendor/github.com/Microsoft/hcsshim/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( @@ -50,6 +52,9 @@ var ( // ErrUnexpectedValue is an error encountered when hcs returns an invalid value ErrUnexpectedValue = hcs.ErrUnexpectedValue + // ErrOperationDenied is an error when hcs attempts an operation that is explicitly denied + ErrOperationDenied = hcs.ErrOperationDenied + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped diff --git a/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 b/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 deleted file mode 100644 index ce6edbcf3..000000000 --- a/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1 +++ /dev/null @@ -1,12 +0,0 @@ -# Requirements so far: -# dockerd running -# - image microsoft/nanoserver (matching host base image) docker load -i c:\baseimages\nanoserver.tar -# - image alpine (linux) docker pull --platform=linux alpine - - -# TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true" -#$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please" - -#pushd uvm -go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./... -#popd \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go index ceb3ac85e..13f80e4a8 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcsshim.go +++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -1,15 +1,17 @@ +//go:build windows + // Shim for the Host Compute Service (HCS) to manage Windows Server // containers and Hyper-V containers. package hcsshim import ( - "syscall" + "golang.org/x/sys/windows" "github.com/Microsoft/hcsshim/internal/hcserror" ) -//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go hcsshim.go //sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId @@ -17,9 +19,9 @@ const ( // Specific user-visible exit codes WaitErrExecFailed = 32767 - ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE - ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) - WSAEINVAL = syscall.Errno(10022) + ERROR_GEN_FAILURE = windows.ERROR_GEN_FAILURE + ERROR_SHUTDOWN_IN_PROGRESS = windows.ERROR_SHUTDOWN_IN_PROGRESS + WSAEINVAL = windows.WSAEINVAL // Timeout on wait calls TimeoutInfinite = 0xFFFFFFFF diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index 9e0059447..d8a73de98 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( @@ -13,7 +15,7 @@ type HNSEndpointStats = hns.EndpointStats // Namespace represents a Compartment. type Namespace = hns.Namespace -//SystemType represents the type of the system on which actions are done +// SystemType represents the type of the system on which actions are done type SystemType string // SystemType const diff --git a/vendor/github.com/Microsoft/hcsshim/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go index 2b5381904..c564bf4a3 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsglobals.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go index f775fa1d0..925c21249 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go @@ -1,14 +1,16 @@ +//go:build windows + package hcsshim import ( "github.com/Microsoft/hcsshim/internal/hns" ) -// Subnet is assoicated with a network and represents a list +// Subnet is associated with a network and represents a list // of subnets available to the network type Subnet = hns.Subnet -// MacPool is assoicated with a network and represents a list +// MacPool is associated with a network and represents a list // of macaddresses available to the network type MacPool = hns.MacPool diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go index 55aaa4a50..9bfe61ee8 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/hnssupport.go index 69405244b..d97681e0c 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnssupport.go +++ b/vendor/github.com/Microsoft/hcsshim/hnssupport.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go index 300eb5996..81a281951 100644 --- a/vendor/github.com/Microsoft/hcsshim/interface.go +++ b/vendor/github.com/Microsoft/hcsshim/interface.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go index f46af33bb..b60cd383b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -1,3 +1,5 @@ +//go:build windows + package cow import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index d13772b03..7b27173c3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/doc.go new file mode 100644 index 000000000..d792dda98 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/doc.go @@ -0,0 +1 @@ +package hcs diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 644f0ab71..3e10f5c7e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( @@ -51,6 +53,9 @@ var ( // ErrUnexpectedValue is an error encountered when hcs returns an invalid value ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + // ErrOperationDenied is an error when hcs attempts an operation that is explicitly denied + ErrOperationDenied = errors.New("operation denied") + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) @@ -78,6 +83,13 @@ var ( // ErrNotSupported is an error encountered when hcs doesn't support the request ErrPlatformNotSupported = errors.New("unsupported platform request") + + // ErrProcessAlreadyStopped is returned by hcs if the process we're trying to kill has already been stopped. + ErrProcessAlreadyStopped = syscall.Errno(0x8037011f) + + // ErrInvalidHandle is an error that can be encountered when querying the properties of a compute system when the handle to that + // compute system has already been closed. + ErrInvalidHandle = syscall.Errno(0x6) ) type ErrorEvent struct { @@ -145,33 +157,38 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Is(target error) bool { + return errors.Is(e.Err, target) +} + +// unwrap isnt really needed, but helpful convince function + +func (e *HcsError) Unwrap() error { + return e.Err +} + +// Deprecated: net.Error.Temporary is deprecated. func (e *HcsError) Temporary() bool { - err, ok := e.Err.(net.Error) - return ok && err.Temporary() + err := e.netError() + return (err != nil) && err.Temporary() } func (e *HcsError) Timeout() bool { - err, ok := e.Err.(net.Error) - return ok && err.Timeout() + err := e.netError() + return (err != nil) && err.Timeout() } -// ProcessError is an error encountered in HCS during an operation on a Process object -type ProcessError struct { - SystemID string - Pid int - Op string - Err error - Events []ErrorEvent +func (e *HcsError) netError() (err net.Error) { + if errors.As(e.Unwrap(), &err) { + return err + } + return nil } -var _ net.Error = &ProcessError{} - // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { - ID string - Op string - Err error - Events []ErrorEvent + HcsError + ID string } var _ net.Error = &SystemError{} @@ -184,29 +201,32 @@ func (e *SystemError) Error() string { return s } -func (e *SystemError) Temporary() bool { - err, ok := e.Err.(net.Error) - return ok && err.Temporary() -} - -func (e *SystemError) Timeout() bool { - err, ok := e.Err.(net.Error) - return ok && err.Timeout() -} - func makeSystemError(system *System, op string, err error, events []ErrorEvent) error { // Don't double wrap errors - if _, ok := err.(*SystemError); ok { + var e *SystemError + if errors.As(err, &e) { return err } + return &SystemError{ - ID: system.ID(), - Op: op, - Err: err, - Events: events, + ID: system.ID(), + HcsError: HcsError{ + Op: op, + Err: err, + Events: events, + }, } } +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + HcsError + SystemID string + Pid int +} + +var _ net.Error = &ProcessError{} + func (e *ProcessError) Error() string { s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error()) for _, ev := range e.Events { @@ -215,27 +235,20 @@ func (e *ProcessError) Error() string { return s } -func (e *ProcessError) Temporary() bool { - err, ok := e.Err.(net.Error) - return ok && err.Temporary() -} - -func (e *ProcessError) Timeout() bool { - err, ok := e.Err.(net.Error) - return ok && err.Timeout() -} - func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors - if _, ok := err.(*ProcessError); ok { + var e *ProcessError + if errors.As(err, &e) { return err } return &ProcessError{ Pid: process.Pid(), SystemID: process.SystemID(), - Op: op, - Err: err, - Events: events, + HcsError: HcsError{ + Op: op, + Err: err, + Events: events, + }, } } @@ -244,33 +257,41 @@ func makeProcessError(process *Process, op string, err error, events []ErrorEven // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound. func IsNotExist(err error) bool { - err = getInnerError(err) - return err == ErrComputeSystemDoesNotExist || - err == ErrElementNotFound + return IsAny(err, ErrComputeSystemDoesNotExist, ErrElementNotFound) +} + +// IsErrorInvalidHandle checks whether the error is the result of an operation carried +// out on a handle that is invalid/closed. This error popped up while trying to query +// stats on a container in the process of being stopped. +func IsErrorInvalidHandle(err error) bool { + return errors.Is(err, ErrInvalidHandle) } // IsAlreadyClosed checks if an error is caused by the Container or Process having been // already closed by a call to the Close() method. func IsAlreadyClosed(err error) bool { - err = getInnerError(err) - return err == ErrAlreadyClosed + return errors.Is(err, ErrAlreadyClosed) } // IsPending returns a boolean indicating whether the error is that // the requested operation is being completed in the background. func IsPending(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeOperationPending + return errors.Is(err, ErrVmcomputeOperationPending) } // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { - if err, ok := err.(net.Error); ok && err.Timeout() { + // HcsError and co. implement Timeout regardless of whether the errors they wrap do, + // so `errors.As(err, net.Error)`` will always be true. + // Using `errors.As(err.Unwrap(), net.Err)` wont work for general errors. + // So first check if there an `ErrTimeout` in the chain, then convert to a net error. + if errors.Is(err, ErrTimeout) { return true } - err = getInnerError(err) - return err == ErrTimeout + + var nerr net.Error + return errors.As(err, &nerr) && nerr.Timeout() } // IsAlreadyStopped returns a boolean indicating whether the error is caused by @@ -279,9 +300,7 @@ func IsTimeout(err error) bool { // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound. func IsAlreadyStopped(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeAlreadyStopped || - err == ErrElementNotFound + return IsAny(err, ErrVmcomputeAlreadyStopped, ErrProcessAlreadyStopped, ErrElementNotFound) } // IsNotSupported returns a boolean indicating whether the error is caused by @@ -290,38 +309,28 @@ func IsAlreadyStopped(err error) bool { // ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage // is thrown from the Platform func IsNotSupported(err error) bool { - err = getInnerError(err) // If Platform doesn't recognize or support the request sent, below errors are seen - return err == ErrVmcomputeInvalidJSON || - err == ErrInvalidData || - err == ErrNotSupported || - err == ErrVmcomputeUnknownMessage + return IsAny(err, ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported, ErrVmcomputeUnknownMessage) } // IsOperationInvalidState returns true when err is caused by // `ErrVmcomputeOperationInvalidState`. func IsOperationInvalidState(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeOperationInvalidState + return errors.Is(err, ErrVmcomputeOperationInvalidState) } // IsAccessIsDenied returns true when err is caused by // `ErrVmcomputeOperationAccessIsDenied`. func IsAccessIsDenied(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeOperationAccessIsDenied + return errors.Is(err, ErrVmcomputeOperationAccessIsDenied) } -func getInnerError(err error) error { - switch pe := err.(type) { - case nil: - return nil - case *HcsError: - err = pe.Err - case *SystemError: - err = pe.Err - case *ProcessError: - err = pe.Err +// IsAny is a vectorized version of [errors.Is], it returns true if err is one of targets. +func IsAny(err error, targets ...error) bool { + for _, e := range targets { + if errors.Is(err, e) { + return true + } } - return err + return false } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 8f2034668..65025f3f9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,13 +1,18 @@ +//go:build windows + package hcs import ( "context" "encoding/json" + "errors" "io" + "os" "sync" "syscall" "time" + "github.com/Microsoft/hcsshim/internal/cow" "github.com/Microsoft/hcsshim/internal/log" "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/vmcompute" @@ -16,16 +21,17 @@ import ( // ContainerError is an error encountered in HCS type Process struct { - handleLock sync.RWMutex - handle vmcompute.HcsProcess - processID int - system *System - hasCachedStdio bool - stdioLock sync.Mutex - stdin io.WriteCloser - stdout io.ReadCloser - stderr io.ReadCloser - callbackNumber uintptr + handleLock sync.RWMutex + handle vmcompute.HcsProcess + processID int + system *System + hasCachedStdio bool + stdioLock sync.Mutex + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser + callbackNumber uintptr + killSignalDelivered bool closedWaitOnce sync.Once waitBlock chan struct{} @@ -33,6 +39,8 @@ type Process struct { waitError error } +var _ cow.Process = &Process{} + func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, @@ -86,10 +94,7 @@ func (process *Process) processSignalResult(ctx context.Context, err error) (boo case nil: return true, nil case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: - select { - case <-process.waitBlock: - // The process exit notification has already arrived. - default: + if !process.stopped() { // The process should be gone, but we have not received the notification. // After a second, force unblock the process wait to work around a possible // deadlock in the HCS. @@ -111,9 +116,9 @@ func (process *Process) processSignalResult(ctx context.Context, err error) (boo // Signal signals the process with `options`. // -// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// For LCOW `guestresource.SignalProcessOptionsLCOW`. // -// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +// For WCOW `guestresource.SignalProcessOptionsWCOW`. func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() @@ -149,12 +154,81 @@ func (process *Process) Kill(ctx context.Context) (bool, error) { return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + if process.stopped() { + return false, makeProcessError(process, operation, ErrProcessAlreadyStopped, nil) + } + + if process.killSignalDelivered { + // A kill signal has already been sent to this process. Sending a second + // one offers no real benefit, as processes cannot stop themselves from + // being terminated, once a TerminateProcess has been issued. Sending a + // second kill may result in a number of errors (two of which detailed bellow) + // and which we can avoid handling. + return true, nil + } + + // HCS serializes the signals sent to a target pid per compute system handle. + // To avoid SIGKILL being serialized behind other signals, we open a new compute + // system handle to deliver the kill signal. + // If the calls to opening a new compute system handle fail, we forcefully + // terminate the container itself so that no container is left behind + hcsSystem, err := OpenComputeSystem(ctx, process.system.id) + if err != nil { + // log error and force termination of container + log.G(ctx).WithField("err", err).Error("OpenComputeSystem() call failed") + err = process.system.Terminate(ctx) + // if the Terminate() call itself ever failed, log and return error + if err != nil { + log.G(ctx).WithField("err", err).Error("Terminate() call failed") + return false, err + } + process.system.Close() + return true, nil + } + defer hcsSystem.Close() + + newProcessHandle, err := hcsSystem.OpenProcess(ctx, process.Pid()) + if err != nil { + // Return true only if the target process has either already + // exited, or does not exist. + if IsAlreadyStopped(err) { + return true, nil + } else { + return false, err + } + } + defer newProcessHandle.Close() + + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, newProcessHandle.handle) + if err != nil { + // We still need to check these two cases, as processes may still be killed by an + // external actor (human operator, OOM, random script etc). + if errors.Is(err, os.ErrPermission) || IsAlreadyStopped(err) { + // There are two cases where it should be safe to ignore an error returned + // by HcsTerminateProcess. The first one is cause by the fact that + // HcsTerminateProcess ends up calling TerminateProcess in the context + // of a container. According to the TerminateProcess documentation: + // https://docs.microsoft.com/en-us/windows/win32/api/processthreadsapi/nf-processthreadsapi-terminateprocess#remarks + // After a process has terminated, call to TerminateProcess with open + // handles to the process fails with ERROR_ACCESS_DENIED (5) error code. + // It's safe to ignore this error here. HCS should always have permissions + // to kill processes inside any container. So an ERROR_ACCESS_DENIED + // is unlikely to be anything else than what the ending remarks in the + // documentation states. + // + // The second case is generated by hcs itself, if for any reason HcsTerminateProcess + // is called twice in a very short amount of time. In such cases, hcs may return + // HCS_E_PROCESS_ALREADY_STOPPED. + return true, nil + } + } events := processHcsResult(ctx, resultJSON) - delivered, err := process.processSignalResult(ctx, err) + delivered, err := newProcessHandle.processSignalResult(ctx, err) if err != nil { - err = makeProcessError(process, operation, err, events) + err = makeProcessError(newProcessHandle, operation, err, events) } + + process.killSignalDelivered = delivered return delivered, err } @@ -165,7 +239,7 @@ func (process *Process) Kill(ctx context.Context) (bool, error) { // call multiple times. func (process *Process) waitBackground() { operation := "hcs::Process::waitBackground" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() span.AddAttributes( trace.StringAttribute("cid", process.SystemID()), @@ -191,12 +265,12 @@ func (process *Process) waitBackground() { propertiesJSON, resultJSON, err = vmcompute.HcsGetProcessProperties(ctx, process.handle) events := processHcsResult(ctx, resultJSON) if err != nil { - err = makeProcessError(process, operation, err, events) //nolint:ineffassign + err = makeProcessError(process, operation, err, events) } else { properties := &processStatus{} err = json.Unmarshal([]byte(propertiesJSON), properties) if err != nil { - err = makeProcessError(process, operation, err, nil) //nolint:ineffassign + err = makeProcessError(process, operation, err, nil) } else { if properties.LastWaitResult != 0 { log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") @@ -218,12 +292,22 @@ func (process *Process) waitBackground() { } // Wait waits for the process to exit. If the process has already exited returns -// the pervious error (if any). +// the previous error (if any). func (process *Process) Wait() error { <-process.waitBlock return process.waitError } +// Exited returns if the process has stopped +func (process *Process) stopped() bool { + select { + case <-process.waitBlock: + return true + default: + return false + } +} + // ResizeConsole resizes the console of the process. func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() @@ -260,15 +344,13 @@ func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) // ExitCode returns the exit code of the process. The process must have // already terminated. func (process *Process) ExitCode() (int, error) { - select { - case <-process.waitBlock: - if process.waitError != nil { - return -1, process.waitError - } - return process.exitCode, nil - default: + if !process.stopped() { return -1, makeProcessError(process, "hcs::Process::ExitCode", ErrInvalidProcessState, nil) } + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil } // StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing @@ -276,7 +358,7 @@ func (process *Process) ExitCode() (int, error) { // are the responsibility of the caller to close. func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { operation := "hcs::Process::StdioLegacy" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -314,7 +396,7 @@ func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.R } // Stdio returns the stdin, stdout, and stderr pipes, respectively. -// To close them, close the process handle. +// To close them, close the process handle, or use the `CloseStd*` functions. func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { process.stdioLock.Lock() defer process.stdioLock.Unlock() @@ -323,46 +405,55 @@ func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin(ctx context.Context) error { +func (process *Process) CloseStdin(ctx context.Context) (err error) { + operation := "hcs::Process::CloseStdin" + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcs::Process::CloseStdin" - if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) } - modifyRequest := processModifyRequest{ - Operation: modifyCloseHandle, - CloseHandle: &closeHandle{ - Handle: stdIn, - }, - } + //HcsModifyProcess request to close stdin will fail if the process has already exited + if !process.stopped() { + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } - modifyRequestb, err := json.Marshal(modifyRequest) - if err != nil { - return err - } + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } - resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) - events := processHcsResult(ctx, resultJSON) - if err != nil { - return makeProcessError(process, operation, err, events) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return makeProcessError(process, operation, err, events) + } } process.stdioLock.Lock() + defer process.stdioLock.Unlock() if process.stdin != nil { process.stdin.Close() process.stdin = nil } - process.stdioLock.Unlock() return nil } func (process *Process) CloseStdout(ctx context.Context) (err error) { - ctx, span := trace.StartSpan(ctx, "hcs::Process::CloseStdout") //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, "hcs::Process::CloseStdout") //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -386,7 +477,7 @@ func (process *Process) CloseStdout(ctx context.Context) (err error) { } func (process *Process) CloseStderr(ctx context.Context) (err error) { - ctx, span := trace.StartSpan(ctx, "hcs::Process::CloseStderr") //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, "hcs::Process::CloseStderr") //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -405,7 +496,6 @@ func (process *Process) CloseStderr(ctx context.Context) (err error) { if process.stderr != nil { process.stderr.Close() process.stderr = nil - } return nil } @@ -414,7 +504,7 @@ func (process *Process) CloseStderr(ctx context.Context) (err error) { // or wait on it. func (process *Process) Close() (err error) { operation := "hcs::Process::Close" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go index b621c5593..d1f219cfa 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema1/schema1.go @@ -1,3 +1,5 @@ +//go:build windows + package schema1 import ( @@ -101,7 +103,7 @@ type ContainerConfig struct { HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM Servicing bool `json:",omitempty"` // True if this container is for servicing AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution - DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution + DNSSearchList string `json:",omitempty"` // Comma separated list of DNS suffixes to use for name resolution ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/attachment.go index bcfeb34d5..70884aad7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/attachment.go @@ -27,4 +27,10 @@ type Attachment struct { CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` + + SupportCompressedVolumes bool `json:"SupportCompressedVolumes,omitempty"` + + AlwaysAllowSparseFiles bool `json:"AlwaysAllowSparseFiles,omitempty"` + + ExtensibleVirtualDiskType string `json:"ExtensibleVirtualDiskType,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container.go index 4fb231076..39a54432c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/container.go @@ -31,4 +31,6 @@ type Container struct { RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"` AssignedDevices []Device `json:"AssignedDevices,omitempty"` + + AdditionalDeviceNamespace *ContainerDefinitionDevice `json:"AdditionalDeviceNamespace,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_config.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_config.go index f1a28cd38..0be0475d4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_config.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_config.go @@ -14,5 +14,5 @@ type CpuGroupConfig struct { Affinity *CpuGroupAffinity `json:"Affinity,omitempty"` GroupProperties []CpuGroupProperty `json:"GroupProperties,omitempty"` // Hypervisor CPU group IDs exposed to clients - HypervisorGroupId int32 `json:"HypervisorGroupId,omitempty"` + HypervisorGroupId uint64 `json:"HypervisorGroupId,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go index bbad6a2c4..31fe07c3a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/cpu_group_property.go @@ -9,6 +9,14 @@ package hcsschema +type CPUGroupPropertyCode uint32 + +const ( + CPUCapacityProperty = 0x00010000 + CPUSchedulingPriorityProperty = 0x00020000 + IdleLPReserveProperty = 0x00030000 +) + type CpuGroupProperty struct { PropertyCode uint32 `json:"PropertyCode,omitempty"` PropertyValue uint32 `json:"PropertyValue,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/debug_options.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/debug_options.go new file mode 100644 index 000000000..5385850fe --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/debug_options.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DebugOptions struct { + // BugcheckSavedStateFileName is the path for the file in which the guest VM state will be saved when + // the guest crashes. + BugcheckSavedStateFileName string `json:"BugcheckSavedStateFileName,omitempty"` + // BugcheckNoCrashdumpSavedStateFileName is the path of the file in which the guest VM state will be + // saved when the guest crashes but the guest isn't able to generate the crash dump. This usually + // happens in early boot failures. + BugcheckNoCrashdumpSavedStateFileName string `json:"BugcheckNoCrashdumpSavedStateFileName,omitempty"` + TripleFaultSavedStateFileName string `json:"TripleFaultSavedStateFileName,omitempty"` + FirmwareDumpFileName string `json:"FirmwareDumpFileName,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/device.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/device.go index 107caddad..31c4538af 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/device.go @@ -12,9 +12,9 @@ package hcsschema type DeviceType string const ( - ClassGUID DeviceType = "ClassGuid" - DeviceInstance DeviceType = "DeviceInstance" - GPUMirror DeviceType = "GpuMirror" + ClassGUID DeviceType = "ClassGuid" + DeviceInstanceID DeviceType = "DeviceInstance" + GPUMirror DeviceType = "GpuMirror" ) type Device struct { @@ -22,6 +22,6 @@ type Device struct { Type DeviceType `json:"Type,omitempty"` // The interface class guid of the device interfaces to assign to the container. Only used when Type is ClassGuid. InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"` - // The location path of the device to assign to the container. Only used when Type is DeviceInstance. + // The location path of the device to assign to the container. Only used when Type is DeviceInstanceID. LocationPath string `json:"LocationPath,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go index ef1eec886..a48a65394 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/guest_state.go @@ -14,6 +14,9 @@ type GuestState struct { // The path to an existing file uses for persistent guest state storage. An empty string indicates the system should initialize new transient, in-memory guest state. GuestStateFilePath string `json:"GuestStateFilePath,omitempty"` + // The guest state file type affected by different guest isolation modes - whether a file or block storage. + GuestStateFileType string `json:"GuestStateFileType,omitempty"` + // The path to an existing file for persistent runtime state storage. An empty string indicates the system should initialize new transient, in-memory runtime state. RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/isolation_settings.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/isolation_settings.go new file mode 100644 index 000000000..3726a297e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/isolation_settings.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type IsolationSettings struct { + // Guest isolation type options to decide virtual trust levels of virtual machine + IsolationType string `json:"IsolationType,omitempty"` + // Configuration to debug HCL layer for HCS VM TODO: Task 31102306: Miss the way to prevent the exposure of private debug configuration in HCS TODO: Think about the secret configurations which are private in VMMS VM (only edit by hvsedit) + DebugHost string `json:"DebugHost,omitempty"` + DebugPort int64 `json:"DebugPort,omitempty"` + // Optional data passed by host on isolated virtual machine start + LaunchData string `json:"LaunchData,omitempty"` + HclEnabled bool `json:"HclEnabled,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_container_definition_device.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_container_definition_device.go new file mode 100644 index 000000000..8dbe40b3b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_container_definition_device.go @@ -0,0 +1,14 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerDefinitionDevice struct { + DeviceExtension []DeviceExtension `json:"device_extension,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_category.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_category.go new file mode 100644 index 000000000..8fe89f927 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_category.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceCategory struct { + Name string `json:"name,omitempty"` + InterfaceClass []InterfaceClass `json:"interface_class,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_extension.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_extension.go new file mode 100644 index 000000000..a62568d89 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_extension.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceExtension struct { + DeviceCategory *DeviceCategory `json:"device_category,omitempty"` + Namespace *DeviceExtensionNamespace `json:"namespace,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_instance.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_instance.go new file mode 100644 index 000000000..a7410febd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_instance.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceInstance struct { + Id string `json:"id,omitempty"` + LocationPath string `json:"location_path,omitempty"` + PortName string `json:"port_name,omitempty"` + InterfaceClass []InterfaceClass `json:"interface_class,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_namespace.go new file mode 100644 index 000000000..355364064 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_device_namespace.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceNamespace struct { + RequiresDriverstore bool `json:"requires_driverstore,omitempty"` + DeviceCategory []DeviceCategory `json:"device_category,omitempty"` + DeviceInstance []DeviceInstance `json:"device_instance,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_interface_class.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_interface_class.go new file mode 100644 index 000000000..7be98b541 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_interface_class.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type InterfaceClass struct { + Type_ string `json:"type,omitempty"` + Identifier string `json:"identifier,omitempty"` + Recurse bool `json:"recurse,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_namespace.go new file mode 100644 index 000000000..3ab9cf1ec --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_namespace.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type DeviceExtensionNamespace struct { + Ob *ObjectNamespace `json:"ob,omitempty"` + Device *DeviceNamespace `json:"device,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_directory.go new file mode 100644 index 000000000..d2f51b3b5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_directory.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ObjectDirectory struct { + Name string `json:"name,omitempty"` + Clonesd string `json:"clonesd,omitempty"` + Shadow string `json:"shadow,omitempty"` + Symlink []ObjectSymlink `json:"symlink,omitempty"` + Objdir []ObjectDirectory `json:"objdir,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_namespace.go new file mode 100644 index 000000000..47dfb55bf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_namespace.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ObjectNamespace struct { + Shadow string `json:"shadow,omitempty"` + Symlink []ObjectSymlink `json:"symlink,omitempty"` + Objdir []ObjectDirectory `json:"objdir,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_symlink.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_symlink.go new file mode 100644 index 000000000..8867ebe5f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/model_object_symlink.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ObjectSymlink struct { + Name string `json:"name,omitempty"` + Path string `json:"path,omitempty"` + Scope string `json:"scope,omitempty"` + Pathtoclone string `json:"pathtoclone,omitempty"` + AccessMask int32 `json:"access_mask,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go index d29455a3e..6364da8e2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/modify_setting_request.go @@ -9,10 +9,12 @@ package hcsschema +import "github.com/Microsoft/hcsshim/internal/protocol/guestrequest" + type ModifySettingRequest struct { ResourcePath string `json:"ResourcePath,omitempty"` - RequestType string `json:"RequestType,omitempty"` + RequestType guestrequest.RequestType `json:"RequestType,omitempty"` // NOTE: Swagger generated as string. Locally updated. Settings interface{} `json:"Settings,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/security_settings.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/security_settings.go new file mode 100644 index 000000000..14f0299e3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/security_settings.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SecuritySettings struct { + // Enablement of Trusted Platform Module on the computer system + EnableTpm bool `json:"EnableTpm,omitempty"` + Isolation *IsolationSettings `json:"Isolation,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/system_time.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/system_time.go new file mode 100644 index 000000000..72de80149 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/system_time.go @@ -0,0 +1,28 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SystemTime struct { + Year int32 `json:"Year,omitempty"` + + Month int32 `json:"Month,omitempty"` + + DayOfWeek int32 `json:"DayOfWeek,omitempty"` + + Day int32 `json:"Day,omitempty"` + + Hour int32 `json:"Hour,omitempty"` + + Minute int32 `json:"Minute,omitempty"` + + Second int32 `json:"Second,omitempty"` + + Milliseconds int32 `json:"Milliseconds,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/time_zone_information.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/time_zone_information.go new file mode 100644 index 000000000..529743d75 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/time_zone_information.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type TimeZoneInformation struct { + Bias int32 `json:"Bias,omitempty"` + + StandardName string `json:"StandardName,omitempty"` + + StandardDate *SystemTime `json:"StandardDate,omitempty"` + + StandardBias int32 `json:"StandardBias,omitempty"` + + DaylightName string `json:"DaylightName,omitempty"` + + DaylightDate *SystemTime `json:"DaylightDate,omitempty"` + + DaylightBias int32 `json:"DaylightBias,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go index 0e48ece50..9228923fe 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/uefi.go @@ -12,6 +12,8 @@ package hcsschema type Uefi struct { EnableDebugger bool `json:"EnableDebugger,omitempty"` + ApplySecureBootTemplate string `json:"ApplySecureBootTemplate,omitempty"` + SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` BootThis *UefiBootEntry `json:"BootThis,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go index 2d22b1bcb..1e0fab289 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_machine.go @@ -29,4 +29,8 @@ type VirtualMachine struct { StorageQoS *StorageQoS `json:"StorageQoS,omitempty"` GuestConnection *GuestConnection `json:"GuestConnection,omitempty"` + + SecuritySettings *SecuritySettings `json:"SecuritySettings,omitempty"` + + DebugOptions *DebugOptions `json:"DebugOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_mapping.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_mapping.go new file mode 100644 index 000000000..9ef322f61 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/schema2/virtual_p_mem_mapping.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.4 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemMapping struct { + HostPath string `json:"HostPath,omitempty"` + ImageFormat string `json:"ImageFormat,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go index a634dfc15..a46b0051d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index b478931c3..cf20adefc 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,20 +1,27 @@ +//go:build windows + package hcs import ( "context" "encoding/json" "errors" + "fmt" "strings" "sync" "syscall" + "time" "github.com/Microsoft/hcsshim/internal/cow" "github.com/Microsoft/hcsshim/internal/hcs/schema1" hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" + "github.com/Microsoft/hcsshim/internal/jobobject" "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/timeout" "github.com/Microsoft/hcsshim/internal/vmcompute" + "github.com/sirupsen/logrus" "go.opencensus.io/trace" ) @@ -28,9 +35,13 @@ type System struct { waitBlock chan struct{} waitError error exitError error - os, typ string + os, typ, owner string + startTime time.Time } +var _ cow.Container = &System{} +var _ cow.ProcessHost = &System{} + func newSystem(id string) *System { return &System{ id: id, @@ -38,13 +49,18 @@ func newSystem(id string) *System { } } +// Implementation detail for silo naming, this should NOT be relied upon very heavily. +func siloNameFmt(containerID string) string { + return fmt.Sprintf(`\Container_%s`, containerID) +} + // CreateComputeSystem creates a new compute system with the given configuration but does not start it. func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcs::CreateComputeSystem" // hcsCreateComputeSystemContext is an async operation. Start the outer span // here to measure the full create time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", id)) @@ -78,7 +94,8 @@ func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface in } } - events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, + hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to @@ -127,6 +144,7 @@ func (computeSystem *System) getCachedProperties(ctx context.Context) error { } computeSystem.typ = strings.ToLower(props.SystemType) computeSystem.os = strings.ToLower(props.RuntimeOSType) + computeSystem.owner = strings.ToLower(props.Owner) if computeSystem.os == "" && computeSystem.typ == "container" { // Pre-RS5 HCS did not return the OS, but it only supported containers // that ran Windows. @@ -178,7 +196,7 @@ func (computeSystem *System) Start(ctx context.Context) (err error) { // hcsStartComputeSystemContext is an async operation. Start the outer span // here to measure the full start time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -186,16 +204,19 @@ func (computeSystem *System) Start(ctx context.Context) (err error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() + // prevent starting an exited system because waitblock we do not recreate waitBlock + // or rerun waitBackground, so we have no way to be notified of it closing again if computeSystem.handle == 0 { return makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) } resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") - events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, + hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { return makeSystemError(computeSystem, operation, err, events) } - + computeSystem.startTime = time.Now() return nil } @@ -211,7 +232,7 @@ func (computeSystem *System) Shutdown(ctx context.Context) error { operation := "hcs::System::Shutdown" - if computeSystem.handle == 0 { + if computeSystem.handle == 0 || computeSystem.stopped() { return nil } @@ -232,7 +253,7 @@ func (computeSystem *System) Terminate(ctx context.Context) error { operation := "hcs::System::Terminate" - if computeSystem.handle == 0 { + if computeSystem.handle == 0 || computeSystem.stopped() { return nil } @@ -253,7 +274,7 @@ func (computeSystem *System) Terminate(ctx context.Context) error { // safe to call multiple times. func (computeSystem *System) waitBackground() { operation := "hcs::System::waitBackground" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -290,17 +311,25 @@ func (computeSystem *System) Wait() error { return computeSystem.WaitError() } -// ExitError returns an error describing the reason the compute system terminated. -func (computeSystem *System) ExitError() error { +// stopped returns true if the compute system stopped. +func (computeSystem *System) stopped() bool { select { case <-computeSystem.waitBlock: - if computeSystem.waitError != nil { - return computeSystem.waitError - } - return computeSystem.exitError + return true default: + } + return false +} + +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { + if !computeSystem.stopped() { return errors.New("container not exited") } + if computeSystem.waitError != nil { + return computeSystem.waitError + } + return computeSystem.exitError } // Properties returns the requested container properties targeting a V1 schema container. @@ -310,6 +339,10 @@ func (computeSystem *System) Properties(ctx context.Context, types ...schema1.Pr operation := "hcs::System::Properties" + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) if err != nil { return nil, makeSystemError(computeSystem, operation, err, nil) @@ -332,13 +365,125 @@ func (computeSystem *System) Properties(ctx context.Context, types ...schema1.Pr return properties, nil } -// PropertiesV2 returns the requested container properties targeting a V2 schema container. -func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) { - computeSystem.handleLock.RLock() - defer computeSystem.handleLock.RUnlock() +// queryInProc handles querying for container properties without reaching out to HCS. `props` +// will be updated to contain any data returned from the queries present in `types`. If any properties +// failed to be queried they will be tallied up and returned in as the first return value. Failures on +// query are NOT considered errors; the only failure case for this method is if the containers job object +// cannot be opened. +func (computeSystem *System) queryInProc( + ctx context.Context, + props *hcsschema.Properties, + types []hcsschema.PropertyType, +) ([]hcsschema.PropertyType, error) { + // In the future we can make use of some new functionality in the HCS that allows you + // to pass a job object for HCS to use for the container. Currently, the only way we'll + // be able to open the job/silo is if we're running as SYSTEM. + jobOptions := &jobobject.Options{ + UseNTVariant: true, + Name: siloNameFmt(computeSystem.id), + } + job, err := jobobject.Open(ctx, jobOptions) + if err != nil { + return nil, err + } + defer job.Close() + + var fallbackQueryTypes []hcsschema.PropertyType + for _, propType := range types { + switch propType { + case hcsschema.PTStatistics: + // Handle a bad caller asking for the same type twice. No use in re-querying if this is + // filled in already. + if props.Statistics == nil { + props.Statistics, err = computeSystem.statisticsInProc(job) + if err != nil { + log.G(ctx).WithError(err).Warn("failed to get statistics in-proc") + + fallbackQueryTypes = append(fallbackQueryTypes, propType) + } + } + default: + fallbackQueryTypes = append(fallbackQueryTypes, propType) + } + } + + return fallbackQueryTypes, nil +} + +// statisticsInProc emulates what HCS does to grab statistics for a given container with a small +// change to make grabbing the private working set total much more efficient. +func (computeSystem *System) statisticsInProc(job *jobobject.JobObject) (*hcsschema.Statistics, error) { + // Start timestamp for these stats before we grab them to match HCS + timestamp := time.Now() + + memInfo, err := job.QueryMemoryStats() + if err != nil { + return nil, err + } + + processorInfo, err := job.QueryProcessorStats() + if err != nil { + return nil, err + } + + storageInfo, err := job.QueryStorageStats() + if err != nil { + return nil, err + } + // This calculates the private working set more efficiently than HCS does. HCS calls NtQuerySystemInformation + // with the class SystemProcessInformation which returns an array containing system information for *every* + // process running on the machine. They then grab the pids that are running in the container and filter down + // the entries in the array to only what's running in that silo and start tallying up the total. This doesn't + // work well as performance should get worse if more processess are running on the machine in general and not + // just in the container. All of the additional information besides the WorkingSetPrivateSize field is ignored + // as well which isn't great and is wasted work to fetch. + // + // HCS only let's you grab statistics in an all or nothing fashion, so we can't just grab the private + // working set ourselves and ask for everything else separately. The optimization we can make here is + // to open the silo ourselves and do the same queries for the rest of the info, as well as calculating + // the private working set in a more efficient manner by: + // + // 1. Find the pids running in the silo + // 2. Get a process handle for every process (only need PROCESS_QUERY_LIMITED_INFORMATION access) + // 3. Call NtQueryInformationProcess on each process with the class ProcessVmCounters + // 4. Tally up the total using the field PrivateWorkingSetSize in VM_COUNTERS_EX2. + privateWorkingSet, err := job.QueryPrivateWorkingSet() + if err != nil { + return nil, err + } + + return &hcsschema.Statistics{ + Timestamp: timestamp, + ContainerStartTime: computeSystem.startTime, + Uptime100ns: uint64(time.Since(computeSystem.startTime).Nanoseconds()) / 100, + Memory: &hcsschema.MemoryStats{ + MemoryUsageCommitBytes: memInfo.JobMemory, + MemoryUsageCommitPeakBytes: memInfo.PeakJobMemoryUsed, + MemoryUsagePrivateWorkingSetBytes: privateWorkingSet, + }, + Processor: &hcsschema.ProcessorStats{ + RuntimeKernel100ns: uint64(processorInfo.TotalKernelTime), + RuntimeUser100ns: uint64(processorInfo.TotalUserTime), + TotalRuntime100ns: uint64(processorInfo.TotalKernelTime + processorInfo.TotalUserTime), + }, + Storage: &hcsschema.StorageStats{ + ReadCountNormalized: uint64(storageInfo.ReadStats.IoCount), + ReadSizeBytes: storageInfo.ReadStats.TotalSize, + WriteCountNormalized: uint64(storageInfo.WriteStats.IoCount), + WriteSizeBytes: storageInfo.WriteStats.TotalSize, + }, + }, nil +} + +// hcsPropertiesV2Query is a helper to make a HcsGetComputeSystemProperties call using the V2 schema property types. +func (computeSystem *System) hcsPropertiesV2Query(ctx context.Context, types []hcsschema.PropertyType) (*hcsschema.Properties, error) { operation := "hcs::System::PropertiesV2" + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, operation, ErrAlreadyClosed, nil) + } + queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) if err != nil { return nil, makeSystemError(computeSystem, operation, err, nil) @@ -353,21 +498,75 @@ func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschem if propertiesJSON == "" { return nil, ErrUnexpectedValue } - properties := &hcsschema.Properties{} - if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + props := &hcsschema.Properties{} + if err := json.Unmarshal([]byte(propertiesJSON), props); err != nil { return nil, makeSystemError(computeSystem, operation, err, nil) } - return properties, nil + return props, nil +} + +// PropertiesV2 returns the requested compute systems properties targeting a V2 schema compute system. +func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (_ *hcsschema.Properties, err error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + // Let HCS tally up the total for VM based queries instead of querying ourselves. + if computeSystem.typ != "container" { + return computeSystem.hcsPropertiesV2Query(ctx, types) + } + + // Define a starter Properties struct with the default fields returned from every + // query. Owner is only returned from Statistics but it's harmless to include. + properties := &hcsschema.Properties{ + Id: computeSystem.id, + SystemType: computeSystem.typ, + RuntimeOsType: computeSystem.os, + Owner: computeSystem.owner, + } + + logEntry := log.G(ctx) + // First lets try and query ourselves without reaching to HCS. If any of the queries fail + // we'll take note and fallback to querying HCS for any of the failed types. + fallbackTypes, err := computeSystem.queryInProc(ctx, properties, types) + if err == nil && len(fallbackTypes) == 0 { + return properties, nil + } else if err != nil { + logEntry = logEntry.WithError(fmt.Errorf("failed to query compute system properties in-proc: %w", err)) + fallbackTypes = types + } + + logEntry.WithFields(logrus.Fields{ + logfields.ContainerID: computeSystem.id, + "propertyTypes": fallbackTypes, + }).Info("falling back to HCS for property type queries") + + hcsProperties, err := computeSystem.hcsPropertiesV2Query(ctx, fallbackTypes) + if err != nil { + return nil, err + } + + // Now add in anything that we might have successfully queried in process. + if properties.Statistics != nil { + hcsProperties.Statistics = properties.Statistics + hcsProperties.Owner = properties.Owner + } + + // For future support for querying processlist in-proc as well. + if properties.ProcessList != nil { + hcsProperties.ProcessList = properties.ProcessList + } + + return hcsProperties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. func (computeSystem *System) Pause(ctx context.Context) (err error) { operation := "hcs::System::Pause" - // hcsPauseComputeSystemContext is an async peration. Start the outer span + // hcsPauseComputeSystemContext is an async operation. Start the outer span // here to measure the full pause time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -380,7 +579,8 @@ func (computeSystem *System) Pause(ctx context.Context) (err error) { } resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") - events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, + hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { return makeSystemError(computeSystem, operation, err, events) } @@ -394,7 +594,7 @@ func (computeSystem *System) Resume(ctx context.Context) (err error) { // hcsResumeComputeSystemContext is an async operation. Start the outer span // here to measure the full restore time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -407,7 +607,8 @@ func (computeSystem *System) Resume(ctx context.Context) (err error) { } resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") - events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, + hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { return makeSystemError(computeSystem, operation, err, events) } @@ -419,9 +620,9 @@ func (computeSystem *System) Resume(ctx context.Context) (err error) { func (computeSystem *System) Save(ctx context.Context, options interface{}) (err error) { operation := "hcs::System::Save" - // hcsSaveComputeSystemContext is an async peration. Start the outer span + // hcsSaveComputeSystemContext is an async operation. Start the outer span // here to measure the full save time. - ctx, span := trace.StartSpan(ctx, operation) + ctx, span := oc.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -439,7 +640,8 @@ func (computeSystem *System) Save(ctx context.Context, options interface{}) (err } result, err := vmcompute.HcsSaveComputeSystem(ctx, computeSystem.handle, string(saveOptions)) - events, err := processAsyncHcsResult(ctx, err, result, computeSystem.callbackNumber, hcsNotificationSystemSaveCompleted, &timeout.SystemSave) + events, err := processAsyncHcsResult(ctx, err, result, computeSystem.callbackNumber, + hcsNotificationSystemSaveCompleted, &timeout.SystemSave) if err != nil { return makeSystemError(computeSystem, operation, err, events) } @@ -464,6 +666,11 @@ func (computeSystem *System) createProcess(ctx context.Context, operation string processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) events := processHcsResult(ctx, resultJSON) if err != nil { + if v2, ok := c.(*hcsschema.ProcessParameters); ok { + operation += ": " + v2.CommandLine + } else if v1, ok := c.(*schema1.ProcessConfig); ok { + operation += ": " + v1.CommandLine + } return nil, nil, makeSystemError(computeSystem, operation, err, events) } @@ -530,7 +737,7 @@ func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { operation := "hcs::System::Close" - ctx, span := trace.StartSpan(context.Background(), operation) + ctx, span := oc.StartSpan(context.Background(), operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) @@ -573,7 +780,8 @@ func (computeSystem *System) registerCallback(ctx context.Context) error { callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, + notificationWatcherCallback, callbackNumber) if err != nil { return err } @@ -600,7 +808,7 @@ func (computeSystem *System) unregisterCallback(ctx context.Context) error { return nil } - // hcsUnregisterComputeSystemCallback has its own syncronization + // hcsUnregisterComputeSystemCallback has its own synchronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go index 3342e5bb9..5dcb97eb3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index db4e14fdf..3a51ed195 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,3 +1,5 @@ +//go:build windows + package hcs import ( @@ -7,7 +9,14 @@ import ( "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { +func processAsyncHcsResult( + ctx context.Context, + err error, + resultJSON string, + callbackNumber uintptr, + expectedNotification hcsNotification, + timeout *time.Duration, +) ([]ErrorEvent, error) { events := processHcsResult(ctx, resultJSON) if IsPending(err) { return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) @@ -16,7 +25,12 @@ func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, ca return events, err } -func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification( + ctx context.Context, + callbackNumber uintptr, + expectedNotification hcsNotification, + timeout *time.Duration, +) error { callbackMapLock.RLock() if _, ok := callbackMap[callbackNumber]; !ok { callbackMapLock.RUnlock() diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/doc.go new file mode 100644 index 000000000..ce7067678 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/doc.go @@ -0,0 +1 @@ +package hcserror diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go index 921c2c855..a70d80da0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go @@ -1,11 +1,13 @@ +//go:build windows + package hcserror import ( + "errors" "fmt" - "syscall" -) -const ERROR_GEN_FAILURE = syscall.Errno(31) + "golang.org/x/sys/windows" +) type HcsError struct { title string @@ -30,18 +32,21 @@ func (e *HcsError) Error() string { func New(err error, title, rest string) error { // Pass through DLL errors directly since they do not originate from HCS. - if _, ok := err.(*syscall.DLLError); ok { + var e *windows.DLLError + if errors.As(err, &e) { return err } return &HcsError{title, rest, err} } func Win32FromError(err error) uint32 { - if herr, ok := err.(*HcsError); ok { + var herr *HcsError + if errors.As(err, &herr) { return Win32FromError(herr.Err) } - if code, ok := err.(syscall.Errno); ok { + var code windows.Errno + if errors.As(err, &code) { return uint32(code) } - return uint32(ERROR_GEN_FAILURE) + return uint32(windows.ERROR_GEN_FAILURE) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/doc.go new file mode 100644 index 000000000..f6d35df0e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/doc.go @@ -0,0 +1 @@ +package hns diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go index b2e475f53..ec4c907d1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go @@ -2,7 +2,7 @@ package hns import "fmt" -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go hns.go //sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 262714b4d..593664419 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( @@ -20,6 +22,7 @@ type HNSEndpoint struct { IPv6Address net.IP `json:",omitempty"` DNSSuffix string `json:",omitempty"` DNSServerList string `json:",omitempty"` + DNSDomain string `json:",omitempty"` GatewayAddress string `json:",omitempty"` GatewayAddressV6 string `json:",omitempty"` EnableInternalDNS bool `json:",omitempty"` @@ -33,7 +36,7 @@ type HNSEndpoint struct { SharedContainers []string `json:",omitempty"` } -//SystemType represents the type of the system on which actions are done +// SystemType represents the type of the system on which actions are done type SystemType string // SystemType const @@ -145,7 +148,6 @@ func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { } return false, nil - } // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods @@ -280,7 +282,6 @@ func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { return err } return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) - } // HostDetach detaches a nic on the host diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 2df4a57f5..0a8f36d83 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go index a8d8cc56a..464bb8954 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go @@ -1,3 +1,5 @@ +//go:build windows + package hns type HNSGlobals struct { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go index f12d3ab04..8861faee7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -1,13 +1,16 @@ +//go:build windows + package hns import ( "encoding/json" "errors" - "github.com/sirupsen/logrus" "net" + + "github.com/sirupsen/logrus" ) -// Subnet is assoicated with a network and represents a list +// Subnet is associated with a network and represents a list // of subnets available to the network type Subnet struct { AddressPrefix string `json:",omitempty"` @@ -15,7 +18,7 @@ type Subnet struct { Policies []json.RawMessage `json:",omitempty"` } -// MacPool is assoicated with a network and represents a list +// MacPool is associated with a network and represents a list // of macaddresses available to the network type MacPool struct { StartMacAddress string `json:",omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go index 6765aaead..082c018a4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -21,10 +21,11 @@ const ( ) type NatPolicy struct { - Type PolicyType `json:"Type"` - Protocol string - InternalPort uint16 - ExternalPort uint16 + Type PolicyType `json:"Type"` + Protocol string `json:",omitempty"` + InternalPort uint16 `json:",omitempty"` + ExternalPort uint16 `json:",omitempty"` + ExternalPortReserved bool `json:",omitempty"` } type QosPolicy struct { @@ -88,20 +89,20 @@ const ( type ACLPolicy struct { Type PolicyType `json:"Type"` Id string `json:"Id,omitempty"` - Protocol uint16 - Protocols string `json:"Protocols,omitempty"` - InternalPort uint16 + Protocol uint16 `json:",omitempty"` + Protocols string `json:"Protocols,omitempty"` + InternalPort uint16 `json:",omitempty"` Action ActionType Direction DirectionType - LocalAddresses string - RemoteAddresses string - LocalPorts string `json:"LocalPorts,omitempty"` - LocalPort uint16 - RemotePorts string `json:"RemotePorts,omitempty"` - RemotePort uint16 + LocalAddresses string `json:",omitempty"` + RemoteAddresses string `json:",omitempty"` + LocalPorts string `json:"LocalPorts,omitempty"` + LocalPort uint16 `json:",omitempty"` + RemotePorts string `json:"RemotePorts,omitempty"` + RemotePort uint16 `json:",omitempty"` RuleType RuleType `json:"RuleType,omitempty"` - Priority uint16 - ServiceName string + Priority uint16 `json:",omitempty"` + ServiceName string `json:",omitempty"` } type Policy struct { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go index 31322a681..b98db40e8 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go index d5efba7f2..b9c30b901 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go index d3b04eefe..749588ad3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go @@ -1,3 +1,5 @@ +//go:build windows + package hns import ( diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go index 204633a48..a35ee945d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package hns @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -62,7 +65,8 @@ func _hnsCall(method string, path string, object string, response **uint16) (hr } func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { - if hr = procHNSCall.Find(); hr != nil { + hr = procHNSCall.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/doc.go new file mode 100644 index 000000000..cb554867f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/doc.go @@ -0,0 +1 @@ +package interop diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 922f7c679..a56469656 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -1,3 +1,5 @@ +//go:build windows + package interop import ( @@ -5,7 +7,7 @@ import ( "unsafe" ) -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go interop.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go interop.go //sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go index 12b0c71c5..a17a11250 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package interop @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/doc.go new file mode 100644 index 000000000..34b53d6e4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/doc.go @@ -0,0 +1,8 @@ +// This package provides higher level constructs for the win32 job object API. +// Most of the core creation and management functions are already present in "golang.org/x/sys/windows" +// (CreateJobObject, AssignProcessToJobObject, etc.) as well as most of the limit information +// structs and associated limit flags. Whatever is not present from the job object API +// in golang.org/x/sys/windows is located in /internal/winapi. +// +// https://docs.microsoft.com/en-us/windows/win32/procthread/job-objects +package jobobject diff --git a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go new file mode 100644 index 000000000..bcca84b0d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/iocp.go @@ -0,0 +1,113 @@ +//go:build windows + +package jobobject + +import ( + "context" + "fmt" + "sync" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/queue" + "github.com/Microsoft/hcsshim/internal/winapi" + "github.com/sirupsen/logrus" + "golang.org/x/sys/windows" +) + +var ( + ioInitOnce sync.Once + initIOErr error + // Global iocp handle that will be re-used for every job object + ioCompletionPort windows.Handle + // Mapping of job handle to queue to place notifications in. + jobMap sync.Map +) + +// MsgAllProcessesExited is a type representing a message that every process in a job has exited. +type MsgAllProcessesExited struct{} + +// MsgUnimplemented represents a message that we are aware of, but that isn't implemented currently. +// This should not be treated as an error. +type MsgUnimplemented struct{} + +// pollIOCP polls the io completion port forever. +func pollIOCP(ctx context.Context, iocpHandle windows.Handle) { + var ( + overlapped uintptr + code uint32 + key uintptr + ) + + for { + err := windows.GetQueuedCompletionStatus(iocpHandle, &code, &key, (**windows.Overlapped)(unsafe.Pointer(&overlapped)), windows.INFINITE) + if err != nil { + log.G(ctx).WithError(err).Error("failed to poll for job object message") + continue + } + if val, ok := jobMap.Load(key); ok { + msq, ok := val.(*queue.MessageQueue) + if !ok { + log.G(ctx).WithField("value", msq).Warn("encountered non queue type in job map") + continue + } + notification, err := parseMessage(code, overlapped) + if err != nil { + log.G(ctx).WithFields(logrus.Fields{ + "code": code, + "overlapped": overlapped, + }).Warn("failed to parse job object message") + continue + } + if err := msq.Enqueue(notification); err == queue.ErrQueueClosed { + // Write will only return an error when the queue is closed. + // The only time a queue would ever be closed is when we call `Close` on + // the job it belongs to which also removes it from the jobMap, so something + // went wrong here. We can't return as this is reading messages for all jobs + // so just log it and move on. + log.G(ctx).WithFields(logrus.Fields{ + "code": code, + "overlapped": overlapped, + }).Warn("tried to write to a closed queue") + continue + } + } else { + log.G(ctx).Warn("received a message for a job not present in the mapping") + } + } +} + +func parseMessage(code uint32, overlapped uintptr) (interface{}, error) { + // Check code and parse out relevant information related to that notification + // that we care about. For now all we handle is the message that all processes + // in the job have exited. + switch code { + case winapi.JOB_OBJECT_MSG_ACTIVE_PROCESS_ZERO: + return MsgAllProcessesExited{}, nil + // Other messages for completeness and a check to make sure that if we fall + // into the default case that this is a code we don't know how to handle. + case winapi.JOB_OBJECT_MSG_END_OF_JOB_TIME: + case winapi.JOB_OBJECT_MSG_END_OF_PROCESS_TIME: + case winapi.JOB_OBJECT_MSG_ACTIVE_PROCESS_LIMIT: + case winapi.JOB_OBJECT_MSG_NEW_PROCESS: + case winapi.JOB_OBJECT_MSG_EXIT_PROCESS: + case winapi.JOB_OBJECT_MSG_ABNORMAL_EXIT_PROCESS: + case winapi.JOB_OBJECT_MSG_PROCESS_MEMORY_LIMIT: + case winapi.JOB_OBJECT_MSG_JOB_MEMORY_LIMIT: + case winapi.JOB_OBJECT_MSG_NOTIFICATION_LIMIT: + default: + return nil, fmt.Errorf("unknown job notification type: %d", code) + } + return MsgUnimplemented{}, nil +} + +// Assigns an IO completion port to get notified of events for the registered job +// object. +func attachIOCP(job windows.Handle, iocp windows.Handle) error { + info := winapi.JOBOBJECT_ASSOCIATE_COMPLETION_PORT{ + CompletionKey: job, + CompletionPort: iocp, + } + _, err := windows.SetInformationJobObject(job, windows.JobObjectAssociateCompletionPortInformation, uintptr(unsafe.Pointer(&info)), uint32(unsafe.Sizeof(info))) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go new file mode 100644 index 000000000..64afd35dc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/jobobject.go @@ -0,0 +1,669 @@ +//go:build windows + +package jobobject + +import ( + "context" + "errors" + "fmt" + "os" + "path/filepath" + "sync" + "sync/atomic" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/queue" + "github.com/Microsoft/hcsshim/internal/winapi" + "golang.org/x/sys/windows" +) + +// JobObject is a high level wrapper around a Windows job object. Holds a handle to +// the job, a queue to receive iocp notifications about the lifecycle +// of the job and a mutex for synchronized handle access. +type JobObject struct { + handle windows.Handle + // All accesses to this MUST be done atomically except in `Open` as the object + // is being created in the function. 1 signifies that this job is currently a silo. + silo uint32 + mq *queue.MessageQueue + handleLock sync.RWMutex +} + +// JobLimits represents the resource constraints that can be applied to a job object. +type JobLimits struct { + CPULimit uint32 + CPUWeight uint32 + MemoryLimitInBytes uint64 + MaxIOPS int64 + MaxBandwidth int64 +} + +type CPURateControlType uint32 + +const ( + WeightBased CPURateControlType = iota + RateBased +) + +// Processor resource controls +const ( + cpuLimitMin = 1 + cpuLimitMax = 10000 + cpuWeightMin = 1 + cpuWeightMax = 9 +) + +var ( + ErrAlreadyClosed = errors.New("the handle has already been closed") + ErrNotRegistered = errors.New("job is not registered to receive notifications") + ErrNotSilo = errors.New("job is not a silo") +) + +// Options represents the set of configurable options when making or opening a job object. +type Options struct { + // `Name` specifies the name of the job object if a named job object is desired. + Name string + // `Notifications` specifies if the job will be registered to receive notifications. + // Defaults to false. + Notifications bool + // `UseNTVariant` specifies if we should use the `Nt` variant of Open/CreateJobObject. + // Defaults to false. + UseNTVariant bool + // `Silo` specifies to promote the job to a silo. This additionally sets the flag + // JOB_OBJECT_LIMIT_KILL_ON_JOB_CLOSE as it is required for the upgrade to complete. + Silo bool + // `IOTracking` enables tracking I/O statistics on the job object. More specifically this + // calls SetInformationJobObject with the JobObjectIoAttribution class. + EnableIOTracking bool +} + +// Create creates a job object. +// +// If options.Name is an empty string, the job will not be assigned a name. +// +// If options.Notifications are not enabled `PollNotifications` will return immediately with error `errNotRegistered`. +// +// If `options` is nil, use default option values. +// +// Returns a JobObject structure and an error if there is one. +func Create(ctx context.Context, options *Options) (_ *JobObject, err error) { + if options == nil { + options = &Options{} + } + + var jobName *winapi.UnicodeString + if options.Name != "" { + jobName, err = winapi.NewUnicodeString(options.Name) + if err != nil { + return nil, err + } + } + + var jobHandle windows.Handle + if options.UseNTVariant { + oa := winapi.ObjectAttributes{ + Length: unsafe.Sizeof(winapi.ObjectAttributes{}), + ObjectName: jobName, + Attributes: 0, + } + status := winapi.NtCreateJobObject(&jobHandle, winapi.JOB_OBJECT_ALL_ACCESS, &oa) + if status != 0 { + return nil, winapi.RtlNtStatusToDosError(status) + } + } else { + var jobNameBuf *uint16 + if jobName != nil && jobName.Buffer != nil { + jobNameBuf = jobName.Buffer + } + jobHandle, err = windows.CreateJobObject(nil, jobNameBuf) + if err != nil { + return nil, err + } + } + + defer func() { + if err != nil { + windows.Close(jobHandle) + } + }() + + job := &JobObject{ + handle: jobHandle, + } + + // If the IOCP we'll be using to receive messages for all jobs hasn't been + // created, create it and start polling. + if options.Notifications { + mq, err := setupNotifications(ctx, job) + if err != nil { + return nil, err + } + job.mq = mq + } + + if options.EnableIOTracking { + if err := enableIOTracking(jobHandle); err != nil { + return nil, err + } + } + + if options.Silo { + // This is a required setting for upgrading to a silo. + if err := job.SetTerminateOnLastHandleClose(); err != nil { + return nil, err + } + if err := job.PromoteToSilo(); err != nil { + return nil, err + } + } + + return job, nil +} + +// Open opens an existing job object with name provided in `options`. If no name is provided +// return an error since we need to know what job object to open. +// +// If options.Notifications is false `PollNotifications` will return immediately with error `errNotRegistered`. +// +// Returns a JobObject structure and an error if there is one. +func Open(ctx context.Context, options *Options) (_ *JobObject, err error) { + if options == nil || (options != nil && options.Name == "") { + return nil, errors.New("no job object name specified to open") + } + + unicodeJobName, err := winapi.NewUnicodeString(options.Name) + if err != nil { + return nil, err + } + + var jobHandle windows.Handle + if options.UseNTVariant { + oa := winapi.ObjectAttributes{ + Length: unsafe.Sizeof(winapi.ObjectAttributes{}), + ObjectName: unicodeJobName, + Attributes: 0, + } + status := winapi.NtOpenJobObject(&jobHandle, winapi.JOB_OBJECT_ALL_ACCESS, &oa) + if status != 0 { + return nil, winapi.RtlNtStatusToDosError(status) + } + } else { + jobHandle, err = winapi.OpenJobObject(winapi.JOB_OBJECT_ALL_ACCESS, 0, unicodeJobName.Buffer) + if err != nil { + return nil, err + } + } + + defer func() { + if err != nil { + windows.Close(jobHandle) + } + }() + + job := &JobObject{ + handle: jobHandle, + } + + if isJobSilo(jobHandle) { + job.silo = 1 + } + + // If the IOCP we'll be using to receive messages for all jobs hasn't been + // created, create it and start polling. + if options.Notifications { + mq, err := setupNotifications(ctx, job) + if err != nil { + return nil, err + } + job.mq = mq + } + + return job, nil +} + +// helper function to setup notifications for creating/opening a job object +func setupNotifications(ctx context.Context, job *JobObject) (*queue.MessageQueue, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + ioInitOnce.Do(func() { + h, err := windows.CreateIoCompletionPort(windows.InvalidHandle, 0, 0, 0xffffffff) + if err != nil { + initIOErr = err + return + } + ioCompletionPort = h + go pollIOCP(ctx, h) + }) + + if initIOErr != nil { + return nil, initIOErr + } + + mq := queue.NewMessageQueue() + jobMap.Store(uintptr(job.handle), mq) + if err := attachIOCP(job.handle, ioCompletionPort); err != nil { + jobMap.Delete(uintptr(job.handle)) + return nil, fmt.Errorf("failed to attach job to IO completion port: %w", err) + } + return mq, nil +} + +// PollNotification will poll for a job object notification. This call should only be called once +// per job (ideally in a goroutine loop) and will block if there is not a notification ready. +// This call will return immediately with error `ErrNotRegistered` if the job was not registered +// to receive notifications during `Create`. Internally, messages will be queued and there +// is no worry of messages being dropped. +func (job *JobObject) PollNotification() (interface{}, error) { + if job.mq == nil { + return nil, ErrNotRegistered + } + return job.mq.Dequeue() +} + +// UpdateProcThreadAttribute updates the passed in ProcThreadAttributeList to contain what is necessary to +// launch a process in a job at creation time. This can be used to avoid having to call Assign() after a process +// has already started running. +func (job *JobObject) UpdateProcThreadAttribute(attrList *windows.ProcThreadAttributeListContainer) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if err := attrList.Update( + winapi.PROC_THREAD_ATTRIBUTE_JOB_LIST, + unsafe.Pointer(&job.handle), + unsafe.Sizeof(job.handle), + ); err != nil { + return fmt.Errorf("failed to update proc thread attributes for job object: %w", err) + } + + return nil +} + +// Close closes the job object handle. +func (job *JobObject) Close() error { + job.handleLock.Lock() + defer job.handleLock.Unlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if err := windows.Close(job.handle); err != nil { + return err + } + + if job.mq != nil { + job.mq.Close() + } + // Handles now invalid so if the map entry to receive notifications for this job still + // exists remove it so we can stop receiving notifications. + if _, ok := jobMap.Load(uintptr(job.handle)); ok { + jobMap.Delete(uintptr(job.handle)) + } + + job.handle = 0 + return nil +} + +// Assign assigns a process to the job object. +func (job *JobObject) Assign(pid uint32) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if pid == 0 { + return errors.New("invalid pid: 0") + } + hProc, err := windows.OpenProcess(winapi.PROCESS_ALL_ACCESS, true, pid) + if err != nil { + return err + } + defer windows.Close(hProc) + return windows.AssignProcessToJobObject(job.handle, hProc) +} + +// Terminate terminates the job, essentially calls TerminateProcess on every process in the +// job. +func (job *JobObject) Terminate(exitCode uint32) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + if job.handle == 0 { + return ErrAlreadyClosed + } + return windows.TerminateJobObject(job.handle, exitCode) +} + +// Pids returns all of the process IDs in the job object. +func (job *JobObject) Pids() ([]uint32, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_BASIC_PROCESS_ID_LIST{} + err := winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectBasicProcessIdList, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ) + + // This is either the case where there is only one process or no processes in + // the job. Any other case will result in ERROR_MORE_DATA. Check if info.NumberOfProcessIdsInList + // is 1 and just return this, otherwise return an empty slice. + if err == nil { + if info.NumberOfProcessIdsInList == 1 { + return []uint32{uint32(info.ProcessIdList[0])}, nil + } + // Return empty slice instead of nil to play well with the caller of this. + // Do not return an error if no processes are running inside the job + return []uint32{}, nil + } + + if err != winapi.ERROR_MORE_DATA { + return nil, fmt.Errorf("failed initial query for PIDs in job object: %w", err) + } + + jobBasicProcessIDListSize := unsafe.Sizeof(info) + (unsafe.Sizeof(info.ProcessIdList[0]) * uintptr(info.NumberOfAssignedProcesses-1)) + buf := make([]byte, jobBasicProcessIDListSize) + if err = winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectBasicProcessIdList, + unsafe.Pointer(&buf[0]), + uint32(len(buf)), + nil, + ); err != nil { + return nil, fmt.Errorf("failed to query for PIDs in job object: %w", err) + } + + bufInfo := (*winapi.JOBOBJECT_BASIC_PROCESS_ID_LIST)(unsafe.Pointer(&buf[0])) + pids := make([]uint32, bufInfo.NumberOfProcessIdsInList) + for i, bufPid := range bufInfo.AllPids() { + pids[i] = uint32(bufPid) + } + return pids, nil +} + +// QueryMemoryStats gets the memory stats for the job object. +func (job *JobObject) QueryMemoryStats() (*winapi.JOBOBJECT_MEMORY_USAGE_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_MEMORY_USAGE_INFORMATION{} + if err := winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectMemoryUsageInformation, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("failed to query for job object memory stats: %w", err) + } + return &info, nil +} + +// QueryProcessorStats gets the processor stats for the job object. +func (job *JobObject) QueryProcessorStats() (*winapi.JOBOBJECT_BASIC_ACCOUNTING_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_BASIC_ACCOUNTING_INFORMATION{} + if err := winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectBasicAccountingInformation, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("failed to query for job object process stats: %w", err) + } + return &info, nil +} + +// QueryStorageStats gets the storage (I/O) stats for the job object. This call will error +// if either `EnableIOTracking` wasn't set to true on creation of the job, or SetIOTracking() +// hasn't been called since creation of the job. +func (job *JobObject) QueryStorageStats() (*winapi.JOBOBJECT_IO_ATTRIBUTION_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_IO_ATTRIBUTION_INFORMATION{ + ControlFlags: winapi.JOBOBJECT_IO_ATTRIBUTION_CONTROL_ENABLE, + } + if err := winapi.QueryInformationJobObject( + job.handle, + winapi.JobObjectIoAttribution, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("failed to query for job object storage stats: %w", err) + } + return &info, nil +} + +// ApplyFileBinding makes a file binding using the Bind Filter from target to root. If the job has +// not been upgraded to a silo this call will fail. The binding is only applied and visible for processes +// running in the job, any processes on the host or in another job will not be able to see the binding. +func (job *JobObject) ApplyFileBinding(root, target string, readOnly bool) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if !job.isSilo() { + return ErrNotSilo + } + + // The parent directory needs to exist for the bind to work. MkdirAll stats and + // returns nil if the directory exists internally so we should be fine to mkdirall + // every time. + if err := os.MkdirAll(filepath.Dir(root), 0); err != nil { + return err + } + + rootPtr, err := windows.UTF16PtrFromString(root) + if err != nil { + return err + } + + targetPtr, err := windows.UTF16PtrFromString(target) + if err != nil { + return err + } + + flags := winapi.BINDFLT_FLAG_USE_CURRENT_SILO_MAPPING + if readOnly { + flags |= winapi.BINDFLT_FLAG_READ_ONLY_MAPPING + } + + if err := winapi.BfSetupFilter( + job.handle, + flags, + rootPtr, + targetPtr, + nil, + 0, + ); err != nil { + return fmt.Errorf("failed to bind target %q to root %q for job object: %w", target, root, err) + } + return nil +} + +// isJobSilo is a helper to determine if a job object that was opened is a silo. This should ONLY be called +// from `Open` and any callers in this package afterwards should use `job.isSilo()` +func isJobSilo(h windows.Handle) bool { + // None of the information from the structure that this info class expects will be used, this is just used as + // the call will fail if the job hasn't been upgraded to a silo so we can use this to tell when we open a job + // if it's a silo or not. Because none of the info matters simply define a dummy struct with the size that the call + // expects which is 16 bytes. + type isSiloObj struct { + _ [16]byte + } + var siloInfo isSiloObj + err := winapi.QueryInformationJobObject( + h, + winapi.JobObjectSiloBasicInformation, + unsafe.Pointer(&siloInfo), + uint32(unsafe.Sizeof(siloInfo)), + nil, + ) + return err == nil +} + +// PromoteToSilo promotes a job object to a silo. There must be no running processess +// in the job for this to succeed. If the job is already a silo this is a no-op. +func (job *JobObject) PromoteToSilo() error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if job.isSilo() { + return nil + } + + pids, err := job.Pids() + if err != nil { + return err + } + + if len(pids) != 0 { + return fmt.Errorf("job cannot have running processes to be promoted to a silo, found %d running processes", len(pids)) + } + + _, err = windows.SetInformationJobObject( + job.handle, + winapi.JobObjectCreateSilo, + 0, + 0, + ) + if err != nil { + return fmt.Errorf("failed to promote job to silo: %w", err) + } + + atomic.StoreUint32(&job.silo, 1) + return nil +} + +// isSilo returns if the job object is a silo. +func (job *JobObject) isSilo() bool { + return atomic.LoadUint32(&job.silo) == 1 +} + +// QueryPrivateWorkingSet returns the private working set size for the job. This is calculated by adding up the +// private working set for every process running in the job. +func (job *JobObject) QueryPrivateWorkingSet() (uint64, error) { + pids, err := job.Pids() + if err != nil { + return 0, err + } + + openAndQueryWorkingSet := func(pid uint32) (uint64, error) { + h, err := windows.OpenProcess(windows.PROCESS_QUERY_LIMITED_INFORMATION, false, pid) + if err != nil { + // Continue to the next if OpenProcess doesn't return a valid handle (fails). Handles a + // case where one of the pids in the job exited before we open. + return 0, nil + } + defer func() { + _ = windows.Close(h) + }() + // Check if the process is actually running in the job still. There's a small chance + // that the process could have exited and had its pid re-used between grabbing the pids + // in the job and opening the handle to it above. + var inJob int32 + if err := winapi.IsProcessInJob(h, job.handle, &inJob); err != nil { + // This shouldn't fail unless we have incorrect access rights which we control + // here so probably best to error out if this failed. + return 0, err + } + // Don't report stats for this process as it's not running in the job. This shouldn't be + // an error condition though. + if inJob == 0 { + return 0, nil + } + + var vmCounters winapi.VM_COUNTERS_EX2 + status := winapi.NtQueryInformationProcess( + h, + winapi.ProcessVmCounters, + unsafe.Pointer(&vmCounters), + uint32(unsafe.Sizeof(vmCounters)), + nil, + ) + if !winapi.NTSuccess(status) { + return 0, fmt.Errorf("failed to query information for process: %w", winapi.RtlNtStatusToDosError(status)) + } + return uint64(vmCounters.PrivateWorkingSetSize), nil + } + + var jobWorkingSetSize uint64 + for _, pid := range pids { + workingSet, err := openAndQueryWorkingSet(pid) + if err != nil { + return 0, err + } + jobWorkingSetSize += workingSet + } + + return jobWorkingSetSize, nil +} + +// SetIOTracking enables IO tracking for processes in the job object. +// This enables use of the QueryStorageStats method. +func (job *JobObject) SetIOTracking() error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + return enableIOTracking(job.handle) +} + +func enableIOTracking(job windows.Handle) error { + info := winapi.JOBOBJECT_IO_ATTRIBUTION_INFORMATION{ + ControlFlags: winapi.JOBOBJECT_IO_ATTRIBUTION_CONTROL_ENABLE, + } + if _, err := windows.SetInformationJobObject( + job, + winapi.JobObjectIoAttribution, + uintptr(unsafe.Pointer(&info)), + uint32(unsafe.Sizeof(info)), + ); err != nil { + return fmt.Errorf("failed to enable IO tracking on job object: %w", err) + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go new file mode 100644 index 000000000..03f71d9a4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/jobobject/limits.go @@ -0,0 +1,317 @@ +//go:build windows + +package jobobject + +import ( + "errors" + "fmt" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/winapi" + "golang.org/x/sys/windows" +) + +const ( + memoryLimitMax uint64 = 0xffffffffffffffff +) + +func isFlagSet(flag, controlFlags uint32) bool { + return (flag & controlFlags) == flag +} + +// SetResourceLimits sets resource limits on the job object (cpu, memory, storage). +func (job *JobObject) SetResourceLimits(limits *JobLimits) error { + // Go through and check what limits were specified and apply them to the job. + if limits.MemoryLimitInBytes != 0 { + if err := job.SetMemoryLimit(limits.MemoryLimitInBytes); err != nil { + return fmt.Errorf("failed to set job object memory limit: %w", err) + } + } + + if limits.CPULimit != 0 { + if err := job.SetCPULimit(RateBased, limits.CPULimit); err != nil { + return fmt.Errorf("failed to set job object cpu limit: %w", err) + } + } else if limits.CPUWeight != 0 { + if err := job.SetCPULimit(WeightBased, limits.CPUWeight); err != nil { + return fmt.Errorf("failed to set job object cpu limit: %w", err) + } + } + + if limits.MaxBandwidth != 0 || limits.MaxIOPS != 0 { + if err := job.SetIOLimit(limits.MaxBandwidth, limits.MaxIOPS); err != nil { + return fmt.Errorf("failed to set io limit on job object: %w", err) + } + } + return nil +} + +// SetTerminateOnLastHandleClose sets the job object flag that specifies that the job should terminate +// all processes in the job on the last open handle being closed. +func (job *JobObject) SetTerminateOnLastHandleClose() error { + info, err := job.getExtendedInformation() + if err != nil { + return err + } + info.BasicLimitInformation.LimitFlags |= windows.JOB_OBJECT_LIMIT_KILL_ON_JOB_CLOSE + return job.setExtendedInformation(info) +} + +// SetMemoryLimit sets the memory limit of the job object based on the given `memoryLimitInBytes`. +func (job *JobObject) SetMemoryLimit(memoryLimitInBytes uint64) error { + if memoryLimitInBytes >= memoryLimitMax { + return errors.New("memory limit specified exceeds the max size") + } + + info, err := job.getExtendedInformation() + if err != nil { + return err + } + + info.JobMemoryLimit = uintptr(memoryLimitInBytes) + info.BasicLimitInformation.LimitFlags |= windows.JOB_OBJECT_LIMIT_JOB_MEMORY + return job.setExtendedInformation(info) +} + +// GetMemoryLimit gets the memory limit in bytes of the job object. +func (job *JobObject) GetMemoryLimit() (uint64, error) { + info, err := job.getExtendedInformation() + if err != nil { + return 0, err + } + return uint64(info.JobMemoryLimit), nil +} + +// SetCPULimit sets the CPU limit depending on the specified `CPURateControlType` to +// `rateControlValue` for the job object. +func (job *JobObject) SetCPULimit(rateControlType CPURateControlType, rateControlValue uint32) error { + cpuInfo, err := job.getCPURateControlInformation() + if err != nil { + return err + } + switch rateControlType { + case WeightBased: + if rateControlValue < cpuWeightMin || rateControlValue > cpuWeightMax { + return fmt.Errorf("processor weight value of `%d` is invalid", rateControlValue) + } + cpuInfo.ControlFlags |= winapi.JOB_OBJECT_CPU_RATE_CONTROL_ENABLE | winapi.JOB_OBJECT_CPU_RATE_CONTROL_WEIGHT_BASED + cpuInfo.Value = rateControlValue + case RateBased: + if rateControlValue < cpuLimitMin || rateControlValue > cpuLimitMax { + return fmt.Errorf("processor rate of `%d` is invalid", rateControlValue) + } + cpuInfo.ControlFlags |= winapi.JOB_OBJECT_CPU_RATE_CONTROL_ENABLE | winapi.JOB_OBJECT_CPU_RATE_CONTROL_HARD_CAP + cpuInfo.Value = rateControlValue + default: + return errors.New("invalid job object cpu rate control type") + } + return job.setCPURateControlInfo(cpuInfo) +} + +// GetCPULimit gets the cpu limits for the job object. +// `rateControlType` is used to indicate what type of cpu limit to query for. +func (job *JobObject) GetCPULimit(rateControlType CPURateControlType) (uint32, error) { + info, err := job.getCPURateControlInformation() + if err != nil { + return 0, err + } + + if !isFlagSet(winapi.JOB_OBJECT_CPU_RATE_CONTROL_ENABLE, info.ControlFlags) { + return 0, errors.New("the job does not have cpu rate control enabled") + } + + switch rateControlType { + case WeightBased: + if !isFlagSet(winapi.JOB_OBJECT_CPU_RATE_CONTROL_WEIGHT_BASED, info.ControlFlags) { + return 0, errors.New("cannot get cpu weight for job object without cpu weight option set") + } + case RateBased: + if !isFlagSet(winapi.JOB_OBJECT_CPU_RATE_CONTROL_HARD_CAP, info.ControlFlags) { + return 0, errors.New("cannot get cpu rate hard cap for job object without cpu rate hard cap option set") + } + default: + return 0, errors.New("invalid job object cpu rate control type") + } + return info.Value, nil +} + +// SetCPUAffinity sets the processor affinity for the job object. +// The affinity is passed in as a bitmask. +func (job *JobObject) SetCPUAffinity(affinityBitMask uint64) error { + info, err := job.getExtendedInformation() + if err != nil { + return err + } + info.BasicLimitInformation.LimitFlags |= uint32(windows.JOB_OBJECT_LIMIT_AFFINITY) + info.BasicLimitInformation.Affinity = uintptr(affinityBitMask) + return job.setExtendedInformation(info) +} + +// GetCPUAffinity gets the processor affinity for the job object. +// The returned affinity is a bitmask. +func (job *JobObject) GetCPUAffinity() (uint64, error) { + info, err := job.getExtendedInformation() + if err != nil { + return 0, err + } + return uint64(info.BasicLimitInformation.Affinity), nil +} + +// SetIOLimit sets the IO limits specified on the job object. +func (job *JobObject) SetIOLimit(maxBandwidth, maxIOPS int64) error { + ioInfo, err := job.getIOLimit() + if err != nil { + return err + } + ioInfo.ControlFlags |= winapi.JOB_OBJECT_IO_RATE_CONTROL_ENABLE + if maxBandwidth != 0 { + ioInfo.MaxBandwidth = maxBandwidth + } + if maxIOPS != 0 { + ioInfo.MaxIops = maxIOPS + } + return job.setIORateControlInfo(ioInfo) +} + +// GetIOMaxBandwidthLimit gets the max bandwidth for the job object. +func (job *JobObject) GetIOMaxBandwidthLimit() (int64, error) { + info, err := job.getIOLimit() + if err != nil { + return 0, err + } + return info.MaxBandwidth, nil +} + +// GetIOMaxIopsLimit gets the max iops for the job object. +func (job *JobObject) GetIOMaxIopsLimit() (int64, error) { + info, err := job.getIOLimit() + if err != nil { + return 0, err + } + return info.MaxIops, nil +} + +// Helper function for getting a job object's extended information. +func (job *JobObject) getExtendedInformation() (*windows.JOBOBJECT_EXTENDED_LIMIT_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := windows.JOBOBJECT_EXTENDED_LIMIT_INFORMATION{} + if err := winapi.QueryInformationJobObject( + job.handle, + windows.JobObjectExtendedLimitInformation, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("query %v returned error: %w", info, err) + } + return &info, nil +} + +// Helper function for getting a job object's CPU rate control information. +func (job *JobObject) getCPURateControlInformation() (*winapi.JOBOBJECT_CPU_RATE_CONTROL_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + info := winapi.JOBOBJECT_CPU_RATE_CONTROL_INFORMATION{} + if err := winapi.QueryInformationJobObject( + job.handle, + windows.JobObjectCpuRateControlInformation, + unsafe.Pointer(&info), + uint32(unsafe.Sizeof(info)), + nil, + ); err != nil { + return nil, fmt.Errorf("query %v returned error: %w", info, err) + } + return &info, nil +} + +// Helper function for setting a job object's extended information. +func (job *JobObject) setExtendedInformation(info *windows.JOBOBJECT_EXTENDED_LIMIT_INFORMATION) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if _, err := windows.SetInformationJobObject( + job.handle, + windows.JobObjectExtendedLimitInformation, + uintptr(unsafe.Pointer(info)), + uint32(unsafe.Sizeof(*info)), + ); err != nil { + return fmt.Errorf("failed to set Extended info %v on job object: %w", info, err) + } + return nil +} + +// Helper function for querying job handle for IO limit information. +func (job *JobObject) getIOLimit() (*winapi.JOBOBJECT_IO_RATE_CONTROL_INFORMATION, error) { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return nil, ErrAlreadyClosed + } + + ioInfo := &winapi.JOBOBJECT_IO_RATE_CONTROL_INFORMATION{} + var blockCount uint32 = 1 + + if _, err := winapi.QueryIoRateControlInformationJobObject( + job.handle, + nil, + &ioInfo, + &blockCount, + ); err != nil { + return nil, fmt.Errorf("query %v returned error: %w", ioInfo, err) + } + + if !isFlagSet(winapi.JOB_OBJECT_IO_RATE_CONTROL_ENABLE, ioInfo.ControlFlags) { + return nil, fmt.Errorf("query %v cannot get IO limits for job object without IO rate control option set", ioInfo) + } + return ioInfo, nil +} + +// Helper function for setting a job object's IO rate control information. +func (job *JobObject) setIORateControlInfo(ioInfo *winapi.JOBOBJECT_IO_RATE_CONTROL_INFORMATION) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + + if _, err := winapi.SetIoRateControlInformationJobObject(job.handle, ioInfo); err != nil { + return fmt.Errorf("failed to set IO limit info %v on job object: %w", ioInfo, err) + } + return nil +} + +// Helper function for setting a job object's CPU rate control information. +func (job *JobObject) setCPURateControlInfo(cpuInfo *winapi.JOBOBJECT_CPU_RATE_CONTROL_INFORMATION) error { + job.handleLock.RLock() + defer job.handleLock.RUnlock() + + if job.handle == 0 { + return ErrAlreadyClosed + } + if _, err := windows.SetInformationJobObject( + job.handle, + windows.JobObjectCpuRateControlInformation, + uintptr(unsafe.Pointer(cpuInfo)), + uint32(unsafe.Sizeof(cpuInfo)), + ); err != nil { + return fmt.Errorf("failed to set cpu limit info %v on job object: %w", cpuInfo, err) + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/context.go b/vendor/github.com/Microsoft/hcsshim/internal/log/context.go new file mode 100644 index 000000000..d17d909d9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/context.go @@ -0,0 +1,118 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +type entryContextKeyType int + +const _entryContextKey entryContextKeyType = iota + +var ( + // L is the default, blank logging entry. WithField and co. all return a copy + // of the original entry, so this will not leak fields between calls. + // + // Do NOT modify fields directly, as that will corrupt state for all users and + // is not thread safe. + // Instead, use `L.With*` or `L.Dup()`. Or `G(context.Background())`. + L = logrus.NewEntry(logrus.StandardLogger()) + + // G is an alias for GetEntry + G = GetEntry + + // S is an alias for SetEntry + S = SetEntry + + // U is an alias for UpdateContext + U = UpdateContext +) + +// GetEntry returns a `logrus.Entry` stored in the context, if one exists. +// Otherwise, it returns a default entry that points to the current context. +// +// Note: if the a new entry is returned, it will reference the passed in context. +// However, existing contexts may be stored in parent contexts and additionally reference +// earlier contexts. +// Use `UpdateContext` to update the entry and context. +func GetEntry(ctx context.Context) *logrus.Entry { + entry := fromContext(ctx) + + if entry == nil { + entry = L.WithContext(ctx) + } + + return entry +} + +// SetEntry updates the log entry in the context with the provided fields, and +// returns both. It is equivalent to: +// +// entry := GetEntry(ctx).WithFields(fields) +// ctx = WithContext(ctx, entry) +// +// See WithContext for more information. +func SetEntry(ctx context.Context, fields logrus.Fields) (context.Context, *logrus.Entry) { + e := GetEntry(ctx) + if len(fields) > 0 { + e = e.WithFields(fields) + } + return WithContext(ctx, e) +} + +// UpdateContext extracts the log entry from the context, and, if the entry's +// context points to a parent's of the current context, ands the entry +// to the most recent context. It is equivalent to: +// +// entry := GetEntry(ctx) +// ctx = WithContext(ctx, entry) +// +// This allows the entry to reference the most recent context and any new +// values (such as span contexts) added to it. +// +// See WithContext for more information. +func UpdateContext(ctx context.Context) context.Context { + // there is no way to check its ctx (and not one of its parents) that contains `e` + // so, at a slight cost, force add `e` to the context + ctx, _ = WithContext(ctx, GetEntry(ctx)) + return ctx +} + +// WithContext returns a context that contains the provided log entry. +// The entry can be extracted with `GetEntry` (`G`) +// +// The entry in the context is a copy of `entry` (generated by `entry.WithContext`) +func WithContext(ctx context.Context, entry *logrus.Entry) (context.Context, *logrus.Entry) { + // regardless of the order, entry.Context != GetEntry(ctx) + // here, the returned entry will reference the supplied context + entry = entry.WithContext(ctx) + ctx = context.WithValue(ctx, _entryContextKey, entry) + + return ctx, entry +} + +// Copy extracts the tracing Span and logging entry from the src Context, if they +// exist, and adds them to the dst Context. +// +// This is useful to share tracing and logging between contexts, but not the +// cancellation. For example, if the src Context has been cancelled but cleanup +// operations triggered by the cancellation require a non-cancelled context to +// execute. +func Copy(dst context.Context, src context.Context) context.Context { + if s := trace.FromContext(src); s != nil { + dst = trace.NewContext(dst, s) + } + + if e := fromContext(src); e != nil { + dst, _ = WithContext(dst, e) + } + + return dst +} + +func fromContext(ctx context.Context) *logrus.Entry { + e, _ := ctx.Value(_entryContextKey).(*logrus.Entry) + return e +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/format.go b/vendor/github.com/Microsoft/hcsshim/internal/log/format.go new file mode 100644 index 000000000..d9bc49d35 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/format.go @@ -0,0 +1,87 @@ +package log + +import ( + "bytes" + "context" + "encoding/json" + "fmt" + "net" + "reflect" + "time" +) + +// TimeFormat is [time.RFC3339Nano] with nanoseconds padded using +// zeros to ensure the formatted time is always the same number of +// characters. +// Based on RFC3339NanoFixed from github.com/containerd/log +const TimeFormat = "2006-01-02T15:04:05.000000000Z07:00" + +func FormatTime(t time.Time) string { + return t.Format(TimeFormat) +} + +// DurationFormat formats a [time.Duration] log entry. +// +// A nil value signals an error with the formatting. +type DurationFormat func(time.Duration) interface{} + +func DurationFormatString(d time.Duration) interface{} { return d.String() } +func DurationFormatSeconds(d time.Duration) interface{} { return d.Seconds() } +func DurationFormatMilliseconds(d time.Duration) interface{} { return d.Milliseconds() } + +// FormatIO formats net.Conn and other types that have an `Addr()` or `Name()`. +// +// See FormatEnabled for more information. +func FormatIO(ctx context.Context, v interface{}) string { + m := make(map[string]string) + m["type"] = reflect.TypeOf(v).String() + + switch t := v.(type) { + case net.Conn: + m["localAddress"] = formatAddr(t.LocalAddr()) + m["remoteAddress"] = formatAddr(t.RemoteAddr()) + case interface{ Addr() net.Addr }: + m["address"] = formatAddr(t.Addr()) + default: + return Format(ctx, t) + } + + return Format(ctx, m) +} + +func formatAddr(a net.Addr) string { + return a.Network() + "://" + a.String() +} + +// Format formats an object into a JSON string, without any indendtation or +// HTML escapes. +// Context is used to output a log waring if the conversion fails. +// +// This is intended primarily for `trace.StringAttribute()` +func Format(ctx context.Context, v interface{}) string { + b, err := encode(v) + if err != nil { + G(ctx).WithError(err).Warning("could not format value") + return "" + } + + return string(b) +} + +func encode(v interface{}) ([]byte, error) { + return encodeBuffer(&bytes.Buffer{}, v) +} + +func encodeBuffer(buf *bytes.Buffer, v interface{}) ([]byte, error) { + enc := json.NewEncoder(buf) + enc.SetEscapeHTML(false) + enc.SetIndent("", "") + + if err := enc.Encode(v); err != nil { + err = fmt.Errorf("could not marshall %T to JSON for logging: %w", v, err) + return nil, err + } + + // encoder.Encode appends a newline to the end + return bytes.TrimSpace(buf.Bytes()), nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go deleted file mode 100644 index ba6b1a4a5..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go +++ /dev/null @@ -1,23 +0,0 @@ -package log - -import ( - "context" - - "github.com/sirupsen/logrus" - "go.opencensus.io/trace" -) - -// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` -// contains an OpenCensus `trace.Span`. -func G(ctx context.Context) *logrus.Entry { - span := trace.FromContext(ctx) - if span != nil { - sctx := span.SpanContext() - return logrus.WithFields(logrus.Fields{ - "traceID": sctx.TraceID.String(), - "spanID": sctx.SpanID.String(), - // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? - }) - } - return logrus.NewEntry(logrus.StandardLogger()) -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/hook.go b/vendor/github.com/Microsoft/hcsshim/internal/log/hook.go new file mode 100644 index 000000000..bb547a329 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/hook.go @@ -0,0 +1,173 @@ +package log + +import ( + "bytes" + "reflect" + "time" + + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +const nullString = "null" + +// Hook intercepts and formats a [logrus.Entry] before it logged. +// +// The shim either outputs the logs through an ETW hook, discarding the (formatted) output +// or logs output to a pipe for logging binaries to consume. +// The Linux GCS outputs logrus entries over stdout, which is then consumed and re-output +// by the shim. +type Hook struct { + // EncodeAsJSON formats structs, maps, arrays, slices, and [bytes.Buffer] as JSON. + // Variables of [bytes.Buffer] will be converted to []byte. + // + // Default is false. + EncodeAsJSON bool + + // FormatTime specifies the format for [time.Time] variables. + // An empty string disables formatting. + // When disabled, the fall back will the JSON encoding, if enabled. + // + // Default is [TimeFormat]. + TimeFormat string + + // Duration format converts a [time.Duration] fields to an appropriate encoding. + // nil disables formatting. + // When disabled, the fall back will the JSON encoding, if enabled. + // + // Default is [DurationFormatString], which appends a duration unit after the value. + DurationFormat DurationFormat + + // AddSpanContext adds [logfields.TraceID] and [logfields.SpanID] fields to + // the entry from the span context stored in [logrus.Entry.Context], if it exists. + AddSpanContext bool +} + +var _ logrus.Hook = &Hook{} + +func NewHook() *Hook { + return &Hook{ + TimeFormat: TimeFormat, + DurationFormat: DurationFormatString, + AddSpanContext: true, + } +} + +func (h *Hook) Levels() []logrus.Level { + return logrus.AllLevels +} + +func (h *Hook) Fire(e *logrus.Entry) (err error) { + // JSON encode, if necessary, then add span information + h.encode(e) + h.addSpanContext(e) + + return nil +} + +// encode loops through all the fields in the [logrus.Entry] and encodes them according to +// the settings in [Hook]. +// If [Hook.TimeFormat] is non-empty, it will be passed to [time.Time.Format] for +// fields of type [time.Time]. +// +// If [Hook.EncodeAsJSON] is true, then fields that are not numeric, boolean, strings, or +// errors will be encoded via a [json.Marshal] (with HTML escaping disabled). +// Chanel- and function-typed fields, as well as unsafe pointers are left alone and not encoded. +// +// If [Hook.TimeFormat] and [Hook.DurationFormat] are empty and [Hook.EncodeAsJSON] is false, +// then this is a no-op. +func (h *Hook) encode(e *logrus.Entry) { + d := e.Data + + formatTime := h.TimeFormat != "" + formatDuration := h.DurationFormat != nil + if !(h.EncodeAsJSON || formatTime || formatDuration) { + return + } + + for k, v := range d { + // encode types with dedicated formatting options first + + if vv, ok := v.(time.Time); formatTime && ok { + d[k] = vv.Format(h.TimeFormat) + continue + } + + if vv, ok := v.(time.Duration); formatDuration && ok { + d[k] = h.DurationFormat(vv) + continue + } + + // general case JSON encoding + + if !h.EncodeAsJSON { + continue + } + + switch vv := v.(type) { + // built in types + // "json" marshals errors as "{}", so leave alone here + case bool, string, error, uintptr, + int8, int16, int32, int64, int, + uint8, uint32, uint64, uint, + float32, float64: + continue + + // Rather than setting d[k] = vv.String(), JSON encode []byte value, since it + // may be a binary payload and not representable as a string. + // `case bytes.Buffer,*bytes.Buffer:` resolves `vv` to `interface{}`, + // so cannot use `vv.Bytes`. + // Could move to below the `reflect.Indirect()` call below, but + // that would require additional typematching and dereferencing. + // Easier to keep these duplicate branches here. + case bytes.Buffer: + v = vv.Bytes() + case *bytes.Buffer: + v = vv.Bytes() + } + + // dereference pointer or interface variables + rv := reflect.Indirect(reflect.ValueOf(v)) + // check if `v` is a null pointer + if !rv.IsValid() { + d[k] = nullString + continue + } + + switch rv.Kind() { + case reflect.Map, reflect.Struct, reflect.Array, reflect.Slice: + default: + // Bool, [U]?Int*, Float*, Complex*, Uintptr, String: encoded as normal + // Chan, Func: not supported by json + // Interface, Pointer: dereferenced above + // UnsafePointer: not supported by json, not safe to de-reference; leave alone + continue + } + + b, err := encode(v) + if err != nil { + // Errors are written to stderr (ie, to `panic.log`) and stops the remaining + // hooks (ie, exporting to ETW) from firing. So add encoding errors to + // the entry data to be written out, but keep on processing. + d[k+"-"+logrus.ErrorKey] = err.Error() + // keep the original `v` as the value, + continue + } + d[k] = string(b) + } +} + +func (h *Hook) addSpanContext(e *logrus.Entry) { + ctx := e.Context + if !h.AddSpanContext || ctx == nil { + return + } + span := trace.FromContext(ctx) + if span == nil { + return + } + sctx := span.SpanContext() + e.Data[logfields.TraceID] = sctx.TraceID.String() + e.Data[logfields.SpanID] = sctx.SpanID.String() +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/scrub.go b/vendor/github.com/Microsoft/hcsshim/internal/log/scrub.go new file mode 100644 index 000000000..d1ef15096 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/scrub.go @@ -0,0 +1,184 @@ +package log + +import ( + "bytes" + "encoding/json" + "errors" + "sync/atomic" + + hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" +) + +// This package scrubs objects of potentially sensitive information to pass to logging + +type genMap = map[string]interface{} +type scrubberFunc func(genMap) error + +const _scrubbedReplacement = "" + +var ( + ErrUnknownType = errors.New("encoded object is of unknown type") + + // case sensitive keywords, so "env" is not a substring on "Environment" + _scrubKeywords = [][]byte{[]byte("env"), []byte("Environment")} + + _scrub int32 +) + +// SetScrubbing enables scrubbing +func SetScrubbing(enable bool) { + v := int32(0) // cant convert from bool to int32 directly + if enable { + v = 1 + } + atomic.StoreInt32(&_scrub, v) +} + +// IsScrubbingEnabled checks if scrubbing is enabled +func IsScrubbingEnabled() bool { + v := atomic.LoadInt32(&_scrub) + return v != 0 +} + +// ScrubProcessParameters scrubs HCS Create Process requests with config parameters of +// type internal/hcs/schema2.ScrubProcessParameters (aka hcsshema.ScrubProcessParameters) +func ScrubProcessParameters(s string) (string, error) { + // todo: deal with v1 ProcessConfig + b := []byte(s) + if !IsScrubbingEnabled() || !hasKeywords(b) || !json.Valid(b) { + return s, nil + } + + pp := hcsschema.ProcessParameters{} + if err := json.Unmarshal(b, &pp); err != nil { + return "", err + } + pp.Environment = map[string]string{_scrubbedReplacement: _scrubbedReplacement} + + b, err := encodeBuffer(bytes.NewBuffer(b[:0]), pp) + if err != nil { + return "", err + } + return string(b), nil +} + +// ScrubBridgeCreate scrubs requests sent over the bridge of type +// internal/gcs/protocol.containerCreate wrapping an internal/hcsoci.linuxHostedSystem +func ScrubBridgeCreate(b []byte) ([]byte, error) { + return scrubBytes(b, scrubBridgeCreate) +} + +func scrubBridgeCreate(m genMap) error { + if !isRequestBase(m) { + return ErrUnknownType + } + if ss, ok := m["ContainerConfig"]; ok { + // ContainerConfig is a json encoded struct passed as a regular string field + s, ok := ss.(string) + if !ok { + return ErrUnknownType + } + b, err := scrubBytes([]byte(s), scrubLinuxHostedSystem) + if err != nil { + return err + } + m["ContainerConfig"] = string(b) + return nil + } + return ErrUnknownType +} + +func scrubLinuxHostedSystem(m genMap) error { + if m, ok := index(m, "OciSpecification"); ok { + if _, ok := m["annotations"]; ok { + m["annotations"] = map[string]string{_scrubbedReplacement: _scrubbedReplacement} + } + if m, ok := index(m, "process"); ok { + if _, ok := m["env"]; ok { + m["env"] = []string{_scrubbedReplacement} + return nil + } + } + } + return ErrUnknownType +} + +// ScrubBridgeExecProcess scrubs requests sent over the bridge of type +// internal/gcs/protocol.containerExecuteProcess +func ScrubBridgeExecProcess(b []byte) ([]byte, error) { + return scrubBytes(b, scrubExecuteProcess) +} + +func scrubExecuteProcess(m genMap) error { + if !isRequestBase(m) { + return ErrUnknownType + } + if m, ok := index(m, "Settings"); ok { + if ss, ok := m["ProcessParameters"]; ok { + // ProcessParameters is a json encoded struct passed as a regular sting field + s, ok := ss.(string) + if !ok { + return ErrUnknownType + } + + s, err := ScrubProcessParameters(s) + if err != nil { + return err + } + + m["ProcessParameters"] = s + return nil + } + } + return ErrUnknownType +} + +func scrubBytes(b []byte, scrub scrubberFunc) ([]byte, error) { + if !IsScrubbingEnabled() || !hasKeywords(b) || !json.Valid(b) { + return b, nil + } + + m := make(genMap) + if err := json.Unmarshal(b, &m); err != nil { + return nil, err + } + + // could use regexp, but if the env strings contain braces, the regexp fails + // parsing into individual structs would require access to private structs + if err := scrub(m); err != nil { + return nil, err + } + + b, err := encode(m) + if err != nil { + return nil, err + } + + return b, nil +} + +func isRequestBase(m genMap) bool { + // neither of these are (currently) `omitempty` + _, a := m["ActivityId"] + _, c := m["ContainerId"] + return a && c +} + +// combination `m, ok := m[s]` and `m, ok := m.(genMap)` +func index(m genMap, s string) (genMap, bool) { + if m, ok := m[s]; ok { + mm, ok := m.(genMap) + return mm, ok + } + + return m, false +} + +func hasKeywords(b []byte) bool { + for _, bb := range _scrubKeywords { + if bytes.Contains(b, bb) { + return true + } + } + return false +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go b/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go index cf2c166d9..3e175e522 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go @@ -3,21 +3,44 @@ package logfields const ( // Identifiers + Name = "name" + Namespace = "namespace" + Operation = "operation" + + ID = "id" + SandboxID = "sid" ContainerID = "cid" - UVMID = "uvm-id" + ExecID = "eid" ProcessID = "pid" + TaskID = "tid" + UVMID = "uvm-id" + + // networking and IO + + File = "file" + Path = "path" + Bytes = "bytes" + Pipe = "pipe" // Common Misc - // Timeout represents an operation timeout. - Timeout = "timeout" + Attempt = "attemptNo" JSON = "json" + // Time + + StartTime = "startTime" + EndTime = "endTime" + Duration = "duration" + Timeout = "timeout" + // Keys/values Field = "field" + Key = "key" OCIAnnotation = "oci-annotation" Value = "value" + Options = "options" // Golang type's @@ -29,4 +52,10 @@ const ( // runhcs VMShimOperation = "vmshim-op" + + // logging and tracing + + TraceID = "traceID" + SpanID = "spanID" + ParentSpanID = "parentSpanID" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/memory/pool.go b/vendor/github.com/Microsoft/hcsshim/internal/memory/pool.go new file mode 100644 index 000000000..1ef5814d7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/memory/pool.go @@ -0,0 +1,316 @@ +package memory + +import ( + "github.com/pkg/errors" +) + +const ( + minimumClassSize = MiB + maximumClassSize = 4 * GiB + memoryClassNumber = 7 +) + +var ( + ErrInvalidMemoryClass = errors.New("invalid memory class") + ErrEarlyMerge = errors.New("not all children have been freed") + ErrEmptyPoolOperation = errors.New("operation on empty pool") +) + +// GetMemoryClassType returns the minimum memory class type that can hold a device of +// a given size. The smallest class is 1MB and the largest one is 4GB with 2 bit offset +// intervals in between, for a total of 7 different classes. This function does not +// do a validity check +func GetMemoryClassType(s uint64) classType { + s = (s - 1) >> 20 + memCls := uint32(0) + for s > 0 { + s = s >> 2 + memCls++ + } + return classType(memCls) +} + +// GetMemoryClassSize returns size in bytes for a given memory class +func GetMemoryClassSize(memCls classType) (uint64, error) { + if memCls >= memoryClassNumber { + return 0, ErrInvalidMemoryClass + } + return minimumClassSize << (2 * memCls), nil +} + +// region represents a contiguous memory block +type region struct { + // parent region that has been split into 4 + parent *region + class classType + // offset represents offset in bytes + offset uint64 +} + +// memoryPool tracks free and busy (used) memory regions +type memoryPool struct { + free map[uint64]*region + busy map[uint64]*region +} + +// PoolAllocator implements a memory allocation strategy similar to buddy-malloc https://github.com/evanw/buddy-malloc/blob/master/buddy-malloc.c +// We borrow the idea of spanning a tree of fixed size regions on top of a contiguous memory +// space. +// +// There are a total of 7 different region sizes that can be allocated, with the smallest +// being 1MB and the largest 4GB (the default maximum size of a Virtual PMem device). +// +// For efficiency and to reduce fragmentation an entire region is allocated when requested. +// When there's no available region of requested size, we try to allocate more memory for +// this particular size by splitting the next available larger region into smaller ones, e.g. +// if there's no region available for size class 0, we try splitting a region from class 1, +// then class 2 etc, until we are able to do so or hit the upper limit. +type PoolAllocator struct { + pools [memoryClassNumber]*memoryPool +} + +var _ MappedRegion = ®ion{} +var _ Allocator = &PoolAllocator{} + +func (r *region) Offset() uint64 { + return r.offset +} + +func (r *region) Size() uint64 { + sz, err := GetMemoryClassSize(r.class) + if err != nil { + panic(err) + } + return sz +} + +func (r *region) Type() classType { + return r.class +} + +func newEmptyMemoryPool() *memoryPool { + return &memoryPool{ + free: make(map[uint64]*region), + busy: make(map[uint64]*region), + } +} + +func NewPoolMemoryAllocator() PoolAllocator { + pa := PoolAllocator{} + p := newEmptyMemoryPool() + // by default we allocate a single region with maximum possible size (class type) + p.free[0] = ®ion{ + class: memoryClassNumber - 1, + offset: 0, + } + pa.pools[memoryClassNumber-1] = p + return pa +} + +// Allocate checks memory region pool for the given `size` and returns a free region with +// minimal offset, if none available tries expanding matched memory pool. +// +// Internally it's done via moving a region from free pool into a busy pool +func (pa *PoolAllocator) Allocate(size uint64) (MappedRegion, error) { + memCls := GetMemoryClassType(size) + if memCls >= memoryClassNumber { + return nil, ErrInvalidMemoryClass + } + + // find region with the smallest offset + nextCls, nextOffset, err := pa.findNextOffset(memCls) + if err != nil { + return nil, err + } + + // this means that there are no more regions for the current class, try expanding + if nextCls != memCls { + if err := pa.split(memCls); err != nil { + if err == ErrInvalidMemoryClass { + return nil, ErrNotEnoughSpace + } + return nil, err + } + } + + if err := pa.markBusy(memCls, nextOffset); err != nil { + return nil, err + } + + // by this point memory pool for memCls should have been created, + // either prior or during split call + if r := pa.pools[memCls].busy[nextOffset]; r != nil { + return r, nil + } + + return nil, ErrNotEnoughSpace +} + +// Release marks a memory region of class `memCls` and offset `offset` as free and tries to merge smaller regions into +// a bigger one +func (pa *PoolAllocator) Release(reg MappedRegion) error { + mp := pa.pools[reg.Type()] + if mp == nil { + return ErrEmptyPoolOperation + } + + err := pa.markFree(reg.Type(), reg.Offset()) + if err != nil { + return err + } + + n := mp.free[reg.Offset()] + if n == nil { + return ErrNotAllocated + } + if err := pa.merge(n.parent); err != nil { + if err != ErrEarlyMerge { + return err + } + } + return nil +} + +// findNextOffset finds next region location for a given memCls +func (pa *PoolAllocator) findNextOffset(memCls classType) (classType, uint64, error) { + for mc := memCls; mc < memoryClassNumber; mc++ { + pi := pa.pools[mc] + if pi == nil || len(pi.free) == 0 { + continue + } + + target := uint64(maximumClassSize) + for offset := range pi.free { + if offset < target { + target = offset + } + } + return mc, target, nil + } + return 0, 0, ErrNotEnoughSpace +} + +// split tries to recursively split a bigger memory region into smaller ones until it succeeds or hits the upper limit +func (pa *PoolAllocator) split(clsType classType) error { + nextClsType := clsType + 1 + if nextClsType >= memoryClassNumber { + return ErrInvalidMemoryClass + } + + nextPool := pa.pools[nextClsType] + if nextPool == nil { + nextPool = newEmptyMemoryPool() + pa.pools[nextClsType] = nextPool + } + + cls, offset, err := pa.findNextOffset(nextClsType) + if err != nil { + return err + } + // not enough memory in the next class, try to recursively expand + if cls != nextClsType { + if err := pa.split(nextClsType); err != nil { + return err + } + } + + if err := pa.markBusy(nextClsType, offset); err != nil { + return err + } + + // memCls validity has been checked already, we can ignore the error + clsSize, _ := GetMemoryClassSize(clsType) + + nextReg := nextPool.busy[offset] + if nextReg == nil { + return ErrNotAllocated + } + + // expand memCls + cp := pa.pools[clsType] + if cp == nil { + cp = newEmptyMemoryPool() + pa.pools[clsType] = cp + } + // create 4 smaller regions + for i := uint64(0); i < 4; i++ { + offset := nextReg.offset + i*clsSize + reg := ®ion{ + parent: nextReg, + class: clsType, + offset: offset, + } + cp.free[offset] = reg + } + return nil +} + +func (pa *PoolAllocator) merge(parent *region) error { + // nothing to merge + if parent == nil { + return nil + } + + childCls := parent.class - 1 + childPool := pa.pools[childCls] + // no child nodes to merge, try to merge parent + if childPool == nil { + return pa.merge(parent.parent) + } + + childSize, err := GetMemoryClassSize(childCls) + if err != nil { + return err + } + + // check if all the child nodes are free + var children []*region + for i := uint64(0); i < 4; i++ { + child, free := childPool.free[parent.offset+i*childSize] + if !free { + return ErrEarlyMerge + } + children = append(children, child) + } + + // at this point all the child nodes will be free and we can merge + for _, child := range children { + delete(childPool.free, child.offset) + } + + if err := pa.markFree(parent.class, parent.offset); err != nil { + return err + } + + return pa.merge(parent.parent) +} + +// markFree internally moves a region with `offset` from busy to free map +func (pa *PoolAllocator) markFree(memCls classType, offset uint64) error { + clsPool := pa.pools[memCls] + if clsPool == nil { + return ErrEmptyPoolOperation + } + + if reg, exists := clsPool.busy[offset]; exists { + clsPool.free[offset] = reg + delete(clsPool.busy, offset) + return nil + } + return ErrNotAllocated +} + +// markBusy internally moves a region with `offset` from free to busy map +func (pa *PoolAllocator) markBusy(memCls classType, offset uint64) error { + clsPool := pa.pools[memCls] + if clsPool == nil { + return ErrEmptyPoolOperation + } + + if reg, exists := clsPool.free[offset]; exists { + clsPool.busy[offset] = reg + delete(clsPool.free, offset) + return nil + } + return ErrNotAllocated +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/memory/types.go b/vendor/github.com/Microsoft/hcsshim/internal/memory/types.go new file mode 100644 index 000000000..d6cdb8cc4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/memory/types.go @@ -0,0 +1,28 @@ +package memory + +import "github.com/pkg/errors" + +type classType uint32 + +const ( + MiB = 1024 * 1024 + GiB = 1024 * MiB +) + +var ( + ErrNotEnoughSpace = errors.New("not enough space") + ErrNotAllocated = errors.New("no memory allocated at the given offset") +) + +// MappedRegion represents a memory block with an offset +type MappedRegion interface { + Offset() uint64 + Size() uint64 + Type() classType +} + +// Allocator is an interface for memory allocation +type Allocator interface { + Allocate(uint64) (MappedRegion, error) + Release(MappedRegion) error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/errors.go new file mode 100644 index 000000000..71df25b8d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/errors.go @@ -0,0 +1,69 @@ +package oc + +import ( + "errors" + "io" + "net" + "os" + + "github.com/containerd/containerd/errdefs" + "google.golang.org/grpc/codes" + "google.golang.org/grpc/status" +) + +// todo: break import cycle with "internal/hcs/errors.go" and reference errors defined there +// todo: add errors defined in "internal/guest/gcserror" (Hresult does not implement error) + +func toStatusCode(err error) codes.Code { + // checks if err implements GRPCStatus() *"google.golang.org/grpc/status".Status, + // wraps an error defined in "github.com/containerd/containerd/errdefs", or is a + // context timeout or cancelled error + if s, ok := status.FromError(errdefs.ToGRPC(err)); ok { + return s.Code() + } + + switch { + // case isAny(err): + // return codes.Cancelled + case isAny(err, os.ErrInvalid): + return codes.InvalidArgument + case isAny(err, os.ErrDeadlineExceeded): + return codes.DeadlineExceeded + case isAny(err, os.ErrNotExist): + return codes.NotFound + case isAny(err, os.ErrExist): + return codes.AlreadyExists + case isAny(err, os.ErrPermission): + return codes.PermissionDenied + // case isAny(err): + // return codes.ResourceExhausted + case isAny(err, os.ErrClosed, net.ErrClosed, io.ErrClosedPipe, io.ErrShortBuffer): + return codes.FailedPrecondition + // case isAny(err): + // return codes.Aborted + // case isAny(err): + // return codes.OutOfRange + // case isAny(err): + // return codes.Unimplemented + case isAny(err, io.ErrNoProgress): + return codes.Internal + // case isAny(err): + // return codes.Unavailable + case isAny(err, io.ErrShortWrite, io.ErrUnexpectedEOF): + return codes.DataLoss + // case isAny(err): + // return codes.Unauthenticated + default: + return codes.Unknown + } +} + +// isAny returns true if errors.Is is true for any of the provided errors, errs. +func isAny(err error, errs ...error) bool { + for _, e := range errs { + if errors.Is(err, e) { + return true + } + } + return false +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go index f428bdaf7..28f8f43a9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -3,19 +3,26 @@ package oc import ( "github.com/sirupsen/logrus" "go.opencensus.io/trace" + "google.golang.org/grpc/codes" + + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" ) -var _ = (trace.Exporter)(&LogrusExporter{}) +const spanMessage = "Span" + +var _errorCodeKey = logrus.ErrorKey + "Code" // LogrusExporter is an OpenCensus `trace.Exporter` that exports // `trace.SpanData` to logrus output. -type LogrusExporter struct { -} +type LogrusExporter struct{} + +var _ trace.Exporter = &LogrusExporter{} // ExportSpan exports `s` based on the the following rules: // -// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, -// `s.ParentSpanID` for correlation +// 1. All output will contain `s.Attributes`, `s.SpanKind`, `s.TraceID`, +// `s.SpanID`, and `s.ParentSpanID` for correlation // // 2. Any calls to .Annotate will not be supported. // @@ -23,21 +30,57 @@ type LogrusExporter struct { // `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` // providing `s.Status.Message` as the error value. func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { - // Combine all span annotations with traceID, spanID, parentSpanID - baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) - baseEntry.Data["traceID"] = s.TraceID.String() - baseEntry.Data["spanID"] = s.SpanID.String() - baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() - baseEntry.Data["startTime"] = s.StartTime - baseEntry.Data["endTime"] = s.EndTime - baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() - baseEntry.Data["name"] = s.Name - baseEntry.Time = s.StartTime + if s.DroppedAnnotationCount > 0 { + logrus.WithFields(logrus.Fields{ + "name": s.Name, + logfields.TraceID: s.TraceID.String(), + logfields.SpanID: s.SpanID.String(), + "dropped": s.DroppedAttributeCount, + "maxAttributes": len(s.Attributes), + }).Warning("span had dropped attributes") + } + + entry := log.L.Dup() + // Combine all span annotations with span data (eg, trace ID, span ID, parent span ID, + // error, status code) + // (OC) Span attributes are guaranteed to be strings, bools, or int64s, so we can + // can skip overhead in entry.WithFields() and add them directly to entry.Data. + // Preallocate ahead of time, since we should add, at most, 10 additional entries + data := make(logrus.Fields, len(entry.Data)+len(s.Attributes)+10) + + // Default log entry may have prexisting/application-wide data + for k, v := range entry.Data { + data[k] = v + } + for k, v := range s.Attributes { + data[k] = v + } + + data[logfields.Name] = s.Name + data[logfields.TraceID] = s.TraceID.String() + data[logfields.SpanID] = s.SpanID.String() + data[logfields.ParentSpanID] = s.ParentSpanID.String() + data[logfields.StartTime] = s.StartTime + data[logfields.EndTime] = s.EndTime + data[logfields.Duration] = s.EndTime.Sub(s.StartTime) + if sk := spanKindToString(s.SpanKind); sk != "" { + data["spanKind"] = sk + } level := logrus.InfoLevel if s.Status.Code != 0 { level = logrus.ErrorLevel - baseEntry.Data[logrus.ErrorKey] = s.Status.Message + + // don't overwrite an existing "error" or "errorCode" attributes + if _, ok := data[logrus.ErrorKey]; !ok { + data[logrus.ErrorKey] = s.Status.Message + } + if _, ok := data[_errorCodeKey]; !ok { + data[_errorCodeKey] = codes.Code(s.Status.Code).String() + } } - baseEntry.Log(level, "Span") + + entry.Data = data + entry.Time = s.StartTime + entry.Log(level, spanMessage) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go index fee4765cb..726078432 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -1,17 +1,58 @@ package oc import ( + "context" + + "github.com/Microsoft/hcsshim/internal/log" "go.opencensus.io/trace" ) +var DefaultSampler = trace.AlwaysSample() + // SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If // `err` is `nil` assumes `trace.StatusCodeOk`. func SetSpanStatus(span *trace.Span, err error) { status := trace.Status{} if err != nil { - // TODO: JTERRY75 - Handle errors in a non-generic way - status.Code = trace.StatusCodeUnknown + status.Code = int32(toStatusCode(err)) status.Message = err.Error() } span.SetStatus(status) } + +// StartSpan wraps "go.opencensus.io/trace".StartSpan, but, if the span is sampling, +// adds a log entry to the context that points to the newly created span. +func StartSpan(ctx context.Context, name string, o ...trace.StartOption) (context.Context, *trace.Span) { + ctx, s := trace.StartSpan(ctx, name, o...) + return update(ctx, s) +} + +// StartSpanWithRemoteParent wraps "go.opencensus.io/trace".StartSpanWithRemoteParent. +// +// See StartSpan for more information. +func StartSpanWithRemoteParent(ctx context.Context, name string, parent trace.SpanContext, o ...trace.StartOption) (context.Context, *trace.Span) { + ctx, s := trace.StartSpanWithRemoteParent(ctx, name, parent, o...) + return update(ctx, s) +} + +func update(ctx context.Context, s *trace.Span) (context.Context, *trace.Span) { + if s.IsRecordingEvents() { + ctx = log.UpdateContext(ctx) + } + + return ctx, s +} + +var WithServerSpanKind = trace.WithSpanKind(trace.SpanKindServer) +var WithClientSpanKind = trace.WithSpanKind(trace.SpanKindClient) + +func spanKindToString(sk int) string { + switch sk { + case trace.SpanKindClient: + return "client" + case trace.SpanKindServer: + return "server" + default: + return "" + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/protocol/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/protocol/guestrequest/types.go new file mode 100644 index 000000000..d8d0c20b1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/protocol/guestrequest/types.go @@ -0,0 +1,56 @@ +package guestrequest + +// These are constants for v2 schema modify requests. + +type RequestType string +type ResourceType string + +// RequestType const +const ( + RequestTypeAdd RequestType = "Add" + RequestTypeRemove RequestType = "Remove" + RequestTypePreAdd RequestType = "PreAdd" // For networking + RequestTypeUpdate RequestType = "Update" +) + +type SignalValueWCOW string + +const ( + SignalValueWCOWCtrlC SignalValueWCOW = "CtrlC" + SignalValueWCOWCtrlBreak SignalValueWCOW = "CtrlBreak" + SignalValueWCOWCtrlClose SignalValueWCOW = "CtrlClose" + SignalValueWCOWCtrlLogOff SignalValueWCOW = "CtrlLogOff" + SignalValueWCOWCtrlShutdown SignalValueWCOW = "CtrlShutdown" +) + +// ModificationRequest is for modify commands passed to the guest. +type ModificationRequest struct { + RequestType RequestType `json:"RequestType,omitempty"` + ResourceType ResourceType `json:"ResourceType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type NetworkModifyRequest struct { + AdapterId string `json:"AdapterId,omitempty"` //nolint:stylecheck + RequestType RequestType `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type RS4NetworkModifyRequest struct { + AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` //nolint:stylecheck + RequestType RequestType `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +var ( + // V5 GUIDs for SCSI controllers + // These GUIDs are created with namespace GUID "d422512d-2bf2-4752-809d-7b82b5fcb1b4" + // and index as names. For example, first GUID is created like this: + // guid.NewV5("d422512d-2bf2-4752-809d-7b82b5fcb1b4", []byte("0")) + ScsiControllerGuids = []string{ + "df6d0690-79e5-55b6-a5ec-c1e2f77f580a", + "0110f83b-de10-5172-a266-78bca56bf50a", + "b5d2d8d4-3a75-51bf-945b-3444dc6b8579", + "305891a9-b251-5dfe-91a2-c25d9212275b", + } +) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/queue/mq.go b/vendor/github.com/Microsoft/hcsshim/internal/queue/mq.go new file mode 100644 index 000000000..4eb9bb9f1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/queue/mq.go @@ -0,0 +1,92 @@ +package queue + +import ( + "errors" + "sync" +) + +var ErrQueueClosed = errors.New("the queue is closed for reading and writing") + +// MessageQueue represents a threadsafe message queue to be used to retrieve or +// write messages to. +type MessageQueue struct { + m *sync.RWMutex + c *sync.Cond + messages []interface{} + closed bool +} + +// NewMessageQueue returns a new MessageQueue. +func NewMessageQueue() *MessageQueue { + m := &sync.RWMutex{} + return &MessageQueue{ + m: m, + c: sync.NewCond(m), + messages: []interface{}{}, + } +} + +// Enqueue writes `msg` to the queue. +func (mq *MessageQueue) Enqueue(msg interface{}) error { + mq.m.Lock() + defer mq.m.Unlock() + + if mq.closed { + return ErrQueueClosed + } + mq.messages = append(mq.messages, msg) + // Signal a waiter that there is now a value available in the queue. + mq.c.Signal() + return nil +} + +// Dequeue will read a value from the queue and remove it. If the queue +// is empty, this will block until the queue is closed or a value gets enqueued. +func (mq *MessageQueue) Dequeue() (interface{}, error) { + mq.m.Lock() + defer mq.m.Unlock() + + for !mq.closed && mq.size() == 0 { + mq.c.Wait() + } + + // We got woken up, check if it's because the queue got closed. + if mq.closed { + return nil, ErrQueueClosed + } + + val := mq.messages[0] + mq.messages[0] = nil + mq.messages = mq.messages[1:] + return val, nil +} + +// Size returns the size of the queue. +func (mq *MessageQueue) Size() int { + mq.m.RLock() + defer mq.m.RUnlock() + return mq.size() +} + +// Nonexported size check to check if the queue is empty inside already locked functions. +func (mq *MessageQueue) size() int { + return len(mq.messages) +} + +// Close closes the queue for future writes or reads. Any attempts to read or write from the +// queue after close will return ErrQueueClosed. This is safe to call multiple times. +func (mq *MessageQueue) Close() { + mq.m.Lock() + defer mq.m.Unlock() + + // Already closed, noop + if mq.closed { + return + } + + mq.messages = nil + mq.closed = true + // If there's anybody currently waiting on a value from Dequeue, we need to + // broadcast so the read(s) can return ErrQueueClosed. + mq.c.Broadcast() +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/do.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/do.go new file mode 100644 index 000000000..f211d25e7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/do.go @@ -0,0 +1 @@ +package safefile diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go index 66b8d7e03..74967f21a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go @@ -1,3 +1,5 @@ +//go:build windows + package safefile import ( @@ -156,7 +158,6 @@ func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os. if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: winapi.RtlNtStatusToDosError(winapi.STATUS_REPARSE_POINT_ENCOUNTERED)} } - } else { parent = newroot } @@ -339,6 +340,33 @@ func MkdirRelative(path string, root *os.File) error { return err } +// MkdirAllRelative creates each directory in the path relative to a root, failing if +// any existing intermediate path components are reparse points. +func MkdirAllRelative(path string, root *os.File) error { + pathParts := strings.Split(filepath.Clean(path), (string)(filepath.Separator)) + for index := range pathParts { + partialPath := filepath.Join(pathParts[0 : index+1]...) + stat, err := LstatRelative(partialPath, root) + + if err != nil { + if os.IsNotExist(err) { + if err := MkdirRelative(partialPath, root); err != nil { + return err + } + continue + } + return err + } + + if !stat.IsDir() { + fullPath := filepath.Join(root.Name(), partialPath) + return &os.PathError{Op: "mkdir", Path: fullPath, Err: syscall.ENOTDIR} + } + } + + return nil +} + // LstatRelative performs a stat operation on a file relative to a root, failing // if any intermediate path components are reparse points. func LstatRelative(path string, root *os.File) (os.FileInfo, error) { diff --git a/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go b/vendor/github.com/Microsoft/hcsshim/internal/security/grantvmgroupaccess.go similarity index 60% rename from vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go rename to vendor/github.com/Microsoft/hcsshim/internal/security/grantvmgroupaccess.go index fca241590..7dfa1e594 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/security/grantvmgroupaccess.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/security/grantvmgroupaccess.go @@ -1,13 +1,13 @@ +//go:build windows // +build windows package security import ( + "fmt" "os" "syscall" "unsafe" - - "github.com/pkg/errors" ) type ( @@ -20,25 +20,31 @@ type ( securityInformation uint32 trusteeForm uint32 trusteeType uint32 +) - explicitAccess struct { - accessPermissions accessMask - accessMode accessMode - inheritance inheritMode - trustee trustee - } +type explicitAccess struct { + accessPermissions accessMask + accessMode accessMode + inheritance inheritMode + trustee trustee +} - trustee struct { - multipleTrustee *trustee - multipleTrusteeOperation int32 - trusteeForm trusteeForm - trusteeType trusteeType - name uintptr - } -) +type trustee struct { + multipleTrustee *trustee + multipleTrusteeOperation int32 + trusteeForm trusteeForm + trusteeType trusteeType + name uintptr +} const ( - accessMaskDesiredPermission accessMask = 1 << 31 // GENERIC_READ + AccessMaskNone accessMask = 0 + AccessMaskRead accessMask = 1 << 31 // GENERIC_READ + AccessMaskWrite accessMask = 1 << 30 // GENERIC_WRITE + AccessMaskExecute accessMask = 1 << 29 // GENERIC_EXECUTE + AccessMaskAll accessMask = 1 << 28 // GENERIC_ALL + + accessMaskDesiredPermission = AccessMaskRead accessModeGrant accessMode = 1 @@ -57,6 +63,7 @@ const ( shareModeRead shareMode = 0x1 shareModeWrite shareMode = 0x2 + //nolint:stylecheck // ST1003 sidVmGroup = "S-1-5-83-0" trusteeFormIsSid trusteeForm = 0 @@ -64,15 +71,24 @@ const ( trusteeTypeWellKnownGroup trusteeType = 5 ) -// GrantVMGroupAccess sets the DACL for a specified file or directory to +// GrantVmGroupAccess sets the DACL for a specified file or directory to // include Grant ACE entries for the VM Group SID. This is a golang re- // implementation of the same function in vmcompute, just not exported in // RS5. Which kind of sucks. Sucks a lot :/ -func GrantVmGroupAccess(name string) error { +func GrantVmGroupAccess(name string) error { //nolint:stylecheck // ST1003 + return GrantVmGroupAccessWithMask(name, accessMaskDesiredPermission) +} + +// GrantVmGroupAccessWithMask sets the desired DACL for a specified file or +// directory. +func GrantVmGroupAccessWithMask(name string, access accessMask) error { //nolint:stylecheck // ST1003 + if access == 0 || access<<4 != 0 { + return fmt.Errorf("invalid access mask: 0x%08x", access) + } // Stat (to determine if `name` is a directory). s, err := os.Stat(name) if err != nil { - return errors.Wrapf(err, "%s os.Stat %s", gvmga, name) + return fmt.Errorf("%s os.Stat %s: %w", gvmga, name, err) } // Get a handle to the file/directory. Must defer Close on success. @@ -80,7 +96,9 @@ func GrantVmGroupAccess(name string) error { if err != nil { return err // Already wrapped } - defer syscall.CloseHandle(fd) + defer func() { + _ = syscall.CloseHandle(fd) + }() // Get the current DACL and Security Descriptor. Must defer LocalFree on success. ot := objectTypeFileObject @@ -88,21 +106,25 @@ func GrantVmGroupAccess(name string) error { sd := uintptr(0) origDACL := uintptr(0) if err := getSecurityInfo(fd, uint32(ot), uint32(si), nil, nil, &origDACL, nil, &sd); err != nil { - return errors.Wrapf(err, "%s GetSecurityInfo %s", gvmga, name) + return fmt.Errorf("%s GetSecurityInfo %s: %w", gvmga, name, err) } - defer syscall.LocalFree((syscall.Handle)(unsafe.Pointer(sd))) + defer func() { + _, _ = syscall.LocalFree((syscall.Handle)(unsafe.Pointer(sd))) + }() // Generate a new DACL which is the current DACL with the required ACEs added. // Must defer LocalFree on success. - newDACL, err := generateDACLWithAcesAdded(name, s.IsDir(), origDACL) + newDACL, err := generateDACLWithAcesAdded(name, s.IsDir(), access, origDACL) if err != nil { return err // Already wrapped } - defer syscall.LocalFree((syscall.Handle)(unsafe.Pointer(newDACL))) + defer func() { + _, _ = syscall.LocalFree((syscall.Handle)(unsafe.Pointer(newDACL))) + }() // And finally use SetSecurityInfo to apply the updated DACL. if err := setSecurityInfo(fd, uint32(ot), uint32(si), uintptr(0), uintptr(0), newDACL, uintptr(0)); err != nil { - return errors.Wrapf(err, "%s SetSecurityInfo %s", gvmga, name) + return fmt.Errorf("%s SetSecurityInfo %s: %w", gvmga, name, err) } return nil @@ -111,7 +133,10 @@ func GrantVmGroupAccess(name string) error { // createFile is a helper function to call [Nt]CreateFile to get a handle to // the file or directory. func createFile(name string, isDir bool) (syscall.Handle, error) { - namep := syscall.StringToUTF16(name) + namep, err := syscall.UTF16FromString(name) + if err != nil { + return 0, fmt.Errorf("syscall.UTF16FromString %s: %w", name, err) + } da := uint32(desiredAccessReadControl | desiredAccessWriteDac) sm := uint32(shareModeRead | shareModeWrite) fa := uint32(syscall.FILE_ATTRIBUTE_NORMAL) @@ -120,18 +145,18 @@ func createFile(name string, isDir bool) (syscall.Handle, error) { } fd, err := syscall.CreateFile(&namep[0], da, sm, nil, syscall.OPEN_EXISTING, fa, 0) if err != nil { - return 0, errors.Wrapf(err, "%s syscall.CreateFile %s", gvmga, name) + return 0, fmt.Errorf("%s syscall.CreateFile %s: %w", gvmga, name, err) } return fd, nil } // generateDACLWithAcesAdded generates a new DACL with the two needed ACEs added. // The caller is responsible for LocalFree of the returned DACL on success. -func generateDACLWithAcesAdded(name string, isDir bool, origDACL uintptr) (uintptr, error) { +func generateDACLWithAcesAdded(name string, isDir bool, desiredAccess accessMask, origDACL uintptr) (uintptr, error) { // Generate pointers to the SIDs based on the string SIDs sid, err := syscall.StringToSid(sidVmGroup) if err != nil { - return 0, errors.Wrapf(err, "%s syscall.StringToSid %s %s", gvmga, name, sidVmGroup) + return 0, fmt.Errorf("%s syscall.StringToSid %s %s: %w", gvmga, name, sidVmGroup, err) } inheritance := inheritModeNoInheritance @@ -140,8 +165,8 @@ func generateDACLWithAcesAdded(name string, isDir bool, origDACL uintptr) (uintp } eaArray := []explicitAccess{ - explicitAccess{ - accessPermissions: accessMaskDesiredPermission, + { + accessPermissions: desiredAccess, accessMode: accessModeGrant, inheritance: inheritance, trustee: trustee{ @@ -154,7 +179,7 @@ func generateDACLWithAcesAdded(name string, isDir bool, origDACL uintptr) (uintp modifiedDACL := uintptr(0) if err := setEntriesInAcl(uintptr(uint32(1)), uintptr(unsafe.Pointer(&eaArray[0])), origDACL, &modifiedDACL); err != nil { - return 0, errors.Wrapf(err, "%s SetEntriesInAcl %s", gvmga, name) + return 0, fmt.Errorf("%s SetEntriesInAcl %s: %w", gvmga, name, err) } return modifiedDACL, nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/security/syscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/security/syscall_windows.go new file mode 100644 index 000000000..71326e4e4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/security/syscall_windows.go @@ -0,0 +1,7 @@ +package security + +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go syscall_windows.go + +//sys getSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, ppsidOwner **uintptr, ppsidGroup **uintptr, ppDacl *uintptr, ppSacl *uintptr, ppSecurityDescriptor *uintptr) (win32err error) = advapi32.GetSecurityInfo +//sys setSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, psidOwner uintptr, psidGroup uintptr, pDacl uintptr, pSacl uintptr) (win32err error) = advapi32.SetSecurityInfo +//sys setEntriesInAcl(count uintptr, pListOfEEs uintptr, oldAcl uintptr, newAcl *uintptr) (win32err error) = advapi32.SetEntriesInAclW diff --git a/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/security/zsyscall_windows.go similarity index 55% rename from vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go rename to vendor/github.com/Microsoft/hcsshim/internal/security/zsyscall_windows.go index 4a90cb3cc..26c986b88 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/security/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/security/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated by 'go generate'; DO NOT EDIT. +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package security @@ -45,26 +47,26 @@ var ( procSetSecurityInfo = modadvapi32.NewProc("SetSecurityInfo") ) -func getSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, ppsidOwner **uintptr, ppsidGroup **uintptr, ppDacl *uintptr, ppSacl *uintptr, ppSecurityDescriptor *uintptr) (err error) { - r1, _, e1 := syscall.Syscall9(procGetSecurityInfo.Addr(), 8, uintptr(handle), uintptr(objectType), uintptr(si), uintptr(unsafe.Pointer(ppsidOwner)), uintptr(unsafe.Pointer(ppsidGroup)), uintptr(unsafe.Pointer(ppDacl)), uintptr(unsafe.Pointer(ppSacl)), uintptr(unsafe.Pointer(ppSecurityDescriptor)), 0) - if r1 != 0 { - err = errnoErr(e1) +func getSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, ppsidOwner **uintptr, ppsidGroup **uintptr, ppDacl *uintptr, ppSacl *uintptr, ppSecurityDescriptor *uintptr) (win32err error) { + r0, _, _ := syscall.Syscall9(procGetSecurityInfo.Addr(), 8, uintptr(handle), uintptr(objectType), uintptr(si), uintptr(unsafe.Pointer(ppsidOwner)), uintptr(unsafe.Pointer(ppsidGroup)), uintptr(unsafe.Pointer(ppDacl)), uintptr(unsafe.Pointer(ppSacl)), uintptr(unsafe.Pointer(ppSecurityDescriptor)), 0) + if r0 != 0 { + win32err = syscall.Errno(r0) } return } -func setEntriesInAcl(count uintptr, pListOfEEs uintptr, oldAcl uintptr, newAcl *uintptr) (err error) { - r1, _, e1 := syscall.Syscall6(procSetEntriesInAclW.Addr(), 4, uintptr(count), uintptr(pListOfEEs), uintptr(oldAcl), uintptr(unsafe.Pointer(newAcl)), 0, 0) - if r1 != 0 { - err = errnoErr(e1) +func setEntriesInAcl(count uintptr, pListOfEEs uintptr, oldAcl uintptr, newAcl *uintptr) (win32err error) { + r0, _, _ := syscall.Syscall6(procSetEntriesInAclW.Addr(), 4, uintptr(count), uintptr(pListOfEEs), uintptr(oldAcl), uintptr(unsafe.Pointer(newAcl)), 0, 0) + if r0 != 0 { + win32err = syscall.Errno(r0) } return } -func setSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, psidOwner uintptr, psidGroup uintptr, pDacl uintptr, pSacl uintptr) (err error) { - r1, _, e1 := syscall.Syscall9(procSetSecurityInfo.Addr(), 7, uintptr(handle), uintptr(objectType), uintptr(si), uintptr(psidOwner), uintptr(psidGroup), uintptr(pDacl), uintptr(pSacl), 0, 0) - if r1 != 0 { - err = errnoErr(e1) +func setSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, psidOwner uintptr, psidGroup uintptr, pDacl uintptr, pSacl uintptr) (win32err error) { + r0, _, _ := syscall.Syscall9(procSetSecurityInfo.Addr(), 7, uintptr(handle), uintptr(objectType), uintptr(si), uintptr(psidOwner), uintptr(psidGroup), uintptr(pDacl), uintptr(pSacl), 0, 0) + if r0 != 0 { + win32err = syscall.Errno(r0) } return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/doc.go new file mode 100644 index 000000000..9dd00c812 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/doc.go @@ -0,0 +1 @@ +package vmcompute diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go index e7f114b67..79b14ef97 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -1,3 +1,5 @@ +//go:build windows + package vmcompute import ( @@ -5,15 +7,17 @@ import ( "syscall" "time" + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" + "github.com/Microsoft/hcsshim/internal/interop" "github.com/Microsoft/hcsshim/internal/log" "github.com/Microsoft/hcsshim/internal/logfields" "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/timeout" - "go.opencensus.io/trace" ) -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go vmcompute.go //sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? //sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? @@ -62,7 +66,7 @@ type HcsCallback syscall.Handle type HcsProcessInformation struct { // ProcessId is the pid of the created process. ProcessId uint32 - reserved uint32 //nolint:structcheck + _ uint32 // reserved padding // StdInput is the handle associated with the stdin of the process. StdInput syscall.Handle // StdOutput is the handle associated with the stdout of the process. @@ -72,12 +76,28 @@ type HcsProcessInformation struct { } func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + now := time.Now() if timeout > 0 { var cancel gcontext.CancelFunc ctx, cancel = gcontext.WithTimeout(ctx, timeout) defer cancel() } + // if ctx already has prior deadlines, the shortest timeout takes precedence and is used. + // find the true timeout for reporting + // + // this is mostly an issue with (*UtilityVM).Start(context.Context), which sets its + // own (2 minute) timeout. + deadline, ok := ctx.Deadline() + trueTimeout := timeout + if ok { + trueTimeout = deadline.Sub(now) + log.G(ctx).WithFields(logrus.Fields{ + logfields.Timeout: trueTimeout, + "desiredTimeout": timeout, + }).Trace("Executing syscall with deadline") + } + done := make(chan error, 1) go func() { done <- f() @@ -85,8 +105,10 @@ func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error select { case <-ctx.Done(): if ctx.Err() == gcontext.DeadlineExceeded { - log.G(ctx).WithField(logfields.Timeout, timeout). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + log.G(ctx).WithField(logfields.Timeout, trueTimeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. " + + "If it appears to be making no forward progress, obtain the stacks and see if there is a syscall " + + "stuck in the platform API for a significant length of time.") } return ctx.Err() case err := <-done: @@ -95,7 +117,7 @@ func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error } func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + ctx, span := oc.StartSpan(ctx, "HcsEnumerateComputeSystems") defer span.End() defer func() { if result != "" { @@ -122,7 +144,7 @@ func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSyst } func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsCreateComputeSystem") defer span.End() defer func() { if result != "" { @@ -147,7 +169,7 @@ func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration strin } func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsOpenComputeSystem") defer span.End() defer func() { if result != "" { @@ -167,7 +189,7 @@ func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSys } func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { - ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsCloseComputeSystem") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -177,7 +199,7 @@ func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr er } func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsStartComputeSystem") defer span.End() defer func() { if result != "" { @@ -200,7 +222,7 @@ func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, option } func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsShutdownComputeSystem") defer span.End() defer func() { if result != "" { @@ -223,7 +245,7 @@ func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, opt } func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsTerminateComputeSystem") defer span.End() defer func() { if result != "" { @@ -246,7 +268,7 @@ func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, op } func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsPauseComputeSystem") defer span.End() defer func() { if result != "" { @@ -269,7 +291,7 @@ func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, option } func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsResumeComputeSystem") defer span.End() defer func() { if result != "" { @@ -292,7 +314,7 @@ func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, optio } func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + ctx, span := oc.StartSpan(ctx, "HcsGetComputeSystemProperties") defer span.End() defer func() { if result != "" { @@ -319,7 +341,7 @@ func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem } func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsModifyComputeSystem") defer span.End() defer func() { if result != "" { @@ -340,7 +362,7 @@ func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, confi } func HcsModifyServiceSettings(ctx gcontext.Context, settings string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsModifyServiceSettings") + ctx, span := oc.StartSpan(ctx, "HcsModifyServiceSettings") defer span.End() defer func() { if result != "" { @@ -361,7 +383,7 @@ func HcsModifyServiceSettings(ctx gcontext.Context, settings string) (result str } func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + ctx, span := oc.StartSpan(ctx, "HcsRegisterComputeSystemCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -371,7 +393,7 @@ func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSys } func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { - ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + ctx, span := oc.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -381,7 +403,7 @@ func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle Hcs } func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + ctx, span := oc.StartSpan(ctx, "HcsCreateProcess") defer span.End() defer func() { if result != "" { @@ -389,7 +411,12 @@ func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processPara } oc.SetSpanStatus(span, hr) }() - span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + if span.IsRecordingEvents() { + // wont handle v1 process parameters + if s, err := log.ScrubProcessParameters(processParameters); err == nil { + span.AddAttributes(trace.StringAttribute("processParameters", s)) + } + } return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 @@ -402,7 +429,7 @@ func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processPara } func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + ctx, span := oc.StartSpan(ctx, "HcsOpenProcess") defer span.End() defer func() { if result != "" { @@ -423,7 +450,7 @@ func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) ( } func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { - ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + ctx, span := oc.StartSpan(ctx, "HcsCloseProcess") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -433,7 +460,7 @@ func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { } func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + ctx, span := oc.StartSpan(ctx, "HcsTerminateProcess") defer span.End() defer func() { if result != "" { @@ -453,7 +480,7 @@ func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result strin } func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + ctx, span := oc.StartSpan(ctx, "HcsSignalProcess") defer span.End() defer func() { if result != "" { @@ -474,7 +501,7 @@ func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) } func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + ctx, span := oc.StartSpan(ctx, "HcsGetProcessInfo") defer span.End() defer func() { if result != "" { @@ -494,7 +521,7 @@ func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInforma } func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + ctx, span := oc.StartSpan(ctx, "HcsGetProcessProperties") defer span.End() defer func() { if result != "" { @@ -520,7 +547,7 @@ func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processP } func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + ctx, span := oc.StartSpan(ctx, "HcsModifyProcess") defer span.End() defer func() { if result != "" { @@ -541,7 +568,7 @@ func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) } func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + ctx, span := oc.StartSpan(ctx, "HcsGetServiceProperties") defer span.End() defer func() { if result != "" { @@ -568,7 +595,7 @@ func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (proper } func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + ctx, span := oc.StartSpan(ctx, "HcsRegisterProcessCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -578,7 +605,7 @@ func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callba } func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { - ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + ctx, span := oc.StartSpan(ctx, "HcsUnregisterProcessCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() @@ -588,7 +615,7 @@ func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallba } func HcsSaveComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { - ctx, span := trace.StartSpan(ctx, "HcsSaveComputeSystem") + ctx, span := oc.StartSpan(ctx, "HcsSaveComputeSystem") defer span.End() defer func() { if result != "" { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index cae55058d..42368872b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package vmcompute @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -39,48 +42,55 @@ func errnoErr(e syscall.Errno) error { var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") - procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") - procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") - procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") - procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") - procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") - procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") - procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") - procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") - procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") procHcsSaveComputeSystem = modvmcompute.NewProc("HcsSaveComputeSystem") - procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") - procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") - procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") - procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) -func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { + hr = procHcsCloseComputeSystem.Find() if hr != nil { return } - return _hcsEnumerateComputeSystems(_p0, computeSystems, result) + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { - if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { +func hcsCloseProcess(process HcsProcess) (hr error) { + hr = procHcsCloseProcess.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -105,7 +115,8 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha } func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { - if hr = procHcsCreateComputeSystem.Find(); hr != nil { + hr = procHcsCreateComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) @@ -118,34 +129,21 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) + _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { return } - return _hcsOpenComputeSystem(_p0, computeSystem, result) -} - -func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { - if hr = procHcsOpenComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { - if hr = procHcsCloseComputeSystem.Find(); hr != nil { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { + hr = procHcsCreateProcess.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -155,20 +153,21 @@ func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) + _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - return _hcsStartComputeSystem(computeSystem, _p0, result) + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) } -func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsStartComputeSystem.Find(); hr != nil { +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + hr = procHcsEnumerateComputeSystems.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -178,20 +177,21 @@ func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { return } - return _hcsShutdownComputeSystem(computeSystem, _p0, result) + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsShutdownComputeSystem.Find(); hr != nil { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + hr = procHcsGetComputeSystemProperties.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -201,20 +201,12 @@ func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { + hr = procHcsGetProcessInfo.Find() if hr != nil { return } - return _hcsTerminateComputeSystem(computeSystem, _p0, result) -} - -func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -224,20 +216,12 @@ func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { + hr = procHcsGetProcessProperties.Find() if hr != nil { return } - return _hcsPauseComputeSystem(computeSystem, _p0, result) -} - -func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsPauseComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -247,20 +231,21 @@ func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { return } - return _hcsResumeComputeSystem(computeSystem, _p0, result) + return _hcsGetServiceProperties(_p0, properties, result) } -func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsResumeComputeSystem.Find(); hr != nil { +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + hr = procHcsGetServiceProperties.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -270,20 +255,21 @@ func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { return } - return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) + return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { + hr = procHcsModifyComputeSystem.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -293,20 +279,21 @@ func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(configuration) + _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcsModifyComputeSystem(computeSystem, _p0, result) + return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { - if hr = procHcsModifyComputeSystem.Find(); hr != nil { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { + hr = procHcsModifyProcess.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -326,7 +313,8 @@ func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { } func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyServiceSettings.Find(); hr != nil { + hr = procHcsModifyServiceSettings.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) @@ -339,11 +327,21 @@ func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { return } -func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { - if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { + hr = procHcsOpenComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -353,11 +351,12 @@ func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { - if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { + hr = procHcsOpenProcess.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -367,20 +366,21 @@ func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { return } -func hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - return _hcsSaveComputeSystem(computeSystem, _p0, result) + return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsSaveComputeSystem.Find(); hr != nil { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsPauseComputeSystem.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsSaveComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -390,20 +390,27 @@ func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **ui return } -func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(processParameters) +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { + hr = procHcsRegisterComputeSystemCallback.Find() if hr != nil { return } - return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { - if hr = procHcsCreateProcess.Find(); hr != nil { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { + hr = procHcsRegisterProcessCallback.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -413,11 +420,21 @@ func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { - if hr = procHcsOpenProcess.Find(); hr != nil { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsResumeComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -427,11 +444,21 @@ func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, re return } -func hcsCloseProcess(process HcsProcess) (hr error) { - if hr = procHcsCloseProcess.Find(); hr != nil { +func hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) + return _hcsSaveComputeSystem(computeSystem, _p0, result) +} + +func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsSaveComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsSaveComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -441,11 +468,21 @@ func hcsCloseProcess(process HcsProcess) (hr error) { return } -func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsShutdownComputeSystem.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -465,7 +502,8 @@ func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr e } func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsSignalProcess.Find(); hr != nil { + hr = procHcsSignalProcess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) @@ -478,25 +516,21 @@ func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { - if hr = procHcsGetProcessInfo.Find(); hr != nil { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return + return _hcsStartComputeSystem(computeSystem, _p0, result) } -func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { - if hr = procHcsGetProcessProperties.Find(); hr != nil { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsStartComputeSystem.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -506,20 +540,21 @@ func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) + _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - return _hcsModifyProcess(process, _p0, result) + return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyProcess.Find(); hr != nil { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsTerminateComputeSystem.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -529,20 +564,12 @@ func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (h return } -func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(propertyQuery) +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { + hr = procHcsTerminateProcess.Find() if hr != nil { return } - return _hcsGetServiceProperties(_p0, properties, result) -} - -func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetServiceProperties.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -552,11 +579,12 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { - if hr = procHcsRegisterProcessCallback.Find(); hr != nil { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { + hr = procHcsUnregisterComputeSystemCallback.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -567,7 +595,8 @@ func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context ui } func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { - if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + hr = procHcsUnregisterProcessCallback.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go index ff81ac2c1..e12253c94 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -14,14 +16,14 @@ import ( // An activated layer must later be deactivated via DeactivateLayer. func ActivateLayer(ctx context.Context, path string) (err error) { title := "hcsshim::ActivateLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) err = activateLayer(&stdDriverInfo, path) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerreader.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerreader.go new file mode 100644 index 000000000..ec4423eff --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerreader.go @@ -0,0 +1,216 @@ +package wclayer + +import ( + "errors" + "io" + "os" + "path/filepath" + "strings" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/oc" + "go.opencensus.io/trace" +) + +type baseLayerReader struct { + s *trace.Span + root string + result chan *fileEntry + proceed chan bool + currentFile *os.File + backupReader *winio.BackupFileReader +} + +func newBaseLayerReader(root string, s *trace.Span) (r *baseLayerReader) { + r = &baseLayerReader{ + s: s, + root: root, + result: make(chan *fileEntry), + proceed: make(chan bool), + } + go r.walk() + return r +} + +func (r *baseLayerReader) walkUntilCancelled() error { + root, err := longpath.LongAbs(r.root) + if err != nil { + return err + } + + r.root = root + + err = filepath.Walk(filepath.Join(r.root, filesPath), func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + // Indirect fix for https://github.com/moby/moby/issues/32838#issuecomment-343610048. + // Handle failure from what may be a golang bug in the conversion of + // UTF16 to UTF8 in files which are left in the recycle bin. Os.Lstat + // which is called by filepath.Walk will fail when a filename contains + // unicode characters. Skip the recycle bin regardless which is goodness. + if strings.EqualFold(path, filepath.Join(r.root, `Files\$Recycle.Bin`)) && info.IsDir() { + return filepath.SkipDir + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + return nil + }) + + if err == errorIterationCanceled { + return nil + } + + if err != nil { + return err + } + + utilityVMAbsPath := filepath.Join(r.root, utilityVMPath) + utilityVMFilesAbsPath := filepath.Join(r.root, utilityVMFilesPath) + + // Ignore a UtilityVM without Files, that's not _really_ a UtiltyVM + if _, err = os.Lstat(utilityVMFilesAbsPath); err != nil { + if os.IsNotExist(err) { + return io.EOF + } + return err + } + + err = filepath.Walk(utilityVMAbsPath, func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + if path != utilityVMAbsPath && path != utilityVMFilesAbsPath && !hasPathPrefix(path, utilityVMFilesAbsPath) { + if info.IsDir() { + return filepath.SkipDir + } + return nil + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + return nil + }) + + if err == errorIterationCanceled { + return nil + } + + if err != nil { + return err + } + + return io.EOF +} + +func (r *baseLayerReader) walk() { + defer close(r.result) + if !<-r.proceed { + return + } + + err := r.walkUntilCancelled() + if err != nil { + for { + r.result <- &fileEntry{err: err} + if !<-r.proceed { + return + } + } + } +} + +func (r *baseLayerReader) reset() { + if r.backupReader != nil { + r.backupReader.Close() + r.backupReader = nil + } + if r.currentFile != nil { + r.currentFile.Close() + r.currentFile = nil + } +} + +func (r *baseLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) { + r.reset() + r.proceed <- true + fe := <-r.result + if fe == nil { + err = errors.New("BaseLayerReader closed") + return + } + if fe.err != nil { + err = fe.err + return + } + + path, err = filepath.Rel(r.root, fe.path) + if err != nil { + return + } + + f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING) + if err != nil { + return + } + defer func() { + if f != nil { + f.Close() + } + }() + + fileInfo, err = winio.GetFileBasicInfo(f) + if err != nil { + return + } + + size = fe.fi.Size() + r.backupReader = winio.NewBackupFileReader(f, true) + + r.currentFile = f + f = nil + return +} + +func (r *baseLayerReader) LinkInfo() (uint32, *winio.FileIDInfo, error) { + fileStandardInfo, err := winio.GetFileStandardInfo(r.currentFile) + if err != nil { + return 0, nil, err + } + fileIDInfo, err := winio.GetFileID(r.currentFile) + if err != nil { + return 0, nil, err + } + return fileStandardInfo.NumberOfLinks, fileIDInfo, nil +} + +func (r *baseLayerReader) Read(b []byte) (int, error) { + if r.backupReader == nil { + return 0, io.EOF + } + return r.backupReader.Read(b) +} + +func (r *baseLayerReader) Close() (err error) { + defer r.s.End() + defer func() { + oc.SetSpanStatus(r.s, err) + close(r.proceed) + }() + r.proceed <- false + // The r.result channel will be closed once walk() returns + <-r.result + r.reset() + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerwriter.go similarity index 99% rename from vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerwriter.go index 3ec708d1e..aea8b421e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayerwriter.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -48,7 +50,6 @@ func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error { if err != nil { return err } - } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/converttobaselayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/converttobaselayer.go new file mode 100644 index 000000000..ceb3b5083 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/converttobaselayer.go @@ -0,0 +1,158 @@ +package wclayer + +import ( + "context" + "fmt" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/safefile" + "github.com/Microsoft/hcsshim/internal/winapi" + "github.com/pkg/errors" + "go.opencensus.io/trace" + "golang.org/x/sys/windows" +) + +var hiveNames = []string{"DEFAULT", "SAM", "SECURITY", "SOFTWARE", "SYSTEM"} + +// Ensure the given file exists as an ordinary file, and create a minimal hive file if not. +func ensureHive(path string, root *os.File) (err error) { + _, err = safefile.LstatRelative(path, root) + if err != nil && !os.IsNotExist(err) { + return fmt.Errorf("accessing %s: %w", path, err) + } + + version := windows.RtlGetVersion() + if version == nil { + return fmt.Errorf("failed to get OS version") + } + + var fullPath string + fullPath, err = longpath.LongAbs(filepath.Join(root.Name(), path)) + if err != nil { + return fmt.Errorf("getting path: %w", err) + } + + var key syscall.Handle + err = winapi.ORCreateHive(&key) + if err != nil { + return fmt.Errorf("creating hive: %w", err) + } + + defer func() { + closeErr := winapi.ORCloseHive(key) + if closeErr != nil && err == nil { + err = fmt.Errorf("closing hive key: %w", closeErr) + } + }() + + err = winapi.ORSaveHive(key, fullPath, version.MajorVersion, version.MinorVersion) + if err != nil { + return fmt.Errorf("saving hive: %w", err) + } + + return nil +} + +func ensureBaseLayer(root *os.File) (hasUtilityVM bool, err error) { + // The base layer registry hives will be copied from here + const hiveSourcePath = "Files\\Windows\\System32\\config" + if err = safefile.MkdirAllRelative(hiveSourcePath, root); err != nil { + return + } + + for _, hiveName := range hiveNames { + hivePath := filepath.Join(hiveSourcePath, hiveName) + if err = ensureHive(hivePath, root); err != nil { + return + } + } + + stat, err := safefile.LstatRelative(utilityVMFilesPath, root) + + if os.IsNotExist(err) { + return false, nil + } + + if err != nil { + return + } + + if !stat.Mode().IsDir() { + fullPath := filepath.Join(root.Name(), utilityVMFilesPath) + return false, errors.Errorf("%s has unexpected file mode %s", fullPath, stat.Mode().String()) + } + + const bcdRelativePath = "EFI\\Microsoft\\Boot\\BCD" + + // Just check that this exists as a regular file. If it exists but is not a valid registry hive, + // ProcessUtilityVMImage will complain: + // "The registry could not read in, or write out, or flush, one of the files that contain the system's image of the registry." + bcdPath := filepath.Join(utilityVMFilesPath, bcdRelativePath) + + stat, err = safefile.LstatRelative(bcdPath, root) + if err != nil { + return false, errors.Wrapf(err, "UtilityVM must contain '%s'", bcdRelativePath) + } + + if !stat.Mode().IsRegular() { + fullPath := filepath.Join(root.Name(), bcdPath) + return false, errors.Errorf("%s has unexpected file mode %s", fullPath, stat.Mode().String()) + } + + return true, nil +} + +func convertToBaseLayer(ctx context.Context, root *os.File) error { + hasUtilityVM, err := ensureBaseLayer(root) + + if err != nil { + return err + } + + if err := ProcessBaseLayer(ctx, root.Name()); err != nil { + return err + } + + if !hasUtilityVM { + return nil + } + + err = safefile.EnsureNotReparsePointRelative(utilityVMPath, root) + if err != nil { + return err + } + + utilityVMPath := filepath.Join(root.Name(), utilityVMPath) + return ProcessUtilityVMImage(ctx, utilityVMPath) +} + +// ConvertToBaseLayer processes a candidate base layer, i.e. a directory +// containing the desired file content under Files/, and optionally the +// desired file content for a UtilityVM under UtilityVM/Files/ +func ConvertToBaseLayer(ctx context.Context, path string) (err error) { + title := "hcsshim::ConvertToBaseLayer" + ctx, span := trace.StartSpan(ctx, title) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("path", path)) + + root, err := safefile.OpenRoot(path) + if err != nil { + return hcserror.New(err, title+" - failed", "") + } + defer func() { + if err2 := root.Close(); err == nil && err2 != nil { + err = hcserror.New(err2, title+" - failed", "") + } + }() + + if err = convertToBaseLayer(ctx, root); err != nil { + return hcserror.New(err, title+" - failed", "") + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go index ffee31ab1..932475723 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // the parent layer provided. func CreateLayer(ctx context.Context, path, parent string) (err error) { title := "hcsshim::CreateLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -21,7 +23,7 @@ func CreateLayer(ctx context.Context, path, parent string) (err error) { err = createLayer(&stdDriverInfo, path, parent) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go index 5a3809ae2..5c9d5d250 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -13,7 +15,7 @@ import ( // This requires the full list of paths to all parent layers up to the base func CreateScratchLayer(ctx context.Context, path string, parentLayerPaths []string) (err error) { title := "hcsshim::CreateScratchLayer" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -28,7 +30,7 @@ func CreateScratchLayer(ctx context.Context, path string, parentLayerPaths []str err = createSandboxLayer(&stdDriverInfo, path, 0, layers) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go index d5bf2f5bd..e3bc77cbc 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -11,7 +13,7 @@ import ( // DeactivateLayer will dismount a layer that was mounted via ActivateLayer. func DeactivateLayer(ctx context.Context, path string) (err error) { title := "hcsshim::DeactivateLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go index 787054e79..d0a59efe1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,14 +14,14 @@ import ( // path, including that layer's containing folder, if any. func DestroyLayer(ctx context.Context, path string) (err error) { title := "hcsshim::DestroyLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) err = destroyLayer(&stdDriverInfo, path) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/doc.go new file mode 100644 index 000000000..dd1d55580 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/doc.go @@ -0,0 +1,4 @@ +// Package wclayer provides bindings to HCS's legacy layer management API and +// provides a higher level interface around these calls for container layer +// management. +package wclayer diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go index 22f7605be..e2ec27ad0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -16,7 +18,7 @@ import ( // ExpandScratchSize expands the size of a layer to at least size bytes. func ExpandScratchSize(ctx context.Context, path string, size uint64) (err error) { title := "hcsshim::ExpandScratchSize" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -25,7 +27,7 @@ func ExpandScratchSize(ctx context.Context, path string, size uint64) (err error err = expandSandboxSize(&stdDriverInfo, path, size) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } // Manually expand the volume now in order to work around bugs in 19H1 and diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go index 09f0de1a4..d4c677aab 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go @@ -1,8 +1,9 @@ +//go:build windows + package wclayer import ( "context" - "io/ioutil" "os" "strings" @@ -19,7 +20,7 @@ import ( // perform the export. func ExportLayer(ctx context.Context, path string, exportFolderPath string, parentLayerPaths []string) (err error) { title := "hcsshim::ExportLayer" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -35,14 +36,21 @@ func ExportLayer(ctx context.Context, path string, exportFolderPath string, pare err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } return nil } +// LayerReader is an interface that supports reading an existing container image layer. type LayerReader interface { + // Next advances to the next file and returns the name, size, and file info Next() (string, int64, *winio.FileBasicInfo, error) + // LinkInfo returns the number of links and the file identifier for the current file. + LinkInfo() (uint32, *winio.FileIDInfo, error) + // Read reads data from the current file, in the format of a Win32 backup stream, and + // returns the number of bytes read. Read(b []byte) (int, error) + // Close finishes the layer reading process and releases any resources. Close() error } @@ -50,7 +58,7 @@ type LayerReader interface { // The caller must have taken the SeBackupPrivilege privilege // to call this and any methods on the resulting LayerReader. func NewLayerReader(ctx context.Context, path string, parentLayerPaths []string) (_ LayerReader, err error) { - ctx, span := trace.StartSpan(ctx, "hcsshim::NewLayerReader") + ctx, span := oc.StartSpan(ctx, "hcsshim::NewLayerReader") defer func() { if err != nil { oc.SetSpanStatus(span, err) @@ -61,7 +69,12 @@ func NewLayerReader(ctx context.Context, path string, parentLayerPaths []string) trace.StringAttribute("path", path), trace.StringAttribute("parentLayerPaths", strings.Join(parentLayerPaths, ", "))) - exportPath, err := ioutil.TempDir("", "hcs") + if len(parentLayerPaths) == 0 { + // This is a base layer. It gets exported differently. + return newBaseLayerReader(path, span), nil + } + + exportPath, err := os.MkdirTemp("", "hcs") if err != nil { return nil, err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go index 4d22d0ecf..715e06e37 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -16,7 +18,7 @@ import ( // folder path at which the layer is stored. func GetLayerMountPath(ctx context.Context, path string) (_ string, err error) { title := "hcsshim::GetLayerMountPath" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) @@ -27,7 +29,7 @@ func GetLayerMountPath(ctx context.Context, path string) (_ string, err error) { log.G(ctx).Debug("Calling proc (1)") err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil) if err != nil { - return "", hcserror.New(err, title+" - failed", "(first call)") + return "", hcserror.New(err, title, "(first call)") } // Allocate a mount path of the returned length. @@ -41,7 +43,7 @@ func GetLayerMountPath(ctx context.Context, path string) (_ string, err error) { log.G(ctx).Debug("Calling proc (2)") err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0]) if err != nil { - return "", hcserror.New(err, title+" - failed", "(second call)") + return "", hcserror.New(err, title, "(second call)") } mountPath := syscall.UTF16ToString(mountPathp[0:]) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go index bcc8fbd42..5e400fb20 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -14,14 +16,14 @@ import ( // of registering them with the graphdriver, graph, and tagstore. func GetSharedBaseImages(ctx context.Context) (_ string, err error) { title := "hcsshim::GetSharedBaseImages" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() var buffer *uint16 err = getBaseImages(&buffer) if err != nil { - return "", hcserror.New(err, title+" - failed", "") + return "", hcserror.New(err, title, "") } imageData := interop.ConvertAndFreeCoTaskMemString(buffer) span.AddAttributes(trace.StringAttribute("imageData", imageData)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go index 3eaca2780..20217ed81 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -11,7 +13,7 @@ import ( // GrantVmAccess adds access to a file for a given VM func GrantVmAccess(ctx context.Context, vmid string, filepath string) (err error) { title := "hcsshim::GrantVmAccess" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -20,7 +22,7 @@ func GrantVmAccess(ctx context.Context, vmid string, filepath string) (err error err = grantVmAccess(vmid, filepath) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go index b3c150d66..50f669a26 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go @@ -1,8 +1,9 @@ +//go:build windows + package wclayer import ( "context" - "io/ioutil" "os" "path/filepath" "strings" @@ -20,7 +21,7 @@ import ( // be present on the system at the paths provided in parentLayerPaths. func ImportLayer(ctx context.Context, path string, importFolderPath string, parentLayerPaths []string) (err error) { title := "hcsshim::ImportLayer" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -36,7 +37,7 @@ func ImportLayer(ctx context.Context, path string, importFolderPath string, pare err = importLayer(&stdDriverInfo, path, importFolderPath, layers) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } return nil } @@ -124,7 +125,7 @@ func (r *legacyLayerWriterWrapper) Close() (err error) { // The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges // to call this and any methods on the resulting LayerWriter. func NewLayerWriter(ctx context.Context, path string, parentLayerPaths []string) (_ LayerWriter, err error) { - ctx, span := trace.StartSpan(ctx, "hcsshim::NewLayerWriter") + ctx, span := oc.StartSpan(ctx, "hcsshim::NewLayerWriter") defer func() { if err != nil { oc.SetSpanStatus(span, err) @@ -148,7 +149,7 @@ func NewLayerWriter(ctx context.Context, path string, parentLayerPaths []string) }, nil } - importPath, err := ioutil.TempDir("", "hcs") + importPath, err := os.MkdirTemp("", "hcs") if err != nil { return nil, err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go index c6999973c..4d82977ea 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // to the system. func LayerExists(ctx context.Context, path string) (_ bool, err error) { title := "hcsshim::LayerExists" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) @@ -21,7 +23,7 @@ func LayerExists(ctx context.Context, path string) (_ bool, err error) { var exists uint32 err = layerExists(&stdDriverInfo, path, &exists) if err != nil { - return false, hcserror.New(err, title+" - failed", "") + return false, hcserror.New(err, title, "") } span.AddAttributes(trace.BoolAttribute("layer-exists", exists != 0)) return exists != 0, nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 0ce34a30f..d4805f144 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // LayerID returns the layer ID of a layer on disk. func LayerID(ctx context.Context, path string) (_ guid.GUID, err error) { title := "hcsshim::LayerID" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 1ec893c6a..d5d2cb137 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer // This file contains utility functions to support storage (graph) related @@ -11,7 +13,9 @@ import ( "github.com/sirupsen/logrus" ) -/* To pass into syscall, we need a struct matching the following: +/* +To pass into syscall, we need a struct matching the following: + enum GraphDriverType { DiffDriver, @@ -34,32 +38,34 @@ var ( stdDriverInfo = driverInfo{1, &utf16EmptyString} ) -/* To pass into syscall, we need a struct matching the following: +/* +To pass into syscall, we need a struct matching the following: + typedef struct _WC_LAYER_DESCRIPTOR { - // - // The ID of the layer - // + // + // The ID of the layer + // - GUID LayerId; + GUID LayerId; - // - // Additional flags - // + // + // Additional flags + // - union { - struct { - ULONG Reserved : 31; - ULONG Dirty : 1; // Created from sandbox as a result of snapshot - }; - ULONG Value; - } Flags; + union { + struct { + ULONG Reserved : 31; + ULONG Dirty : 1; // Created from sandbox as a result of snapshot + }; + ULONG Value; + } Flags; - // - // Path to the layer root directory, null-terminated - // + // + // Path to the layer root directory, null-terminated + // - PCWSTR Path; + PCWSTR Path; } WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; */ diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go index 83ba72cfa..ee8da5df9 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -6,7 +8,6 @@ import ( "errors" "fmt" "io" - "io/ioutil" "os" "path/filepath" "strings" @@ -76,7 +77,7 @@ func readTombstones(path string) (map[string]([]string), error) { defer tf.Close() s := bufio.NewScanner(tf) if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" { - return nil, errors.New("Invalid tombstones file") + return nil, errors.New("invalid tombstones file") } ts := make(map[string]([]string)) @@ -262,7 +263,6 @@ func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.Fil // The creation time and access time get reset for files outside of the Files path. fileInfo.CreationTime = fileInfo.LastWriteTime fileInfo.LastAccessTime = fileInfo.LastWriteTime - } else { // The file attributes are written before the backup stream. var attr uint32 @@ -294,6 +294,18 @@ func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.Fil return } +func (r *legacyLayerReader) LinkInfo() (uint32, *winio.FileIDInfo, error) { + fileStandardInfo, err := winio.GetFileStandardInfo(r.currentFile) + if err != nil { + return 0, nil, err + } + fileIDInfo, err := winio.GetFileID(r.currentFile) + if err != nil { + return 0, nil, err + } + return fileStandardInfo.NumberOfLinks, fileIDInfo, nil +} + func (r *legacyLayerReader) Read(b []byte) (int, error) { if r.backupReader == nil { if r.currentFile == nil { @@ -349,7 +361,7 @@ type legacyLayerWriter struct { currentIsDir bool } -// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer +// newLegacyLayerWriter returns a LayerWriter that can write the container layer // transport format to disk. func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w *legacyLayerWriter, err error) { w = &legacyLayerWriter{ @@ -376,7 +388,7 @@ func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w } w.parentRoots = append(w.parentRoots, f) } - w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536) + w.bufWriter = bufio.NewWriterSize(io.Discard, 65536) return } @@ -419,7 +431,7 @@ func (w *legacyLayerWriter) reset() error { if err != nil { return err } - w.bufWriter.Reset(ioutil.Discard) + w.bufWriter.Reset(io.Discard) if w.currentIsDir { r := w.currentFile br := winio.NewBackupStreamReader(r) @@ -695,7 +707,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro // The file attributes are written before the stream. err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes)) if err != nil { - w.bufWriter.Reset(ioutil.Discard) + w.bufWriter.Reset(io.Discard) return err } } @@ -730,7 +742,7 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error { return errors.New("invalid hard link in layer") } - // Find to try the target of the link in a previously added file. If that + // Try to find the target of the link in a previously added file. If that // fails, search in parent layers. var selectedRoot *os.File if _, ok := w.addedFiles[target]; ok { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index bcf39c6b8..c45fa2750 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -14,15 +16,15 @@ import ( // across all clients. func NameToGuid(ctx context.Context, name string) (_ guid.GUID, err error) { title := "hcsshim::NameToGuid" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() - span.AddAttributes(trace.StringAttribute("name", name)) + span.AddAttributes(trace.StringAttribute("objectName", name)) var id guid.GUID err = nameToGuid(name, &id) if err != nil { - return guid.GUID{}, hcserror.New(err, title+" - failed", "") + return guid.GUID{}, hcserror.New(err, title, "") } span.AddAttributes(trace.StringAttribute("guid", id.String())) return id, nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go index 55f7730d0..b66e07124 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -19,7 +21,7 @@ var prepareLayerLock sync.Mutex // Disabling the filter must be done via UnprepareLayer. func PrepareLayer(ctx context.Context, path string, parentLayerPaths []string) (err error) { title := "hcsshim::PrepareLayer" - ctx, span := trace.StartSpan(ctx, title) + ctx, span := oc.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( @@ -38,7 +40,7 @@ func PrepareLayer(ctx context.Context, path string, parentLayerPaths []string) ( defer prepareLayerLock.Unlock() err = prepareLayer(&stdDriverInfo, path, layers) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go index 30bcdff5f..7c49cbda4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,7 +14,7 @@ import ( // The files should have been extracted to \Files. func ProcessBaseLayer(ctx context.Context, path string) (err error) { title := "hcsshim::ProcessBaseLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) @@ -28,7 +30,7 @@ func ProcessBaseLayer(ctx context.Context, path string) (err error) { // The files should have been extracted to \Files. func ProcessUtilityVMImage(ctx context.Context, path string) (err error) { title := "hcsshim::ProcessUtilityVMImage" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go index 79fb98678..fe20702c1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go @@ -1,3 +1,5 @@ +//go:build windows + package wclayer import ( @@ -12,14 +14,14 @@ import ( // the given id. func UnprepareLayer(ctx context.Context, path string) (err error) { title := "hcsshim::UnprepareLayer" - ctx, span := trace.StartSpan(ctx, title) //nolint:ineffassign,staticcheck + ctx, span := oc.StartSpan(ctx, title) //nolint:ineffassign,staticcheck defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("path", path)) err = unprepareLayer(&stdDriverInfo, path) if err != nil { - return hcserror.New(err, title+" - failed", "") + return hcserror.New(err, title, "") } return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 9b1e06d50..39682b817 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,11 +1,10 @@ -// Package wclayer provides bindings to HCS's legacy layer management API and -// provides a higher level interface around these calls for container layer -// management. +//go:build windows + package wclayer import "github.com/Microsoft/go-winio/pkg/guid" -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go wclayer.go //sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? //sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go index 67f917f07..0cb509c46 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package wclayer @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -37,33 +40,75 @@ func errnoErr(e syscall.Errno) error { } var ( - modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") - modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") procActivateLayer = modvmcompute.NewProc("ActivateLayer") procCopyLayer = modvmcompute.NewProc("CopyLayer") procCreateLayer = modvmcompute.NewProc("CreateLayer") procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") - procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") procExportLayer = modvmcompute.NewProc("ExportLayer") - procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") procImportLayer = modvmcompute.NewProc("ImportLayer") procLayerExists = modvmcompute.NewProc("LayerExists") procNameToGuid = modvmcompute.NewProc("NameToGuid") procPrepareLayer = modvmcompute.NewProc("PrepareLayer") - procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") - procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") - procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") - procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") - procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") ) +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + func activateLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) @@ -74,7 +119,8 @@ func activateLayer(info *driverInfo, id string) (hr error) { } func _activateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procActivateLayer.Find(); hr != nil { + hr = procActivateLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) @@ -102,13 +148,14 @@ func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LA } func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procCopyLayer.Find() + if hr != nil { + return + } var _p2 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p2 = &descriptors[0] } - if hr = procCopyLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -134,7 +181,8 @@ func createLayer(info *driverInfo, id string, parent string) (hr error) { } func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { - if hr = procCreateLayer.Find(); hr != nil { + hr = procCreateLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) @@ -157,13 +205,14 @@ func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors } func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procCreateSandboxLayer.Find() + if hr != nil { + return + } var _p1 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p1 = &descriptors[0] } - if hr = procCreateSandboxLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -174,20 +223,21 @@ func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descripto return } -func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { +func deactivateLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } - return _expandSandboxSize(info, _p0, size) + return _deactivateLayer(info, _p0) } -func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { - if hr = procExpandSandboxSize.Find(); hr != nil { +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + hr = procDeactivateLayer.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -197,20 +247,21 @@ func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { return } -func deactivateLayer(info *driverInfo, id string) (hr error) { +func destroyLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } - return _deactivateLayer(info, _p0) + return _destroyLayer(info, _p0) } -func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDeactivateLayer.Find(); hr != nil { +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + hr = procDestroyLayer.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -220,20 +271,21 @@ func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { return } -func destroyLayer(info *driverInfo, id string) (hr error) { +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } - return _destroyLayer(info, _p0) + return _expandSandboxSize(info, _p0, size) } -func _destroyLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDestroyLayer.Find(); hr != nil { +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + hr = procExpandSandboxSize.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -258,14 +310,30 @@ func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYE } func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procExportLayer.Find() + if hr != nil { + return + } var _p2 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p2 = &descriptors[0] } - if hr = procExportLayer.Find(); hr != nil { + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + hr = procGetBaseImages.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -285,7 +353,8 @@ func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uin } func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { - if hr = procGetLayerMountPath.Find(); hr != nil { + hr = procGetLayerMountPath.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) @@ -298,11 +367,26 @@ func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *u return } -func getBaseImages(buffer **uint16) (hr error) { - if hr = procGetBaseImages.Find(); hr != nil { +func grantVmAccess(vmid string, filepath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(vmid) + if hr != nil { return } - r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(filepath) + if hr != nil { + return + } + return _grantVmAccess(_p0, _p1) +} + +func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { + hr = procGrantVmAccess.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -327,13 +411,14 @@ func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYE } func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procImportLayer.Find() + if hr != nil { + return + } var _p2 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p2 = &descriptors[0] } - if hr = procImportLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -354,7 +439,8 @@ func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { } func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { - if hr = procLayerExists.Find(); hr != nil { + hr = procLayerExists.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) @@ -377,7 +463,8 @@ func nameToGuid(name string, guid *_guid) (hr error) { } func _nameToGuid(name *uint16, guid *_guid) (hr error) { - if hr = procNameToGuid.Find(); hr != nil { + hr = procNameToGuid.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) @@ -400,13 +487,14 @@ func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR } func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procPrepareLayer.Find() + if hr != nil { + return + } var _p1 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p1 = &descriptors[0] } - if hr = procPrepareLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -417,29 +505,6 @@ func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPT return } -func unprepareLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _unprepareLayer(info, _p0) -} - -func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procUnprepareLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - func processBaseImage(path string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(path) @@ -450,7 +515,8 @@ func processBaseImage(path string) (hr error) { } func _processBaseImage(path *uint16) (hr error) { - if hr = procProcessBaseImage.Find(); hr != nil { + hr = procProcessBaseImage.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) @@ -473,7 +539,8 @@ func processUtilityImage(path string) (hr error) { } func _processUtilityImage(path *uint16) (hr error) { - if hr = procProcessUtilityImage.Find(); hr != nil { + hr = procProcessUtilityImage.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) @@ -486,25 +553,21 @@ func _processUtilityImage(path *uint16) (hr error) { return } -func grantVmAccess(vmid string, filepath string) (hr error) { +func unprepareLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(vmid) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(filepath) + _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } - return _grantVmAccess(_p0, _p1) + return _unprepareLayer(info, _p0) } -func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { - if hr = procGrantVmAccess.Find(); hr != nil { +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + hr = procUnprepareLayer.Find() + if hr != nil { return } - r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -513,57 +576,3 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { } return } - -func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(path) - if err != nil { - return - } - return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) -} - -func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { - r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) - if r1 != 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { - r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) - if r1 != 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} - -func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(directoryName) - if err != nil { - return - } - return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) -} - -func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { - r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } - return -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/bindflt.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/bindflt.go new file mode 100644 index 000000000..559d44325 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/bindflt.go @@ -0,0 +1,19 @@ +package winapi + +const ( + BINDFLT_FLAG_READ_ONLY_MAPPING uint32 = 0x00000001 + BINDFLT_FLAG_MERGED_BIND_MAPPING uint32 = 0x00000002 + BINDFLT_FLAG_USE_CURRENT_SILO_MAPPING uint32 = 0x00000004 +) + +// HRESULT +// BfSetupFilter( +// _In_opt_ HANDLE JobHandle, +// _In_ ULONG Flags, +// _In_ LPCWSTR VirtualizationRootPath, +// _In_ LPCWSTR VirtualizationTargetPath, +// _In_reads_opt_( VirtualizationExceptionPathCount ) LPCWSTR* VirtualizationExceptionPaths, +// _In_opt_ ULONG VirtualizationExceptionPathCount +// ); +// +//sys BfSetupFilter(jobHandle windows.Handle, flags uint32, virtRootPath *uint16, virtTargetPath *uint16, virtExceptions **uint16, virtExceptionPathCount uint32) (hr error) = bindfltapi.BfSetupFilter? diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go new file mode 100644 index 000000000..4547cdd8e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/console.go @@ -0,0 +1,46 @@ +//go:build windows + +package winapi + +import ( + "unsafe" + + "golang.org/x/sys/windows" +) + +const PSEUDOCONSOLE_INHERIT_CURSOR = 0x1 + +// CreatePseudoConsole creates a windows pseudo console. +func CreatePseudoConsole(size windows.Coord, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) error { + // We need this wrapper as the function takes a COORD struct and not a pointer to one, so we need to cast to something beforehand. + return createPseudoConsole(*((*uint32)(unsafe.Pointer(&size))), hInput, hOutput, 0, hpcon) +} + +// ResizePseudoConsole resizes the internal buffers of the pseudo console to the width and height specified in `size`. +func ResizePseudoConsole(hpcon windows.Handle, size windows.Coord) error { + // We need this wrapper as the function takes a COORD struct and not a pointer to one, so we need to cast to something beforehand. + return resizePseudoConsole(hpcon, *((*uint32)(unsafe.Pointer(&size)))) +} + +// HRESULT WINAPI CreatePseudoConsole( +// _In_ COORD size, +// _In_ HANDLE hInput, +// _In_ HANDLE hOutput, +// _In_ DWORD dwFlags, +// _Out_ HPCON* phPC +// ); +// +//sys createPseudoConsole(size uint32, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) (hr error) = kernel32.CreatePseudoConsole + +// void WINAPI ClosePseudoConsole( +// _In_ HPCON hPC +// ); +// +//sys ClosePseudoConsole(hpc windows.Handle) = kernel32.ClosePseudoConsole + +// HRESULT WINAPI ResizePseudoConsole( +// _In_ HPCON hPC , +// _In_ COORD size +// ); +// +//sys resizePseudoConsole(hPc windows.Handle, size uint32) (hr error) = kernel32.ResizePseudoConsole diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go index df28ea242..7875466ca 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/devices.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import "github.com/Microsoft/go-winio/pkg/guid" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/doc.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/doc.go new file mode 100644 index 000000000..9acc0bfc1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/doc.go @@ -0,0 +1,3 @@ +// Package winapi contains various low-level bindings to Windows APIs. It can +// be thought of as an extension to golang.org/x/sys/windows. +package winapi diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/elevation.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/elevation.go new file mode 100644 index 000000000..40cbf8712 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/elevation.go @@ -0,0 +1,11 @@ +//go:build windows + +package winapi + +import ( + "golang.org/x/sys/windows" +) + +func IsElevated() bool { + return windows.GetCurrentProcessToken().IsElevated() +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go index 4e80ef68c..49ce924cb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/errors.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import "syscall" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go index 7ce52afd5..3dcb3faa0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/filesystem.go @@ -1,5 +1,8 @@ +//go:build windows + package winapi +//sys CopyFileW(existingFileName *uint16, newFileName *uint16, failIfExists int32) (err error) = kernel32.CopyFileW //sys NtCreateFile(handle *uintptr, accessMask uint32, oa *ObjectAttributes, iosb *IOStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile //sys NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile @@ -34,34 +37,35 @@ const ( // Select entries from FILE_INFO_BY_HANDLE_CLASS. // // C declaration: -// typedef enum _FILE_INFO_BY_HANDLE_CLASS { -// FileBasicInfo, -// FileStandardInfo, -// FileNameInfo, -// FileRenameInfo, -// FileDispositionInfo, -// FileAllocationInfo, -// FileEndOfFileInfo, -// FileStreamInfo, -// FileCompressionInfo, -// FileAttributeTagInfo, -// FileIdBothDirectoryInfo, -// FileIdBothDirectoryRestartInfo, -// FileIoPriorityHintInfo, -// FileRemoteProtocolInfo, -// FileFullDirectoryInfo, -// FileFullDirectoryRestartInfo, -// FileStorageInfo, -// FileAlignmentInfo, -// FileIdInfo, -// FileIdExtdDirectoryInfo, -// FileIdExtdDirectoryRestartInfo, -// FileDispositionInfoEx, -// FileRenameInfoEx, -// FileCaseSensitiveInfo, -// FileNormalizedNameInfo, -// MaximumFileInfoByHandleClass -// } FILE_INFO_BY_HANDLE_CLASS, *PFILE_INFO_BY_HANDLE_CLASS; +// +// typedef enum _FILE_INFO_BY_HANDLE_CLASS { +// FileBasicInfo, +// FileStandardInfo, +// FileNameInfo, +// FileRenameInfo, +// FileDispositionInfo, +// FileAllocationInfo, +// FileEndOfFileInfo, +// FileStreamInfo, +// FileCompressionInfo, +// FileAttributeTagInfo, +// FileIdBothDirectoryInfo, +// FileIdBothDirectoryRestartInfo, +// FileIoPriorityHintInfo, +// FileRemoteProtocolInfo, +// FileFullDirectoryInfo, +// FileFullDirectoryRestartInfo, +// FileStorageInfo, +// FileAlignmentInfo, +// FileIdInfo, +// FileIdExtdDirectoryInfo, +// FileIdExtdDirectoryRestartInfo, +// FileDispositionInfoEx, +// FileRenameInfoEx, +// FileCaseSensitiveInfo, +// FileNormalizedNameInfo, +// MaximumFileInfoByHandleClass +// } FILE_INFO_BY_HANDLE_CLASS, *PFILE_INFO_BY_HANDLE_CLASS; // // Documentation: https://docs.microsoft.com/en-us/windows/win32/api/minwinbase/ne-minwinbase-file_info_by_handle_class const ( @@ -98,10 +102,11 @@ type FileLinkInformation struct { } // C declaration: -// typedef struct _FILE_ID_INFO { -// ULONGLONG VolumeSerialNumber; -// FILE_ID_128 FileId; -// } FILE_ID_INFO, *PFILE_ID_INFO; +// +// typedef struct _FILE_ID_INFO { +// ULONGLONG VolumeSerialNumber; +// FILE_ID_128 FileId; +// } FILE_ID_INFO, *PFILE_ID_INFO; // // Documentation: https://docs.microsoft.com/en-us/windows/win32/api/winbase/ns-winbase-file_id_info type FILE_ID_INFO struct { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/iocp.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/iocp.go deleted file mode 100644 index 4e609cbf1..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/iocp.go +++ /dev/null @@ -1,3 +0,0 @@ -package winapi - -//sys GetQueuedCompletionStatus(cphandle windows.Handle, qty *uint32, key *uintptr, overlapped **windows.Overlapped, timeout uint32) (err error) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go index ba12b1ad9..b0deb5c72 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/jobobject.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import ( @@ -24,7 +26,10 @@ const ( // Access rights for creating or opening job objects. // // https://docs.microsoft.com/en-us/windows/win32/procthread/job-object-security-and-access-rights -const JOB_OBJECT_ALL_ACCESS = 0x1F001F +const ( + JOB_OBJECT_QUERY = 0x0004 + JOB_OBJECT_ALL_ACCESS = 0x1F001F +) // IO limit flags // @@ -52,6 +57,8 @@ const ( JobObjectLimitViolationInformation uint32 = 13 JobObjectMemoryUsageInformation uint32 = 28 JobObjectNotificationLimitInformation2 uint32 = 33 + JobObjectCreateSilo uint32 = 35 + JobObjectSiloBasicInformation uint32 = 36 JobObjectIoAttribution uint32 = 42 ) @@ -93,7 +100,7 @@ type JOBOBJECT_BASIC_PROCESS_ID_LIST struct { // AllPids returns all the process Ids in the job object. func (p *JOBOBJECT_BASIC_PROCESS_ID_LIST) AllPids() []uintptr { - return (*[(1 << 27) - 1]uintptr)(unsafe.Pointer(&p.ProcessIdList[0]))[:p.NumberOfProcessIdsInList] + return (*[(1 << 27) - 1]uintptr)(unsafe.Pointer(&p.ProcessIdList[0]))[:p.NumberOfProcessIdsInList:p.NumberOfProcessIdsInList] } // https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_accounting_information @@ -108,29 +115,27 @@ type JOBOBJECT_BASIC_ACCOUNTING_INFORMATION struct { TotalTerminateProcesses uint32 } -//https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_and_io_accounting_information +// https://docs.microsoft.com/en-us/windows/win32/api/winnt/ns-winnt-jobobject_basic_and_io_accounting_information type JOBOBJECT_BASIC_AND_IO_ACCOUNTING_INFORMATION struct { BasicInfo JOBOBJECT_BASIC_ACCOUNTING_INFORMATION IoInfo windows.IO_COUNTERS } -// typedef struct _JOBOBJECT_MEMORY_USAGE_INFORMATION { -// ULONG64 JobMemory; -// ULONG64 PeakJobMemoryUsed; -// } JOBOBJECT_MEMORY_USAGE_INFORMATION, *PJOBOBJECT_MEMORY_USAGE_INFORMATION; -// +// typedef struct _JOBOBJECT_MEMORY_USAGE_INFORMATION { +// ULONG64 JobMemory; +// ULONG64 PeakJobMemoryUsed; +// } JOBOBJECT_MEMORY_USAGE_INFORMATION, *PJOBOBJECT_MEMORY_USAGE_INFORMATION; type JOBOBJECT_MEMORY_USAGE_INFORMATION struct { JobMemory uint64 PeakJobMemoryUsed uint64 } -// typedef struct _JOBOBJECT_IO_ATTRIBUTION_STATS { -// ULONG_PTR IoCount; -// ULONGLONG TotalNonOverlappedQueueTime; -// ULONGLONG TotalNonOverlappedServiceTime; -// ULONGLONG TotalSize; -// } JOBOBJECT_IO_ATTRIBUTION_STATS, *PJOBOBJECT_IO_ATTRIBUTION_STATS; -// +// typedef struct _JOBOBJECT_IO_ATTRIBUTION_STATS { +// ULONG_PTR IoCount; +// ULONGLONG TotalNonOverlappedQueueTime; +// ULONGLONG TotalNonOverlappedServiceTime; +// ULONGLONG TotalSize; +// } JOBOBJECT_IO_ATTRIBUTION_STATS, *PJOBOBJECT_IO_ATTRIBUTION_STATS; type JOBOBJECT_IO_ATTRIBUTION_STATS struct { IoCount uintptr TotalNonOverlappedQueueTime uint64 @@ -138,12 +143,11 @@ type JOBOBJECT_IO_ATTRIBUTION_STATS struct { TotalSize uint64 } -// typedef struct _JOBOBJECT_IO_ATTRIBUTION_INFORMATION { -// ULONG ControlFlags; -// JOBOBJECT_IO_ATTRIBUTION_STATS ReadStats; -// JOBOBJECT_IO_ATTRIBUTION_STATS WriteStats; -// } JOBOBJECT_IO_ATTRIBUTION_INFORMATION, *PJOBOBJECT_IO_ATTRIBUTION_INFORMATION; -// +// typedef struct _JOBOBJECT_IO_ATTRIBUTION_INFORMATION { +// ULONG ControlFlags; +// JOBOBJECT_IO_ATTRIBUTION_STATS ReadStats; +// JOBOBJECT_IO_ATTRIBUTION_STATS WriteStats; +// } JOBOBJECT_IO_ATTRIBUTION_INFORMATION, *PJOBOBJECT_IO_ATTRIBUTION_INFORMATION; type JOBOBJECT_IO_ATTRIBUTION_INFORMATION struct { ControlFlags uint32 ReadStats JOBOBJECT_IO_ATTRIBUTION_STATS @@ -162,7 +166,7 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // PBOOL Result // ); // -//sys IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *bool) (err error) = kernel32.IsProcessInJob +//sys IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *int32) (err error) = kernel32.IsProcessInJob // BOOL QueryInformationJobObject( // HANDLE hJob, @@ -172,7 +176,7 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // LPDWORD lpReturnLength // ); // -//sys QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo uintptr, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) = kernel32.QueryInformationJobObject +//sys QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo unsafe.Pointer, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) = kernel32.QueryInformationJobObject // HANDLE OpenJobObjectW( // DWORD dwDesiredAccess, @@ -180,7 +184,7 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // LPCWSTR lpName // ); // -//sys OpenJobObject(desiredAccess uint32, inheritHandle bool, lpName *uint16) (handle windows.Handle, err error) = kernel32.OpenJobObjectW +//sys OpenJobObject(desiredAccess uint32, inheritHandle int32, lpName *uint16) (handle windows.Handle, err error) = kernel32.OpenJobObjectW // DWORD SetIoRateControlInformationJobObject( // HANDLE hJob, @@ -195,6 +199,7 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // JOBOBJECT_IO_RATE_CONTROL_INFORMATION **InfoBlocks, // ULONG *InfoBlockCount // ); +// //sys QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) = kernel32.QueryIoRateControlInformationJobObject // NTSTATUS @@ -203,6 +208,7 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // _In_ ACCESS_MASK DesiredAccess, // _In_ POBJECT_ATTRIBUTES ObjectAttributes // ); +// //sys NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) = ntdll.NtOpenJobObject // NTSTATUS @@ -212,4 +218,5 @@ type JOBOBJECT_ASSOCIATE_COMPLETION_PORT struct { // _In_ ACCESS_MASK DesiredAccess, // _In_opt_ POBJECT_ATTRIBUTES ObjectAttributes // ); +// //sys NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) = ntdll.NtCreateJobObject diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go index 83f704064..53f62948c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/memory.go @@ -1,27 +1,4 @@ package winapi -// VOID RtlMoveMemory( -// _Out_ VOID UNALIGNED *Destination, -// _In_ const VOID UNALIGNED *Source, -// _In_ SIZE_T Length -// ); -//sys RtlMoveMemory(destination *byte, source *byte, length uintptr) (err error) = kernel32.RtlMoveMemory - //sys LocalAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc //sys LocalFree(ptr uintptr) = kernel32.LocalFree - -// BOOL QueryWorkingSet( -// HANDLE hProcess, -// PVOID pv, -// DWORD cb -// ); -//sys QueryWorkingSet(handle windows.Handle, pv uintptr, cb uint32) (err error) = psapi.QueryWorkingSet - -type PSAPI_WORKING_SET_INFORMATION struct { - NumberOfEntries uintptr - WorkingSetInfo [1]PSAPI_WORKING_SET_BLOCK -} - -type PSAPI_WORKING_SET_BLOCK struct { - Flags uintptr -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/ofreg.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/ofreg.go new file mode 100644 index 000000000..d8f7afe8a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/ofreg.go @@ -0,0 +1,5 @@ +package winapi + +//sys ORCreateHive(key *syscall.Handle) (regerrno error) = offreg.ORCreateHive +//sys ORSaveHive(key syscall.Handle, file string, OsMajorVersion uint32, OsMinorVersion uint32) (regerrno error) = offreg.ORSaveHive +//sys ORCloseHive(key syscall.Handle) (regerrno error) = offreg.ORCloseHive diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go index 908920e87..c6a149b55 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/path.go @@ -8,4 +8,5 @@ package winapi // LPWSTR lpBuffer, // LPWSTR *lpFilePart // ); +// //sys SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) = kernel32.SearchPathW diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go index b87068327..f4ae94cfa 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/process.go @@ -2,9 +2,60 @@ package winapi const PROCESS_ALL_ACCESS uint32 = 2097151 -// DWORD GetProcessImageFileNameW( -// HANDLE hProcess, -// LPWSTR lpImageFileName, -// DWORD nSize +const ( + PROC_THREAD_ATTRIBUTE_PSEUDOCONSOLE = 0x20016 + PROC_THREAD_ATTRIBUTE_JOB_LIST = 0x2000D +) + +// ProcessVmCounters corresponds to the _VM_COUNTERS_EX and _VM_COUNTERS_EX2 structures. +const ProcessVmCounters = 3 + +// __kernel_entry NTSTATUS NtQueryInformationProcess( +// [in] HANDLE ProcessHandle, +// [in] PROCESSINFOCLASS ProcessInformationClass, +// [out] PVOID ProcessInformation, +// [in] ULONG ProcessInformationLength, +// [out, optional] PULONG ReturnLength // ); -//sys GetProcessImageFileName(hProcess windows.Handle, imageFileName *uint16, nSize uint32) (size uint32, err error) = kernel32.GetProcessImageFileNameW +// +//sys NtQueryInformationProcess(processHandle windows.Handle, processInfoClass uint32, processInfo unsafe.Pointer, processInfoLength uint32, returnLength *uint32) (status uint32) = ntdll.NtQueryInformationProcess + +// typedef struct _VM_COUNTERS_EX { +// SIZE_T PeakVirtualSize; +// SIZE_T VirtualSize; +// ULONG PageFaultCount; +// SIZE_T PeakWorkingSetSize; +// SIZE_T WorkingSetSize; +// SIZE_T QuotaPeakPagedPoolUsage; +// SIZE_T QuotaPagedPoolUsage; +// SIZE_T QuotaPeakNonPagedPoolUsage; +// SIZE_T QuotaNonPagedPoolUsage; +// SIZE_T PagefileUsage; +// SIZE_T PeakPagefileUsage; +// SIZE_T PrivateUsage; +// } VM_COUNTERS_EX, *PVM_COUNTERS_EX; +type VM_COUNTERS_EX struct { + PeakVirtualSize uintptr + VirtualSize uintptr + PageFaultCount uint32 + PeakWorkingSetSize uintptr + WorkingSetSize uintptr + QuotaPeakPagedPoolUsage uintptr + QuotaPagedPoolUsage uintptr + QuotaPeakNonPagedPoolUsage uintptr + QuotaNonPagedPoolUsage uintptr + PagefileUsage uintptr + PeakPagefileUsage uintptr + PrivateUsage uintptr +} + +// typedef struct _VM_COUNTERS_EX2 { +// VM_COUNTERS_EX CountersEx; +// SIZE_T PrivateWorkingSetSize; +// SIZE_T SharedCommitUsage; +// } VM_COUNTERS_EX2, *PVM_COUNTERS_EX2; +type VM_COUNTERS_EX2 struct { + CountersEx VM_COUNTERS_EX + PrivateWorkingSetSize uintptr + SharedCommitUsage uintptr +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go index 327f57d7c..cb494aaa6 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/system.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import "golang.org/x/sys/windows" @@ -12,7 +14,8 @@ const STATUS_INFO_LENGTH_MISMATCH = 0xC0000004 // ULONG SystemInformationLength, // PULONG ReturnLength // ); -//sys NtQuerySystemInformation(systemInfoClass int, systemInformation uintptr, systemInfoLength uint32, returnLength *uint32) (status uint32) = ntdll.NtQuerySystemInformation +// +//sys NtQuerySystemInformation(systemInfoClass int, systemInformation unsafe.Pointer, systemInfoLength uint32, returnLength *uint32) (status uint32) = ntdll.NtQuerySystemInformation type SYSTEM_PROCESS_INFORMATION struct { NextEntryOffset uint32 // ULONG diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go index 4724713e3..f23141a83 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/thread.go @@ -9,4 +9,5 @@ package winapi // DWORD dwCreationFlags, // LPDWORD lpThreadId // ); +// //sys CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) = kernel32.CreateRemoteThread diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/user.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/user.go new file mode 100644 index 000000000..84d4cc294 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/user.go @@ -0,0 +1,194 @@ +//go:build windows + +package winapi + +import ( + "syscall" + + "golang.org/x/sys/windows" +) + +const UserNameCharLimit = 20 + +const ( + USER_PRIV_GUEST uint32 = iota + USER_PRIV_USER + USER_PRIV_ADMIN +) + +const ( + UF_NORMAL_ACCOUNT = 0x00200 + UF_DONT_EXPIRE_PASSWD = 0x10000 +) + +const NERR_UserNotFound = syscall.Errno(0x8AD) + +// typedef struct _LOCALGROUP_MEMBERS_INFO_0 { +// PSID lgrmi0_sid; +// } LOCALGROUP_MEMBERS_INFO_0, *PLOCALGROUP_MEMBERS_INFO_0, *LPLOCALGROUP_MEMBERS_INFO_0; +type LocalGroupMembersInfo0 struct { + Sid *windows.SID +} + +// typedef struct _LOCALGROUP_INFO_1 { +// LPWSTR lgrpi1_name; +// LPWSTR lgrpi1_comment; +// } LOCALGROUP_INFO_1, *PLOCALGROUP_INFO_1, *LPLOCALGROUP_INFO_1; +type LocalGroupInfo1 struct { + Name *uint16 + Comment *uint16 +} + +// typedef struct _USER_INFO_1 { +// LPWSTR usri1_name; +// LPWSTR usri1_password; +// DWORD usri1_password_age; +// DWORD usri1_priv; +// LPWSTR usri1_home_dir; +// LPWSTR usri1_comment; +// DWORD usri1_flags; +// LPWSTR usri1_script_path; +// } USER_INFO_1, *PUSER_INFO_1, *LPUSER_INFO_1; +type UserInfo1 struct { + Name *uint16 + Password *uint16 + PasswordAge uint32 + Priv uint32 + HomeDir *uint16 + Comment *uint16 + Flags uint32 + ScriptPath *uint16 +} + +// NET_API_STATUS NET_API_FUNCTION NetLocalGroupGetInfo( +// [in] LPCWSTR servername, +// [in] LPCWSTR groupname, +// [in] DWORD level, +// [out] LPBYTE *bufptr +// ); +// +//sys netLocalGroupGetInfo(serverName *uint16, groupName *uint16, level uint32, bufptr **byte) (status error) = netapi32.NetLocalGroupGetInfo + +// NetLocalGroupGetInfo is a slightly go friendlier wrapper around the NetLocalGroupGetInfo function. Instead of taking in *uint16's, it takes in +// go strings and does the conversion internally. +func NetLocalGroupGetInfo(serverName, groupName string, level uint32, bufPtr **byte) (err error) { + var ( + serverNameUTF16 *uint16 + groupNameUTF16 *uint16 + ) + if serverName != "" { + serverNameUTF16, err = windows.UTF16PtrFromString(serverName) + if err != nil { + return err + } + } + if groupName != "" { + groupNameUTF16, err = windows.UTF16PtrFromString(groupName) + if err != nil { + return err + } + } + return netLocalGroupGetInfo( + serverNameUTF16, + groupNameUTF16, + level, + bufPtr, + ) +} + +// NET_API_STATUS NET_API_FUNCTION NetUserAdd( +// [in] LPCWSTR servername, +// [in] DWORD level, +// [in] LPBYTE buf, +// [out] LPDWORD parm_err +// ); +// +//sys netUserAdd(serverName *uint16, level uint32, buf *byte, parm_err *uint32) (status error) = netapi32.NetUserAdd + +// NetUserAdd is a slightly go friendlier wrapper around the NetUserAdd function. Instead of taking in *uint16's, it takes in +// go strings and does the conversion internally. +func NetUserAdd(serverName string, level uint32, buf *byte, parm_err *uint32) (err error) { + var serverNameUTF16 *uint16 + if serverName != "" { + serverNameUTF16, err = windows.UTF16PtrFromString(serverName) + if err != nil { + return err + } + } + return netUserAdd( + serverNameUTF16, + level, + buf, + parm_err, + ) +} + +// NET_API_STATUS NET_API_FUNCTION NetUserDel( +// [in] LPCWSTR servername, +// [in] LPCWSTR username +// ); +// +//sys netUserDel(serverName *uint16, username *uint16) (status error) = netapi32.NetUserDel + +// NetUserDel is a slightly go friendlier wrapper around the NetUserDel function. Instead of taking in *uint16's, it takes in +// go strings and does the conversion internally. +func NetUserDel(serverName, userName string) (err error) { + var ( + serverNameUTF16 *uint16 + userNameUTF16 *uint16 + ) + if serverName != "" { + serverNameUTF16, err = windows.UTF16PtrFromString(serverName) + if err != nil { + return err + } + } + if userName != "" { + userNameUTF16, err = windows.UTF16PtrFromString(userName) + if err != nil { + return err + } + } + return netUserDel( + serverNameUTF16, + userNameUTF16, + ) +} + +// NET_API_STATUS NET_API_FUNCTION NetLocalGroupAddMembers( +// [in] LPCWSTR servername, +// [in] LPCWSTR groupname, +// [in] DWORD level, +// [in] LPBYTE buf, +// [in] DWORD totalentries +// ); +// +//sys netLocalGroupAddMembers(serverName *uint16, groupName *uint16, level uint32, buf *byte, totalEntries uint32) (status error) = netapi32.NetLocalGroupAddMembers + +// NetLocalGroupAddMembers is a slightly go friendlier wrapper around the NetLocalGroupAddMembers function. Instead of taking in *uint16's, it takes in +// go strings and does the conversion internally. +func NetLocalGroupAddMembers(serverName, groupName string, level uint32, buf *byte, totalEntries uint32) (err error) { + var ( + serverNameUTF16 *uint16 + groupNameUTF16 *uint16 + ) + if serverName != "" { + serverNameUTF16, err = windows.UTF16PtrFromString(serverName) + if err != nil { + return err + } + } + if groupName != "" { + groupNameUTF16, err = windows.UTF16PtrFromString(groupName) + if err != nil { + return err + } + } + return netLocalGroupAddMembers( + serverNameUTF16, + groupNameUTF16, + level, + buf, + totalEntries, + ) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go index 859b753c2..a2da57070 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/utils.go @@ -1,3 +1,5 @@ +//go:build windows + package winapi import ( @@ -32,7 +34,7 @@ type UnicodeString struct { // denotes the maximum number of wide chars a path can have. const NTSTRSAFE_UNICODE_STRING_MAX_CCH = 32767 -//String converts a UnicodeString to a golang string +// String converts a UnicodeString to a golang string func (uni UnicodeString) String() string { // UnicodeString is not guaranteed to be null terminated, therefore // use the UnicodeString's Length field diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go index ec88c0d21..6a90e3a69 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/winapi.go @@ -1,5 +1,3 @@ -// Package winapi contains various low-level bindings to Windows APIs. It can -// be thought of as an extension to golang.org/x/sys/windows. package winapi -//go:generate go run ..\..\mksyscall_windows.go -output zsyscall_windows.go system.go net.go path.go thread.go iocp.go jobobject.go logon.go memory.go process.go processor.go devices.go filesystem.go errors.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go ./*.go diff --git a/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go index 2941b0f98..c607245eb 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/winapi/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package winapi @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -37,196 +40,181 @@ func errnoErr(e syscall.Errno) error { } var ( - modntdll = windows.NewLazySystemDLL("ntdll.dll") - modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") - modkernel32 = windows.NewLazySystemDLL("kernel32.dll") - modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") - modpsapi = windows.NewLazySystemDLL("psapi.dll") - modcfgmgr32 = windows.NewLazySystemDLL("cfgmgr32.dll") + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + modbindfltapi = windows.NewLazySystemDLL("bindfltapi.dll") + modcfgmgr32 = windows.NewLazySystemDLL("cfgmgr32.dll") + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modnetapi32 = windows.NewLazySystemDLL("netapi32.dll") + modntdll = windows.NewLazySystemDLL("ntdll.dll") + modoffreg = windows.NewLazySystemDLL("offreg.dll") - procNtQuerySystemInformation = modntdll.NewProc("NtQuerySystemInformation") + procLogonUserW = modadvapi32.NewProc("LogonUserW") + procBfSetupFilter = modbindfltapi.NewProc("BfSetupFilter") + procCM_Get_DevNode_PropertyW = modcfgmgr32.NewProc("CM_Get_DevNode_PropertyW") + procCM_Get_Device_ID_ListA = modcfgmgr32.NewProc("CM_Get_Device_ID_ListA") + procCM_Get_Device_ID_List_SizeA = modcfgmgr32.NewProc("CM_Get_Device_ID_List_SizeA") + procCM_Locate_DevNodeW = modcfgmgr32.NewProc("CM_Locate_DevNodeW") procSetJobCompartmentId = modiphlpapi.NewProc("SetJobCompartmentId") - procSearchPathW = modkernel32.NewProc("SearchPathW") + procClosePseudoConsole = modkernel32.NewProc("ClosePseudoConsole") + procCopyFileW = modkernel32.NewProc("CopyFileW") + procCreatePseudoConsole = modkernel32.NewProc("CreatePseudoConsole") procCreateRemoteThread = modkernel32.NewProc("CreateRemoteThread") - procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus") + procGetActiveProcessorCount = modkernel32.NewProc("GetActiveProcessorCount") procIsProcessInJob = modkernel32.NewProc("IsProcessInJob") - procQueryInformationJobObject = modkernel32.NewProc("QueryInformationJobObject") - procOpenJobObjectW = modkernel32.NewProc("OpenJobObjectW") - procSetIoRateControlInformationJobObject = modkernel32.NewProc("SetIoRateControlInformationJobObject") - procQueryIoRateControlInformationJobObject = modkernel32.NewProc("QueryIoRateControlInformationJobObject") - procNtOpenJobObject = modntdll.NewProc("NtOpenJobObject") - procNtCreateJobObject = modntdll.NewProc("NtCreateJobObject") - procLogonUserW = modadvapi32.NewProc("LogonUserW") - procRtlMoveMemory = modkernel32.NewProc("RtlMoveMemory") procLocalAlloc = modkernel32.NewProc("LocalAlloc") procLocalFree = modkernel32.NewProc("LocalFree") - procQueryWorkingSet = modpsapi.NewProc("QueryWorkingSet") - procGetProcessImageFileNameW = modkernel32.NewProc("GetProcessImageFileNameW") - procGetActiveProcessorCount = modkernel32.NewProc("GetActiveProcessorCount") - procCM_Get_Device_ID_List_SizeA = modcfgmgr32.NewProc("CM_Get_Device_ID_List_SizeA") - procCM_Get_Device_ID_ListA = modcfgmgr32.NewProc("CM_Get_Device_ID_ListA") - procCM_Locate_DevNodeW = modcfgmgr32.NewProc("CM_Locate_DevNodeW") - procCM_Get_DevNode_PropertyW = modcfgmgr32.NewProc("CM_Get_DevNode_PropertyW") + procOpenJobObjectW = modkernel32.NewProc("OpenJobObjectW") + procQueryInformationJobObject = modkernel32.NewProc("QueryInformationJobObject") + procQueryIoRateControlInformationJobObject = modkernel32.NewProc("QueryIoRateControlInformationJobObject") + procResizePseudoConsole = modkernel32.NewProc("ResizePseudoConsole") + procSearchPathW = modkernel32.NewProc("SearchPathW") + procSetIoRateControlInformationJobObject = modkernel32.NewProc("SetIoRateControlInformationJobObject") + procNetLocalGroupAddMembers = modnetapi32.NewProc("NetLocalGroupAddMembers") + procNetLocalGroupGetInfo = modnetapi32.NewProc("NetLocalGroupGetInfo") + procNetUserAdd = modnetapi32.NewProc("NetUserAdd") + procNetUserDel = modnetapi32.NewProc("NetUserDel") procNtCreateFile = modntdll.NewProc("NtCreateFile") - procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") + procNtCreateJobObject = modntdll.NewProc("NtCreateJobObject") procNtOpenDirectoryObject = modntdll.NewProc("NtOpenDirectoryObject") + procNtOpenJobObject = modntdll.NewProc("NtOpenJobObject") procNtQueryDirectoryObject = modntdll.NewProc("NtQueryDirectoryObject") + procNtQueryInformationProcess = modntdll.NewProc("NtQueryInformationProcess") + procNtQuerySystemInformation = modntdll.NewProc("NtQuerySystemInformation") + procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") procRtlNtStatusToDosError = modntdll.NewProc("RtlNtStatusToDosError") + procORCloseHive = modoffreg.NewProc("ORCloseHive") + procORCreateHive = modoffreg.NewProc("ORCreateHive") + procORSaveHive = modoffreg.NewProc("ORSaveHive") ) -func NtQuerySystemInformation(systemInfoClass int, systemInformation uintptr, systemInfoLength uint32, returnLength *uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtQuerySystemInformation.Addr(), 4, uintptr(systemInfoClass), uintptr(systemInformation), uintptr(systemInfoLength), uintptr(unsafe.Pointer(returnLength)), 0, 0) - status = uint32(r0) +func LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) { + r1, _, e1 := syscall.Syscall6(procLogonUserW.Addr(), 6, uintptr(unsafe.Pointer(username)), uintptr(unsafe.Pointer(domain)), uintptr(unsafe.Pointer(password)), uintptr(logonType), uintptr(logonProvider), uintptr(unsafe.Pointer(token))) + if r1 == 0 { + err = errnoErr(e1) + } return } -func SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err error) { - r0, _, _ := syscall.Syscall(procSetJobCompartmentId.Addr(), 2, uintptr(handle), uintptr(compartmentId), 0) - if r0 != 0 { - win32Err = syscall.Errno(r0) +func BfSetupFilter(jobHandle windows.Handle, flags uint32, virtRootPath *uint16, virtTargetPath *uint16, virtExceptions **uint16, virtExceptionPathCount uint32) (hr error) { + hr = procBfSetupFilter.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procBfSetupFilter.Addr(), 6, uintptr(jobHandle), uintptr(flags), uintptr(unsafe.Pointer(virtRootPath)), uintptr(unsafe.Pointer(virtTargetPath)), uintptr(unsafe.Pointer(virtExceptions)), uintptr(virtExceptionPathCount)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) } return } -func SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) { - r0, _, e1 := syscall.Syscall6(procSearchPathW.Addr(), 6, uintptr(unsafe.Pointer(lpPath)), uintptr(unsafe.Pointer(lpFileName)), uintptr(unsafe.Pointer(lpExtension)), uintptr(nBufferLength), uintptr(unsafe.Pointer(lpBuffer)), uintptr(unsafe.Pointer(lpFilePath))) - size = uint32(r0) - if size == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL +func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall6(procCM_Get_DevNode_PropertyW.Addr(), 6, uintptr(dnDevInst), uintptr(unsafe.Pointer(propertyKey)), uintptr(unsafe.Pointer(propertyType)), uintptr(unsafe.Pointer(propertyBuffer)), uintptr(unsafe.Pointer(propertyBufferSize)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff } + hr = syscall.Errno(r0) } return } -func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) { - r0, _, e1 := syscall.Syscall9(procCreateRemoteThread.Addr(), 7, uintptr(process), uintptr(unsafe.Pointer(sa)), uintptr(stackSize), uintptr(startAddr), uintptr(parameter), uintptr(creationFlags), uintptr(unsafe.Pointer(threadID)), 0, 0) - handle = windows.Handle(r0) - if handle == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL +func CMGetDeviceIDList(pszFilter *byte, buffer *byte, bufferLen uint32, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall6(procCM_Get_Device_ID_ListA.Addr(), 4, uintptr(unsafe.Pointer(pszFilter)), uintptr(unsafe.Pointer(buffer)), uintptr(bufferLen), uintptr(uFlags), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff } + hr = syscall.Errno(r0) } return } -func GetQueuedCompletionStatus(cphandle windows.Handle, qty *uint32, key *uintptr, overlapped **windows.Overlapped, timeout uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(cphandle), uintptr(unsafe.Pointer(qty)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(overlapped)), uintptr(timeout), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL +func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall(procCM_Get_Device_ID_List_SizeA.Addr(), 3, uintptr(unsafe.Pointer(pulLen)), uintptr(unsafe.Pointer(pszFilter)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff } + hr = syscall.Errno(r0) } return } -func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *bool) (err error) { - r1, _, e1 := syscall.Syscall(procIsProcessInJob.Addr(), 3, uintptr(procHandle), uintptr(jobHandle), uintptr(unsafe.Pointer(result))) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } +func CMLocateDevNode(pdnDevInst *uint32, pDeviceID string, uFlags uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(pDeviceID) + if hr != nil { + return } - return + return _CMLocateDevNode(pdnDevInst, _p0, uFlags) } -func QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo uintptr, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procQueryInformationJobObject.Addr(), 5, uintptr(jobHandle), uintptr(infoClass), uintptr(jobObjectInfo), uintptr(jobObjectInformationLength), uintptr(unsafe.Pointer(lpReturnLength)), 0) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL +func _CMLocateDevNode(pdnDevInst *uint32, pDeviceID *uint16, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall(procCM_Locate_DevNodeW.Addr(), 3, uintptr(unsafe.Pointer(pdnDevInst)), uintptr(unsafe.Pointer(pDeviceID)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff } + hr = syscall.Errno(r0) } return } -func OpenJobObject(desiredAccess uint32, inheritHandle bool, lpName *uint16) (handle windows.Handle, err error) { - var _p0 uint32 - if inheritHandle { - _p0 = 1 - } else { - _p0 = 0 - } - r0, _, e1 := syscall.Syscall(procOpenJobObjectW.Addr(), 3, uintptr(desiredAccess), uintptr(_p0), uintptr(unsafe.Pointer(lpName))) - handle = windows.Handle(r0) - if handle == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } +func SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err error) { + r0, _, _ := syscall.Syscall(procSetJobCompartmentId.Addr(), 2, uintptr(handle), uintptr(compartmentId), 0) + if r0 != 0 { + win32Err = syscall.Errno(r0) } return } -func SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) { - r0, _, e1 := syscall.Syscall(procSetIoRateControlInformationJobObject.Addr(), 2, uintptr(jobHandle), uintptr(unsafe.Pointer(ioRateControlInfo)), 0) - ret = uint32(r0) - if ret == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } +func ClosePseudoConsole(hpc windows.Handle) { + syscall.Syscall(procClosePseudoConsole.Addr(), 1, uintptr(hpc), 0, 0) return } -func QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) { - r0, _, e1 := syscall.Syscall6(procQueryIoRateControlInformationJobObject.Addr(), 4, uintptr(jobHandle), uintptr(unsafe.Pointer(volumeName)), uintptr(unsafe.Pointer(ioRateControlInfo)), uintptr(unsafe.Pointer(infoBlockCount)), 0, 0) - ret = uint32(r0) - if ret == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } +func CopyFileW(existingFileName *uint16, newFileName *uint16, failIfExists int32) (err error) { + r1, _, e1 := syscall.Syscall(procCopyFileW.Addr(), 3, uintptr(unsafe.Pointer(existingFileName)), uintptr(unsafe.Pointer(newFileName)), uintptr(failIfExists)) + if r1 == 0 { + err = errnoErr(e1) } return } -func NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { - r0, _, _ := syscall.Syscall(procNtOpenJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) - status = uint32(r0) +func createPseudoConsole(size uint32, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) (hr error) { + r0, _, _ := syscall.Syscall6(procCreatePseudoConsole.Addr(), 5, uintptr(size), uintptr(hInput), uintptr(hOutput), uintptr(dwFlags), uintptr(unsafe.Pointer(hpcon)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } return } -func NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { - r0, _, _ := syscall.Syscall(procNtCreateJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) - status = uint32(r0) +func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) { + r0, _, e1 := syscall.Syscall9(procCreateRemoteThread.Addr(), 7, uintptr(process), uintptr(unsafe.Pointer(sa)), uintptr(stackSize), uintptr(startAddr), uintptr(parameter), uintptr(creationFlags), uintptr(unsafe.Pointer(threadID)), 0, 0) + handle = windows.Handle(r0) + if handle == 0 { + err = errnoErr(e1) + } return } -func LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) { - r1, _, e1 := syscall.Syscall6(procLogonUserW.Addr(), 6, uintptr(unsafe.Pointer(username)), uintptr(unsafe.Pointer(domain)), uintptr(unsafe.Pointer(password)), uintptr(logonType), uintptr(logonProvider), uintptr(unsafe.Pointer(token))) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } - } +func GetActiveProcessorCount(groupNumber uint16) (amount uint32) { + r0, _, _ := syscall.Syscall(procGetActiveProcessorCount.Addr(), 1, uintptr(groupNumber), 0, 0) + amount = uint32(r0) return } -func RtlMoveMemory(destination *byte, source *byte, length uintptr) (err error) { - r1, _, e1 := syscall.Syscall(procRtlMoveMemory.Addr(), 3, uintptr(unsafe.Pointer(destination)), uintptr(unsafe.Pointer(source)), uintptr(length)) +func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *int32) (err error) { + r1, _, e1 := syscall.Syscall(procIsProcessInJob.Addr(), 3, uintptr(procHandle), uintptr(jobHandle), uintptr(unsafe.Pointer(result))) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -242,39 +230,34 @@ func LocalFree(ptr uintptr) { return } -func QueryWorkingSet(handle windows.Handle, pv uintptr, cb uint32) (err error) { - r1, _, e1 := syscall.Syscall(procQueryWorkingSet.Addr(), 3, uintptr(handle), uintptr(pv), uintptr(cb)) - if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } +func OpenJobObject(desiredAccess uint32, inheritHandle int32, lpName *uint16) (handle windows.Handle, err error) { + r0, _, e1 := syscall.Syscall(procOpenJobObjectW.Addr(), 3, uintptr(desiredAccess), uintptr(inheritHandle), uintptr(unsafe.Pointer(lpName))) + handle = windows.Handle(r0) + if handle == 0 { + err = errnoErr(e1) } return } -func GetProcessImageFileName(hProcess windows.Handle, imageFileName *uint16, nSize uint32) (size uint32, err error) { - r0, _, e1 := syscall.Syscall(procGetProcessImageFileNameW.Addr(), 3, uintptr(hProcess), uintptr(unsafe.Pointer(imageFileName)), uintptr(nSize)) - size = uint32(r0) - if size == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } +func QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo unsafe.Pointer, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procQueryInformationJobObject.Addr(), 5, uintptr(jobHandle), uintptr(infoClass), uintptr(jobObjectInfo), uintptr(jobObjectInformationLength), uintptr(unsafe.Pointer(lpReturnLength)), 0) + if r1 == 0 { + err = errnoErr(e1) } return } -func GetActiveProcessorCount(groupNumber uint16) (amount uint32) { - r0, _, _ := syscall.Syscall(procGetActiveProcessorCount.Addr(), 1, uintptr(groupNumber), 0, 0) - amount = uint32(r0) +func QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName *uint16, ioRateControlInfo **JOBOBJECT_IO_RATE_CONTROL_INFORMATION, infoBlockCount *uint32) (ret uint32, err error) { + r0, _, e1 := syscall.Syscall6(procQueryIoRateControlInformationJobObject.Addr(), 4, uintptr(jobHandle), uintptr(unsafe.Pointer(volumeName)), uintptr(unsafe.Pointer(ioRateControlInfo)), uintptr(unsafe.Pointer(infoBlockCount)), 0, 0) + ret = uint32(r0) + if ret == 0 { + err = errnoErr(e1) + } return } -func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall(procCM_Get_Device_ID_List_SizeA.Addr(), 3, uintptr(unsafe.Pointer(pulLen)), uintptr(unsafe.Pointer(pszFilter)), uintptr(uFlags)) +func resizePseudoConsole(hPc windows.Handle, size uint32) (hr error) { + r0, _, _ := syscall.Syscall(procResizePseudoConsole.Addr(), 2, uintptr(hPc), uintptr(size), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -284,44 +267,52 @@ func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr e return } -func CMGetDeviceIDList(pszFilter *byte, buffer *byte, bufferLen uint32, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall6(procCM_Get_Device_ID_ListA.Addr(), 4, uintptr(unsafe.Pointer(pszFilter)), uintptr(unsafe.Pointer(buffer)), uintptr(bufferLen), uintptr(uFlags), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) +func SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) { + r0, _, e1 := syscall.Syscall6(procSearchPathW.Addr(), 6, uintptr(unsafe.Pointer(lpPath)), uintptr(unsafe.Pointer(lpFileName)), uintptr(unsafe.Pointer(lpExtension)), uintptr(nBufferLength), uintptr(unsafe.Pointer(lpBuffer)), uintptr(unsafe.Pointer(lpFilePath))) + size = uint32(r0) + if size == 0 { + err = errnoErr(e1) } return } -func CMLocateDevNode(pdnDevInst *uint32, pDeviceID string, uFlags uint32) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(pDeviceID) - if hr != nil { - return +func SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) { + r0, _, e1 := syscall.Syscall(procSetIoRateControlInformationJobObject.Addr(), 2, uintptr(jobHandle), uintptr(unsafe.Pointer(ioRateControlInfo)), 0) + ret = uint32(r0) + if ret == 0 { + err = errnoErr(e1) } - return _CMLocateDevNode(pdnDevInst, _p0, uFlags) + return } -func _CMLocateDevNode(pdnDevInst *uint32, pDeviceID *uint16, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall(procCM_Locate_DevNodeW.Addr(), 3, uintptr(unsafe.Pointer(pdnDevInst)), uintptr(unsafe.Pointer(pDeviceID)), uintptr(uFlags)) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) +func netLocalGroupAddMembers(serverName *uint16, groupName *uint16, level uint32, buf *byte, totalEntries uint32) (status error) { + r0, _, _ := syscall.Syscall6(procNetLocalGroupAddMembers.Addr(), 5, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(groupName)), uintptr(level), uintptr(unsafe.Pointer(buf)), uintptr(totalEntries), 0) + if r0 != 0 { + status = syscall.Errno(r0) } return } -func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall6(procCM_Get_DevNode_PropertyW.Addr(), 6, uintptr(dnDevInst), uintptr(unsafe.Pointer(propertyKey)), uintptr(unsafe.Pointer(propertyType)), uintptr(unsafe.Pointer(propertyBuffer)), uintptr(unsafe.Pointer(propertyBufferSize)), uintptr(uFlags)) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) +func netLocalGroupGetInfo(serverName *uint16, groupName *uint16, level uint32, bufptr **byte) (status error) { + r0, _, _ := syscall.Syscall6(procNetLocalGroupGetInfo.Addr(), 4, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(groupName)), uintptr(level), uintptr(unsafe.Pointer(bufptr)), 0, 0) + if r0 != 0 { + status = syscall.Errno(r0) + } + return +} + +func netUserAdd(serverName *uint16, level uint32, buf *byte, parm_err *uint32) (status error) { + r0, _, _ := syscall.Syscall6(procNetUserAdd.Addr(), 4, uintptr(unsafe.Pointer(serverName)), uintptr(level), uintptr(unsafe.Pointer(buf)), uintptr(unsafe.Pointer(parm_err)), 0, 0) + if r0 != 0 { + status = syscall.Errno(r0) + } + return +} + +func netUserDel(serverName *uint16, username *uint16) (status error) { + r0, _, _ := syscall.Syscall(procNetUserDel.Addr(), 2, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(username)), 0) + if r0 != 0 { + status = syscall.Errno(r0) } return } @@ -332,8 +323,8 @@ func NtCreateFile(handle *uintptr, accessMask uint32, oa *ObjectAttributes, iosb return } -func NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) +func NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtCreateJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) status = uint32(r0) return } @@ -344,24 +335,44 @@ func NtOpenDirectoryObject(handle *uintptr, accessMask uint32, oa *ObjectAttribu return } +func NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtOpenJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) + status = uint32(r0) + return +} + func NtQueryDirectoryObject(handle uintptr, buffer *byte, length uint32, singleEntry bool, restartScan bool, context *uint32, returnLength *uint32) (status uint32) { var _p0 uint32 if singleEntry { _p0 = 1 - } else { - _p0 = 0 } var _p1 uint32 if restartScan { _p1 = 1 - } else { - _p1 = 0 } r0, _, _ := syscall.Syscall9(procNtQueryDirectoryObject.Addr(), 7, uintptr(handle), uintptr(unsafe.Pointer(buffer)), uintptr(length), uintptr(_p0), uintptr(_p1), uintptr(unsafe.Pointer(context)), uintptr(unsafe.Pointer(returnLength)), 0, 0) status = uint32(r0) return } +func NtQueryInformationProcess(processHandle windows.Handle, processInfoClass uint32, processInfo unsafe.Pointer, processInfoLength uint32, returnLength *uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtQueryInformationProcess.Addr(), 5, uintptr(processHandle), uintptr(processInfoClass), uintptr(processInfo), uintptr(processInfoLength), uintptr(unsafe.Pointer(returnLength)), 0) + status = uint32(r0) + return +} + +func NtQuerySystemInformation(systemInfoClass int, systemInformation unsafe.Pointer, systemInfoLength uint32, returnLength *uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtQuerySystemInformation.Addr(), 4, uintptr(systemInfoClass), uintptr(systemInformation), uintptr(systemInfoLength), uintptr(unsafe.Pointer(returnLength)), 0, 0) + status = uint32(r0) + return +} + +func NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) + status = uint32(r0) + return +} + func RtlNtStatusToDosError(status uint32) (winerr error) { r0, _, _ := syscall.Syscall(procRtlNtStatusToDosError.Addr(), 1, uintptr(status), 0, 0) if r0 != 0 { @@ -369,3 +380,36 @@ func RtlNtStatusToDosError(status uint32) (winerr error) { } return } + +func ORCloseHive(key syscall.Handle) (regerrno error) { + r0, _, _ := syscall.Syscall(procORCloseHive.Addr(), 1, uintptr(key), 0, 0) + if r0 != 0 { + regerrno = syscall.Errno(r0) + } + return +} + +func ORCreateHive(key *syscall.Handle) (regerrno error) { + r0, _, _ := syscall.Syscall(procORCreateHive.Addr(), 1, uintptr(unsafe.Pointer(key)), 0, 0) + if r0 != 0 { + regerrno = syscall.Errno(r0) + } + return +} + +func ORSaveHive(key syscall.Handle, file string, OsMajorVersion uint32, OsMinorVersion uint32) (regerrno error) { + var _p0 *uint16 + _p0, regerrno = syscall.UTF16PtrFromString(file) + if regerrno != nil { + return + } + return _ORSaveHive(key, _p0, OsMajorVersion, OsMinorVersion) +} + +func _ORSaveHive(key syscall.Handle, file *uint16, OsMajorVersion uint32, OsMinorVersion uint32) (regerrno error) { + r0, _, _ := syscall.Syscall6(procORSaveHive.Addr(), 4, uintptr(key), uintptr(unsafe.Pointer(file)), uintptr(OsMajorVersion), uintptr(OsMinorVersion), 0, 0) + if r0 != 0 { + regerrno = syscall.Errno(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index 891616370..afd1ddd0a 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( @@ -68,6 +70,9 @@ func ProcessUtilityVMImage(path string) error { func UnprepareLayer(info DriverInfo, layerId string) error { return wclayer.UnprepareLayer(context.Background(), layerPath(&info, layerId)) } +func ConvertToBaseLayer(path string) error { + return wclayer.ConvertToBaseLayer(context.Background(), path) +} type DriverInfo struct { Flavour int diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go index 3ab3bcd89..6c435d2b6 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go @@ -45,6 +45,15 @@ func Build() uint16 { return Get().Build } -func (osv OSVersion) ToString() string { +// String returns the OSVersion formatted as a string. It implements the +// [fmt.Stringer] interface. +func (osv OSVersion) String() string { return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) } + +// ToString returns the OSVersion formatted as a string. +// +// Deprecated: use [OSVersion.String]. +func (osv OSVersion) ToString() string { + return osv.String() +} diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/platform_compat_windows.go b/vendor/github.com/Microsoft/hcsshim/osversion/platform_compat_windows.go new file mode 100644 index 000000000..f8d411ad7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/osversion/platform_compat_windows.go @@ -0,0 +1,35 @@ +package osversion + +// List of stable ABI compliant ltsc releases +// Note: List must be sorted in ascending order +var compatLTSCReleases = []uint16{ + V21H2Server, +} + +// CheckHostAndContainerCompat checks if given host and container +// OS versions are compatible. +// It includes support for stable ABI compliant versions as well. +// Every release after WS 2022 will support the previous ltsc +// container image. Stable ABI is in preview mode for windows 11 client. +// Refer: https://learn.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/version-compatibility?tabs=windows-server-2022%2Cwindows-10#windows-server-host-os-compatibility +func CheckHostAndContainerCompat(host, ctr OSVersion) bool { + // check major minor versions of host and guest + if host.MajorVersion != ctr.MajorVersion || + host.MinorVersion != ctr.MinorVersion { + return false + } + + // If host is < WS 2022, exact version match is required + if host.Build < V21H2Server { + return host.Build == ctr.Build + } + + var supportedLtscRelease uint16 + for i := len(compatLTSCReleases) - 1; i >= 0; i-- { + if host.Build >= compatLTSCReleases[i] { + supportedLtscRelease = compatLTSCReleases[i] + break + } + } + return ctr.Build >= supportedLtscRelease && ctr.Build <= host.Build +} diff --git a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go index e9267b955..446369591 100644 --- a/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go +++ b/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go @@ -1,38 +1,84 @@ package osversion +// Windows Client and Server build numbers. +// +// See: +// https://learn.microsoft.com/en-us/windows/release-health/release-information +// https://learn.microsoft.com/en-us/windows/release-health/windows-server-release-info +// https://learn.microsoft.com/en-us/windows/release-health/windows11-release-information const ( // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server // 2016 (ltsc2016) and Windows 10 (Anniversary Update). RS1 = 14393 + // V1607 (version 1607, codename "Redstone 1") is an alias for [RS1]. + V1607 = RS1 + // LTSC2016 (Windows Server 2016) is an alias for [RS1]. + LTSC2016 = RS1 // RS2 (version 1703, codename "Redstone 2") was a client-only update, and // corresponds to Windows 10 (Creators Update). RS2 = 15063 + // V1703 (version 1703, codename "Redstone 2") is an alias for [RS2]. + V1703 = RS2 // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). RS3 = 16299 + // V1709 (version 1709, codename "Redstone 3") is an alias for [RS3]. + V1709 = RS3 // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). RS4 = 17134 + // V1803 (version 1803, codename "Redstone 4") is an alias for [RS4]. + V1803 = RS4 // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server // 2019 (ltsc2019), and Windows 10 (October 2018 Update). RS5 = 17763 + // V1809 (version 1809, codename "Redstone 5") is an alias for [RS5]. + V1809 = RS5 + // LTSC2019 (Windows Server 2019) is an alias for [RS5]. + LTSC2019 = RS5 - // V19H1 (version 1903) corresponds to Windows Server 1903 (semi-annual + // V19H1 (version 1903, codename 19H1) corresponds to Windows Server 1903 (semi-annual // channel). V19H1 = 18362 + // V1903 (version 1903) is an alias for [V19H1]. + V1903 = V19H1 - // V19H2 (version 1909) corresponds to Windows Server 1909 (semi-annual + // V19H2 (version 1909, codename 19H2) corresponds to Windows Server 1909 (semi-annual // channel). V19H2 = 18363 + // V1909 (version 1909) is an alias for [V19H2]. + V1909 = V19H2 - // V20H1 (version 2004) corresponds to Windows Server 2004 (semi-annual + // V20H1 (version 2004, codename 20H1) corresponds to Windows Server 2004 (semi-annual // channel). V20H1 = 19041 + // V2004 (version 2004) is an alias for [V20H1]. + V2004 = V20H1 // V20H2 corresponds to Windows Server 20H2 (semi-annual channel). V20H2 = 19042 + + // V21H1 corresponds to Windows Server 21H1 (semi-annual channel). + V21H1 = 19043 + + // V21H2Win10 corresponds to Windows 10 (November 2021 Update). + V21H2Win10 = 19044 + + // V21H2Server corresponds to Windows Server 2022 (ltsc2022). + V21H2Server = 20348 + // LTSC2022 (Windows Server 2022) is an alias for [V21H2Server] + LTSC2022 = V21H2Server + + // V21H2Win11 corresponds to Windows 11 (original release). + V21H2Win11 = 22000 + + // V22H2Win10 corresponds to Windows 10 (2022 Update). + V22H2Win10 = 19045 + + // V22H2Win11 corresponds to Windows 11 (2022 Update). + V22H2Win11 = 22621 ) diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index 3362c6833..44df91cde 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,3 +1,5 @@ +//go:build windows + package hcsshim import ( diff --git a/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go index 8bed84857..9b619b6e6 100644 --- a/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package hcsshim @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } diff --git a/vendor/github.com/containerd/containerd/LICENSE b/vendor/github.com/containerd/containerd/LICENSE new file mode 100644 index 000000000..584149b6e --- /dev/null +++ b/vendor/github.com/containerd/containerd/LICENSE @@ -0,0 +1,191 @@ + + Apache License + Version 2.0, January 2004 + https://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + Copyright The containerd Authors + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + https://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/containerd/containerd/NOTICE b/vendor/github.com/containerd/containerd/NOTICE new file mode 100644 index 000000000..8915f0277 --- /dev/null +++ b/vendor/github.com/containerd/containerd/NOTICE @@ -0,0 +1,16 @@ +Docker +Copyright 2012-2015 Docker, Inc. + +This product includes software developed at Docker, Inc. (https://www.docker.com). + +The following is courtesy of our legal counsel: + + +Use and transfer of Docker may be subject to certain restrictions by the +United States and other governments. +It is your responsibility to ensure that your use and/or transfer does not +violate applicable laws. + +For more information, please see https://www.bis.doc.gov + +See also https://www.apache.org/dev/crypto.html and/or seek legal counsel. diff --git a/vendor/github.com/containerd/containerd/errdefs/errors.go b/vendor/github.com/containerd/containerd/errdefs/errors.go new file mode 100644 index 000000000..876225597 --- /dev/null +++ b/vendor/github.com/containerd/containerd/errdefs/errors.go @@ -0,0 +1,92 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +// Package errdefs defines the common errors used throughout containerd +// packages. +// +// Use with fmt.Errorf to add context to an error. +// +// To detect an error class, use the IsXXX functions to tell whether an error +// is of a certain type. +// +// The functions ToGRPC and FromGRPC can be used to map server-side and +// client-side errors to the correct types. +package errdefs + +import ( + "context" + "errors" +) + +// Definitions of common error types used throughout containerd. All containerd +// errors returned by most packages will map into one of these errors classes. +// Packages should return errors of these types when they want to instruct a +// client to take a particular action. +// +// For the most part, we just try to provide local grpc errors. Most conditions +// map very well to those defined by grpc. +var ( + ErrUnknown = errors.New("unknown") // used internally to represent a missed mapping. + ErrInvalidArgument = errors.New("invalid argument") + ErrNotFound = errors.New("not found") + ErrAlreadyExists = errors.New("already exists") + ErrFailedPrecondition = errors.New("failed precondition") + ErrUnavailable = errors.New("unavailable") + ErrNotImplemented = errors.New("not implemented") // represents not supported and unimplemented +) + +// IsInvalidArgument returns true if the error is due to an invalid argument +func IsInvalidArgument(err error) bool { + return errors.Is(err, ErrInvalidArgument) +} + +// IsNotFound returns true if the error is due to a missing object +func IsNotFound(err error) bool { + return errors.Is(err, ErrNotFound) +} + +// IsAlreadyExists returns true if the error is due to an already existing +// metadata item +func IsAlreadyExists(err error) bool { + return errors.Is(err, ErrAlreadyExists) +} + +// IsFailedPrecondition returns true if an operation could not proceed to the +// lack of a particular condition +func IsFailedPrecondition(err error) bool { + return errors.Is(err, ErrFailedPrecondition) +} + +// IsUnavailable returns true if the error is due to a resource being unavailable +func IsUnavailable(err error) bool { + return errors.Is(err, ErrUnavailable) +} + +// IsNotImplemented returns true if the error is due to not being implemented +func IsNotImplemented(err error) bool { + return errors.Is(err, ErrNotImplemented) +} + +// IsCanceled returns true if the error is due to `context.Canceled`. +func IsCanceled(err error) bool { + return errors.Is(err, context.Canceled) +} + +// IsDeadlineExceeded returns true if the error is due to +// `context.DeadlineExceeded`. +func IsDeadlineExceeded(err error) bool { + return errors.Is(err, context.DeadlineExceeded) +} diff --git a/vendor/github.com/containerd/containerd/errdefs/grpc.go b/vendor/github.com/containerd/containerd/errdefs/grpc.go new file mode 100644 index 000000000..7a9b33e05 --- /dev/null +++ b/vendor/github.com/containerd/containerd/errdefs/grpc.go @@ -0,0 +1,147 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package errdefs + +import ( + "context" + "fmt" + "strings" + + "google.golang.org/grpc/codes" + "google.golang.org/grpc/status" +) + +// ToGRPC will attempt to map the backend containerd error into a grpc error, +// using the original error message as a description. +// +// Further information may be extracted from certain errors depending on their +// type. +// +// If the error is unmapped, the original error will be returned to be handled +// by the regular grpc error handling stack. +func ToGRPC(err error) error { + if err == nil { + return nil + } + + if isGRPCError(err) { + // error has already been mapped to grpc + return err + } + + switch { + case IsInvalidArgument(err): + return status.Errorf(codes.InvalidArgument, err.Error()) + case IsNotFound(err): + return status.Errorf(codes.NotFound, err.Error()) + case IsAlreadyExists(err): + return status.Errorf(codes.AlreadyExists, err.Error()) + case IsFailedPrecondition(err): + return status.Errorf(codes.FailedPrecondition, err.Error()) + case IsUnavailable(err): + return status.Errorf(codes.Unavailable, err.Error()) + case IsNotImplemented(err): + return status.Errorf(codes.Unimplemented, err.Error()) + case IsCanceled(err): + return status.Errorf(codes.Canceled, err.Error()) + case IsDeadlineExceeded(err): + return status.Errorf(codes.DeadlineExceeded, err.Error()) + } + + return err +} + +// ToGRPCf maps the error to grpc error codes, assembling the formatting string +// and combining it with the target error string. +// +// This is equivalent to errdefs.ToGRPC(fmt.Errorf("%s: %w", fmt.Sprintf(format, args...), err)) +func ToGRPCf(err error, format string, args ...interface{}) error { + return ToGRPC(fmt.Errorf("%s: %w", fmt.Sprintf(format, args...), err)) +} + +// FromGRPC returns the underlying error from a grpc service based on the grpc error code +func FromGRPC(err error) error { + if err == nil { + return nil + } + + var cls error // divide these into error classes, becomes the cause + + switch code(err) { + case codes.InvalidArgument: + cls = ErrInvalidArgument + case codes.AlreadyExists: + cls = ErrAlreadyExists + case codes.NotFound: + cls = ErrNotFound + case codes.Unavailable: + cls = ErrUnavailable + case codes.FailedPrecondition: + cls = ErrFailedPrecondition + case codes.Unimplemented: + cls = ErrNotImplemented + case codes.Canceled: + cls = context.Canceled + case codes.DeadlineExceeded: + cls = context.DeadlineExceeded + default: + cls = ErrUnknown + } + + msg := rebaseMessage(cls, err) + if msg != "" { + err = fmt.Errorf("%s: %w", msg, cls) + } else { + err = cls + } + + return err +} + +// rebaseMessage removes the repeats for an error at the end of an error +// string. This will happen when taking an error over grpc then remapping it. +// +// Effectively, we just remove the string of cls from the end of err if it +// appears there. +func rebaseMessage(cls error, err error) string { + desc := errDesc(err) + clss := cls.Error() + if desc == clss { + return "" + } + + return strings.TrimSuffix(desc, ": "+clss) +} + +func isGRPCError(err error) bool { + _, ok := status.FromError(err) + return ok +} + +func code(err error) codes.Code { + if s, ok := status.FromError(err); ok { + return s.Code() + } + return codes.Unknown +} + +func errDesc(err error) string { + if s, ok := status.FromError(err); ok { + return s.Message() + } + return err.Error() +} diff --git a/vendor/github.com/emicklei/go-restful/v3/CHANGES.md b/vendor/github.com/emicklei/go-restful/v3/CHANGES.md index 74a378157..02a73ccfd 100644 --- a/vendor/github.com/emicklei/go-restful/v3/CHANGES.md +++ b/vendor/github.com/emicklei/go-restful/v3/CHANGES.md @@ -1,10 +1,21 @@ # Change history of go-restful -## [v3.9.0] - 20221-07-21 +## [v3.10.1] - 2022-11-19 + +- fix broken 3.10.0 by using path package for joining paths + +## [v3.10.0] - 2022-10-11 - BROKEN + +- changed tokenizer to match std route match behavior; do not trimright the path (#511) +- Add MIME_ZIP (#512) +- Add MIME_ZIP and HEADER_ContentDisposition (#513) +- Changed how to get query parameter issue #510 + +## [v3.9.0] - 2022-07-21 - add support for http.Handler implementations to work as FilterFunction, issue #504 (thanks to https://github.com/ggicci) -## [v3.8.0] - 20221-06-06 +## [v3.8.0] - 2022-06-06 - use exact matching of allowed domain entries, issue #489 (#493) - this changes fixes [security] Authorization Bypass Through User-Controlled Key diff --git a/vendor/github.com/emicklei/go-restful/v3/constants.go b/vendor/github.com/emicklei/go-restful/v3/constants.go index 203439c5e..2328bde6c 100644 --- a/vendor/github.com/emicklei/go-restful/v3/constants.go +++ b/vendor/github.com/emicklei/go-restful/v3/constants.go @@ -7,12 +7,14 @@ package restful const ( MIME_XML = "application/xml" // Accept or Content-Type used in Consumes() and/or Produces() MIME_JSON = "application/json" // Accept or Content-Type used in Consumes() and/or Produces() + MIME_ZIP = "application/zip" // Accept or Content-Type used in Consumes() and/or Produces() MIME_OCTET = "application/octet-stream" // If Content-Type is not present in request, use the default HEADER_Allow = "Allow" HEADER_Accept = "Accept" HEADER_Origin = "Origin" HEADER_ContentType = "Content-Type" + HEADER_ContentDisposition = "Content-Disposition" HEADER_LastModified = "Last-Modified" HEADER_AcceptEncoding = "Accept-Encoding" HEADER_ContentEncoding = "Content-Encoding" diff --git a/vendor/github.com/emicklei/go-restful/v3/request.go b/vendor/github.com/emicklei/go-restful/v3/request.go index 5725a0759..0020095e8 100644 --- a/vendor/github.com/emicklei/go-restful/v3/request.go +++ b/vendor/github.com/emicklei/go-restful/v3/request.go @@ -31,7 +31,8 @@ func NewRequest(httpRequest *http.Request) *Request { // a "Unable to unmarshal content of type:" response is returned. // Valid values are restful.MIME_JSON and restful.MIME_XML // Example: -// restful.DefaultRequestContentType(restful.MIME_JSON) +// +// restful.DefaultRequestContentType(restful.MIME_JSON) func DefaultRequestContentType(mime string) { defaultRequestContentType = mime } @@ -48,7 +49,7 @@ func (r *Request) PathParameters() map[string]string { // QueryParameter returns the (first) Query parameter value by its name func (r *Request) QueryParameter(name string) string { - return r.Request.FormValue(name) + return r.Request.URL.Query().Get(name) } // QueryParameters returns the all the query parameters values by name diff --git a/vendor/github.com/emicklei/go-restful/v3/response.go b/vendor/github.com/emicklei/go-restful/v3/response.go index 8f0b56aa2..a41a92cc2 100644 --- a/vendor/github.com/emicklei/go-restful/v3/response.go +++ b/vendor/github.com/emicklei/go-restful/v3/response.go @@ -109,6 +109,9 @@ func (r *Response) EntityWriter() (EntityReaderWriter, bool) { if DefaultResponseMimeType == MIME_XML { return entityAccessRegistry.accessorAt(MIME_XML) } + if DefaultResponseMimeType == MIME_ZIP { + return entityAccessRegistry.accessorAt(MIME_ZIP) + } // Fallback to whatever the route says it can produce. // https://www.w3.org/Protocols/rfc2616/rfc2616-sec14.html for _, each := range r.routeProduces { diff --git a/vendor/github.com/emicklei/go-restful/v3/route.go b/vendor/github.com/emicklei/go-restful/v3/route.go index 193f4a6b0..ea05b3da8 100644 --- a/vendor/github.com/emicklei/go-restful/v3/route.go +++ b/vendor/github.com/emicklei/go-restful/v3/route.go @@ -164,7 +164,7 @@ func tokenizePath(path string) []string { if "/" == path { return nil } - return strings.Split(strings.Trim(path, "/"), "/") + return strings.Split(strings.TrimLeft(path, "/"), "/") } // for debugging @@ -176,3 +176,5 @@ func (r *Route) String() string { func (r *Route) EnableContentEncoding(enabled bool) { r.contentEncodingEnabled = &enabled } + +var TrimRightSlashEnabled = false diff --git a/vendor/github.com/emicklei/go-restful/v3/route_builder.go b/vendor/github.com/emicklei/go-restful/v3/route_builder.go index 23641b6dd..830ebf148 100644 --- a/vendor/github.com/emicklei/go-restful/v3/route_builder.go +++ b/vendor/github.com/emicklei/go-restful/v3/route_builder.go @@ -7,6 +7,7 @@ package restful import ( "fmt" "os" + "path" "reflect" "runtime" "strings" @@ -46,11 +47,12 @@ type RouteBuilder struct { // Do evaluates each argument with the RouteBuilder itself. // This allows you to follow DRY principles without breaking the fluent programming style. // Example: -// ws.Route(ws.DELETE("/{name}").To(t.deletePerson).Do(Returns200, Returns500)) // -// func Returns500(b *RouteBuilder) { -// b.Returns(500, "Internal Server Error", restful.ServiceError{}) -// } +// ws.Route(ws.DELETE("/{name}").To(t.deletePerson).Do(Returns200, Returns500)) +// +// func Returns500(b *RouteBuilder) { +// b.Returns(500, "Internal Server Error", restful.ServiceError{}) +// } func (b *RouteBuilder) Do(oneArgBlocks ...func(*RouteBuilder)) *RouteBuilder { for _, each := range oneArgBlocks { each(b) @@ -352,7 +354,7 @@ func (b *RouteBuilder) Build() Route { } func concatPath(path1, path2 string) string { - return strings.TrimRight(path1, "/") + "/" + strings.TrimLeft(path2, "/") + return path.Join(path1, path2) } var anonymousFuncCount int32 diff --git a/vendor/github.com/google/gofuzz/.travis.yml b/vendor/github.com/google/gofuzz/.travis.yml index f8684d99f..061d72ae0 100644 --- a/vendor/github.com/google/gofuzz/.travis.yml +++ b/vendor/github.com/google/gofuzz/.travis.yml @@ -1,13 +1,10 @@ language: go go: - - 1.4 - - 1.3 - - 1.2 - - tip - -install: - - if ! go get code.google.com/p/go.tools/cmd/cover; then go get golang.org/x/tools/cmd/cover; fi + - 1.11.x + - 1.12.x + - 1.13.x + - master script: - go test -cover diff --git a/vendor/github.com/google/gofuzz/CONTRIBUTING.md b/vendor/github.com/google/gofuzz/CONTRIBUTING.md index 51cf5cd1a..97c1b34fd 100644 --- a/vendor/github.com/google/gofuzz/CONTRIBUTING.md +++ b/vendor/github.com/google/gofuzz/CONTRIBUTING.md @@ -1,7 +1,7 @@ # How to contribute # We'd love to accept your patches and contributions to this project. There are -a just a few small guidelines you need to follow. +just a few small guidelines you need to follow. ## Contributor License Agreement ## diff --git a/vendor/github.com/google/gofuzz/README.md b/vendor/github.com/google/gofuzz/README.md index 386c2a457..b503aae7d 100644 --- a/vendor/github.com/google/gofuzz/README.md +++ b/vendor/github.com/google/gofuzz/README.md @@ -68,4 +68,22 @@ f.Fuzz(&myObject) // Type will correspond to whether A or B info is set. See more examples in ```example_test.go```. +You can use this library for easier [go-fuzz](https://github.com/dvyukov/go-fuzz)ing. +go-fuzz provides the user a byte-slice, which should be converted to different inputs +for the tested function. This library can help convert the byte slice. Consider for +example a fuzz test for a the function `mypackage.MyFunc` that takes an int arguments: +```go +// +build gofuzz +package mypackage + +import fuzz "github.com/google/gofuzz" + +func Fuzz(data []byte) int { + var i int + fuzz.NewFromGoFuzz(data).Fuzz(&i) + MyFunc(i) + return 0 +} +``` + Happy testing! diff --git a/vendor/github.com/google/gofuzz/bytesource/bytesource.go b/vendor/github.com/google/gofuzz/bytesource/bytesource.go new file mode 100644 index 000000000..5bb365949 --- /dev/null +++ b/vendor/github.com/google/gofuzz/bytesource/bytesource.go @@ -0,0 +1,81 @@ +/* +Copyright 2014 Google Inc. All rights reserved. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Package bytesource provides a rand.Source64 that is determined by a slice of bytes. +package bytesource + +import ( + "bytes" + "encoding/binary" + "io" + "math/rand" +) + +// ByteSource implements rand.Source64 determined by a slice of bytes. The random numbers are +// generated from each 8 bytes in the slice, until the last bytes are consumed, from which a +// fallback pseudo random source is created in case more random numbers are required. +// It also exposes a `bytes.Reader` API, which lets callers consume the bytes directly. +type ByteSource struct { + *bytes.Reader + fallback rand.Source +} + +// New returns a new ByteSource from a given slice of bytes. +func New(input []byte) *ByteSource { + s := &ByteSource{ + Reader: bytes.NewReader(input), + fallback: rand.NewSource(0), + } + if len(input) > 0 { + s.fallback = rand.NewSource(int64(s.consumeUint64())) + } + return s +} + +func (s *ByteSource) Uint64() uint64 { + // Return from input if it was not exhausted. + if s.Len() > 0 { + return s.consumeUint64() + } + + // Input was exhausted, return random number from fallback (in this case fallback should not be + // nil). Try first having a Uint64 output (Should work in current rand implementation), + // otherwise return a conversion of Int63. + if s64, ok := s.fallback.(rand.Source64); ok { + return s64.Uint64() + } + return uint64(s.fallback.Int63()) +} + +func (s *ByteSource) Int63() int64 { + return int64(s.Uint64() >> 1) +} + +func (s *ByteSource) Seed(seed int64) { + s.fallback = rand.NewSource(seed) + s.Reader = bytes.NewReader(nil) +} + +// consumeUint64 reads 8 bytes from the input and convert them to a uint64. It assumes that the the +// bytes reader is not empty. +func (s *ByteSource) consumeUint64() uint64 { + var bytes [8]byte + _, err := s.Read(bytes[:]) + if err != nil && err != io.EOF { + panic("failed reading source") // Should not happen. + } + return binary.BigEndian.Uint64(bytes[:]) +} diff --git a/vendor/github.com/google/gofuzz/fuzz.go b/vendor/github.com/google/gofuzz/fuzz.go index da0a5f938..761520a8c 100644 --- a/vendor/github.com/google/gofuzz/fuzz.go +++ b/vendor/github.com/google/gofuzz/fuzz.go @@ -22,6 +22,9 @@ import ( "reflect" "regexp" "time" + + "github.com/google/gofuzz/bytesource" + "strings" ) // fuzzFuncMap is a map from a type to a fuzzFunc that handles that type. @@ -61,6 +64,34 @@ func NewWithSeed(seed int64) *Fuzzer { return f } +// NewFromGoFuzz is a helper function that enables using gofuzz (this +// project) with go-fuzz (https://github.com/dvyukov/go-fuzz) for continuous +// fuzzing. Essentially, it enables translating the fuzzing bytes from +// go-fuzz to any Go object using this library. +// +// This implementation promises a constant translation from a given slice of +// bytes to the fuzzed objects. This promise will remain over future +// versions of Go and of this library. +// +// Note: the returned Fuzzer should not be shared between multiple goroutines, +// as its deterministic output will no longer be available. +// +// Example: use go-fuzz to test the function `MyFunc(int)` in the package +// `mypackage`. Add the file: "mypacakge_fuzz.go" with the content: +// +// // +build gofuzz +// package mypacakge +// import fuzz "github.com/google/gofuzz" +// func Fuzz(data []byte) int { +// var i int +// fuzz.NewFromGoFuzz(data).Fuzz(&i) +// MyFunc(i) +// return 0 +// } +func NewFromGoFuzz(data []byte) *Fuzzer { + return New().RandSource(bytesource.New(data)) +} + // Funcs adds each entry in fuzzFuncs as a custom fuzzing function. // // Each entry in fuzzFuncs must be a function taking two parameters. @@ -141,7 +172,7 @@ func (f *Fuzzer) genElementCount() int { } func (f *Fuzzer) genShouldFill() bool { - return f.r.Float64() > f.nilChance + return f.r.Float64() >= f.nilChance } // MaxDepth sets the maximum number of recursive fuzz calls that will be made @@ -240,6 +271,7 @@ func (fc *fuzzerContext) doFuzz(v reflect.Value, flags uint64) { fn(v, fc.fuzzer.r) return } + switch v.Kind() { case reflect.Map: if fc.fuzzer.genShouldFill() { @@ -450,10 +482,10 @@ var fillFuncMap = map[reflect.Kind]func(reflect.Value, *rand.Rand){ v.SetFloat(r.Float64()) }, reflect.Complex64: func(v reflect.Value, r *rand.Rand) { - panic("unimplemented") + v.SetComplex(complex128(complex(r.Float32(), r.Float32()))) }, reflect.Complex128: func(v reflect.Value, r *rand.Rand) { - panic("unimplemented") + v.SetComplex(complex(r.Float64(), r.Float64())) }, reflect.String: func(v reflect.Value, r *rand.Rand) { v.SetString(randString(r)) @@ -465,38 +497,105 @@ var fillFuncMap = map[reflect.Kind]func(reflect.Value, *rand.Rand){ // randBool returns true or false randomly. func randBool(r *rand.Rand) bool { - if r.Int()&1 == 1 { - return true - } - return false + return r.Int31()&(1<<30) == 0 +} + +type int63nPicker interface { + Int63n(int64) int64 } -type charRange struct { - first, last rune +// UnicodeRange describes a sequential range of unicode characters. +// Last must be numerically greater than First. +type UnicodeRange struct { + First, Last rune } +// UnicodeRanges describes an arbitrary number of sequential ranges of unicode characters. +// To be useful, each range must have at least one character (First <= Last) and +// there must be at least one range. +type UnicodeRanges []UnicodeRange + // choose returns a random unicode character from the given range, using the // given randomness source. -func (r *charRange) choose(rand *rand.Rand) rune { - count := int64(r.last - r.first) - return r.first + rune(rand.Int63n(count)) +func (ur UnicodeRange) choose(r int63nPicker) rune { + count := int64(ur.Last - ur.First + 1) + return ur.First + rune(r.Int63n(count)) +} + +// CustomStringFuzzFunc constructs a FuzzFunc which produces random strings. +// Each character is selected from the range ur. If there are no characters +// in the range (cr.Last < cr.First), this will panic. +func (ur UnicodeRange) CustomStringFuzzFunc() func(s *string, c Continue) { + ur.check() + return func(s *string, c Continue) { + *s = ur.randString(c.Rand) + } } -var unicodeRanges = []charRange{ +// check is a function that used to check whether the first of ur(UnicodeRange) +// is greater than the last one. +func (ur UnicodeRange) check() { + if ur.Last < ur.First { + panic("The last encoding must be greater than the first one.") + } +} + +// randString of UnicodeRange makes a random string up to 20 characters long. +// Each character is selected form ur(UnicodeRange). +func (ur UnicodeRange) randString(r *rand.Rand) string { + n := r.Intn(20) + sb := strings.Builder{} + sb.Grow(n) + for i := 0; i < n; i++ { + sb.WriteRune(ur.choose(r)) + } + return sb.String() +} + +// defaultUnicodeRanges sets a default unicode range when user do not set +// CustomStringFuzzFunc() but wants fuzz string. +var defaultUnicodeRanges = UnicodeRanges{ {' ', '~'}, // ASCII characters {'\u00a0', '\u02af'}, // Multi-byte encoded characters {'\u4e00', '\u9fff'}, // Common CJK (even longer encodings) } +// CustomStringFuzzFunc constructs a FuzzFunc which produces random strings. +// Each character is selected from one of the ranges of ur(UnicodeRanges). +// Each range has an equal probability of being chosen. If there are no ranges, +// or a selected range has no characters (.Last < .First), this will panic. +// Do not modify any of the ranges in ur after calling this function. +func (ur UnicodeRanges) CustomStringFuzzFunc() func(s *string, c Continue) { + // Check unicode ranges slice is empty. + if len(ur) == 0 { + panic("UnicodeRanges is empty.") + } + // if not empty, each range should be checked. + for i := range ur { + ur[i].check() + } + return func(s *string, c Continue) { + *s = ur.randString(c.Rand) + } +} + +// randString of UnicodeRanges makes a random string up to 20 characters long. +// Each character is selected form one of the ranges of ur(UnicodeRanges), +// and each range has an equal probability of being chosen. +func (ur UnicodeRanges) randString(r *rand.Rand) string { + n := r.Intn(20) + sb := strings.Builder{} + sb.Grow(n) + for i := 0; i < n; i++ { + sb.WriteRune(ur[r.Intn(len(ur))].choose(r)) + } + return sb.String() +} + // randString makes a random string up to 20 characters long. The returned string // may include a variety of (valid) UTF-8 encodings. func randString(r *rand.Rand) string { - n := r.Intn(20) - runes := make([]rune, n) - for i := range runes { - runes[i] = unicodeRanges[r.Intn(len(unicodeRanges))].choose(r) - } - return string(runes) + return defaultUnicodeRanges.randString(r) } // randUint64 makes random 64 bit numbers. diff --git a/vendor/github.com/imdario/mergo/.deepsource.toml b/vendor/github.com/imdario/mergo/.deepsource.toml new file mode 100644 index 000000000..8a0681af8 --- /dev/null +++ b/vendor/github.com/imdario/mergo/.deepsource.toml @@ -0,0 +1,12 @@ +version = 1 + +test_patterns = [ + "*_test.go" +] + +[[analyzers]] +name = "go" +enabled = true + + [analyzers.meta] + import_path = "github.com/imdario/mergo" \ No newline at end of file diff --git a/vendor/github.com/imdario/mergo/.travis.yml b/vendor/github.com/imdario/mergo/.travis.yml index b13a50ed1..d324c43ba 100644 --- a/vendor/github.com/imdario/mergo/.travis.yml +++ b/vendor/github.com/imdario/mergo/.travis.yml @@ -1,7 +1,12 @@ language: go +arch: + - amd64 + - ppc64le install: - go get -t - go get golang.org/x/tools/cmd/cover - go get github.com/mattn/goveralls script: + - go test -race -v ./... +after_script: - $HOME/gopath/bin/goveralls -service=travis-ci -repotoken $COVERALLS_TOKEN diff --git a/vendor/github.com/imdario/mergo/README.md b/vendor/github.com/imdario/mergo/README.md index 02fc81e06..aa8cbd7ce 100644 --- a/vendor/github.com/imdario/mergo/README.md +++ b/vendor/github.com/imdario/mergo/README.md @@ -1,44 +1,54 @@ # Mergo -A helper to merge structs and maps in Golang. Useful for configuration default values, avoiding messy if-statements. - -Also a lovely [comune](http://en.wikipedia.org/wiki/Mergo) (municipality) in the Province of Ancona in the Italian region of Marche. - -## Status - -It is ready for production use. [It is used in several projects by Docker, Google, The Linux Foundation, VMWare, Shopify, etc](https://github.com/imdario/mergo#mergo-in-the-wild). [![GoDoc][3]][4] -[![GoCard][5]][6] +[![GitHub release][5]][6] +[![GoCard][7]][8] [![Build Status][1]][2] -[![Coverage Status][7]][8] -[![Sourcegraph][9]][10] -[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fimdario%2Fmergo.svg?type=shield)](https://app.fossa.io/projects/git%2Bgithub.com%2Fimdario%2Fmergo?ref=badge_shield) +[![Coverage Status][9]][10] +[![Sourcegraph][11]][12] +[![FOSSA Status][13]][14] + +[![GoCenter Kudos][15]][16] [1]: https://travis-ci.org/imdario/mergo.png [2]: https://travis-ci.org/imdario/mergo [3]: https://godoc.org/github.com/imdario/mergo?status.svg [4]: https://godoc.org/github.com/imdario/mergo -[5]: https://goreportcard.com/badge/imdario/mergo -[6]: https://goreportcard.com/report/github.com/imdario/mergo -[7]: https://coveralls.io/repos/github/imdario/mergo/badge.svg?branch=master -[8]: https://coveralls.io/github/imdario/mergo?branch=master -[9]: https://sourcegraph.com/github.com/imdario/mergo/-/badge.svg -[10]: https://sourcegraph.com/github.com/imdario/mergo?badge +[5]: https://img.shields.io/github/release/imdario/mergo.svg +[6]: https://github.com/imdario/mergo/releases +[7]: https://goreportcard.com/badge/imdario/mergo +[8]: https://goreportcard.com/report/github.com/imdario/mergo +[9]: https://coveralls.io/repos/github/imdario/mergo/badge.svg?branch=master +[10]: https://coveralls.io/github/imdario/mergo?branch=master +[11]: https://sourcegraph.com/github.com/imdario/mergo/-/badge.svg +[12]: https://sourcegraph.com/github.com/imdario/mergo?badge +[13]: https://app.fossa.io/api/projects/git%2Bgithub.com%2Fimdario%2Fmergo.svg?type=shield +[14]: https://app.fossa.io/projects/git%2Bgithub.com%2Fimdario%2Fmergo?ref=badge_shield +[15]: https://search.gocenter.io/api/ui/badge/github.com%2Fimdario%2Fmergo +[16]: https://search.gocenter.io/github.com/imdario/mergo -### Latest release +A helper to merge structs and maps in Golang. Useful for configuration default values, avoiding messy if-statements. -[Release v0.3.7](https://github.com/imdario/mergo/releases/tag/v0.3.7). +Mergo merges same-type structs and maps by setting default values in zero-value fields. Mergo won't merge unexported (private) fields. It will do recursively any exported one. It also won't merge structs inside maps (because they are not addressable using Go reflection). + +Also a lovely [comune](http://en.wikipedia.org/wiki/Mergo) (municipality) in the Province of Ancona in the Italian region of Marche. + +## Status + +It is ready for production use. [It is used in several projects by Docker, Google, The Linux Foundation, VMWare, Shopify, etc](https://github.com/imdario/mergo#mergo-in-the-wild). ### Important note -Please keep in mind that in [0.3.2](//github.com/imdario/mergo/releases/tag/0.3.2) Mergo changed `Merge()`and `Map()` signatures to support [transformers](#transformers). An optional/variadic argument has been added, so it won't break existing code. +Please keep in mind that a problematic PR broke [0.3.9](//github.com/imdario/mergo/releases/tag/0.3.9). I reverted it in [0.3.10](//github.com/imdario/mergo/releases/tag/0.3.10), and I consider it stable but not bug-free. Also, this version adds suppot for go modules. -If you were using Mergo **before** April 6th 2015, please check your project works as intended after updating your local copy with ```go get -u github.com/imdario/mergo```. I apologize for any issue caused by its previous behavior and any future bug that Mergo could cause (I hope it won't!) in existing projects after the change (release 0.2.0). +Keep in mind that in [0.3.2](//github.com/imdario/mergo/releases/tag/0.3.2), Mergo changed `Merge()`and `Map()` signatures to support [transformers](#transformers). I added an optional/variadic argument so that it won't break the existing code. + +If you were using Mergo before April 6th, 2015, please check your project works as intended after updating your local copy with ```go get -u github.com/imdario/mergo```. I apologize for any issue caused by its previous behavior and any future bug that Mergo could cause in existing projects after the change (release 0.2.0). ### Donations -If Mergo is useful to you, consider buying me a coffee, a beer or making a monthly donation so I can keep building great free software. :heart_eyes: +If Mergo is useful to you, consider buying me a coffee, a beer, or making a monthly donation to allow me to keep building great free software. :heart_eyes: Buy Me a Coffee at ko-fi.com [![Beerpay](https://beerpay.io/imdario/mergo/badge.svg)](https://beerpay.io/imdario/mergo) @@ -87,8 +97,9 @@ If Mergo is useful to you, consider buying me a coffee, a beer or making a month - [mantasmatelis/whooplist-server](https://github.com/mantasmatelis/whooplist-server) - [jnuthong/item_search](https://github.com/jnuthong/item_search) - [bukalapak/snowboard](https://github.com/bukalapak/snowboard) +- [containerssh/containerssh](https://github.com/containerssh/containerssh) -## Installation +## Install go get github.com/imdario/mergo @@ -99,7 +110,7 @@ If Mergo is useful to you, consider buying me a coffee, a beer or making a month ## Usage -You can only merge same-type structs with exported fields initialized as zero value of their type and same-types maps. Mergo won't merge unexported (private) fields but will do recursively any exported one. It won't merge empty structs value as [they are not considered zero values](https://golang.org/ref/spec#The_zero_value) either. Also maps will be merged recursively except for structs inside maps (because they are not addressable using Go reflection). +You can only merge same-type structs with exported fields initialized as zero value of their type and same-types maps. Mergo won't merge unexported (private) fields but will do recursively any exported one. It won't merge empty structs value as [they are zero values](https://golang.org/ref/spec#The_zero_value) too. Also, maps will be merged recursively except for structs inside maps (because they are not addressable using Go reflection). ```go if err := mergo.Merge(&dst, src); err != nil { @@ -125,9 +136,7 @@ if err := mergo.Map(&dst, srcMap); err != nil { Warning: if you map a struct to map, it won't do it recursively. Don't expect Mergo to map struct members of your struct as `map[string]interface{}`. They will be just assigned as values. -More information and examples in [godoc documentation](http://godoc.org/github.com/imdario/mergo). - -### Nice example +Here is a nice example: ```go package main @@ -175,10 +184,10 @@ import ( "time" ) -type timeTransfomer struct { +type timeTransformer struct { } -func (t timeTransfomer) Transformer(typ reflect.Type) func(dst, src reflect.Value) error { +func (t timeTransformer) Transformer(typ reflect.Type) func(dst, src reflect.Value) error { if typ == reflect.TypeOf(time.Time{}) { return func(dst, src reflect.Value) error { if dst.CanSet() { @@ -202,7 +211,7 @@ type Snapshot struct { func main() { src := Snapshot{time.Now()} dest := Snapshot{} - mergo.Merge(&dest, src, mergo.WithTransformers(timeTransfomer{})) + mergo.Merge(&dest, src, mergo.WithTransformers(timeTransformer{})) fmt.Println(dest) // Will print // { 2018-01-12 01:15:00 +0000 UTC m=+0.000000001 } diff --git a/vendor/github.com/imdario/mergo/doc.go b/vendor/github.com/imdario/mergo/doc.go index 6e9aa7baf..fcd985f99 100644 --- a/vendor/github.com/imdario/mergo/doc.go +++ b/vendor/github.com/imdario/mergo/doc.go @@ -4,41 +4,140 @@ // license that can be found in the LICENSE file. /* -Package mergo merges same-type structs and maps by setting default values in zero-value fields. +A helper to merge structs and maps in Golang. Useful for configuration default values, avoiding messy if-statements. -Mergo won't merge unexported (private) fields but will do recursively any exported one. It also won't merge structs inside maps (because they are not addressable using Go reflection). +Mergo merges same-type structs and maps by setting default values in zero-value fields. Mergo won't merge unexported (private) fields. It will do recursively any exported one. It also won't merge structs inside maps (because they are not addressable using Go reflection). + +Status + +It is ready for production use. It is used in several projects by Docker, Google, The Linux Foundation, VMWare, Shopify, etc. + +Important note + +Please keep in mind that a problematic PR broke 0.3.9. We reverted it in 0.3.10. We consider 0.3.10 as stable but not bug-free. . Also, this version adds suppot for go modules. + +Keep in mind that in 0.3.2, Mergo changed Merge() and Map() signatures to support transformers. We added an optional/variadic argument so that it won't break the existing code. + +If you were using Mergo before April 6th, 2015, please check your project works as intended after updating your local copy with go get -u github.com/imdario/mergo. I apologize for any issue caused by its previous behavior and any future bug that Mergo could cause in existing projects after the change (release 0.2.0). + +Install + +Do your usual installation procedure: + + go get github.com/imdario/mergo + + // use in your .go code + import ( + "github.com/imdario/mergo" + ) Usage -From my own work-in-progress project: +You can only merge same-type structs with exported fields initialized as zero value of their type and same-types maps. Mergo won't merge unexported (private) fields but will do recursively any exported one. It won't merge empty structs value as they are zero values too. Also, maps will be merged recursively except for structs inside maps (because they are not addressable using Go reflection). + + if err := mergo.Merge(&dst, src); err != nil { + // ... + } + +Also, you can merge overwriting values using the transformer WithOverride. + + if err := mergo.Merge(&dst, src, mergo.WithOverride); err != nil { + // ... + } + +Additionally, you can map a map[string]interface{} to a struct (and otherwise, from struct to map), following the same restrictions as in Merge(). Keys are capitalized to find each corresponding exported field. + + if err := mergo.Map(&dst, srcMap); err != nil { + // ... + } + +Warning: if you map a struct to map, it won't do it recursively. Don't expect Mergo to map struct members of your struct as map[string]interface{}. They will be just assigned as values. + +Here is a nice example: + + package main + + import ( + "fmt" + "github.com/imdario/mergo" + ) - type networkConfig struct { - Protocol string - Address string - ServerType string `json: "server_type"` - Port uint16 + type Foo struct { + A string + B int64 } - type FssnConfig struct { - Network networkConfig + func main() { + src := Foo{ + A: "one", + B: 2, + } + dest := Foo{ + A: "two", + } + mergo.Merge(&dest, src) + fmt.Println(dest) + // Will print + // {two 2} } - var fssnDefault = FssnConfig { - networkConfig { - "tcp", - "127.0.0.1", - "http", - 31560, - }, +Transformers + +Transformers allow to merge specific types differently than in the default behavior. In other words, now you can customize how some types are merged. For example, time.Time is a struct; it doesn't have zero value but IsZero can return true because it has fields with zero value. How can we merge a non-zero time.Time? + + package main + + import ( + "fmt" + "github.com/imdario/mergo" + "reflect" + "time" + ) + + type timeTransformer struct { } - // Inside a function [...] + func (t timeTransformer) Transformer(typ reflect.Type) func(dst, src reflect.Value) error { + if typ == reflect.TypeOf(time.Time{}) { + return func(dst, src reflect.Value) error { + if dst.CanSet() { + isZero := dst.MethodByName("IsZero") + result := isZero.Call([]reflect.Value{}) + if result[0].Bool() { + dst.Set(src) + } + } + return nil + } + } + return nil + } + + type Snapshot struct { + Time time.Time + // ... + } - if err := mergo.Merge(&config, fssnDefault); err != nil { - log.Fatal(err) + func main() { + src := Snapshot{time.Now()} + dest := Snapshot{} + mergo.Merge(&dest, src, mergo.WithTransformers(timeTransformer{})) + fmt.Println(dest) + // Will print + // { 2018-01-12 01:15:00 +0000 UTC m=+0.000000001 } } - // More code [...] +Contact me + +If I can help you, you have an idea or you are using Mergo in your projects, don't hesitate to drop me a line (or a pull request): https://twitter.com/im_dario + +About + +Written by Dario Castañé: https://da.rio.hn + +License + +BSD 3-Clause license, as Go language. */ package mergo diff --git a/vendor/github.com/imdario/mergo/map.go b/vendor/github.com/imdario/mergo/map.go index 3f5afa83a..a13a7ee46 100644 --- a/vendor/github.com/imdario/mergo/map.go +++ b/vendor/github.com/imdario/mergo/map.go @@ -141,6 +141,9 @@ func MapWithOverwrite(dst, src interface{}, opts ...func(*Config)) error { } func _map(dst, src interface{}, opts ...func(*Config)) error { + if dst != nil && reflect.ValueOf(dst).Kind() != reflect.Ptr { + return ErrNonPointerAgument + } var ( vDst, vSrc reflect.Value err error diff --git a/vendor/github.com/imdario/mergo/merge.go b/vendor/github.com/imdario/mergo/merge.go index f8de6c543..8c2a8fcd9 100644 --- a/vendor/github.com/imdario/mergo/merge.go +++ b/vendor/github.com/imdario/mergo/merge.go @@ -13,23 +13,39 @@ import ( "reflect" ) -func hasExportedField(dst reflect.Value) (exported bool) { +func hasMergeableFields(dst reflect.Value) (exported bool) { for i, n := 0, dst.NumField(); i < n; i++ { field := dst.Type().Field(i) if field.Anonymous && dst.Field(i).Kind() == reflect.Struct { - exported = exported || hasExportedField(dst.Field(i)) - } else { + exported = exported || hasMergeableFields(dst.Field(i)) + } else if isExportedComponent(&field) { exported = exported || len(field.PkgPath) == 0 } } return } +func isExportedComponent(field *reflect.StructField) bool { + pkgPath := field.PkgPath + if len(pkgPath) > 0 { + return false + } + c := field.Name[0] + if 'a' <= c && c <= 'z' || c == '_' { + return false + } + return true +} + type Config struct { - Overwrite bool - AppendSlice bool - Transformers Transformers - overwriteWithEmptyValue bool + Overwrite bool + AppendSlice bool + TypeCheck bool + Transformers Transformers + overwriteWithEmptyValue bool + overwriteSliceWithEmptyValue bool + sliceDeepCopy bool + debug bool } type Transformers interface { @@ -41,8 +57,10 @@ type Transformers interface { // short circuiting on recursive types. func deepMerge(dst, src reflect.Value, visited map[uintptr]*visit, depth int, config *Config) (err error) { overwrite := config.Overwrite + typeCheck := config.TypeCheck overwriteWithEmptySrc := config.overwriteWithEmptyValue - config.overwriteWithEmptyValue = false + overwriteSliceWithEmptySrc := config.overwriteSliceWithEmptyValue + sliceDeepCopy := config.sliceDeepCopy if !src.IsValid() { return @@ -70,21 +88,34 @@ func deepMerge(dst, src reflect.Value, visited map[uintptr]*visit, depth int, co switch dst.Kind() { case reflect.Struct: - if hasExportedField(dst) { + if hasMergeableFields(dst) { for i, n := 0, dst.NumField(); i < n; i++ { if err = deepMerge(dst.Field(i), src.Field(i), visited, depth+1, config); err != nil { return } } } else { - if dst.CanSet() && (!isEmptyValue(src) || overwriteWithEmptySrc) && (overwrite || isEmptyValue(dst)) { + if dst.CanSet() && (isReflectNil(dst) || overwrite) && (!isEmptyValue(src) || overwriteWithEmptySrc) { dst.Set(src) } } case reflect.Map: if dst.IsNil() && !src.IsNil() { - dst.Set(reflect.MakeMap(dst.Type())) + if dst.CanSet() { + dst.Set(reflect.MakeMap(dst.Type())) + } else { + dst = src + return + } } + + if src.Kind() != reflect.Map { + if overwrite { + dst.Set(src) + } + return + } + for _, key := range src.MapKeys() { srcElement := src.MapIndex(key) if !srcElement.IsValid() { @@ -94,6 +125,9 @@ func deepMerge(dst, src reflect.Value, visited map[uintptr]*visit, depth int, co switch srcElement.Kind() { case reflect.Chan, reflect.Func, reflect.Map, reflect.Interface, reflect.Slice: if srcElement.IsNil() { + if overwrite { + dst.SetMapIndex(key, srcElement) + } continue } fallthrough @@ -128,13 +162,34 @@ func deepMerge(dst, src reflect.Value, visited map[uintptr]*visit, depth int, co dstSlice = reflect.ValueOf(dstElement.Interface()) } - if (!isEmptyValue(src) || overwriteWithEmptySrc) && (overwrite || isEmptyValue(dst)) && !config.AppendSlice { + if (!isEmptyValue(src) || overwriteWithEmptySrc || overwriteSliceWithEmptySrc) && (overwrite || isEmptyValue(dst)) && !config.AppendSlice && !sliceDeepCopy { + if typeCheck && srcSlice.Type() != dstSlice.Type() { + return fmt.Errorf("cannot override two slices with different type (%s, %s)", srcSlice.Type(), dstSlice.Type()) + } dstSlice = srcSlice } else if config.AppendSlice { if srcSlice.Type() != dstSlice.Type() { - return fmt.Errorf("cannot append two slice with different type (%s, %s)", srcSlice.Type(), dstSlice.Type()) + return fmt.Errorf("cannot append two slices with different type (%s, %s)", srcSlice.Type(), dstSlice.Type()) } dstSlice = reflect.AppendSlice(dstSlice, srcSlice) + } else if sliceDeepCopy { + i := 0 + for ; i < srcSlice.Len() && i < dstSlice.Len(); i++ { + srcElement := srcSlice.Index(i) + dstElement := dstSlice.Index(i) + + if srcElement.CanInterface() { + srcElement = reflect.ValueOf(srcElement.Interface()) + } + if dstElement.CanInterface() { + dstElement = reflect.ValueOf(dstElement.Interface()) + } + + if err = deepMerge(dstElement, srcElement, visited, depth+1, config); err != nil { + return + } + } + } dst.SetMapIndex(key, dstSlice) } @@ -143,7 +198,7 @@ func deepMerge(dst, src reflect.Value, visited map[uintptr]*visit, depth int, co continue } - if srcElement.IsValid() && (overwrite || (!dstElement.IsValid() || isEmptyValue(dstElement))) { + if srcElement.IsValid() && ((srcElement.Kind() != reflect.Ptr && overwrite) || !dstElement.IsValid() || isEmptyValue(dstElement)) { if dst.IsNil() { dst.Set(reflect.MakeMap(dst.Type())) } @@ -154,22 +209,41 @@ func deepMerge(dst, src reflect.Value, visited map[uintptr]*visit, depth int, co if !dst.CanSet() { break } - if (!isEmptyValue(src) || overwriteWithEmptySrc) && (overwrite || isEmptyValue(dst)) && !config.AppendSlice { + if (!isEmptyValue(src) || overwriteWithEmptySrc || overwriteSliceWithEmptySrc) && (overwrite || isEmptyValue(dst)) && !config.AppendSlice && !sliceDeepCopy { dst.Set(src) } else if config.AppendSlice { if src.Type() != dst.Type() { return fmt.Errorf("cannot append two slice with different type (%s, %s)", src.Type(), dst.Type()) } dst.Set(reflect.AppendSlice(dst, src)) + } else if sliceDeepCopy { + for i := 0; i < src.Len() && i < dst.Len(); i++ { + srcElement := src.Index(i) + dstElement := dst.Index(i) + if srcElement.CanInterface() { + srcElement = reflect.ValueOf(srcElement.Interface()) + } + if dstElement.CanInterface() { + dstElement = reflect.ValueOf(dstElement.Interface()) + } + + if err = deepMerge(dstElement, srcElement, visited, depth+1, config); err != nil { + return + } + } } case reflect.Ptr: fallthrough case reflect.Interface: - if src.IsNil() { + if isReflectNil(src) { + if overwriteWithEmptySrc && dst.CanSet() && src.Type().AssignableTo(dst.Type()) { + dst.Set(src) + } break } + if src.Kind() != reflect.Interface { - if dst.IsNil() || overwrite { + if dst.IsNil() || (src.Kind() != reflect.Ptr && overwrite) { if dst.CanSet() && (overwrite || isEmptyValue(dst)) { dst.Set(src) } @@ -186,18 +260,31 @@ func deepMerge(dst, src reflect.Value, visited map[uintptr]*visit, depth int, co } break } + if dst.IsNil() || overwrite { if dst.CanSet() && (overwrite || isEmptyValue(dst)) { dst.Set(src) } - } else if err = deepMerge(dst.Elem(), src.Elem(), visited, depth+1, config); err != nil { - return + break + } + + if dst.Elem().Kind() == src.Elem().Kind() { + if err = deepMerge(dst.Elem(), src.Elem(), visited, depth+1, config); err != nil { + return + } + break } default: - if dst.CanSet() && (!isEmptyValue(src) || overwriteWithEmptySrc) && (overwrite || isEmptyValue(dst)) { - dst.Set(src) + mustSet := (isEmptyValue(dst) || overwrite) && (!isEmptyValue(src) || overwriteWithEmptySrc) + if mustSet { + if dst.CanSet() { + dst.Set(src) + } else { + dst = src + } } } + return } @@ -209,7 +296,7 @@ func Merge(dst, src interface{}, opts ...func(*Config)) error { return merge(dst, src, opts...) } -// MergeWithOverwrite will do the same as Merge except that non-empty dst attributes will be overriden by +// MergeWithOverwrite will do the same as Merge except that non-empty dst attributes will be overridden by // non-empty src attribute values. // Deprecated: use Merge(…) with WithOverride func MergeWithOverwrite(dst, src interface{}, opts ...func(*Config)) error { @@ -228,12 +315,37 @@ func WithOverride(config *Config) { config.Overwrite = true } -// WithAppendSlice will make merge append slices instead of overwriting it +// WithOverwriteWithEmptyValue will make merge override non empty dst attributes with empty src attributes values. +func WithOverwriteWithEmptyValue(config *Config) { + config.Overwrite = true + config.overwriteWithEmptyValue = true +} + +// WithOverrideEmptySlice will make merge override empty dst slice with empty src slice. +func WithOverrideEmptySlice(config *Config) { + config.overwriteSliceWithEmptyValue = true +} + +// WithAppendSlice will make merge append slices instead of overwriting it. func WithAppendSlice(config *Config) { config.AppendSlice = true } +// WithTypeCheck will make merge check types while overwriting it (must be used with WithOverride). +func WithTypeCheck(config *Config) { + config.TypeCheck = true +} + +// WithSliceDeepCopy will merge slice element one by one with Overwrite flag. +func WithSliceDeepCopy(config *Config) { + config.sliceDeepCopy = true + config.Overwrite = true +} + func merge(dst, src interface{}, opts ...func(*Config)) error { + if dst != nil && reflect.ValueOf(dst).Kind() != reflect.Ptr { + return ErrNonPointerAgument + } var ( vDst, vSrc reflect.Value err error @@ -253,3 +365,16 @@ func merge(dst, src interface{}, opts ...func(*Config)) error { } return deepMerge(vDst, vSrc, make(map[uintptr]*visit), 0, config) } + +// IsReflectNil is the reflect value provided nil +func isReflectNil(v reflect.Value) bool { + k := v.Kind() + switch k { + case reflect.Interface, reflect.Slice, reflect.Chan, reflect.Func, reflect.Map, reflect.Ptr: + // Both interface and slice are nil if first word is 0. + // Both are always bigger than a word; assume flagIndir. + return v.IsNil() + default: + return false + } +} diff --git a/vendor/github.com/imdario/mergo/mergo.go b/vendor/github.com/imdario/mergo/mergo.go index a82fea2fd..3cc926c7f 100644 --- a/vendor/github.com/imdario/mergo/mergo.go +++ b/vendor/github.com/imdario/mergo/mergo.go @@ -20,6 +20,7 @@ var ( ErrNotSupported = errors.New("only structs and maps are supported") ErrExpectedMapAsDestination = errors.New("dst was expected to be a map") ErrExpectedStructAsDestination = errors.New("dst was expected to be a struct") + ErrNonPointerAgument = errors.New("dst must be a pointer") ) // During deepMerge, must keep track of checks that are @@ -75,23 +76,3 @@ func resolveValues(dst, src interface{}) (vDst, vSrc reflect.Value, err error) { } return } - -// Traverses recursively both values, assigning src's fields values to dst. -// The map argument tracks comparisons that have already been seen, which allows -// short circuiting on recursive types. -func deeper(dst, src reflect.Value, visited map[uintptr]*visit, depth int) (err error) { - if dst.CanAddr() { - addr := dst.UnsafeAddr() - h := 17 * addr - seen := visited[h] - typ := dst.Type() - for p := seen; p != nil; p = p.next { - if p.ptr == addr && p.typ == typ { - return nil - } - } - // Remember, remember... - visited[h] = &visit{addr, typ, seen} - } - return // TODO refactor -} diff --git a/vendor/github.com/opencontainers/selinux/go-selinux/rchcon.go b/vendor/github.com/opencontainers/selinux/go-selinux/rchcon.go index 897ecbac4..feb739d32 100644 --- a/vendor/github.com/opencontainers/selinux/go-selinux/rchcon.go +++ b/vendor/github.com/opencontainers/selinux/go-selinux/rchcon.go @@ -12,7 +12,7 @@ import ( func rchcon(fpath, label string) error { return pwalkdir.Walk(fpath, func(p string, _ fs.DirEntry, _ error) error { - e := setFileLabel(p, label) + e := lSetFileLabel(p, label) // Walk a file tree can race with removal, so ignore ENOENT. if errors.Is(e, os.ErrNotExist) { return nil diff --git a/vendor/github.com/opencontainers/selinux/go-selinux/rchcon_go115.go b/vendor/github.com/opencontainers/selinux/go-selinux/rchcon_go115.go index 2c8b033ce..ecc7abfac 100644 --- a/vendor/github.com/opencontainers/selinux/go-selinux/rchcon_go115.go +++ b/vendor/github.com/opencontainers/selinux/go-selinux/rchcon_go115.go @@ -11,7 +11,7 @@ import ( func rchcon(fpath, label string) error { return pwalk.Walk(fpath, func(p string, _ os.FileInfo, _ error) error { - e := setFileLabel(p, label) + e := lSetFileLabel(p, label) // Walk a file tree can race with removal, so ignore ENOENT. if errors.Is(e, os.ErrNotExist) { return nil diff --git a/vendor/github.com/vishvananda/netlink/.travis.yml b/vendor/github.com/vishvananda/netlink/.travis.yml deleted file mode 100644 index 7d14af4d6..000000000 --- a/vendor/github.com/vishvananda/netlink/.travis.yml +++ /dev/null @@ -1,19 +0,0 @@ -language: go -go: - - "1.10.x" - - "1.11.x" - - "1.12.x" -before_script: - # make sure we keep path in tact when we sudo - - sudo sed -i -e 's/^Defaults\tsecure_path.*$//' /etc/sudoers - # modprobe ip_gre or else the first gre device can't be deleted - - sudo modprobe ip_gre - # modprobe nf_conntrack for the conntrack testing - - sudo modprobe nf_conntrack - - sudo modprobe nf_conntrack_netlink - - sudo modprobe nf_conntrack_ipv4 - - sudo modprobe nf_conntrack_ipv6 - - sudo modprobe sch_hfsc -install: - - go get github.com/vishvananda/netns -go_import_path: github.com/vishvananda/netlink diff --git a/vendor/github.com/vishvananda/netlink/README.md b/vendor/github.com/vishvananda/netlink/README.md index a88e2f418..0128bc67d 100644 --- a/vendor/github.com/vishvananda/netlink/README.md +++ b/vendor/github.com/vishvananda/netlink/README.md @@ -1,6 +1,6 @@ # netlink - netlink library for go # -[![Build Status](https://travis-ci.org/vishvananda/netlink.png?branch=master)](https://travis-ci.org/vishvananda/netlink) [![GoDoc](https://godoc.org/github.com/vishvananda/netlink?status.svg)](https://godoc.org/github.com/vishvananda/netlink) +![Build Status](https://github.com/vishvananda/netlink/actions/workflows/main.yml/badge.svg) [![GoDoc](https://godoc.org/github.com/vishvananda/netlink?status.svg)](https://godoc.org/github.com/vishvananda/netlink) The netlink package provides a simple netlink library for go. Netlink is the interface a user-space program in linux uses to communicate with diff --git a/vendor/github.com/vishvananda/netlink/addr.go b/vendor/github.com/vishvananda/netlink/addr.go index f08c95696..653f540db 100644 --- a/vendor/github.com/vishvananda/netlink/addr.go +++ b/vendor/github.com/vishvananda/netlink/addr.go @@ -17,6 +17,7 @@ type Addr struct { Broadcast net.IP PreferedLft int ValidLft int + LinkIndex int } // String returns $ip/$netmask $label diff --git a/vendor/github.com/vishvananda/netlink/addr_linux.go b/vendor/github.com/vishvananda/netlink/addr_linux.go index 28746d5af..72862ce1f 100644 --- a/vendor/github.com/vishvananda/netlink/addr_linux.go +++ b/vendor/github.com/vishvananda/netlink/addr_linux.go @@ -11,9 +11,6 @@ import ( "golang.org/x/sys/unix" ) -// IFA_FLAGS is a u32 attribute. -const IFA_FLAGS = 0x8 - // AddrAdd will add an IP address to a link device. // // Equivalent to: `ip addr add $addr dev $link` @@ -125,7 +122,7 @@ func (h *Handle) addrHandle(link Link, addr *Addr, req *nl.NetlinkRequest) error } else { b := make([]byte, 4) native.PutUint32(b, uint32(addr.Flags)) - flagsData := nl.NewRtAttr(IFA_FLAGS, b) + flagsData := nl.NewRtAttr(unix.IFA_FLAGS, b) req.AddData(flagsData) } } @@ -156,10 +153,10 @@ func (h *Handle) addrHandle(link Link, addr *Addr, req *nl.NetlinkRequest) error // value should be "forever". To compensate for that, only add the attributes if at least one of the values is // non-zero, which means the caller has explicitly set them if addr.ValidLft > 0 || addr.PreferedLft > 0 { - cachedata := nl.IfaCacheInfo{ - IfaValid: uint32(addr.ValidLft), - IfaPrefered: uint32(addr.PreferedLft), - } + cachedata := nl.IfaCacheInfo{unix.IfaCacheinfo{ + Valid: uint32(addr.ValidLft), + Prefered: uint32(addr.PreferedLft), + }} req.AddData(nl.NewRtAttr(unix.IFA_CACHEINFO, cachedata.Serialize())) } @@ -179,7 +176,7 @@ func AddrList(link Link, family int) ([]Addr, error) { // The list can be filtered by link and ip family. func (h *Handle) AddrList(link Link, family int) ([]Addr, error) { req := h.newNetlinkRequest(unix.RTM_GETADDR, unix.NLM_F_DUMP) - msg := nl.NewIfInfomsg(family) + msg := nl.NewIfAddrmsg(family) req.AddData(msg) msgs, err := req.Execute(unix.NETLINK_ROUTE, unix.RTM_NEWADDR) @@ -196,12 +193,12 @@ func (h *Handle) AddrList(link Link, family int) ([]Addr, error) { var res []Addr for _, m := range msgs { - addr, msgFamily, ifindex, err := parseAddr(m) + addr, msgFamily, err := parseAddr(m) if err != nil { return res, err } - if link != nil && ifindex != indexFilter { + if link != nil && addr.LinkIndex != indexFilter { // Ignore messages from other interfaces continue } @@ -216,11 +213,11 @@ func (h *Handle) AddrList(link Link, family int) ([]Addr, error) { return res, nil } -func parseAddr(m []byte) (addr Addr, family, index int, err error) { +func parseAddr(m []byte) (addr Addr, family int, err error) { msg := nl.DeserializeIfAddrmsg(m) family = -1 - index = -1 + addr.LinkIndex = -1 attrs, err1 := nl.ParseRouteAttr(m[msg.Len():]) if err1 != nil { @@ -229,7 +226,7 @@ func parseAddr(m []byte) (addr Addr, family, index int, err error) { } family = int(msg.Family) - index = int(msg.Index) + addr.LinkIndex = int(msg.Index) var local, dst *net.IPNet for _, attr := range attrs { @@ -254,12 +251,12 @@ func parseAddr(m []byte) (addr Addr, family, index int, err error) { addr.Broadcast = attr.Value case unix.IFA_LABEL: addr.Label = string(attr.Value[:len(attr.Value)-1]) - case IFA_FLAGS: + case unix.IFA_FLAGS: addr.Flags = int(native.Uint32(attr.Value[0:4])) - case nl.IFA_CACHEINFO: + case unix.IFA_CACHEINFO: ci := nl.DeserializeIfaCacheInfo(attr.Value) - addr.PreferedLft = int(ci.IfaPrefered) - addr.ValidLft = int(ci.IfaValid) + addr.PreferedLft = int(ci.Prefered) + addr.ValidLft = int(ci.Valid) } } @@ -271,7 +268,7 @@ func parseAddr(m []byte) (addr Addr, family, index int, err error) { // But obviously, as there are IPv6 PtP addresses, too, // IFA_LOCAL should also be handled for IPv6. if local != nil { - if family == FAMILY_V4 && local.IP.Equal(dst.IP) { + if family == FAMILY_V4 && dst != nil && local.IP.Equal(dst.IP) { addr.IPNet = dst } else { addr.IPNet = local @@ -299,13 +296,13 @@ type AddrUpdate struct { // AddrSubscribe takes a chan down which notifications will be sent // when addresses change. Close the 'done' chan to stop subscription. func AddrSubscribe(ch chan<- AddrUpdate, done <-chan struct{}) error { - return addrSubscribeAt(netns.None(), netns.None(), ch, done, nil, false, 0) + return addrSubscribeAt(netns.None(), netns.None(), ch, done, nil, false, 0, nil) } // AddrSubscribeAt works like AddrSubscribe plus it allows the caller // to choose the network namespace in which to subscribe (ns). func AddrSubscribeAt(ns netns.NsHandle, ch chan<- AddrUpdate, done <-chan struct{}) error { - return addrSubscribeAt(ns, netns.None(), ch, done, nil, false, 0) + return addrSubscribeAt(ns, netns.None(), ch, done, nil, false, 0, nil) } // AddrSubscribeOptions contains a set of options to use with @@ -315,6 +312,7 @@ type AddrSubscribeOptions struct { ErrorCallback func(error) ListExisting bool ReceiveBufferSize int + ReceiveTimeout *unix.Timeval } // AddrSubscribeWithOptions work like AddrSubscribe but enable to @@ -325,14 +323,20 @@ func AddrSubscribeWithOptions(ch chan<- AddrUpdate, done <-chan struct{}, option none := netns.None() options.Namespace = &none } - return addrSubscribeAt(*options.Namespace, netns.None(), ch, done, options.ErrorCallback, options.ListExisting, options.ReceiveBufferSize) + return addrSubscribeAt(*options.Namespace, netns.None(), ch, done, options.ErrorCallback, options.ListExisting, options.ReceiveBufferSize, options.ReceiveTimeout) } -func addrSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- AddrUpdate, done <-chan struct{}, cberr func(error), listExisting bool, rcvbuf int) error { +func addrSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- AddrUpdate, done <-chan struct{}, cberr func(error), listExisting bool, rcvbuf int, rcvTimeout *unix.Timeval) error { s, err := nl.SubscribeAt(newNs, curNs, unix.NETLINK_ROUTE, unix.RTNLGRP_IPV4_IFADDR, unix.RTNLGRP_IPV6_IFADDR) if err != nil { return err } + if rcvTimeout != nil { + if err := s.SetReceiveTimeout(rcvTimeout); err != nil { + return err + } + } + if done != nil { go func() { <-done @@ -360,7 +364,8 @@ func addrSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- AddrUpdate, done <-c msgs, from, err := s.Receive() if err != nil { if cberr != nil { - cberr(err) + cberr(fmt.Errorf("Receive failed: %v", + err)) } return } @@ -375,7 +380,6 @@ func addrSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- AddrUpdate, done <-c continue } if m.Header.Type == unix.NLMSG_ERROR { - native := nl.NativeEndian() error := int32(native.Uint32(m.Data[0:4])) if error == 0 { continue @@ -394,7 +398,7 @@ func addrSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- AddrUpdate, done <-c continue } - addr, _, ifindex, err := parseAddr(m.Data) + addr, _, err := parseAddr(m.Data) if err != nil { if cberr != nil { cberr(fmt.Errorf("could not parse address: %v", err)) @@ -403,7 +407,7 @@ func addrSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- AddrUpdate, done <-c } ch <- AddrUpdate{LinkAddress: *addr.IPNet, - LinkIndex: ifindex, + LinkIndex: addr.LinkIndex, NewAddr: msgType == unix.RTM_NEWADDR, Flags: addr.Flags, Scope: addr.Scope, diff --git a/vendor/github.com/vishvananda/netlink/bpf_linux.go b/vendor/github.com/vishvananda/netlink/bpf_linux.go index 6631626bf..96befbfe0 100644 --- a/vendor/github.com/vishvananda/netlink/bpf_linux.go +++ b/vendor/github.com/vishvananda/netlink/bpf_linux.go @@ -16,6 +16,30 @@ const ( BPF_PROG_TYPE_SCHED_ACT BPF_PROG_TYPE_TRACEPOINT BPF_PROG_TYPE_XDP + BPF_PROG_TYPE_PERF_EVENT + BPF_PROG_TYPE_CGROUP_SKB + BPF_PROG_TYPE_CGROUP_SOCK + BPF_PROG_TYPE_LWT_IN + BPF_PROG_TYPE_LWT_OUT + BPF_PROG_TYPE_LWT_XMIT + BPF_PROG_TYPE_SOCK_OPS + BPF_PROG_TYPE_SK_SKB + BPF_PROG_TYPE_CGROUP_DEVICE + BPF_PROG_TYPE_SK_MSG + BPF_PROG_TYPE_RAW_TRACEPOINT + BPF_PROG_TYPE_CGROUP_SOCK_ADDR + BPF_PROG_TYPE_LWT_SEG6LOCAL + BPF_PROG_TYPE_LIRC_MODE2 + BPF_PROG_TYPE_SK_REUSEPORT + BPF_PROG_TYPE_FLOW_DISSECTOR + BPF_PROG_TYPE_CGROUP_SYSCTL + BPF_PROG_TYPE_RAW_TRACEPOINT_WRITABLE + BPF_PROG_TYPE_CGROUP_SOCKOPT + BPF_PROG_TYPE_TRACING + BPF_PROG_TYPE_STRUCT_OPS + BPF_PROG_TYPE_EXT + BPF_PROG_TYPE_LSM + BPF_PROG_TYPE_SK_LOOKUP ) type BPFAttr struct { diff --git a/vendor/github.com/vishvananda/netlink/class.go b/vendor/github.com/vishvananda/netlink/class.go index dcc22d9e9..10ceffed8 100644 --- a/vendor/github.com/vishvananda/netlink/class.go +++ b/vendor/github.com/vishvananda/netlink/class.go @@ -132,7 +132,10 @@ func (class *GenericClass) Type() string { return class.ClassType } -// ServiceCurve is the way the HFSC curve are represented +// ServiceCurve is a nondecreasing function of some time unit, returning the amount of service +// (an allowed or allocated amount of bandwidth) at some specific point in time. The purpose of it +// should be subconsciously obvious: if a class was allowed to transfer not less than the amount +// specified by its service curve, then the service curve is not violated. type ServiceCurve struct { m1 uint32 d uint32 @@ -144,6 +147,21 @@ func (c *ServiceCurve) Attrs() (uint32, uint32, uint32) { return c.m1, c.d, c.m2 } +// Burst returns the burst rate (m1) of the curve +func (c *ServiceCurve) Burst() uint32 { + return c.m1 +} + +// Delay return the delay (d) of the curve +func (c *ServiceCurve) Delay() uint32 { + return c.d +} + +// Rate returns the rate (m2) of the curve +func (c *ServiceCurve) Rate() uint32 { + return c.m2 +} + // HfscClass is a representation of the HFSC class type HfscClass struct { ClassAttrs @@ -152,35 +170,44 @@ type HfscClass struct { Usc ServiceCurve } -// SetUsc sets the Usc curve +// SetUsc sets the USC curve. The bandwidth (m1 and m2) is specified in bits and the delay in +// seconds. func (hfsc *HfscClass) SetUsc(m1 uint32, d uint32, m2 uint32) { - hfsc.Usc = ServiceCurve{m1: m1 / 8, d: d, m2: m2 / 8} + hfsc.Usc = ServiceCurve{m1: m1, d: d, m2: m2} } -// SetFsc sets the Fsc curve +// SetFsc sets the Fsc curve. The bandwidth (m1 and m2) is specified in bits and the delay in +// seconds. func (hfsc *HfscClass) SetFsc(m1 uint32, d uint32, m2 uint32) { - hfsc.Fsc = ServiceCurve{m1: m1 / 8, d: d, m2: m2 / 8} + hfsc.Fsc = ServiceCurve{m1: m1, d: d, m2: m2} } -// SetRsc sets the Rsc curve +// SetRsc sets the Rsc curve. The bandwidth (m1 and m2) is specified in bits and the delay in +// seconds. func (hfsc *HfscClass) SetRsc(m1 uint32, d uint32, m2 uint32) { - hfsc.Rsc = ServiceCurve{m1: m1 / 8, d: d, m2: m2 / 8} + hfsc.Rsc = ServiceCurve{m1: m1, d: d, m2: m2} } -// SetSC implements the SC from the tc CLI +// SetSC implements the SC from the `tc` CLI. This function behaves the same as if one would set the +// USC through the `tc` command-line tool. This means bandwidth (m1 and m2) is specified in bits and +// the delay in ms. func (hfsc *HfscClass) SetSC(m1 uint32, d uint32, m2 uint32) { - hfsc.Rsc = ServiceCurve{m1: m1 / 8, d: d, m2: m2 / 8} - hfsc.Fsc = ServiceCurve{m1: m1 / 8, d: d, m2: m2 / 8} + hfsc.SetRsc(m1, d, m2) + hfsc.SetFsc(m1, d, m2) } -// SetUL implements the UL from the tc CLI +// SetUL implements the UL from the `tc` CLI. This function behaves the same as if one would set the +// USC through the `tc` command-line tool. This means bandwidth (m1 and m2) is specified in bits and +// the delay in ms. func (hfsc *HfscClass) SetUL(m1 uint32, d uint32, m2 uint32) { - hfsc.Usc = ServiceCurve{m1: m1 / 8, d: d, m2: m2 / 8} + hfsc.SetUsc(m1, d, m2) } -// SetLS implements the LS from the tc CLI +// SetLS implements the LS from the `tc` CLI. This function behaves the same as if one would set the +// USC through the `tc` command-line tool. This means bandwidth (m1 and m2) is specified in bits and +// the delay in ms. func (hfsc *HfscClass) SetLS(m1 uint32, d uint32, m2 uint32) { - hfsc.Fsc = ServiceCurve{m1: m1 / 8, d: d, m2: m2 / 8} + hfsc.SetFsc(m1, d, m2) } // NewHfscClass returns a new HFSC struct with the set parameters @@ -193,6 +220,7 @@ func NewHfscClass(attrs ClassAttrs) *HfscClass { } } +// String() returns a string that contains the information and attributes of the HFSC class func (hfsc *HfscClass) String() string { return fmt.Sprintf( "{%s -- {RSC: {m1=%d d=%d m2=%d}} {FSC: {m1=%d d=%d m2=%d}} {USC: {m1=%d d=%d m2=%d}}}", diff --git a/vendor/github.com/vishvananda/netlink/class_linux.go b/vendor/github.com/vishvananda/netlink/class_linux.go index 31091e501..6f542ba4e 100644 --- a/vendor/github.com/vishvananda/netlink/class_linux.go +++ b/vendor/github.com/vishvananda/netlink/class_linux.go @@ -43,12 +43,12 @@ func NewHtbClass(attrs ClassAttrs, cattrs HtbClassAttrs) *HtbClass { if buffer == 0 { buffer = uint32(float64(rate)/Hz() + float64(mtu)) } - buffer = uint32(Xmittime(rate, buffer)) + buffer = Xmittime(rate, buffer) if cbuffer == 0 { cbuffer = uint32(float64(ceil)/Hz() + float64(mtu)) } - cbuffer = uint32(Xmittime(ceil, cbuffer)) + cbuffer = Xmittime(ceil, cbuffer) return &HtbClass{ ClassAttrs: attrs, @@ -56,9 +56,9 @@ func NewHtbClass(attrs ClassAttrs, cattrs HtbClassAttrs) *HtbClass { Ceil: ceil, Buffer: buffer, Cbuffer: cbuffer, - Quantum: 10, Level: 0, - Prio: 0, + Prio: cattrs.Prio, + Quantum: cattrs.Quantum, } } @@ -176,12 +176,21 @@ func classPayload(req *nl.NetlinkRequest, class Class) error { options.AddRtAttr(nl.TCA_HTB_PARMS, opt.Serialize()) options.AddRtAttr(nl.TCA_HTB_RTAB, SerializeRtab(rtab)) options.AddRtAttr(nl.TCA_HTB_CTAB, SerializeRtab(ctab)) + if htb.Rate >= uint64(1<<32) { + options.AddRtAttr(nl.TCA_HTB_RATE64, nl.Uint64Attr(htb.Rate)) + } + if htb.Ceil >= uint64(1<<32) { + options.AddRtAttr(nl.TCA_HTB_CEIL64, nl.Uint64Attr(htb.Ceil)) + } case "hfsc": hfsc := class.(*HfscClass) opt := nl.HfscCopt{} - opt.Rsc.Set(hfsc.Rsc.Attrs()) - opt.Fsc.Set(hfsc.Fsc.Attrs()) - opt.Usc.Set(hfsc.Usc.Attrs()) + rm1, rd, rm2 := hfsc.Rsc.Attrs() + opt.Rsc.Set(rm1/8, rd, rm2/8) + fm1, fd, fm2 := hfsc.Fsc.Attrs() + opt.Fsc.Set(fm1/8, fd, fm2/8) + um1, ud, um2 := hfsc.Usc.Attrs() + opt.Usc.Set(um1/8, ud, um2/8) options.AddRtAttr(nl.TCA_HFSC_RSC, nl.SerializeHfscCurve(&opt.Rsc)) options.AddRtAttr(nl.TCA_HFSC_FSC, nl.SerializeHfscCurve(&opt.Fsc)) options.AddRtAttr(nl.TCA_HFSC_USC, nl.SerializeHfscCurve(&opt.Usc)) @@ -303,6 +312,10 @@ func parseHtbClassData(class Class, data []syscall.NetlinkRouteAttr) (bool, erro htb.Quantum = opt.Quantum htb.Level = opt.Level htb.Prio = opt.Prio + case nl.TCA_HTB_RATE64: + htb.Rate = native.Uint64(datum.Value[0:8]) + case nl.TCA_HTB_CEIL64: + htb.Ceil = native.Uint64(datum.Value[0:8]) } } return detailed, nil @@ -315,11 +328,11 @@ func parseHfscClassData(class Class, data []syscall.NetlinkRouteAttr) (bool, err m1, d, m2 := nl.DeserializeHfscCurve(datum.Value).Attrs() switch datum.Attr.Type { case nl.TCA_HFSC_RSC: - hfsc.Rsc = ServiceCurve{m1: m1, d: d, m2: m2} + hfsc.Rsc = ServiceCurve{m1: m1 * 8, d: d, m2: m2 * 8} case nl.TCA_HFSC_FSC: - hfsc.Fsc = ServiceCurve{m1: m1, d: d, m2: m2} + hfsc.Fsc = ServiceCurve{m1: m1 * 8, d: d, m2: m2 * 8} case nl.TCA_HFSC_USC: - hfsc.Usc = ServiceCurve{m1: m1, d: d, m2: m2} + hfsc.Usc = ServiceCurve{m1: m1 * 8, d: d, m2: m2 * 8} } } return detailed, nil @@ -328,7 +341,6 @@ func parseHfscClassData(class Class, data []syscall.NetlinkRouteAttr) (bool, err func parseTcStats(data []byte) (*ClassStatistics, error) { buf := &bytes.Buffer{} buf.Write(data) - native := nl.NativeEndian() tcStats := &tcStats{} if err := binary.Read(buf, native, tcStats); err != nil { return nil, err @@ -350,7 +362,6 @@ func parseTcStats(data []byte) (*ClassStatistics, error) { func parseGnetStats(data []byte, gnetStats interface{}) error { buf := &bytes.Buffer{} buf.Write(data) - native := nl.NativeEndian() return binary.Read(buf, native, gnetStats) } diff --git a/vendor/github.com/vishvananda/netlink/conntrack_linux.go b/vendor/github.com/vishvananda/netlink/conntrack_linux.go index 4bff0dcba..03ea1b98f 100644 --- a/vendor/github.com/vishvananda/netlink/conntrack_linux.go +++ b/vendor/github.com/vishvananda/netlink/conntrack_linux.go @@ -6,6 +6,7 @@ import ( "errors" "fmt" "net" + "time" "github.com/vishvananda/netlink/nl" "golang.org/x/sys/unix" @@ -145,16 +146,23 @@ type ConntrackFlow struct { Forward ipTuple Reverse ipTuple Mark uint32 + TimeStart uint64 + TimeStop uint64 + TimeOut uint32 } func (s *ConntrackFlow) String() string { // conntrack cmd output: // udp 17 src=127.0.0.1 dst=127.0.0.1 sport=4001 dport=1234 packets=5 bytes=532 [UNREPLIED] src=127.0.0.1 dst=127.0.0.1 sport=1234 dport=4001 packets=10 bytes=1078 mark=0 - return fmt.Sprintf("%s\t%d src=%s dst=%s sport=%d dport=%d packets=%d bytes=%d\tsrc=%s dst=%s sport=%d dport=%d packets=%d bytes=%d mark=%d", + // start=2019-07-26 01:26:21.557800506 +0000 UTC stop=1970-01-01 00:00:00 +0000 UTC timeout=30(sec) + start := time.Unix(0, int64(s.TimeStart)) + stop := time.Unix(0, int64(s.TimeStop)) + timeout := int32(s.TimeOut) + return fmt.Sprintf("%s\t%d src=%s dst=%s sport=%d dport=%d packets=%d bytes=%d\tsrc=%s dst=%s sport=%d dport=%d packets=%d bytes=%d mark=0x%x start=%v stop=%v timeout=%d(sec)", nl.L4ProtoMap[s.Forward.Protocol], s.Forward.Protocol, s.Forward.SrcIP.String(), s.Forward.DstIP.String(), s.Forward.SrcPort, s.Forward.DstPort, s.Forward.Packets, s.Forward.Bytes, s.Reverse.SrcIP.String(), s.Reverse.DstIP.String(), s.Reverse.SrcPort, s.Reverse.DstPort, s.Reverse.Packets, s.Reverse.Bytes, - s.Mark) + s.Mark, start, stop, timeout) } // This method parse the ip tuple structure @@ -174,25 +182,43 @@ func parseIpTuple(reader *bytes.Reader, tpl *ipTuple) uint8 { tpl.DstIP = v } } - // Skip the next 4 bytes nl.NLA_F_NESTED|nl.CTA_TUPLE_PROTO - reader.Seek(4, seekCurrent) - _, t, _, v := parseNfAttrTLV(reader) + // Get total length of nested protocol-specific info. + _, _, protoInfoTotalLen := parseNfAttrTL(reader) + _, t, l, v := parseNfAttrTLV(reader) + // Track the number of bytes read. + protoInfoBytesRead := uint16(nl.SizeofNfattr) + l if t == nl.CTA_PROTO_NUM { tpl.Protocol = uint8(v[0]) } - // Skip some padding 3 bytes + // We only parse TCP & UDP headers. Skip the others. + if tpl.Protocol != 6 && tpl.Protocol != 17 { + // skip the rest + bytesRemaining := protoInfoTotalLen - protoInfoBytesRead + reader.Seek(int64(bytesRemaining), seekCurrent) + return tpl.Protocol + } + // Skip 3 bytes of padding reader.Seek(3, seekCurrent) + protoInfoBytesRead += 3 for i := 0; i < 2; i++ { _, t, _ := parseNfAttrTL(reader) + protoInfoBytesRead += uint16(nl.SizeofNfattr) switch t { case nl.CTA_PROTO_SRC_PORT: parseBERaw16(reader, &tpl.SrcPort) + protoInfoBytesRead += 2 case nl.CTA_PROTO_DST_PORT: parseBERaw16(reader, &tpl.DstPort) + protoInfoBytesRead += 2 } - // Skip some padding 2 byte + // Skip 2 bytes of padding reader.Seek(2, seekCurrent) + protoInfoBytesRead += 2 } + // Skip any remaining/unknown parts of the message + bytesRemaining := protoInfoTotalLen - protoInfoBytesRead + reader.Seek(int64(bytesRemaining), seekCurrent) + return tpl.Protocol } @@ -211,10 +237,14 @@ func parseNfAttrTL(r *bytes.Reader) (isNested bool, attrType, len uint16) { binary.Read(r, nl.NativeEndian(), &attrType) isNested = (attrType & nl.NLA_F_NESTED) == nl.NLA_F_NESTED attrType = attrType & (nl.NLA_F_NESTED - 1) - return isNested, attrType, len } +func skipNfAttrValue(r *bytes.Reader, len uint16) { + len = (len + nl.NLA_ALIGNTO - 1) & ^(nl.NLA_ALIGNTO - 1) + r.Seek(int64(len), seekCurrent) +} + func parseBERaw16(r *bytes.Reader, v *uint16) { binary.Read(r, binary.BigEndian, v) } @@ -241,6 +271,36 @@ func parseByteAndPacketCounters(r *bytes.Reader) (bytes, packets uint64) { return } +// when the flow is alive, only the timestamp_start is returned in structure +func parseTimeStamp(r *bytes.Reader, readSize uint16) (tstart, tstop uint64) { + var numTimeStamps int + oneItem := nl.SizeofNfattr + 8 // 4 bytes attr header + 8 bytes timestamp + if readSize == uint16(oneItem) { + numTimeStamps = 1 + } else if readSize == 2*uint16(oneItem) { + numTimeStamps = 2 + } else { + return + } + for i := 0; i < numTimeStamps; i++ { + switch _, t, _ := parseNfAttrTL(r); t { + case nl.CTA_TIMESTAMP_START: + parseBERaw64(r, &tstart) + case nl.CTA_TIMESTAMP_STOP: + parseBERaw64(r, &tstop) + default: + return + } + } + return + +} + +func parseTimeOut(r *bytes.Reader) (ttimeout uint32) { + parseBERaw32(r, &ttimeout) + return +} + func parseConnectionMark(r *bytes.Reader) (mark uint32) { parseBERaw32(r, &mark) return @@ -266,25 +326,37 @@ func parseRawData(data []byte) *ConntrackFlow { if nested, t, l := parseNfAttrTL(reader); nested { switch t { case nl.CTA_TUPLE_ORIG: - if nested, t, _ = parseNfAttrTL(reader); nested && t == nl.CTA_TUPLE_IP { + if nested, t, l = parseNfAttrTL(reader); nested && t == nl.CTA_TUPLE_IP { parseIpTuple(reader, &s.Forward) } case nl.CTA_TUPLE_REPLY: - if nested, t, _ = parseNfAttrTL(reader); nested && t == nl.CTA_TUPLE_IP { + if nested, t, l = parseNfAttrTL(reader); nested && t == nl.CTA_TUPLE_IP { parseIpTuple(reader, &s.Reverse) } else { // Header not recognized skip it - reader.Seek(int64(l), seekCurrent) + skipNfAttrValue(reader, l) } case nl.CTA_COUNTERS_ORIG: s.Forward.Bytes, s.Forward.Packets = parseByteAndPacketCounters(reader) case nl.CTA_COUNTERS_REPLY: s.Reverse.Bytes, s.Reverse.Packets = parseByteAndPacketCounters(reader) + case nl.CTA_TIMESTAMP: + s.TimeStart, s.TimeStop = parseTimeStamp(reader, l) + case nl.CTA_PROTOINFO: + skipNfAttrValue(reader, l) + default: + skipNfAttrValue(reader, l) } } else { switch t { case nl.CTA_MARK: s.Mark = parseConnectionMark(reader) + case nl.CTA_TIMEOUT: + s.TimeOut = parseTimeOut(reader) + case nl.CTA_STATUS, nl.CTA_USE, nl.CTA_ID: + skipNfAttrValue(reader, l) + default: + skipNfAttrValue(reader, l) } } } @@ -318,18 +390,25 @@ func parseRawData(data []byte) *ConntrackFlow { // --mask-src ip Source mask address // --mask-dst ip Destination mask address +// Layer 4 Protocol common parameters and options: +// TCP, UDP, SCTP, UDPLite and DCCP +// --sport, --orig-port-src port Source port in original direction +// --dport, --orig-port-dst port Destination port in original direction + // Filter types type ConntrackFilterType uint8 const ( - ConntrackOrigSrcIP = iota // -orig-src ip Source address from original direction - ConntrackOrigDstIP // -orig-dst ip Destination address from original direction - ConntrackReplySrcIP // --reply-src ip Reply Source IP - ConntrackReplyDstIP // --reply-dst ip Reply Destination IP - ConntrackReplyAnyIP // Match source or destination reply IP - ConntrackNatSrcIP = ConntrackReplySrcIP // deprecated use instead ConntrackReplySrcIP - ConntrackNatDstIP = ConntrackReplyDstIP // deprecated use instead ConntrackReplyDstIP - ConntrackNatAnyIP = ConntrackReplyAnyIP // deprecated use instaed ConntrackReplyAnyIP + ConntrackOrigSrcIP = iota // -orig-src ip Source address from original direction + ConntrackOrigDstIP // -orig-dst ip Destination address from original direction + ConntrackReplySrcIP // --reply-src ip Reply Source IP + ConntrackReplyDstIP // --reply-dst ip Reply Destination IP + ConntrackReplyAnyIP // Match source or destination reply IP + ConntrackOrigSrcPort // --orig-port-src port Source port in original direction + ConntrackOrigDstPort // --orig-port-dst port Destination port in original direction + ConntrackNatSrcIP = ConntrackReplySrcIP // deprecated use instead ConntrackReplySrcIP + ConntrackNatDstIP = ConntrackReplyDstIP // deprecated use instead ConntrackReplyDstIP + ConntrackNatAnyIP = ConntrackReplyAnyIP // deprecated use instead ConntrackReplyAnyIP ) type CustomConntrackFilter interface { @@ -339,53 +418,117 @@ type CustomConntrackFilter interface { } type ConntrackFilter struct { - ipFilter map[ConntrackFilterType]net.IP + ipNetFilter map[ConntrackFilterType]*net.IPNet + portFilter map[ConntrackFilterType]uint16 + protoFilter uint8 +} + +// AddIPNet adds a IP subnet to the conntrack filter +func (f *ConntrackFilter) AddIPNet(tp ConntrackFilterType, ipNet *net.IPNet) error { + if ipNet == nil { + return fmt.Errorf("Filter attribute empty") + } + if f.ipNetFilter == nil { + f.ipNetFilter = make(map[ConntrackFilterType]*net.IPNet) + } + if _, ok := f.ipNetFilter[tp]; ok { + return errors.New("Filter attribute already present") + } + f.ipNetFilter[tp] = ipNet + return nil } // AddIP adds an IP to the conntrack filter func (f *ConntrackFilter) AddIP(tp ConntrackFilterType, ip net.IP) error { - if f.ipFilter == nil { - f.ipFilter = make(map[ConntrackFilterType]net.IP) + if ip == nil { + return fmt.Errorf("Filter attribute empty") } - if _, ok := f.ipFilter[tp]; ok { + return f.AddIPNet(tp, NewIPNet(ip)) +} + +// AddPort adds a Port to the conntrack filter if the Layer 4 protocol allows it +func (f *ConntrackFilter) AddPort(tp ConntrackFilterType, port uint16) error { + switch f.protoFilter { + // TCP, UDP, DCCP, SCTP, UDPLite + case 6, 17, 33, 132, 136: + default: + return fmt.Errorf("Filter attribute not available without a valid Layer 4 protocol: %d", f.protoFilter) + } + + if f.portFilter == nil { + f.portFilter = make(map[ConntrackFilterType]uint16) + } + if _, ok := f.portFilter[tp]; ok { return errors.New("Filter attribute already present") } - f.ipFilter[tp] = ip + f.portFilter[tp] = port + return nil +} + +// AddProtocol adds the Layer 4 protocol to the conntrack filter +func (f *ConntrackFilter) AddProtocol(proto uint8) error { + if f.protoFilter != 0 { + return errors.New("Filter attribute already present") + } + f.protoFilter = proto return nil } // MatchConntrackFlow applies the filter to the flow and returns true if the flow matches the filter // false otherwise func (f *ConntrackFilter) MatchConntrackFlow(flow *ConntrackFlow) bool { - if len(f.ipFilter) == 0 { + if len(f.ipNetFilter) == 0 && len(f.portFilter) == 0 && f.protoFilter == 0 { // empty filter always not match return false } - match := true - // -orig-src ip Source address from original direction - if elem, found := f.ipFilter[ConntrackOrigSrcIP]; found { - match = match && elem.Equal(flow.Forward.SrcIP) + // -p, --protonum proto Layer 4 Protocol, eg. 'tcp' + if f.protoFilter != 0 && flow.Forward.Protocol != f.protoFilter { + // different Layer 4 protocol always not match + return false } - // -orig-dst ip Destination address from original direction - if elem, found := f.ipFilter[ConntrackOrigDstIP]; match && found { - match = match && elem.Equal(flow.Forward.DstIP) - } + match := true - // -src-nat ip Source NAT ip - if elem, found := f.ipFilter[ConntrackReplySrcIP]; match && found { - match = match && elem.Equal(flow.Reverse.SrcIP) - } + // IP conntrack filter + if len(f.ipNetFilter) > 0 { + // -orig-src ip Source address from original direction + if elem, found := f.ipNetFilter[ConntrackOrigSrcIP]; found { + match = match && elem.Contains(flow.Forward.SrcIP) + } + + // -orig-dst ip Destination address from original direction + if elem, found := f.ipNetFilter[ConntrackOrigDstIP]; match && found { + match = match && elem.Contains(flow.Forward.DstIP) + } + + // -src-nat ip Source NAT ip + if elem, found := f.ipNetFilter[ConntrackReplySrcIP]; match && found { + match = match && elem.Contains(flow.Reverse.SrcIP) + } - // -dst-nat ip Destination NAT ip - if elem, found := f.ipFilter[ConntrackReplyDstIP]; match && found { - match = match && elem.Equal(flow.Reverse.DstIP) + // -dst-nat ip Destination NAT ip + if elem, found := f.ipNetFilter[ConntrackReplyDstIP]; match && found { + match = match && elem.Contains(flow.Reverse.DstIP) + } + + // Match source or destination reply IP + if elem, found := f.ipNetFilter[ConntrackReplyAnyIP]; match && found { + match = match && (elem.Contains(flow.Reverse.SrcIP) || elem.Contains(flow.Reverse.DstIP)) + } } - // Match source or destination reply IP - if elem, found := f.ipFilter[ConntrackReplyAnyIP]; match && found { - match = match && (elem.Equal(flow.Reverse.SrcIP) || elem.Equal(flow.Reverse.DstIP)) + // Layer 4 Port filter + if len(f.portFilter) > 0 { + // -orig-port-src port Source port from original direction + if elem, found := f.portFilter[ConntrackOrigSrcPort]; match && found { + match = match && elem == flow.Forward.SrcPort + } + + // -orig-port-dst port Destination port from original direction + if elem, found := f.portFilter[ConntrackOrigDstPort]; match && found { + match = match && elem == flow.Forward.DstPort + } } return match diff --git a/vendor/github.com/vishvananda/netlink/devlink_linux.go b/vendor/github.com/vishvananda/netlink/devlink_linux.go index 29b3f8ec1..358b232c6 100644 --- a/vendor/github.com/vishvananda/netlink/devlink_linux.go +++ b/vendor/github.com/vishvananda/netlink/devlink_linux.go @@ -1,9 +1,11 @@ package netlink import ( + "fmt" + "net" + "strings" "syscall" - "fmt" "github.com/vishvananda/netlink/nl" "golang.org/x/sys/unix" ) @@ -27,6 +29,61 @@ type DevlinkDevice struct { Attrs DevlinkDevAttrs } +// DevlinkPortFn represents port function and its attributes +type DevlinkPortFn struct { + HwAddr net.HardwareAddr + State uint8 + OpState uint8 +} + +// DevlinkPortFnSetAttrs represents attributes to set +type DevlinkPortFnSetAttrs struct { + FnAttrs DevlinkPortFn + HwAddrValid bool + StateValid bool +} + +// DevlinkPort represents port and its attributes +type DevlinkPort struct { + BusName string + DeviceName string + PortIndex uint32 + PortType uint16 + NetdeviceName string + NetdevIfIndex uint32 + RdmaDeviceName string + PortFlavour uint16 + Fn *DevlinkPortFn +} + +type DevLinkPortAddAttrs struct { + Controller uint32 + SfNumber uint32 + PortIndex uint32 + PfNumber uint16 + SfNumberValid bool + PortIndexValid bool + ControllerValid bool +} + +// DevlinkDeviceInfo represents devlink info +type DevlinkDeviceInfo struct { + Driver string + SerialNumber string + BoardID string + FwApp string + FwAppBoundleID string + FwAppName string + FwBoundleID string + FwMgmt string + FwMgmtAPI string + FwMgmtBuild string + FwNetlist string + FwNetlistBuild string + FwPsidAPI string + FwUndi string +} + func parseDevLinkDeviceList(msgs [][]byte) ([]*DevlinkDevice, error) { devices := make([]*DevlinkDevice, 0, len(msgs)) for _, m := range msgs { @@ -95,9 +152,9 @@ func (d *DevlinkDevice) parseAttributes(attrs []syscall.NetlinkRouteAttr) error for _, a := range attrs { switch a.Attr.Type { case nl.DEVLINK_ATTR_BUS_NAME: - d.BusName = string(a.Value) + d.BusName = string(a.Value[:len(a.Value)-1]) case nl.DEVLINK_ATTR_DEV_NAME: - d.DeviceName = string(a.Value) + d.DeviceName = string(a.Value[:len(a.Value)-1]) case nl.DEVLINK_ATTR_ESWITCH_MODE: d.Attrs.Eswitch.Mode = parseEswitchMode(native.Uint16(a.Value)) case nl.DEVLINK_ATTR_ESWITCH_INLINE_MODE: @@ -126,12 +183,12 @@ func (h *Handle) getEswitchAttrs(family *GenlFamily, dev *DevlinkDevice) { req := h.newNetlinkRequest(int(family.ID), unix.NLM_F_REQUEST|unix.NLM_F_ACK) req.AddData(msg) - b := make([]byte, len(dev.BusName)) + b := make([]byte, len(dev.BusName)+1) copy(b, dev.BusName) data := nl.NewRtAttr(nl.DEVLINK_ATTR_BUS_NAME, b) req.AddData(data) - b = make([]byte, len(dev.DeviceName)) + b = make([]byte, len(dev.DeviceName)+1) copy(b, dev.DeviceName) data = nl.NewRtAttr(nl.DEVLINK_ATTR_DEV_NAME, b) req.AddData(data) @@ -270,3 +327,402 @@ func (h *Handle) DevLinkSetEswitchMode(Dev *DevlinkDevice, NewMode string) error func DevLinkSetEswitchMode(Dev *DevlinkDevice, NewMode string) error { return pkgHandle.DevLinkSetEswitchMode(Dev, NewMode) } + +func (port *DevlinkPort) parseAttributes(attrs []syscall.NetlinkRouteAttr) error { + for _, a := range attrs { + switch a.Attr.Type { + case nl.DEVLINK_ATTR_BUS_NAME: + port.BusName = string(a.Value[:len(a.Value)-1]) + case nl.DEVLINK_ATTR_DEV_NAME: + port.DeviceName = string(a.Value[:len(a.Value)-1]) + case nl.DEVLINK_ATTR_PORT_INDEX: + port.PortIndex = native.Uint32(a.Value) + case nl.DEVLINK_ATTR_PORT_TYPE: + port.PortType = native.Uint16(a.Value) + case nl.DEVLINK_ATTR_PORT_NETDEV_NAME: + port.NetdeviceName = string(a.Value[:len(a.Value)-1]) + case nl.DEVLINK_ATTR_PORT_NETDEV_IFINDEX: + port.NetdevIfIndex = native.Uint32(a.Value) + case nl.DEVLINK_ATTR_PORT_IBDEV_NAME: + port.RdmaDeviceName = string(a.Value[:len(a.Value)-1]) + case nl.DEVLINK_ATTR_PORT_FLAVOUR: + port.PortFlavour = native.Uint16(a.Value) + case nl.DEVLINK_ATTR_PORT_FUNCTION: + port.Fn = &DevlinkPortFn{} + for nested := range nl.ParseAttributes(a.Value) { + switch nested.Type { + case nl.DEVLINK_PORT_FUNCTION_ATTR_HW_ADDR: + port.Fn.HwAddr = nested.Value[:] + case nl.DEVLINK_PORT_FN_ATTR_STATE: + port.Fn.State = uint8(nested.Value[0]) + case nl.DEVLINK_PORT_FN_ATTR_OPSTATE: + port.Fn.OpState = uint8(nested.Value[0]) + } + } + } + } + return nil +} + +func parseDevLinkAllPortList(msgs [][]byte) ([]*DevlinkPort, error) { + ports := make([]*DevlinkPort, 0, len(msgs)) + for _, m := range msgs { + attrs, err := nl.ParseRouteAttr(m[nl.SizeofGenlmsg:]) + if err != nil { + return nil, err + } + port := &DevlinkPort{} + if err = port.parseAttributes(attrs); err != nil { + return nil, err + } + ports = append(ports, port) + } + return ports, nil +} + +// DevLinkGetPortList provides a pointer to devlink ports and nil error, +// otherwise returns an error code. +func (h *Handle) DevLinkGetAllPortList() ([]*DevlinkPort, error) { + f, err := h.GenlFamilyGet(nl.GENL_DEVLINK_NAME) + if err != nil { + return nil, err + } + msg := &nl.Genlmsg{ + Command: nl.DEVLINK_CMD_PORT_GET, + Version: nl.GENL_DEVLINK_VERSION, + } + req := h.newNetlinkRequest(int(f.ID), + unix.NLM_F_REQUEST|unix.NLM_F_ACK|unix.NLM_F_DUMP) + req.AddData(msg) + msgs, err := req.Execute(unix.NETLINK_GENERIC, 0) + if err != nil { + return nil, err + } + ports, err := parseDevLinkAllPortList(msgs) + if err != nil { + return nil, err + } + return ports, nil +} + +// DevLinkGetPortList provides a pointer to devlink ports and nil error, +// otherwise returns an error code. +func DevLinkGetAllPortList() ([]*DevlinkPort, error) { + return pkgHandle.DevLinkGetAllPortList() +} + +func parseDevlinkPortMsg(msgs [][]byte) (*DevlinkPort, error) { + m := msgs[0] + attrs, err := nl.ParseRouteAttr(m[nl.SizeofGenlmsg:]) + if err != nil { + return nil, err + } + port := &DevlinkPort{} + if err = port.parseAttributes(attrs); err != nil { + return nil, err + } + return port, nil +} + +// DevLinkGetPortByIndexprovides a pointer to devlink device and nil error, +// otherwise returns an error code. +func (h *Handle) DevLinkGetPortByIndex(Bus string, Device string, PortIndex uint32) (*DevlinkPort, error) { + + _, req, err := h.createCmdReq(nl.DEVLINK_CMD_PORT_GET, Bus, Device) + if err != nil { + return nil, err + } + + req.AddData(nl.NewRtAttr(nl.DEVLINK_ATTR_PORT_INDEX, nl.Uint32Attr(PortIndex))) + + respmsg, err := req.Execute(unix.NETLINK_GENERIC, 0) + if err != nil { + return nil, err + } + port, err := parseDevlinkPortMsg(respmsg) + return port, err +} + +// DevLinkGetPortByIndex provides a pointer to devlink portand nil error, +// otherwise returns an error code. +func DevLinkGetPortByIndex(Bus string, Device string, PortIndex uint32) (*DevlinkPort, error) { + return pkgHandle.DevLinkGetPortByIndex(Bus, Device, PortIndex) +} + +// DevLinkPortAdd adds a devlink port and returns a port on success +// otherwise returns nil port and an error code. +func (h *Handle) DevLinkPortAdd(Bus string, Device string, Flavour uint16, Attrs DevLinkPortAddAttrs) (*DevlinkPort, error) { + _, req, err := h.createCmdReq(nl.DEVLINK_CMD_PORT_NEW, Bus, Device) + if err != nil { + return nil, err + } + + req.AddData(nl.NewRtAttr(nl.DEVLINK_ATTR_PORT_FLAVOUR, nl.Uint16Attr(Flavour))) + + req.AddData(nl.NewRtAttr(nl.DEVLINK_ATTR_PORT_PCI_PF_NUMBER, nl.Uint16Attr(Attrs.PfNumber))) + if Flavour == nl.DEVLINK_PORT_FLAVOUR_PCI_SF && Attrs.SfNumberValid { + req.AddData(nl.NewRtAttr(nl.DEVLINK_ATTR_PORT_PCI_SF_NUMBER, nl.Uint32Attr(Attrs.SfNumber))) + } + if Attrs.PortIndexValid { + req.AddData(nl.NewRtAttr(nl.DEVLINK_ATTR_PORT_INDEX, nl.Uint32Attr(Attrs.PortIndex))) + } + if Attrs.ControllerValid { + req.AddData(nl.NewRtAttr(nl.DEVLINK_ATTR_PORT_CONTROLLER_NUMBER, nl.Uint32Attr(Attrs.Controller))) + } + respmsg, err := req.Execute(unix.NETLINK_GENERIC, 0) + if err != nil { + return nil, err + } + port, err := parseDevlinkPortMsg(respmsg) + return port, err +} + +// DevLinkPortAdd adds a devlink port and returns a port on success +// otherwise returns nil port and an error code. +func DevLinkPortAdd(Bus string, Device string, Flavour uint16, Attrs DevLinkPortAddAttrs) (*DevlinkPort, error) { + return pkgHandle.DevLinkPortAdd(Bus, Device, Flavour, Attrs) +} + +// DevLinkPortDel deletes a devlink port and returns success or error code. +func (h *Handle) DevLinkPortDel(Bus string, Device string, PortIndex uint32) error { + _, req, err := h.createCmdReq(nl.DEVLINK_CMD_PORT_DEL, Bus, Device) + if err != nil { + return err + } + + req.AddData(nl.NewRtAttr(nl.DEVLINK_ATTR_PORT_INDEX, nl.Uint32Attr(PortIndex))) + _, err = req.Execute(unix.NETLINK_GENERIC, 0) + return err +} + +// DevLinkPortDel deletes a devlink port and returns success or error code. +func DevLinkPortDel(Bus string, Device string, PortIndex uint32) error { + return pkgHandle.DevLinkPortDel(Bus, Device, PortIndex) +} + +// DevlinkPortFnSet sets one or more port function attributes specified by the attribute mask. +// It returns 0 on success or error code. +func (h *Handle) DevlinkPortFnSet(Bus string, Device string, PortIndex uint32, FnAttrs DevlinkPortFnSetAttrs) error { + _, req, err := h.createCmdReq(nl.DEVLINK_CMD_PORT_SET, Bus, Device) + if err != nil { + return err + } + + req.AddData(nl.NewRtAttr(nl.DEVLINK_ATTR_PORT_INDEX, nl.Uint32Attr(PortIndex))) + + fnAttr := nl.NewRtAttr(nl.DEVLINK_ATTR_PORT_FUNCTION|unix.NLA_F_NESTED, nil) + + if FnAttrs.HwAddrValid { + fnAttr.AddRtAttr(nl.DEVLINK_PORT_FUNCTION_ATTR_HW_ADDR, []byte(FnAttrs.FnAttrs.HwAddr)) + } + + if FnAttrs.StateValid { + fnAttr.AddRtAttr(nl.DEVLINK_PORT_FN_ATTR_STATE, nl.Uint8Attr(FnAttrs.FnAttrs.State)) + } + req.AddData(fnAttr) + + _, err = req.Execute(unix.NETLINK_GENERIC, 0) + return err +} + +// DevlinkPortFnSet sets one or more port function attributes specified by the attribute mask. +// It returns 0 on success or error code. +func DevlinkPortFnSet(Bus string, Device string, PortIndex uint32, FnAttrs DevlinkPortFnSetAttrs) error { + return pkgHandle.DevlinkPortFnSet(Bus, Device, PortIndex, FnAttrs) +} + +// devlinkInfoGetter is function that is responsible for getting devlink info message +// this is introduced for test purpose +type devlinkInfoGetter func(bus, device string) ([]byte, error) + +// DevlinkGetDeviceInfoByName returns devlink info for selected device, +// otherwise returns an error code. +// Equivalent to: `devlink dev info $dev` +func (h *Handle) DevlinkGetDeviceInfoByName(Bus string, Device string, getInfoMsg devlinkInfoGetter) (*DevlinkDeviceInfo, error) { + info, err := h.DevlinkGetDeviceInfoByNameAsMap(Bus, Device, getInfoMsg) + if err != nil { + return nil, err + } + + return parseInfoData(info), nil +} + +// DevlinkGetDeviceInfoByName returns devlink info for selected device, +// otherwise returns an error code. +// Equivalent to: `devlink dev info $dev` +func DevlinkGetDeviceInfoByName(Bus string, Device string) (*DevlinkDeviceInfo, error) { + return pkgHandle.DevlinkGetDeviceInfoByName(Bus, Device, pkgHandle.getDevlinkInfoMsg) +} + +// DevlinkGetDeviceInfoByNameAsMap returns devlink info for selected device as a map, +// otherwise returns an error code. +// Equivalent to: `devlink dev info $dev` +func (h *Handle) DevlinkGetDeviceInfoByNameAsMap(Bus string, Device string, getInfoMsg devlinkInfoGetter) (map[string]string, error) { + response, err := getInfoMsg(Bus, Device) + if err != nil { + return nil, err + } + + info, err := parseInfoMsg(response) + if err != nil { + return nil, err + } + + return info, nil +} + +// DevlinkGetDeviceInfoByNameAsMap returns devlink info for selected device as a map, +// otherwise returns an error code. +// Equivalent to: `devlink dev info $dev` +func DevlinkGetDeviceInfoByNameAsMap(Bus string, Device string) (map[string]string, error) { + return pkgHandle.DevlinkGetDeviceInfoByNameAsMap(Bus, Device, pkgHandle.getDevlinkInfoMsg) +} + +// GetDevlinkInfo returns devlink info for target device, +// otherwise returns an error code. +func (d *DevlinkDevice) GetDevlinkInfo() (*DevlinkDeviceInfo, error) { + return pkgHandle.DevlinkGetDeviceInfoByName(d.BusName, d.DeviceName, pkgHandle.getDevlinkInfoMsg) +} + +// GetDevlinkInfoAsMap returns devlink info for target device as a map, +// otherwise returns an error code. +func (d *DevlinkDevice) GetDevlinkInfoAsMap() (map[string]string, error) { + return pkgHandle.DevlinkGetDeviceInfoByNameAsMap(d.BusName, d.DeviceName, pkgHandle.getDevlinkInfoMsg) +} + +func (h *Handle) getDevlinkInfoMsg(bus, device string) ([]byte, error) { + _, req, err := h.createCmdReq(nl.DEVLINK_CMD_INFO_GET, bus, device) + if err != nil { + return nil, err + } + + response, err := req.Execute(unix.NETLINK_GENERIC, 0) + if err != nil { + return nil, err + } + + if len(response) < 1 { + return nil, fmt.Errorf("getDevlinkInfoMsg: message too short") + } + + return response[0], nil +} + +func parseInfoMsg(msg []byte) (map[string]string, error) { + if len(msg) < nl.SizeofGenlmsg { + return nil, fmt.Errorf("parseInfoMsg: message too short") + } + + info := make(map[string]string) + err := collectInfoData(msg[nl.SizeofGenlmsg:], info) + + if err != nil { + return nil, err + } + + return info, nil +} + +func collectInfoData(msg []byte, data map[string]string) error { + attrs, err := nl.ParseRouteAttr(msg) + if err != nil { + return err + } + + for _, attr := range attrs { + switch attr.Attr.Type { + case nl.DEVLINK_ATTR_INFO_DRIVER_NAME: + data["driver"] = parseInfoValue(attr.Value) + case nl.DEVLINK_ATTR_INFO_SERIAL_NUMBER: + data["serialNumber"] = parseInfoValue(attr.Value) + case nl.DEVLINK_ATTR_INFO_VERSION_RUNNING, nl.DEVLINK_ATTR_INFO_VERSION_FIXED, + nl.DEVLINK_ATTR_INFO_VERSION_STORED: + key, value, err := getNestedInfoData(attr.Value) + if err != nil { + return err + } + data[key] = value + } + } + + if len(data) == 0 { + return fmt.Errorf("collectInfoData: could not read attributes") + } + + return nil +} + +func getNestedInfoData(msg []byte) (string, string, error) { + nestedAttrs, err := nl.ParseRouteAttr(msg) + + var key, value string + + if err != nil { + return "", "", err + } + + if len(nestedAttrs) != 2 { + return "", "", fmt.Errorf("getNestedInfoData: too few attributes in nested structure") + } + + for _, nestedAttr := range nestedAttrs { + switch nestedAttr.Attr.Type { + case nl.DEVLINK_ATTR_INFO_VERSION_NAME: + key = parseInfoValue(nestedAttr.Value) + case nl.DEVLINK_ATTR_INFO_VERSION_VALUE: + value = parseInfoValue(nestedAttr.Value) + } + } + + if key == "" { + return "", "", fmt.Errorf("getNestedInfoData: key not found") + } + + if value == "" { + return "", "", fmt.Errorf("getNestedInfoData: value not found") + } + + return key, value, nil +} + +func parseInfoData(data map[string]string) *DevlinkDeviceInfo { + info := new(DevlinkDeviceInfo) + for key, value := range data { + switch key { + case "driver": + info.Driver = value + case "serialNumber": + info.SerialNumber = value + case "board.id": + info.BoardID = value + case "fw.app": + info.FwApp = value + case "fw.app.bundle_id": + info.FwAppBoundleID = value + case "fw.app.name": + info.FwAppName = value + case "fw.bundle_id": + info.FwBoundleID = value + case "fw.mgmt": + info.FwMgmt = value + case "fw.mgmt.api": + info.FwMgmtAPI = value + case "fw.mgmt.build": + info.FwMgmtBuild = value + case "fw.netlist": + info.FwNetlist = value + case "fw.netlist.build": + info.FwNetlistBuild = value + case "fw.psid.api": + info.FwPsidAPI = value + case "fw.undi": + info.FwUndi = value + } + } + return info +} + +func parseInfoValue(value []byte) string { + v := strings.ReplaceAll(string(value), "\x00", "") + return strings.TrimSpace(v) +} diff --git a/vendor/github.com/vishvananda/netlink/filter.go b/vendor/github.com/vishvananda/netlink/filter.go index 88792eab0..2d798b0fb 100644 --- a/vendor/github.com/vishvananda/netlink/filter.go +++ b/vendor/github.com/vishvananda/netlink/filter.go @@ -157,6 +157,39 @@ func NewConnmarkAction() *ConnmarkAction { } } +type CsumUpdateFlags uint32 + +const ( + TCA_CSUM_UPDATE_FLAG_IPV4HDR CsumUpdateFlags = 1 + TCA_CSUM_UPDATE_FLAG_ICMP CsumUpdateFlags = 2 + TCA_CSUM_UPDATE_FLAG_IGMP CsumUpdateFlags = 4 + TCA_CSUM_UPDATE_FLAG_TCP CsumUpdateFlags = 8 + TCA_CSUM_UPDATE_FLAG_UDP CsumUpdateFlags = 16 + TCA_CSUM_UPDATE_FLAG_UDPLITE CsumUpdateFlags = 32 + TCA_CSUM_UPDATE_FLAG_SCTP CsumUpdateFlags = 64 +) + +type CsumAction struct { + ActionAttrs + UpdateFlags CsumUpdateFlags +} + +func (action *CsumAction) Type() string { + return "csum" +} + +func (action *CsumAction) Attrs() *ActionAttrs { + return &action.ActionAttrs +} + +func NewCsumAction() *CsumAction { + return &CsumAction{ + ActionAttrs: ActionAttrs{ + Action: TC_ACT_PIPE, + }, + } +} + type MirredAct uint8 func (a MirredAct) String() string { @@ -213,10 +246,11 @@ const ( type TunnelKeyAction struct { ActionAttrs - Action TunnelKeyAct - SrcAddr net.IP - DstAddr net.IP - KeyID uint32 + Action TunnelKeyAct + SrcAddr net.IP + DstAddr net.IP + KeyID uint32 + DestPort uint16 } func (action *TunnelKeyAction) Type() string { @@ -259,6 +293,40 @@ func NewSkbEditAction() *SkbEditAction { } } +type PoliceAction struct { + ActionAttrs + Rate uint32 // in byte per second + Burst uint32 // in byte + RCellLog int + Mtu uint32 + Mpu uint16 // in byte + PeakRate uint32 // in byte per second + PCellLog int + AvRate uint32 // in byte per second + Overhead uint16 + LinkLayer int + ExceedAction TcPolAct + NotExceedAction TcPolAct +} + +func (action *PoliceAction) Type() string { + return "police" +} + +func (action *PoliceAction) Attrs() *ActionAttrs { + return &action.ActionAttrs +} + +func NewPoliceAction() *PoliceAction { + return &PoliceAction{ + RCellLog: -1, + PCellLog: -1, + LinkLayer: 1, // ETHERNET + ExceedAction: TC_POLICE_RECLASSIFY, + NotExceedAction: TC_POLICE_OK, + } +} + // MatchAll filters match all packets type MatchAll struct { FilterAttrs @@ -274,20 +342,20 @@ func (filter *MatchAll) Type() string { return "matchall" } -type FilterFwAttrs struct { - ClassId uint32 - InDev string - Mask uint32 - Index uint32 - Buffer uint32 - Mtu uint32 - Mpu uint16 - Rate uint32 - AvRate uint32 - PeakRate uint32 - Action TcPolAct - Overhead uint16 - LinkLayer int +type FwFilter struct { + FilterAttrs + ClassId uint32 + InDev string + Mask uint32 + Police *PoliceAction +} + +func (filter *FwFilter) Attrs() *FilterAttrs { + return &filter.FilterAttrs +} + +func (filter *FwFilter) Type() string { + return "fw" } type BpfFilter struct { diff --git a/vendor/github.com/vishvananda/netlink/filter_linux.go b/vendor/github.com/vishvananda/netlink/filter_linux.go index c56f314cd..4c6d1cf7d 100644 --- a/vendor/github.com/vishvananda/netlink/filter_linux.go +++ b/vendor/github.com/vishvananda/netlink/filter_linux.go @@ -37,6 +37,7 @@ type U32 struct { ClassId uint32 Divisor uint32 // Divisor MUST be power of 2. Hash uint32 + Link uint32 RedirIndex int Sel *TcU32Sel Actions []Action @@ -50,74 +51,129 @@ func (filter *U32) Type() string { return "u32" } -// Fw filter filters on firewall marks -// NOTE: this is in filter_linux because it refers to nl.TcPolice which -// is defined in nl/tc_linux.go -type Fw struct { +type Flower struct { FilterAttrs - ClassId uint32 - // TODO remove nl type from interface - Police nl.TcPolice - InDev string - // TODO Action - Mask uint32 - AvRate uint32 - Rtab [256]uint32 - Ptab [256]uint32 -} - -func NewFw(attrs FilterAttrs, fattrs FilterFwAttrs) (*Fw, error) { - var rtab [256]uint32 - var ptab [256]uint32 - rcellLog := -1 - pcellLog := -1 - avrate := fattrs.AvRate / 8 - police := nl.TcPolice{} - police.Rate.Rate = fattrs.Rate / 8 - police.PeakRate.Rate = fattrs.PeakRate / 8 - buffer := fattrs.Buffer - linklayer := nl.LINKLAYER_ETHERNET + DestIP net.IP + DestIPMask net.IPMask + SrcIP net.IP + SrcIPMask net.IPMask + EthType uint16 + EncDestIP net.IP + EncDestIPMask net.IPMask + EncSrcIP net.IP + EncSrcIPMask net.IPMask + EncDestPort uint16 + EncKeyId uint32 + + Actions []Action +} - if fattrs.LinkLayer != nl.LINKLAYER_UNSPEC { - linklayer = fattrs.LinkLayer - } +func (filter *Flower) Attrs() *FilterAttrs { + return &filter.FilterAttrs +} - police.Action = int32(fattrs.Action) - if police.Rate.Rate != 0 { - police.Rate.Mpu = fattrs.Mpu - police.Rate.Overhead = fattrs.Overhead - if CalcRtable(&police.Rate, rtab[:], rcellLog, fattrs.Mtu, linklayer) < 0 { - return nil, errors.New("TBF: failed to calculate rate table") - } - police.Burst = uint32(Xmittime(uint64(police.Rate.Rate), uint32(buffer))) +func (filter *Flower) Type() string { + return "flower" +} + +func (filter *Flower) encodeIP(parent *nl.RtAttr, ip net.IP, mask net.IPMask, v4Type, v6Type int, v4MaskType, v6MaskType int) { + ipType := v4Type + maskType := v4MaskType + + encodeMask := mask + if mask == nil { + encodeMask = net.CIDRMask(32, 32) } - police.Mtu = fattrs.Mtu - if police.PeakRate.Rate != 0 { - police.PeakRate.Mpu = fattrs.Mpu - police.PeakRate.Overhead = fattrs.Overhead - if CalcRtable(&police.PeakRate, ptab[:], pcellLog, fattrs.Mtu, linklayer) < 0 { - return nil, errors.New("POLICE: failed to calculate peak rate table") + v4IP := ip.To4() + if v4IP == nil { + ipType = v6Type + maskType = v6MaskType + if mask == nil { + encodeMask = net.CIDRMask(128, 128) } + } else { + ip = v4IP } - return &Fw{ - FilterAttrs: attrs, - ClassId: fattrs.ClassId, - InDev: fattrs.InDev, - Mask: fattrs.Mask, - Police: police, - AvRate: avrate, - Rtab: rtab, - Ptab: ptab, - }, nil + parent.AddRtAttr(ipType, ip) + parent.AddRtAttr(maskType, encodeMask) } -func (filter *Fw) Attrs() *FilterAttrs { - return &filter.FilterAttrs +func (filter *Flower) encode(parent *nl.RtAttr) error { + if filter.EthType != 0 { + parent.AddRtAttr(nl.TCA_FLOWER_KEY_ETH_TYPE, htons(filter.EthType)) + } + if filter.SrcIP != nil { + filter.encodeIP(parent, filter.SrcIP, filter.SrcIPMask, + nl.TCA_FLOWER_KEY_IPV4_SRC, nl.TCA_FLOWER_KEY_IPV6_SRC, + nl.TCA_FLOWER_KEY_IPV4_SRC_MASK, nl.TCA_FLOWER_KEY_IPV6_SRC_MASK) + } + if filter.DestIP != nil { + filter.encodeIP(parent, filter.DestIP, filter.DestIPMask, + nl.TCA_FLOWER_KEY_IPV4_DST, nl.TCA_FLOWER_KEY_IPV6_DST, + nl.TCA_FLOWER_KEY_IPV4_DST_MASK, nl.TCA_FLOWER_KEY_IPV6_DST_MASK) + } + if filter.EncSrcIP != nil { + filter.encodeIP(parent, filter.EncSrcIP, filter.EncSrcIPMask, + nl.TCA_FLOWER_KEY_ENC_IPV4_SRC, nl.TCA_FLOWER_KEY_ENC_IPV6_SRC, + nl.TCA_FLOWER_KEY_ENC_IPV4_SRC_MASK, nl.TCA_FLOWER_KEY_ENC_IPV6_SRC_MASK) + } + if filter.EncDestIP != nil { + filter.encodeIP(parent, filter.EncDestIP, filter.EncSrcIPMask, + nl.TCA_FLOWER_KEY_ENC_IPV4_DST, nl.TCA_FLOWER_KEY_ENC_IPV6_DST, + nl.TCA_FLOWER_KEY_ENC_IPV4_DST_MASK, nl.TCA_FLOWER_KEY_ENC_IPV6_DST_MASK) + } + if filter.EncDestPort != 0 { + parent.AddRtAttr(nl.TCA_FLOWER_KEY_ENC_UDP_DST_PORT, htons(filter.EncDestPort)) + } + if filter.EncKeyId != 0 { + parent.AddRtAttr(nl.TCA_FLOWER_KEY_ENC_KEY_ID, htonl(filter.EncKeyId)) + } + + actionsAttr := parent.AddRtAttr(nl.TCA_FLOWER_ACT, nil) + if err := EncodeActions(actionsAttr, filter.Actions); err != nil { + return err + } + return nil } -func (filter *Fw) Type() string { - return "fw" +func (filter *Flower) decode(data []syscall.NetlinkRouteAttr) error { + for _, datum := range data { + switch datum.Attr.Type { + case nl.TCA_FLOWER_KEY_ETH_TYPE: + filter.EthType = ntohs(datum.Value) + case nl.TCA_FLOWER_KEY_IPV4_SRC, nl.TCA_FLOWER_KEY_IPV6_SRC: + filter.SrcIP = datum.Value + case nl.TCA_FLOWER_KEY_IPV4_SRC_MASK, nl.TCA_FLOWER_KEY_IPV6_SRC_MASK: + filter.SrcIPMask = datum.Value + case nl.TCA_FLOWER_KEY_IPV4_DST, nl.TCA_FLOWER_KEY_IPV6_DST: + filter.DestIP = datum.Value + case nl.TCA_FLOWER_KEY_IPV4_DST_MASK, nl.TCA_FLOWER_KEY_IPV6_DST_MASK: + filter.DestIPMask = datum.Value + case nl.TCA_FLOWER_KEY_ENC_IPV4_SRC, nl.TCA_FLOWER_KEY_ENC_IPV6_SRC: + filter.EncSrcIP = datum.Value + case nl.TCA_FLOWER_KEY_ENC_IPV4_SRC_MASK, nl.TCA_FLOWER_KEY_ENC_IPV6_SRC_MASK: + filter.EncSrcIPMask = datum.Value + case nl.TCA_FLOWER_KEY_ENC_IPV4_DST, nl.TCA_FLOWER_KEY_ENC_IPV6_DST: + filter.EncDestIP = datum.Value + case nl.TCA_FLOWER_KEY_ENC_IPV4_DST_MASK, nl.TCA_FLOWER_KEY_ENC_IPV6_DST_MASK: + filter.EncDestIPMask = datum.Value + case nl.TCA_FLOWER_KEY_ENC_UDP_DST_PORT: + filter.EncDestPort = ntohs(datum.Value) + case nl.TCA_FLOWER_KEY_ENC_KEY_ID: + filter.EncKeyId = ntohl(datum.Value) + case nl.TCA_FLOWER_ACT: + tables, err := nl.ParseRouteAttr(datum.Value) + if err != nil { + return err + } + filter.Actions, err = parseActions(tables) + if err != nil { + return err + } + } + } + return nil } // FilterDel will delete a filter from the system. @@ -169,7 +225,6 @@ func (h *Handle) FilterReplace(filter Filter) error { } func (h *Handle) filterModify(filter Filter, flags int) error { - native = nl.NativeEndian() req := h.newNetlinkRequest(unix.RTM_NEWTFILTER, flags|unix.NLM_F_ACK) base := filter.Attrs() msg := &nl.TcMsg{ @@ -226,6 +281,9 @@ func (h *Handle) filterModify(filter Filter, flags int) error { if filter.Hash != 0 { options.AddRtAttr(nl.TCA_U32_HASH, nl.Uint32Attr(filter.Hash)) } + if filter.Link != 0 { + options.AddRtAttr(nl.TCA_U32_LINK, nl.Uint32Attr(filter.Link)) + } actionsAttr := options.AddRtAttr(nl.TCA_U32_ACT, nil) // backwards compatibility if filter.RedirIndex != 0 { @@ -234,7 +292,7 @@ func (h *Handle) filterModify(filter Filter, flags int) error { if err := EncodeActions(actionsAttr, filter.Actions); err != nil { return err } - case *Fw: + case *FwFilter: if filter.Mask != 0 { b := make([]byte, 4) native.PutUint32(b, filter.Mask) @@ -243,17 +301,10 @@ func (h *Handle) filterModify(filter Filter, flags int) error { if filter.InDev != "" { options.AddRtAttr(nl.TCA_FW_INDEV, nl.ZeroTerminated(filter.InDev)) } - if (filter.Police != nl.TcPolice{}) { - + if filter.Police != nil { police := options.AddRtAttr(nl.TCA_FW_POLICE, nil) - police.AddRtAttr(nl.TCA_POLICE_TBF, filter.Police.Serialize()) - if (filter.Police.Rate != nl.TcRateSpec{}) { - payload := SerializeRtab(filter.Rtab) - police.AddRtAttr(nl.TCA_POLICE_RATE, payload) - } - if (filter.Police.PeakRate != nl.TcRateSpec{}) { - payload := SerializeRtab(filter.Ptab) - police.AddRtAttr(nl.TCA_POLICE_PEAKRATE, payload) + if err := encodePolice(police, filter.Police); err != nil { + return err } } if filter.ClassId != 0 { @@ -284,6 +335,10 @@ func (h *Handle) filterModify(filter Filter, flags int) error { if filter.ClassId != 0 { options.AddRtAttr(nl.TCA_MATCHALL_CLASSID, nl.Uint32Attr(filter.ClassId)) } + case *Flower: + if err := filter.encode(options); err != nil { + return err + } } req.AddData(options) @@ -347,11 +402,13 @@ func (h *Handle) FilterList(link Link, parent uint32) ([]Filter, error) { case "u32": filter = &U32{} case "fw": - filter = &Fw{} + filter = &FwFilter{} case "bpf": filter = &BpfFilter{} case "matchall": filter = &MatchAll{} + case "flower": + filter = &Flower{} default: filter = &GenericFilter{FilterType: filterType} } @@ -381,6 +438,11 @@ func (h *Handle) FilterList(link Link, parent uint32) ([]Filter, error) { if err != nil { return nil, err } + case "flower": + detailed, err = parseFlowerData(filter, data) + if err != nil { + return nil, err + } default: detailed = true } @@ -412,6 +474,53 @@ func toAttrs(tcgen *nl.TcGen, attrs *ActionAttrs) { attrs.Bindcnt = int(tcgen.Bindcnt) } +func encodePolice(attr *nl.RtAttr, action *PoliceAction) error { + var rtab [256]uint32 + var ptab [256]uint32 + police := nl.TcPolice{} + police.Index = uint32(action.Attrs().Index) + police.Bindcnt = int32(action.Attrs().Bindcnt) + police.Capab = uint32(action.Attrs().Capab) + police.Refcnt = int32(action.Attrs().Refcnt) + police.Rate.Rate = action.Rate + police.PeakRate.Rate = action.PeakRate + police.Action = int32(action.ExceedAction) + + if police.Rate.Rate != 0 { + police.Rate.Mpu = action.Mpu + police.Rate.Overhead = action.Overhead + if CalcRtable(&police.Rate, rtab[:], action.RCellLog, action.Mtu, action.LinkLayer) < 0 { + return errors.New("TBF: failed to calculate rate table") + } + police.Burst = Xmittime(uint64(police.Rate.Rate), action.Burst) + } + + police.Mtu = action.Mtu + if police.PeakRate.Rate != 0 { + police.PeakRate.Mpu = action.Mpu + police.PeakRate.Overhead = action.Overhead + if CalcRtable(&police.PeakRate, ptab[:], action.PCellLog, action.Mtu, action.LinkLayer) < 0 { + return errors.New("POLICE: failed to calculate peak rate table") + } + } + + attr.AddRtAttr(nl.TCA_POLICE_TBF, police.Serialize()) + if police.Rate.Rate != 0 { + attr.AddRtAttr(nl.TCA_POLICE_RATE, SerializeRtab(rtab)) + } + if police.PeakRate.Rate != 0 { + attr.AddRtAttr(nl.TCA_POLICE_PEAKRATE, SerializeRtab(ptab)) + } + if action.AvRate != 0 { + attr.AddRtAttr(nl.TCA_POLICE_AVRATE, nl.Uint32Attr(action.AvRate)) + } + if action.NotExceedAction != 0 { + attr.AddRtAttr(nl.TCA_POLICE_RESULT, nl.Uint32Attr(uint32(action.NotExceedAction))) + } + + return nil +} + func EncodeActions(attr *nl.RtAttr, actions []Action) error { tabIndex := int(nl.TCA_ACT_TAB) @@ -419,6 +528,14 @@ func EncodeActions(attr *nl.RtAttr, actions []Action) error { switch action := action.(type) { default: return fmt.Errorf("unknown action type %s", action.Type()) + case *PoliceAction: + table := attr.AddRtAttr(tabIndex, nil) + tabIndex++ + table.AddRtAttr(nl.TCA_ACT_KIND, nl.ZeroTerminated("police")) + aopts := table.AddRtAttr(nl.TCA_ACT_OPTIONS, nil) + if err := encodePolice(aopts, action); err != nil { + return err + } case *MirredAction: table := attr.AddRtAttr(tabIndex, nil) tabIndex++ @@ -456,6 +573,9 @@ func EncodeActions(attr *nl.RtAttr, actions []Action) error { } else { return fmt.Errorf("invalid dst addr %s for tunnel_key action", action.DstAddr) } + if action.DestPort != 0 { + aopts.AddRtAttr(nl.TCA_TUNNEL_KEY_ENC_DST_PORT, htons(action.DestPort)) + } } case *SkbEditAction: table := attr.AddRtAttr(tabIndex, nil) @@ -487,6 +607,16 @@ func EncodeActions(attr *nl.RtAttr, actions []Action) error { } toTcGen(action.Attrs(), &connmark.TcGen) aopts.AddRtAttr(nl.TCA_CONNMARK_PARMS, connmark.Serialize()) + case *CsumAction: + table := attr.AddRtAttr(tabIndex, nil) + tabIndex++ + table.AddRtAttr(nl.TCA_ACT_KIND, nl.ZeroTerminated("csum")) + aopts := table.AddRtAttr(nl.TCA_ACT_OPTIONS, nil) + csum := nl.TcCsum{ + UpdateFlags: uint32(action.UpdateFlags), + } + toTcGen(action.Attrs(), &csum.TcGen) + aopts.AddRtAttr(nl.TCA_CSUM_PARMS, csum.Serialize()) case *BpfAction: table := attr.AddRtAttr(tabIndex, nil) tabIndex++ @@ -510,6 +640,29 @@ func EncodeActions(attr *nl.RtAttr, actions []Action) error { return nil } +func parsePolice(data syscall.NetlinkRouteAttr, police *PoliceAction) { + switch data.Attr.Type { + case nl.TCA_POLICE_RESULT: + police.NotExceedAction = TcPolAct(native.Uint32(data.Value[0:4])) + case nl.TCA_POLICE_AVRATE: + police.AvRate = native.Uint32(data.Value[0:4]) + case nl.TCA_POLICE_TBF: + p := *nl.DeserializeTcPolice(data.Value) + police.ActionAttrs = ActionAttrs{} + police.Attrs().Index = int(p.Index) + police.Attrs().Bindcnt = int(p.Bindcnt) + police.Attrs().Capab = int(p.Capab) + police.Attrs().Refcnt = int(p.Refcnt) + police.ExceedAction = TcPolAct(p.Action) + police.Rate = p.Rate.Rate + police.PeakRate = p.PeakRate.Rate + police.Burst = Xmitsize(uint64(p.Rate.Rate), p.Burst) + police.Mtu = p.Mtu + police.LinkLayer = int(p.Rate.Linklayer) & nl.TC_LINKLAYER_MASK + police.Overhead = p.Rate.Overhead + } +} + func parseActions(tables []syscall.NetlinkRouteAttr) ([]Action, error) { var actions []Action for _, table := range tables { @@ -532,12 +685,16 @@ func parseActions(tables []syscall.NetlinkRouteAttr) ([]Action, error) { action = &BpfAction{} case "connmark": action = &ConnmarkAction{} + case "csum": + action = &CsumAction{} case "gact": action = &GenericAction{} case "tunnel_key": action = &TunnelKeyAction{} case "skbedit": action = &SkbEditAction{} + case "police": + action = &PoliceAction{} default: break nextattr } @@ -566,12 +723,12 @@ func parseActions(tables []syscall.NetlinkRouteAttr) ([]Action, error) { action.(*TunnelKeyAction).Action = TunnelKeyAct(tun.Action) case nl.TCA_TUNNEL_KEY_ENC_KEY_ID: action.(*TunnelKeyAction).KeyID = networkOrder.Uint32(adatum.Value[0:4]) - case nl.TCA_TUNNEL_KEY_ENC_IPV6_SRC: - case nl.TCA_TUNNEL_KEY_ENC_IPV4_SRC: - action.(*TunnelKeyAction).SrcAddr = net.IP(adatum.Value[:]) - case nl.TCA_TUNNEL_KEY_ENC_IPV6_DST: - case nl.TCA_TUNNEL_KEY_ENC_IPV4_DST: - action.(*TunnelKeyAction).DstAddr = net.IP(adatum.Value[:]) + case nl.TCA_TUNNEL_KEY_ENC_IPV6_SRC, nl.TCA_TUNNEL_KEY_ENC_IPV4_SRC: + action.(*TunnelKeyAction).SrcAddr = adatum.Value[:] + case nl.TCA_TUNNEL_KEY_ENC_IPV6_DST, nl.TCA_TUNNEL_KEY_ENC_IPV4_DST: + action.(*TunnelKeyAction).DstAddr = adatum.Value[:] + case nl.TCA_TUNNEL_KEY_ENC_DST_PORT: + action.(*TunnelKeyAction).DestPort = ntohs(adatum.Value) } case "skbedit": switch adatum.Attr.Type { @@ -610,12 +767,22 @@ func parseActions(tables []syscall.NetlinkRouteAttr) ([]Action, error) { toAttrs(&connmark.TcGen, action.Attrs()) action.(*ConnmarkAction).Zone = connmark.Zone } + case "csum": + switch adatum.Attr.Type { + case nl.TCA_CSUM_PARMS: + csum := *nl.DeserializeTcCsum(adatum.Value) + action.(*CsumAction).ActionAttrs = ActionAttrs{} + toAttrs(&csum.TcGen, action.Attrs()) + action.(*CsumAction).UpdateFlags = CsumUpdateFlags(csum.UpdateFlags) + } case "gact": switch adatum.Attr.Type { case nl.TCA_GACT_PARMS: gen := *nl.DeserializeTcGen(adatum.Value) toAttrs(&gen, action.Attrs()) } + case "police": + parsePolice(adatum, action.(*PoliceAction)) } } } @@ -626,7 +793,6 @@ func parseActions(tables []syscall.NetlinkRouteAttr) ([]Action, error) { } func parseU32Data(filter Filter, data []syscall.NetlinkRouteAttr) (bool, error) { - native = nl.NativeEndian() u32 := filter.(*U32) detailed := false for _, datum := range data { @@ -664,14 +830,15 @@ func parseU32Data(filter Filter, data []syscall.NetlinkRouteAttr) (bool, error) u32.Divisor = native.Uint32(datum.Value) case nl.TCA_U32_HASH: u32.Hash = native.Uint32(datum.Value) + case nl.TCA_U32_LINK: + u32.Link = native.Uint32(datum.Value) } } return detailed, nil } func parseFwData(filter Filter, data []syscall.NetlinkRouteAttr) (bool, error) { - native = nl.NativeEndian() - fw := filter.(*Fw) + fw := filter.(*FwFilter) detailed := true for _, datum := range data { switch datum.Attr.Type { @@ -682,24 +849,18 @@ func parseFwData(filter Filter, data []syscall.NetlinkRouteAttr) (bool, error) { case nl.TCA_FW_INDEV: fw.InDev = string(datum.Value[:len(datum.Value)-1]) case nl.TCA_FW_POLICE: + var police PoliceAction adata, _ := nl.ParseRouteAttr(datum.Value) for _, aattr := range adata { - switch aattr.Attr.Type { - case nl.TCA_POLICE_TBF: - fw.Police = *nl.DeserializeTcPolice(aattr.Value) - case nl.TCA_POLICE_RATE: - fw.Rtab = DeserializeRtab(aattr.Value) - case nl.TCA_POLICE_PEAKRATE: - fw.Ptab = DeserializeRtab(aattr.Value) - } + parsePolice(aattr, &police) } + fw.Police = &police } } return detailed, nil } func parseBpfData(filter Filter, data []syscall.NetlinkRouteAttr) (bool, error) { - native = nl.NativeEndian() bpf := filter.(*BpfFilter) detailed := true for _, datum := range data { @@ -718,14 +879,13 @@ func parseBpfData(filter Filter, data []syscall.NetlinkRouteAttr) (bool, error) case nl.TCA_BPF_ID: bpf.Id = int(native.Uint32(datum.Value[0:4])) case nl.TCA_BPF_TAG: - bpf.Tag = hex.EncodeToString(datum.Value[:len(datum.Value)-1]) + bpf.Tag = hex.EncodeToString(datum.Value) } } return detailed, nil } func parseMatchAllData(filter Filter, data []syscall.NetlinkRouteAttr) (bool, error) { - native = nl.NativeEndian() matchall := filter.(*MatchAll) detailed := true for _, datum := range data { @@ -746,6 +906,10 @@ func parseMatchAllData(filter Filter, data []syscall.NetlinkRouteAttr) (bool, er return detailed, nil } +func parseFlowerData(filter Filter, data []syscall.NetlinkRouteAttr) (bool, error) { + return true, filter.(*Flower).decode(data) +} + func AlignToAtm(size uint) uint { var linksize, cells int cells = int(size / nl.ATM_CELL_PAYLOAD) @@ -783,7 +947,7 @@ func CalcRtable(rate *nl.TcRateSpec, rtab []uint32, cellLog int, mtu uint32, lin } for i := 0; i < 256; i++ { sz = AdjustSize(uint((i+1)<= nl.IPSET_ERR_PRIVATE { + err = nl.IPSetError(uintptr(errno)) + } + } + return +} + +func ipsetUnserialize(msgs [][]byte) (result IPSetResult) { + for _, msg := range msgs { + result.unserialize(msg) + } + return result +} + +func (result *IPSetResult) unserialize(msg []byte) { + result.Nfgenmsg = nl.DeserializeNfgenmsg(msg) + + for attr := range nl.ParseAttributes(msg[4:]) { + switch attr.Type { + case nl.IPSET_ATTR_PROTOCOL: + result.Protocol = attr.Value[0] + case nl.IPSET_ATTR_SETNAME: + result.SetName = nl.BytesToString(attr.Value) + case nl.IPSET_ATTR_COMMENT: + result.Comment = nl.BytesToString(attr.Value) + case nl.IPSET_ATTR_TYPENAME: + result.TypeName = nl.BytesToString(attr.Value) + case nl.IPSET_ATTR_REVISION: + result.Revision = attr.Value[0] + case nl.IPSET_ATTR_FAMILY: + result.Family = attr.Value[0] + case nl.IPSET_ATTR_FLAGS: + result.Flags = attr.Value[0] + case nl.IPSET_ATTR_DATA | nl.NLA_F_NESTED: + result.parseAttrData(attr.Value) + case nl.IPSET_ATTR_ADT | nl.NLA_F_NESTED: + result.parseAttrADT(attr.Value) + case nl.IPSET_ATTR_PROTOCOL_MIN: + result.ProtocolMinVersion = attr.Value[0] + case nl.IPSET_ATTR_MARKMASK: + result.MarkMask = attr.Uint32() + default: + log.Printf("unknown ipset attribute from kernel: %+v %v", attr, attr.Type&nl.NLA_TYPE_MASK) + } + } +} + +func (result *IPSetResult) parseAttrData(data []byte) { + for attr := range nl.ParseAttributes(data) { + switch attr.Type { + case nl.IPSET_ATTR_HASHSIZE | nl.NLA_F_NET_BYTEORDER: + result.HashSize = attr.Uint32() + case nl.IPSET_ATTR_MAXELEM | nl.NLA_F_NET_BYTEORDER: + result.MaxElements = attr.Uint32() + case nl.IPSET_ATTR_TIMEOUT | nl.NLA_F_NET_BYTEORDER: + val := attr.Uint32() + result.Timeout = &val + case nl.IPSET_ATTR_ELEMENTS | nl.NLA_F_NET_BYTEORDER: + result.NumEntries = attr.Uint32() + case nl.IPSET_ATTR_REFERENCES | nl.NLA_F_NET_BYTEORDER: + result.References = attr.Uint32() + case nl.IPSET_ATTR_MEMSIZE | nl.NLA_F_NET_BYTEORDER: + result.SizeInMemory = attr.Uint32() + case nl.IPSET_ATTR_CADT_FLAGS | nl.NLA_F_NET_BYTEORDER: + result.CadtFlags = attr.Uint32() + case nl.IPSET_ATTR_IP | nl.NLA_F_NESTED: + for nested := range nl.ParseAttributes(attr.Value) { + switch nested.Type { + case nl.IPSET_ATTR_IP | nl.NLA_F_NET_BYTEORDER: + result.Entries = append(result.Entries, IPSetEntry{IP: nested.Value}) + case nl.IPSET_ATTR_IP: + result.IPFrom = nested.Value + default: + log.Printf("unknown nested ipset data attribute from kernel: %+v %v", nested, nested.Type&nl.NLA_TYPE_MASK) + } + } + case nl.IPSET_ATTR_IP_TO | nl.NLA_F_NESTED: + for nested := range nl.ParseAttributes(attr.Value) { + switch nested.Type { + case nl.IPSET_ATTR_IP: + result.IPTo = nested.Value + default: + log.Printf("unknown nested ipset data attribute from kernel: %+v %v", nested, nested.Type&nl.NLA_TYPE_MASK) + } + } + case nl.IPSET_ATTR_PORT_FROM | nl.NLA_F_NET_BYTEORDER: + result.PortFrom = networkOrder.Uint16(attr.Value) + case nl.IPSET_ATTR_PORT_TO | nl.NLA_F_NET_BYTEORDER: + result.PortTo = networkOrder.Uint16(attr.Value) + case nl.IPSET_ATTR_CADT_LINENO | nl.NLA_F_NET_BYTEORDER: + result.LineNo = attr.Uint32() + case nl.IPSET_ATTR_COMMENT: + result.Comment = nl.BytesToString(attr.Value) + case nl.IPSET_ATTR_MARKMASK: + result.MarkMask = attr.Uint32() + default: + log.Printf("unknown ipset data attribute from kernel: %+v %v", attr, attr.Type&nl.NLA_TYPE_MASK) + } + } +} + +func (result *IPSetResult) parseAttrADT(data []byte) { + for attr := range nl.ParseAttributes(data) { + switch attr.Type { + case nl.IPSET_ATTR_DATA | nl.NLA_F_NESTED: + result.Entries = append(result.Entries, parseIPSetEntry(attr.Value)) + default: + log.Printf("unknown ADT attribute from kernel: %+v %v", attr, attr.Type&nl.NLA_TYPE_MASK) + } + } +} + +func parseIPSetEntry(data []byte) (entry IPSetEntry) { + for attr := range nl.ParseAttributes(data) { + switch attr.Type { + case nl.IPSET_ATTR_TIMEOUT | nl.NLA_F_NET_BYTEORDER: + val := attr.Uint32() + entry.Timeout = &val + case nl.IPSET_ATTR_BYTES | nl.NLA_F_NET_BYTEORDER: + val := attr.Uint64() + entry.Bytes = &val + case nl.IPSET_ATTR_PACKETS | nl.NLA_F_NET_BYTEORDER: + val := attr.Uint64() + entry.Packets = &val + case nl.IPSET_ATTR_ETHER: + entry.MAC = net.HardwareAddr(attr.Value) + case nl.IPSET_ATTR_IP: + entry.IP = net.IP(attr.Value) + case nl.IPSET_ATTR_COMMENT: + entry.Comment = nl.BytesToString(attr.Value) + case nl.IPSET_ATTR_IP | nl.NLA_F_NESTED: + for attr := range nl.ParseAttributes(attr.Value) { + switch attr.Type { + case nl.IPSET_ATTR_IP: + entry.IP = net.IP(attr.Value) + default: + log.Printf("unknown nested ADT attribute from kernel: %+v", attr) + } + } + case nl.IPSET_ATTR_IP2 | nl.NLA_F_NESTED: + for attr := range nl.ParseAttributes(attr.Value) { + switch attr.Type { + case nl.IPSET_ATTR_IP: + entry.IP2 = net.IP(attr.Value) + default: + log.Printf("unknown nested ADT attribute from kernel: %+v", attr) + } + } + case nl.IPSET_ATTR_CIDR: + entry.CIDR = attr.Value[0] + case nl.IPSET_ATTR_CIDR2: + entry.CIDR2 = attr.Value[0] + case nl.IPSET_ATTR_PORT | nl.NLA_F_NET_BYTEORDER: + val := networkOrder.Uint16(attr.Value) + entry.Port = &val + case nl.IPSET_ATTR_PROTO: + val := attr.Value[0] + entry.Protocol = &val + case nl.IPSET_ATTR_IFACE: + entry.IFace = nl.BytesToString(attr.Value) + case nl.IPSET_ATTR_MARK | nl.NLA_F_NET_BYTEORDER: + val := attr.Uint32() + entry.Mark = &val + default: + log.Printf("unknown ADT attribute from kernel: %+v", attr) + } + } + return +} diff --git a/vendor/github.com/vishvananda/netlink/link.go b/vendor/github.com/vishvananda/netlink/link.go index 886d88d1b..33c872336 100644 --- a/vendor/github.com/vishvananda/netlink/link.go +++ b/vendor/github.com/vishvananda/netlink/link.go @@ -35,10 +35,13 @@ type LinkAttrs struct { Alias string Statistics *LinkStatistics Promisc int + Allmulti int + Multi int Xdp *LinkXdp EncapType string Protinfo *Protinfo OperState LinkOperState + PhysSwitchID int NetNsID int NumTxQueues int NumRxQueues int @@ -65,6 +68,17 @@ type VfInfo struct { LinkState uint32 MaxTxRate uint32 // IFLA_VF_RATE Max TxRate MinTxRate uint32 // IFLA_VF_RATE Min TxRate + RxPackets uint64 + TxPackets uint64 + RxBytes uint64 + TxBytes uint64 + Multicast uint64 + Broadcast uint64 + RxDropped uint64 + TxDropped uint64 + + RssQuery uint32 + Trust uint32 } // LinkOperState represents the values of the IFLA_OPERSTATE link @@ -103,7 +117,8 @@ func (s LinkOperState) String() string { // NewLinkAttrs returns LinkAttrs structure filled with default values func NewLinkAttrs() LinkAttrs { return LinkAttrs{ - TxQLen: -1, + NetNsID: -1, + TxQLen: -1, } } @@ -196,10 +211,11 @@ type LinkStatistics64 struct { } type LinkXdp struct { - Fd int - Attached bool - Flags uint32 - ProgId uint32 + Fd int + Attached bool + AttachMode uint32 + Flags uint32 + ProgId uint32 } // Device links cannot be created via netlink. These links @@ -246,6 +262,7 @@ func (ifb *Ifb) Type() string { type Bridge struct { LinkAttrs MulticastSnooping *bool + AgeingTime *uint32 HelloTime *uint32 VlanFiltering *bool } @@ -338,6 +355,7 @@ type Veth struct { LinkAttrs PeerName string // veth on create only PeerHardwareAddr net.HardwareAddr + PeerNamespace interface{} } func (veth *Veth) Attrs() *LinkAttrs { @@ -348,6 +366,19 @@ func (veth *Veth) Type() string { return "veth" } +// Wireguard represent links of type "wireguard", see https://www.wireguard.com/ +type Wireguard struct { + LinkAttrs +} + +func (wg *Wireguard) Attrs() *LinkAttrs { + return &wg.LinkAttrs +} + +func (wg *Wireguard) Type() string { + return "wireguard" +} + // GenericLink links represent types that are not currently understood // by this netlink library. type GenericLink struct { @@ -428,6 +459,19 @@ func (ipvlan *IPVlan) Type() string { return "ipvlan" } +// IPVtap - IPVtap is a virtual interfaces based on ipvlan +type IPVtap struct { + IPVlan +} + +func (ipvtap *IPVtap) Attrs() *LinkAttrs { + return &ipvtap.LinkAttrs +} + +func (ipvtap IPVtap) Type() string { + return "ipvtap" +} + // VlanProtocol type type VlanProtocol int @@ -527,6 +571,27 @@ const ( BOND_ARP_VALIDATE_ALL ) +var bondArpValidateToString = map[BondArpValidate]string{ + BOND_ARP_VALIDATE_NONE: "none", + BOND_ARP_VALIDATE_ACTIVE: "active", + BOND_ARP_VALIDATE_BACKUP: "backup", + BOND_ARP_VALIDATE_ALL: "none", +} +var StringToBondArpValidateMap = map[string]BondArpValidate{ + "none": BOND_ARP_VALIDATE_NONE, + "active": BOND_ARP_VALIDATE_ACTIVE, + "backup": BOND_ARP_VALIDATE_BACKUP, + "all": BOND_ARP_VALIDATE_ALL, +} + +func (b BondArpValidate) String() string { + s, ok := bondArpValidateToString[b] + if !ok { + return fmt.Sprintf("BondArpValidate(%d)", b) + } + return s +} + // BondPrimaryReselect type type BondPrimaryReselect int @@ -537,6 +602,25 @@ const ( BOND_PRIMARY_RESELECT_FAILURE ) +var bondPrimaryReselectToString = map[BondPrimaryReselect]string{ + BOND_PRIMARY_RESELECT_ALWAYS: "always", + BOND_PRIMARY_RESELECT_BETTER: "better", + BOND_PRIMARY_RESELECT_FAILURE: "failure", +} +var StringToBondPrimaryReselectMap = map[string]BondPrimaryReselect{ + "always": BOND_PRIMARY_RESELECT_ALWAYS, + "better": BOND_PRIMARY_RESELECT_BETTER, + "failure": BOND_PRIMARY_RESELECT_FAILURE, +} + +func (b BondPrimaryReselect) String() string { + s, ok := bondPrimaryReselectToString[b] + if !ok { + return fmt.Sprintf("BondPrimaryReselect(%d)", b) + } + return s +} + // BondArpAllTargets type type BondArpAllTargets int @@ -546,6 +630,23 @@ const ( BOND_ARP_ALL_TARGETS_ALL ) +var bondArpAllTargetsToString = map[BondArpAllTargets]string{ + BOND_ARP_ALL_TARGETS_ANY: "any", + BOND_ARP_ALL_TARGETS_ALL: "all", +} +var StringToBondArpAllTargetsMap = map[string]BondArpAllTargets{ + "any": BOND_ARP_ALL_TARGETS_ANY, + "all": BOND_ARP_ALL_TARGETS_ALL, +} + +func (b BondArpAllTargets) String() string { + s, ok := bondArpAllTargetsToString[b] + if !ok { + return fmt.Sprintf("BondArpAllTargets(%d)", b) + } + return s +} + // BondFailOverMac type type BondFailOverMac int @@ -556,6 +657,25 @@ const ( BOND_FAIL_OVER_MAC_FOLLOW ) +var bondFailOverMacToString = map[BondFailOverMac]string{ + BOND_FAIL_OVER_MAC_NONE: "none", + BOND_FAIL_OVER_MAC_ACTIVE: "active", + BOND_FAIL_OVER_MAC_FOLLOW: "follow", +} +var StringToBondFailOverMacMap = map[string]BondFailOverMac{ + "none": BOND_FAIL_OVER_MAC_NONE, + "active": BOND_FAIL_OVER_MAC_ACTIVE, + "follow": BOND_FAIL_OVER_MAC_FOLLOW, +} + +func (b BondFailOverMac) String() string { + s, ok := bondFailOverMacToString[b] + if !ok { + return fmt.Sprintf("BondFailOverMac(%d)", b) + } + return s +} + // BondXmitHashPolicy type type BondXmitHashPolicy int @@ -647,6 +767,25 @@ const ( BOND_AD_SELECT_COUNT ) +var bondAdSelectToString = map[BondAdSelect]string{ + BOND_AD_SELECT_STABLE: "stable", + BOND_AD_SELECT_BANDWIDTH: "bandwidth", + BOND_AD_SELECT_COUNT: "count", +} +var StringToBondAdSelectMap = map[string]BondAdSelect{ + "stable": BOND_AD_SELECT_STABLE, + "bandwidth": BOND_AD_SELECT_BANDWIDTH, + "count": BOND_AD_SELECT_COUNT, +} + +func (b BondAdSelect) String() string { + s, ok := bondAdSelectToString[b] + if !ok { + return fmt.Sprintf("BondAdSelect(%d)", b) + } + return s +} + // BondAdInfo represents ad info for bond type BondAdInfo struct { AggregatorId int @@ -678,7 +817,7 @@ type Bond struct { AllSlavesActive int MinLinks int LpInterval int - PackersPerSlave int + PacketsPerSlave int LacpRate BondLacpRate AdSelect BondAdSelect // looking at iproute tool AdInfo can only be retrived. It can't be set. @@ -711,7 +850,7 @@ func NewLinkBond(atr LinkAttrs) *Bond { AllSlavesActive: -1, MinLinks: -1, LpInterval: -1, - PackersPerSlave: -1, + PacketsPerSlave: -1, LacpRate: -1, AdSelect: -1, AdActorSysPrio: -1, @@ -761,8 +900,10 @@ func (bond *Bond) Type() string { type BondSlaveState uint8 const ( - BondStateActive = iota // Link is active. - BondStateBackup // Link is backup. + //BondStateActive Link is active. + BondStateActive BondSlaveState = iota + //BondStateBackup Link is backup. + BondStateBackup ) func (s BondSlaveState) String() string { @@ -776,15 +917,19 @@ func (s BondSlaveState) String() string { } } -// BondSlaveState represents the values of the IFLA_BOND_SLAVE_MII_STATUS bond slave +// BondSlaveMiiStatus represents the values of the IFLA_BOND_SLAVE_MII_STATUS bond slave // attribute, which contains the status of MII link monitoring type BondSlaveMiiStatus uint8 const ( - BondLinkUp = iota // link is up and running. - BondLinkFail // link has just gone down. - BondLinkDown // link has been down for too long time. - BondLinkBack // link is going back. + //BondLinkUp link is up and running. + BondLinkUp BondSlaveMiiStatus = iota + //BondLinkFail link has just gone down. + BondLinkFail + //BondLinkDown link has been down for too long time. + BondLinkDown + //BondLinkBack link is going back. + BondLinkBack ) func (s BondSlaveMiiStatus) String() string { @@ -817,6 +962,38 @@ func (b *BondSlave) SlaveType() string { return "bond" } +type VrfSlave struct { + Table uint32 +} + +func (v *VrfSlave) SlaveType() string { + return "vrf" +} + +// Geneve devices must specify RemoteIP and ID (VNI) on create +// https://github.com/torvalds/linux/blob/47ec5303d73ea344e84f46660fff693c57641386/drivers/net/geneve.c#L1209-L1223 +type Geneve struct { + LinkAttrs + ID uint32 // vni + Remote net.IP + Ttl uint8 + Tos uint8 + Dport uint16 + UdpCsum uint8 + UdpZeroCsum6Tx uint8 + UdpZeroCsum6Rx uint8 + Link uint32 + FlowBased bool +} + +func (geneve *Geneve) Attrs() *LinkAttrs { + return &geneve.LinkAttrs +} + +func (geneve *Geneve) Type() string { + return "geneve" +} + // Gretap devices must specify LocalIP and RemoteIP on create type Gretap struct { LinkAttrs @@ -861,6 +1038,7 @@ type Iptun struct { EncapType uint16 EncapFlags uint16 FlowBased bool + Proto uint8 } func (iptun *Iptun) Attrs() *LinkAttrs { @@ -878,10 +1056,14 @@ type Ip6tnl struct { Remote net.IP Ttl uint8 Tos uint8 - EncapLimit uint8 Flags uint32 Proto uint8 FlowInfo uint32 + EncapLimit uint8 + EncapType uint16 + EncapFlags uint16 + EncapSport uint16 + EncapDport uint16 } func (ip6tnl *Ip6tnl) Attrs() *LinkAttrs { @@ -892,14 +1074,47 @@ func (ip6tnl *Ip6tnl) Type() string { return "ip6tnl" } +// from https://elixir.bootlin.com/linux/v5.15.4/source/include/uapi/linux/if_tunnel.h#L84 +type TunnelEncapType uint16 + +const ( + None TunnelEncapType = iota + FOU + GUE +) + +// from https://elixir.bootlin.com/linux/v5.15.4/source/include/uapi/linux/if_tunnel.h#L91 +type TunnelEncapFlag uint16 + +const ( + CSum TunnelEncapFlag = 1 << 0 + CSum6 = 1 << 1 + RemCSum = 1 << 2 +) + +// from https://elixir.bootlin.com/linux/latest/source/include/uapi/linux/ip6_tunnel.h#L12 +type IP6TunnelFlag uint16 + +const ( + IP6_TNL_F_IGN_ENCAP_LIMIT IP6TunnelFlag = 1 // don't add encapsulation limit if one isn't present in inner packet + IP6_TNL_F_USE_ORIG_TCLASS = 2 // copy the traffic class field from the inner packet + IP6_TNL_F_USE_ORIG_FLOWLABEL = 4 // copy the flowlabel from the inner packet + IP6_TNL_F_MIP6_DEV = 8 // being used for Mobile IPv6 + IP6_TNL_F_RCV_DSCP_COPY = 10 // copy DSCP from the outer packet + IP6_TNL_F_USE_ORIG_FWMARK = 20 // copy fwmark from inner packet + IP6_TNL_F_ALLOW_LOCAL_REMOTE = 40 // allow remote endpoint on the local node +) + type Sittun struct { LinkAttrs Link uint32 - Local net.IP - Remote net.IP Ttl uint8 Tos uint8 PMtuDisc uint8 + Proto uint8 + Local net.IP + Remote net.IP + EncapLimit uint8 EncapType uint16 EncapFlags uint16 EncapSport uint16 @@ -1034,6 +1249,58 @@ var StringToIPoIBMode = map[string]IPoIBMode{ "connected": IPOIB_MODE_CONNECTED, } +const ( + CAN_STATE_ERROR_ACTIVE = iota + CAN_STATE_ERROR_WARNING + CAN_STATE_ERROR_PASSIVE + CAN_STATE_BUS_OFF + CAN_STATE_STOPPED + CAN_STATE_SLEEPING +) + +type Can struct { + LinkAttrs + + BitRate uint32 + SamplePoint uint32 + TimeQuanta uint32 + PropagationSegment uint32 + PhaseSegment1 uint32 + PhaseSegment2 uint32 + SyncJumpWidth uint32 + BitRatePreScaler uint32 + + Name string + TimeSegment1Min uint32 + TimeSegment1Max uint32 + TimeSegment2Min uint32 + TimeSegment2Max uint32 + SyncJumpWidthMax uint32 + BitRatePreScalerMin uint32 + BitRatePreScalerMax uint32 + BitRatePreScalerInc uint32 + + ClockFrequency uint32 + + State uint32 + + Mask uint32 + Flags uint32 + + TxError uint16 + RxError uint16 + + RestartMs uint32 +} + +func (can *Can) Attrs() *LinkAttrs { + return &can.LinkAttrs +} + +func (can *Can) Type() string { + return "can" +} + type IPoIB struct { LinkAttrs Pkey uint16 @@ -1049,11 +1316,27 @@ func (ipoib *IPoIB) Type() string { return "ipoib" } +type BareUDP struct { + LinkAttrs + Port uint16 + EtherType uint16 + SrcPortMin uint16 + MultiProto bool +} + +func (bareudp *BareUDP) Attrs() *LinkAttrs { + return &bareudp.LinkAttrs +} + +func (bareudp *BareUDP) Type() string { + return "bareudp" +} + // iproute2 supported devices; // vlan | veth | vcan | dummy | ifb | macvlan | macvtap | // bridge | bond | ipoib | ip6tnl | ipip | sit | vxlan | // gre | gretap | ip6gre | ip6gretap | vti | vti6 | nlmon | -// bond_slave | ipvlan | xfrm +// bond_slave | ipvlan | xfrm | bareudp // LinkNotFoundError wraps the various not found errors when // getting/reading links. This is intended for better error diff --git a/vendor/github.com/vishvananda/netlink/link_linux.go b/vendor/github.com/vishvananda/netlink/link_linux.go index ec915a0b9..276947a00 100644 --- a/vendor/github.com/vishvananda/netlink/link_linux.go +++ b/vendor/github.com/vishvananda/netlink/link_linux.go @@ -34,14 +34,27 @@ const ( TUNTAP_MULTI_QUEUE_DEFAULTS TuntapFlag = TUNTAP_MULTI_QUEUE | TUNTAP_NO_PI ) +var StringToTuntapModeMap = map[string]TuntapMode{ + "tun": TUNTAP_MODE_TUN, + "tap": TUNTAP_MODE_TAP, +} + +func (ttm TuntapMode) String() string { + switch ttm { + case TUNTAP_MODE_TUN: + return "tun" + case TUNTAP_MODE_TAP: + return "tap" + } + return "unknown" +} + const ( VF_LINK_STATE_AUTO uint32 = 0 VF_LINK_STATE_ENABLE uint32 = 1 VF_LINK_STATE_DISABLE uint32 = 2 ) -var lookupByDump = false - var macvlanModes = [...]uint32{ 0, nl.MACVLAN_MODE_PRIVATE, @@ -138,7 +151,6 @@ func (h *Handle) LinkSetAllmulticastOn(link Link) error { msg := nl.NewIfInfomsg(unix.AF_UNSPEC) msg.Change = unix.IFF_ALLMULTI msg.Flags = unix.IFF_ALLMULTI - msg.Index = int32(base.Index) req.AddData(msg) @@ -168,6 +180,51 @@ func (h *Handle) LinkSetAllmulticastOff(link Link) error { return err } +// LinkSetMulticastOn enables the reception of multicast packets for the link device. +// Equivalent to: `ip link set $link multicast on` +func LinkSetMulticastOn(link Link) error { + return pkgHandle.LinkSetMulticastOn(link) +} + +// LinkSetMulticastOn enables the reception of multicast packets for the link device. +// Equivalent to: `ip link set $link multicast on` +func (h *Handle) LinkSetMulticastOn(link Link) error { + base := link.Attrs() + h.ensureIndex(base) + req := h.newNetlinkRequest(unix.RTM_NEWLINK, unix.NLM_F_ACK) + + msg := nl.NewIfInfomsg(unix.AF_UNSPEC) + msg.Change = unix.IFF_MULTICAST + msg.Flags = unix.IFF_MULTICAST + msg.Index = int32(base.Index) + req.AddData(msg) + + _, err := req.Execute(unix.NETLINK_ROUTE, 0) + return err +} + +// LinkSetAllmulticastOff disables the reception of multicast packets for the link device. +// Equivalent to: `ip link set $link multicast off` +func LinkSetMulticastOff(link Link) error { + return pkgHandle.LinkSetMulticastOff(link) +} + +// LinkSetAllmulticastOff disables the reception of multicast packets for the link device. +// Equivalent to: `ip link set $link multicast off` +func (h *Handle) LinkSetMulticastOff(link Link) error { + base := link.Attrs() + h.ensureIndex(base) + req := h.newNetlinkRequest(unix.RTM_NEWLINK, unix.NLM_F_ACK) + + msg := nl.NewIfInfomsg(unix.AF_UNSPEC) + msg.Change = unix.IFF_MULTICAST + msg.Index = int32(base.Index) + req.AddData(msg) + + _, err := req.Execute(unix.NETLINK_ROUTE, 0) + return err +} + func MacvlanMACAddrAdd(link Link, addr net.HardwareAddr) error { return pkgHandle.MacvlanMACAddrAdd(link, addr) } @@ -237,6 +294,37 @@ func (h *Handle) macvlanMACAddrChange(link Link, addrs []net.HardwareAddr, mode return err } +// LinkSetMacvlanMode sets the mode of a macvlan or macvtap link device. +// Note that passthrough mode cannot be set to and from and will fail. +// Equivalent to: `ip link set $link type (macvlan|macvtap) mode $mode +func LinkSetMacvlanMode(link Link, mode MacvlanMode) error { + return pkgHandle.LinkSetMacvlanMode(link, mode) +} + +// LinkSetMacvlanMode sets the mode of the macvlan or macvtap link device. +// Note that passthrough mode cannot be set to and from and will fail. +// Equivalent to: `ip link set $link type (macvlan|macvtap) mode $mode +func (h *Handle) LinkSetMacvlanMode(link Link, mode MacvlanMode) error { + base := link.Attrs() + h.ensureIndex(base) + req := h.newNetlinkRequest(unix.RTM_NEWLINK, unix.NLM_F_ACK) + + msg := nl.NewIfInfomsg(unix.AF_UNSPEC) + msg.Index = int32(base.Index) + req.AddData(msg) + + linkInfo := nl.NewRtAttr(unix.IFLA_LINKINFO, nil) + linkInfo.AddRtAttr(nl.IFLA_INFO_KIND, nl.NonZeroTerminated(link.Type())) + + data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) + data.AddRtAttr(nl.IFLA_MACVLAN_MODE, nl.Uint32Attr(macvlanModes[mode])) + + req.AddData(linkInfo) + + _, err := req.Execute(unix.NETLINK_ROUTE, 0) + return err +} + func BridgeSetMcastSnoop(link Link, on bool) error { return pkgHandle.BridgeSetMcastSnoop(link, on) } @@ -247,6 +335,16 @@ func (h *Handle) BridgeSetMcastSnoop(link Link, on bool) error { return h.linkModify(bridge, unix.NLM_F_ACK) } +func BridgeSetVlanFiltering(link Link, on bool) error { + return pkgHandle.BridgeSetVlanFiltering(link, on) +} + +func (h *Handle) BridgeSetVlanFiltering(link Link, on bool) error { + bridge := link.(*Bridge) + bridge.VlanFiltering = &on + return h.linkModify(bridge, unix.NLM_F_ACK) +} + func SetPromiscOn(link Link) error { return pkgHandle.SetPromiscOn(link) } @@ -491,13 +589,13 @@ func (h *Handle) LinkSetVfVlanQos(link Link, vf, vlan, qos int) error { req.AddData(msg) data := nl.NewRtAttr(unix.IFLA_VFINFO_LIST, nil) - info := nl.NewRtAttrChild(data, nl.IFLA_VF_INFO, nil) + info := data.AddRtAttr(nl.IFLA_VF_INFO, nil) vfmsg := nl.VfVlan{ Vf: uint32(vf), Vlan: uint32(vlan), Qos: uint32(qos), } - nl.NewRtAttrChild(info, nl.IFLA_VF_VLAN, vfmsg.Serialize()) + info.AddRtAttr(nl.IFLA_VF_VLAN, vfmsg.Serialize()) req.AddData(data) _, err := req.Execute(unix.NETLINK_ROUTE, 0) @@ -1005,8 +1103,8 @@ func addBondAttrs(bond *Bond, linkInfo *nl.RtAttr) { if bond.LpInterval >= 0 { data.AddRtAttr(nl.IFLA_BOND_LP_INTERVAL, nl.Uint32Attr(uint32(bond.LpInterval))) } - if bond.PackersPerSlave >= 0 { - data.AddRtAttr(nl.IFLA_BOND_PACKETS_PER_SLAVE, nl.Uint32Attr(uint32(bond.PackersPerSlave))) + if bond.PacketsPerSlave >= 0 { + data.AddRtAttr(nl.IFLA_BOND_PACKETS_PER_SLAVE, nl.Uint32Attr(uint32(bond.PacketsPerSlave))) } if bond.LacpRate >= 0 { data.AddRtAttr(nl.IFLA_BOND_AD_LACP_RATE, nl.Uint8Attr(uint8(bond.LacpRate))) @@ -1048,6 +1146,14 @@ func (h *Handle) LinkAdd(link Link) error { return h.linkModify(link, unix.NLM_F_CREATE|unix.NLM_F_EXCL|unix.NLM_F_ACK) } +func LinkModify(link Link) error { + return pkgHandle.LinkModify(link) +} + +func (h *Handle) LinkModify(link Link) error { + return h.linkModify(link, unix.NLM_F_REQUEST|unix.NLM_F_ACK) +} + func (h *Handle) linkModify(link Link, flags int) error { // TODO: support extra data for macvlan base := link.Attrs() @@ -1060,8 +1166,6 @@ func (h *Handle) linkModify(link Link, flags int) error { } if isTuntap { - // TODO: support user - // TODO: support group if tuntap.Mode < unix.IFF_TUN || tuntap.Mode > unix.IFF_TAP { return fmt.Errorf("Tuntap.Mode %v unknown", tuntap.Mode) } @@ -1089,21 +1193,64 @@ func (h *Handle) linkModify(link Link, flags int) error { } req.Flags |= uint16(tuntap.Mode) - + const TUN = "/dev/net/tun" for i := 0; i < queues; i++ { localReq := req - file, err := os.OpenFile("/dev/net/tun", os.O_RDWR, 0) + fd, err := unix.Open(TUN, os.O_RDWR|syscall.O_CLOEXEC, 0) if err != nil { cleanupFds(fds) return err } - fds = append(fds, file) - _, _, errno := unix.Syscall(unix.SYS_IOCTL, file.Fd(), uintptr(unix.TUNSETIFF), uintptr(unsafe.Pointer(&localReq))) + _, _, errno := unix.Syscall(unix.SYS_IOCTL, uintptr(fd), uintptr(unix.TUNSETIFF), uintptr(unsafe.Pointer(&localReq))) if errno != 0 { + // close the new fd + unix.Close(fd) + // and the already opened ones cleanupFds(fds) return fmt.Errorf("Tuntap IOCTL TUNSETIFF failed [%d], errno %v", i, errno) } + + _, _, errno = syscall.Syscall(syscall.SYS_IOCTL, uintptr(fd), syscall.TUNSETOWNER, uintptr(tuntap.Owner)) + if errno != 0 { + cleanupFds(fds) + return fmt.Errorf("Tuntap IOCTL TUNSETOWNER failed [%d], errno %v", i, errno) + } + + _, _, errno = syscall.Syscall(syscall.SYS_IOCTL, uintptr(fd), syscall.TUNSETGROUP, uintptr(tuntap.Group)) + if errno != 0 { + cleanupFds(fds) + return fmt.Errorf("Tuntap IOCTL TUNSETGROUP failed [%d], errno %v", i, errno) + } + + // Set the tun device to non-blocking before use. The below comment + // taken from: + // + // https://github.com/mistsys/tuntap/commit/161418c25003bbee77d085a34af64d189df62bea + // + // Note there is a complication because in go, if a device node is + // opened, go sets it to use nonblocking I/O. However a /dev/net/tun + // doesn't work with epoll until after the TUNSETIFF ioctl has been + // done. So we open the unix fd directly, do the ioctl, then put the + // fd in nonblocking mode, an then finally wrap it in a os.File, + // which will see the nonblocking mode and add the fd to the + // pollable set, so later on when we Read() from it blocked the + // calling thread in the kernel. + // + // See + // https://github.com/golang/go/issues/30426 + // which got exposed in go 1.13 by the fix to + // https://github.com/golang/go/issues/30624 + err = unix.SetNonblock(fd, true) + if err != nil { + cleanupFds(fds) + return fmt.Errorf("Tuntap set to non-blocking failed [%d], err %v", i, err) + } + + // create the file from the file descriptor and store it + file := os.NewFile(uintptr(fd), TUN) + fds = append(fds, file) + // 1) we only care for the name of the first tap in the multi queue set // 2) if the original name was empty, the localReq has now the actual name // @@ -1114,11 +1261,29 @@ func (h *Handle) linkModify(link Link, flags int) error { if i == 0 { link.Attrs().Name = strings.Trim(string(localReq.Name[:]), "\x00") } + + } + + control := func(file *os.File, f func(fd uintptr)) error { + name := file.Name() + conn, err := file.SyscallConn() + if err != nil { + return fmt.Errorf("SyscallConn() failed on %s: %v", name, err) + } + if err := conn.Control(f); err != nil { + return fmt.Errorf("Failed to get file descriptor for %s: %v", name, err) + } + return nil } // only persist interface if NonPersist is NOT set if !tuntap.NonPersist { - _, _, errno := unix.Syscall(unix.SYS_IOCTL, fds[0].Fd(), uintptr(unix.TUNSETPERSIST), 1) + var errno syscall.Errno + if err := control(fds[0], func(fd uintptr) { + _, _, errno = unix.Syscall(unix.SYS_IOCTL, fd, uintptr(unix.TUNSETPERSIST), 1) + }); err != nil { + return err + } if errno != 0 { cleanupFds(fds) return fmt.Errorf("Tuntap IOCTL TUNSETPERSIST failed, errno %v", errno) @@ -1135,7 +1300,10 @@ func (h *Handle) linkModify(link Link, flags int) error { // un-persist (e.g. allow the interface to be removed) the tuntap // should not hurt if not set prior, condition might be not needed if !tuntap.NonPersist { - _, _, _ = unix.Syscall(unix.SYS_IOCTL, fds[0].Fd(), uintptr(unix.TUNSETPERSIST), 0) + // ignore error + _ = control(fds[0], func(fd uintptr) { + _, _, _ = unix.Syscall(unix.SYS_IOCTL, fd, uintptr(unix.TUNSETPERSIST), 0) + }) } cleanupFds(fds) return err @@ -1193,6 +1361,11 @@ func (h *Handle) linkModify(link Link, flags int) error { nameData := nl.NewRtAttr(unix.IFLA_IFNAME, nl.ZeroTerminated(base.Name)) req.AddData(nameData) + if base.Alias != "" { + alias := nl.NewRtAttr(unix.IFLA_IFALIAS, []byte(base.Alias)) + req.AddData(alias) + } + if base.MTU > 0 { mtu := nl.NewRtAttr(unix.IFLA_MTU, nl.Uint32Attr(uint32(base.MTU))) req.AddData(mtu) @@ -1272,12 +1445,28 @@ func (h *Handle) linkModify(link Link, flags int) error { if base.TxQLen >= 0 { peer.AddRtAttr(unix.IFLA_TXQLEN, nl.Uint32Attr(uint32(base.TxQLen))) } + if base.NumTxQueues > 0 { + peer.AddRtAttr(unix.IFLA_NUM_TX_QUEUES, nl.Uint32Attr(uint32(base.NumTxQueues))) + } + if base.NumRxQueues > 0 { + peer.AddRtAttr(unix.IFLA_NUM_RX_QUEUES, nl.Uint32Attr(uint32(base.NumRxQueues))) + } if base.MTU > 0 { peer.AddRtAttr(unix.IFLA_MTU, nl.Uint32Attr(uint32(base.MTU))) } if link.PeerHardwareAddr != nil { peer.AddRtAttr(unix.IFLA_ADDRESS, []byte(link.PeerHardwareAddr)) } + if link.PeerNamespace != nil { + switch ns := link.PeerNamespace.(type) { + case NsPid: + val := nl.Uint32Attr(uint32(ns)) + peer.AddRtAttr(unix.IFLA_NET_NS_PID, val) + case NsFd: + val := nl.Uint32Attr(uint32(ns)) + peer.AddRtAttr(unix.IFLA_NET_NS_FD, val) + } + } case *Vxlan: addVxlanAttrs(link, linkInfo) case *Bond: @@ -1286,6 +1475,10 @@ func (h *Handle) linkModify(link Link, flags int) error { data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) data.AddRtAttr(nl.IFLA_IPVLAN_MODE, nl.Uint16Attr(uint16(link.Mode))) data.AddRtAttr(nl.IFLA_IPVLAN_FLAG, nl.Uint16Attr(uint16(link.Flag))) + case *IPVtap: + data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) + data.AddRtAttr(nl.IFLA_IPVLAN_MODE, nl.Uint16Attr(uint16(link.Mode))) + data.AddRtAttr(nl.IFLA_IPVLAN_FLAG, nl.Uint16Attr(uint16(link.Flag))) case *Macvlan: if link.Mode != MACVLAN_MODE_DEFAULT { data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) @@ -1296,6 +1489,8 @@ func (h *Handle) linkModify(link Link, flags int) error { data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) data.AddRtAttr(nl.IFLA_MACVLAN_MODE, nl.Uint32Attr(macvlanModes[link.Mode])) } + case *Geneve: + addGeneveAttrs(link, linkInfo) case *Gretap: addGretapAttrs(link, linkInfo) case *Iptun: @@ -1318,6 +1513,8 @@ func (h *Handle) linkModify(link Link, flags int) error { addXfrmiAttrs(link, linkInfo) case *IPoIB: addIPoIBAttrs(link, linkInfo) + case *BareUDP: + addBareUDPAttrs(link, linkInfo) } req.AddData(linkInfo) @@ -1499,7 +1696,7 @@ func execGetLink(req *nl.NetlinkRequest) (Link, error) { } } -// linkDeserialize deserializes a raw message received from netlink into +// LinkDeserialize deserializes a raw message received from netlink into // a link object. func LinkDeserialize(hdr *unix.NlMsghdr, m []byte) (Link, error) { msg := nl.DeserializeIfInfomsg(m) @@ -1509,10 +1706,22 @@ func LinkDeserialize(hdr *unix.NlMsghdr, m []byte) (Link, error) { return nil, err } - base := LinkAttrs{Index: int(msg.Index), RawFlags: msg.Flags, Flags: linkFlags(msg.Flags), EncapType: msg.EncapType()} + base := NewLinkAttrs() + base.Index = int(msg.Index) + base.RawFlags = msg.Flags + base.Flags = linkFlags(msg.Flags) + base.EncapType = msg.EncapType() + base.NetNsID = -1 if msg.Flags&unix.IFF_PROMISC != 0 { base.Promisc = 1 } + if msg.Flags&unix.IFF_ALLMULTI != 0 { + base.Allmulti = 1 + } + if msg.Flags&unix.IFF_MULTICAST != 0 { + base.Multi = 1 + } + var ( link Link stats32 *LinkStatistics32 @@ -1543,16 +1752,22 @@ func LinkDeserialize(hdr *unix.NlMsghdr, m []byte) (Link, error) { link = &Vlan{} case "veth": link = &Veth{} + case "wireguard": + link = &Wireguard{} case "vxlan": link = &Vxlan{} case "bond": link = &Bond{} case "ipvlan": link = &IPVlan{} + case "ipvtap": + link = &IPVtap{} case "macvlan": link = &Macvlan{} case "macvtap": link = &Macvtap{} + case "geneve": + link = &Geneve{} case "gretap": link = &Gretap{} case "ip6gretap": @@ -1579,6 +1794,10 @@ func LinkDeserialize(hdr *unix.NlMsghdr, m []byte) (Link, error) { link = &Tuntap{} case "ipoib": link = &IPoIB{} + case "can": + link = &Can{} + case "bareudp": + link = &BareUDP{} default: link = &GenericLink{LinkType: linkType} } @@ -1596,10 +1815,14 @@ func LinkDeserialize(hdr *unix.NlMsghdr, m []byte) (Link, error) { parseBondData(link, data) case "ipvlan": parseIPVlanData(link, data) + case "ipvtap": + parseIPVtapData(link, data) case "macvlan": parseMacvlanData(link, data) case "macvtap": parseMacvtapData(link, data) + case "geneve": + parseGeneveData(link, data) case "gretap": parseGretapData(link, data) case "ip6gretap": @@ -1628,13 +1851,21 @@ func LinkDeserialize(hdr *unix.NlMsghdr, m []byte) (Link, error) { parseTuntapData(link, data) case "ipoib": parseIPoIBData(link, data) + case "can": + parseCanData(link, data) + case "bareudp": + parseBareUDPData(link, data) } + case nl.IFLA_INFO_SLAVE_KIND: slaveType = string(info.Value[:len(info.Value)-1]) switch slaveType { case "bond": linkSlave = &BondSlave{} + case "vrf": + linkSlave = &VrfSlave{} } + case nl.IFLA_INFO_SLAVE_DATA: switch slaveType { case "bond": @@ -1643,6 +1874,12 @@ func LinkDeserialize(hdr *unix.NlMsghdr, m []byte) (Link, error) { return nil, err } parseBondSlaveData(linkSlave, data) + case "vrf": + data, err := nl.ParseRouteAttr(info.Value) + if err != nil { + return nil, err + } + parseVrfSlaveData(linkSlave, data) } } } @@ -1696,6 +1933,8 @@ func LinkDeserialize(hdr *unix.NlMsghdr, m []byte) (Link, error) { } case unix.IFLA_OPERSTATE: base.OperState = LinkOperState(uint8(attr.Value[0])) + case unix.IFLA_PHYS_SWITCH_ID: + base.PhysSwitchID = int(native.Uint32(attr.Value[0:4])) case unix.IFLA_LINK_NETNSID: base.NetNsID = int(native.Uint32(attr.Value[0:4])) case unix.IFLA_GSO_MAX_SIZE: @@ -1884,7 +2123,8 @@ func linkSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- LinkUpdate, done <-c msgs, from, err := s.Receive() if err != nil { if cberr != nil { - cberr(err) + cberr(fmt.Errorf("Receive failed: %v", + err)) } return } @@ -1899,15 +2139,15 @@ func linkSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- LinkUpdate, done <-c continue } if m.Header.Type == unix.NLMSG_ERROR { - native := nl.NativeEndian() error := int32(native.Uint32(m.Data[0:4])) if error == 0 { continue } if cberr != nil { - cberr(syscall.Errno(-error)) + cberr(fmt.Errorf("error message: %v", + syscall.Errno(-error))) } - return + continue } ifmsg := nl.DeserializeIfInfomsg(m.Data) header := unix.NlMsghdr(m.Header) @@ -1916,7 +2156,7 @@ func linkSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- LinkUpdate, done <-c if cberr != nil { cberr(err) } - return + continue } ch <- LinkUpdate{IfInfomsg: *ifmsg, Header: header, Link: link} } @@ -2080,6 +2320,13 @@ func parseVlanData(link Link, data []syscall.NetlinkRouteAttr) { func parseVxlanData(link Link, data []syscall.NetlinkRouteAttr) { vxlan := link.(*Vxlan) for _, datum := range data { + // NOTE(vish): Apparently some messages can be sent with no value. + // We special case GBP here to not change existing + // functionality. It appears that GBP sends a datum.Value + // of null. + if len(datum.Value) == 0 && datum.Attr.Type != nl.IFLA_VXLAN_GBP { + continue + } switch datum.Attr.Type { case nl.IFLA_VXLAN_ID: vxlan.VxlanId = int(native.Uint32(datum.Value[0:4])) @@ -2178,7 +2425,7 @@ func parseBondData(link Link, data []syscall.NetlinkRouteAttr) { case nl.IFLA_BOND_LP_INTERVAL: bond.LpInterval = int(native.Uint32(data[i].Value[0:4])) case nl.IFLA_BOND_PACKETS_PER_SLAVE: - bond.PackersPerSlave = int(native.Uint32(data[i].Value[0:4])) + bond.PacketsPerSlave = int(native.Uint32(data[i].Value[0:4])) case nl.IFLA_BOND_AD_LACP_RATE: bond.LacpRate = BondLacpRate(data[i].Value[0]) case nl.IFLA_BOND_AD_SELECT: @@ -2258,6 +2505,16 @@ func parseBondSlaveData(slave LinkSlave, data []syscall.NetlinkRouteAttr) { } } +func parseVrfSlaveData(slave LinkSlave, data []syscall.NetlinkRouteAttr) { + vrfSlave := slave.(*VrfSlave) + for i := range data { + switch data[i].Attr.Type { + case nl.IFLA_BOND_SLAVE_STATE: + vrfSlave.Table = native.Uint32(data[i].Value[0:4]) + } + } +} + func parseIPVlanData(link Link, data []syscall.NetlinkRouteAttr) { ipv := link.(*IPVlan) for _, datum := range data { @@ -2270,6 +2527,18 @@ func parseIPVlanData(link Link, data []syscall.NetlinkRouteAttr) { } } +func parseIPVtapData(link Link, data []syscall.NetlinkRouteAttr) { + ipv := link.(*IPVtap) + for _, datum := range data { + switch datum.Attr.Type { + case nl.IFLA_IPVLAN_MODE: + ipv.Mode = IPVlanMode(native.Uint32(datum.Value[0:4])) + case nl.IFLA_IPVLAN_FLAG: + ipv.Flag = IPVlanFlag(native.Uint32(datum.Value[0:4])) + } + } +} + func parseMacvtapData(link Link, data []syscall.NetlinkRouteAttr) { macv := link.(*Macvtap) parseMacvlanData(&macv.Macvlan, data) @@ -2327,6 +2596,58 @@ func linkFlags(rawFlags uint32) net.Flags { return f } +func addGeneveAttrs(geneve *Geneve, linkInfo *nl.RtAttr) { + data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) + + if geneve.FlowBased { + // In flow based mode, no other attributes need to be configured + linkInfo.AddRtAttr(nl.IFLA_GENEVE_COLLECT_METADATA, boolAttr(geneve.FlowBased)) + return + } + + if ip := geneve.Remote; ip != nil { + if ip4 := ip.To4(); ip4 != nil { + data.AddRtAttr(nl.IFLA_GENEVE_REMOTE, ip.To4()) + } else { + data.AddRtAttr(nl.IFLA_GENEVE_REMOTE6, []byte(ip)) + } + } + + if geneve.ID != 0 { + data.AddRtAttr(nl.IFLA_GENEVE_ID, nl.Uint32Attr(geneve.ID)) + } + + if geneve.Dport != 0 { + data.AddRtAttr(nl.IFLA_GENEVE_PORT, htons(geneve.Dport)) + } + + if geneve.Ttl != 0 { + data.AddRtAttr(nl.IFLA_GENEVE_TTL, nl.Uint8Attr(geneve.Ttl)) + } + + if geneve.Tos != 0 { + data.AddRtAttr(nl.IFLA_GENEVE_TOS, nl.Uint8Attr(geneve.Tos)) + } +} + +func parseGeneveData(link Link, data []syscall.NetlinkRouteAttr) { + geneve := link.(*Geneve) + for _, datum := range data { + switch datum.Attr.Type { + case nl.IFLA_GENEVE_ID: + geneve.ID = native.Uint32(datum.Value[0:4]) + case nl.IFLA_GENEVE_REMOTE, nl.IFLA_GENEVE_REMOTE6: + geneve.Remote = datum.Value + case nl.IFLA_GENEVE_PORT: + geneve.Dport = ntohs(datum.Value[0:2]) + case nl.IFLA_GENEVE_TTL: + geneve.Ttl = uint8(datum.Value[0]) + case nl.IFLA_GENEVE_TOS: + geneve.Tos = uint8(datum.Value[0]) + } + } +} + func addGretapAttrs(gretap *Gretap, linkInfo *nl.RtAttr) { data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) @@ -2513,7 +2834,8 @@ func parseLinkXdp(data []byte) (*LinkXdp, error) { case nl.IFLA_XDP_FD: xdp.Fd = int(native.Uint32(attr.Value[0:4])) case nl.IFLA_XDP_ATTACHED: - xdp.Attached = attr.Value[0] != 0 + xdp.AttachMode = uint32(attr.Value[0]) + xdp.Attached = xdp.AttachMode != 0 case nl.IFLA_XDP_FLAGS: xdp.Flags = native.Uint32(attr.Value[0:4]) case nl.IFLA_XDP_PROG_ID: @@ -2552,11 +2874,16 @@ func addIptunAttrs(iptun *Iptun, linkInfo *nl.RtAttr) { data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_FLAGS, nl.Uint16Attr(iptun.EncapFlags)) data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_SPORT, htons(iptun.EncapSport)) data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_DPORT, htons(iptun.EncapDport)) + data.AddRtAttr(nl.IFLA_IPTUN_PROTO, nl.Uint8Attr(iptun.Proto)) } func parseIptunData(link Link, data []syscall.NetlinkRouteAttr) { iptun := link.(*Iptun) for _, datum := range data { + // NOTE: same with vxlan, ip tunnel may also has null datum.Value + if len(datum.Value) == 0 { + continue + } switch datum.Attr.Type { case nl.IFLA_IPTUN_LOCAL: iptun.Local = net.IP(datum.Value[0:4]) @@ -2577,7 +2904,9 @@ func parseIptunData(link Link, data []syscall.NetlinkRouteAttr) { case nl.IFLA_IPTUN_ENCAP_FLAGS: iptun.EncapFlags = native.Uint16(datum.Value[0:2]) case nl.IFLA_IPTUN_COLLECT_METADATA: - iptun.FlowBased = int8(datum.Value[0]) != 0 + iptun.FlowBased = true + case nl.IFLA_IPTUN_PROTO: + iptun.Proto = datum.Value[0] } } } @@ -2601,10 +2930,14 @@ func addIp6tnlAttrs(ip6tnl *Ip6tnl, linkInfo *nl.RtAttr) { data.AddRtAttr(nl.IFLA_IPTUN_TTL, nl.Uint8Attr(ip6tnl.Ttl)) data.AddRtAttr(nl.IFLA_IPTUN_TOS, nl.Uint8Attr(ip6tnl.Tos)) - data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_LIMIT, nl.Uint8Attr(ip6tnl.EncapLimit)) data.AddRtAttr(nl.IFLA_IPTUN_FLAGS, nl.Uint32Attr(ip6tnl.Flags)) data.AddRtAttr(nl.IFLA_IPTUN_PROTO, nl.Uint8Attr(ip6tnl.Proto)) data.AddRtAttr(nl.IFLA_IPTUN_FLOWINFO, nl.Uint32Attr(ip6tnl.FlowInfo)) + data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_LIMIT, nl.Uint8Attr(ip6tnl.EncapLimit)) + data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_TYPE, nl.Uint16Attr(ip6tnl.EncapType)) + data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_FLAGS, nl.Uint16Attr(ip6tnl.EncapFlags)) + data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_SPORT, htons(ip6tnl.EncapSport)) + data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_DPORT, htons(ip6tnl.EncapDport)) } func parseIp6tnlData(link Link, data []syscall.NetlinkRouteAttr) { @@ -2616,17 +2949,25 @@ func parseIp6tnlData(link Link, data []syscall.NetlinkRouteAttr) { case nl.IFLA_IPTUN_REMOTE: ip6tnl.Remote = net.IP(datum.Value[:16]) case nl.IFLA_IPTUN_TTL: - ip6tnl.Ttl = uint8(datum.Value[0]) + ip6tnl.Ttl = datum.Value[0] case nl.IFLA_IPTUN_TOS: - ip6tnl.Tos = uint8(datum.Value[0]) - case nl.IFLA_IPTUN_ENCAP_LIMIT: - ip6tnl.EncapLimit = uint8(datum.Value[0]) + ip6tnl.Tos = datum.Value[0] case nl.IFLA_IPTUN_FLAGS: ip6tnl.Flags = native.Uint32(datum.Value[:4]) case nl.IFLA_IPTUN_PROTO: - ip6tnl.Proto = uint8(datum.Value[0]) + ip6tnl.Proto = datum.Value[0] case nl.IFLA_IPTUN_FLOWINFO: ip6tnl.FlowInfo = native.Uint32(datum.Value[:4]) + case nl.IFLA_IPTUN_ENCAP_LIMIT: + ip6tnl.EncapLimit = datum.Value[0] + case nl.IFLA_IPTUN_ENCAP_TYPE: + ip6tnl.EncapType = native.Uint16(datum.Value[0:2]) + case nl.IFLA_IPTUN_ENCAP_FLAGS: + ip6tnl.EncapFlags = native.Uint16(datum.Value[0:2]) + case nl.IFLA_IPTUN_ENCAP_SPORT: + ip6tnl.EncapSport = ntohs(datum.Value[0:2]) + case nl.IFLA_IPTUN_ENCAP_DPORT: + ip6tnl.EncapDport = ntohs(datum.Value[0:2]) } } } @@ -2653,8 +2994,10 @@ func addSittunAttrs(sittun *Sittun, linkInfo *nl.RtAttr) { data.AddRtAttr(nl.IFLA_IPTUN_TTL, nl.Uint8Attr(sittun.Ttl)) } + data.AddRtAttr(nl.IFLA_IPTUN_PROTO, nl.Uint8Attr(sittun.Proto)) data.AddRtAttr(nl.IFLA_IPTUN_TOS, nl.Uint8Attr(sittun.Tos)) data.AddRtAttr(nl.IFLA_IPTUN_PMTUDISC, nl.Uint8Attr(sittun.PMtuDisc)) + data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_LIMIT, nl.Uint8Attr(sittun.EncapLimit)) data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_TYPE, nl.Uint16Attr(sittun.EncapType)) data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_FLAGS, nl.Uint16Attr(sittun.EncapFlags)) data.AddRtAttr(nl.IFLA_IPTUN_ENCAP_SPORT, htons(sittun.EncapSport)) @@ -2670,11 +3013,13 @@ func parseSittunData(link Link, data []syscall.NetlinkRouteAttr) { case nl.IFLA_IPTUN_REMOTE: sittun.Remote = net.IP(datum.Value[0:4]) case nl.IFLA_IPTUN_TTL: - sittun.Ttl = uint8(datum.Value[0]) + sittun.Ttl = datum.Value[0] case nl.IFLA_IPTUN_TOS: - sittun.Tos = uint8(datum.Value[0]) + sittun.Tos = datum.Value[0] case nl.IFLA_IPTUN_PMTUDISC: - sittun.PMtuDisc = uint8(datum.Value[0]) + sittun.PMtuDisc = datum.Value[0] + case nl.IFLA_IPTUN_PROTO: + sittun.Proto = datum.Value[0] case nl.IFLA_IPTUN_ENCAP_TYPE: sittun.EncapType = native.Uint16(datum.Value[0:2]) case nl.IFLA_IPTUN_ENCAP_FLAGS: @@ -2761,6 +3106,9 @@ func addBridgeAttrs(bridge *Bridge, linkInfo *nl.RtAttr) { if bridge.MulticastSnooping != nil { data.AddRtAttr(nl.IFLA_BR_MCAST_SNOOPING, boolToByte(*bridge.MulticastSnooping)) } + if bridge.AgeingTime != nil { + data.AddRtAttr(nl.IFLA_BR_AGEING_TIME, nl.Uint32Attr(*bridge.AgeingTime)) + } if bridge.HelloTime != nil { data.AddRtAttr(nl.IFLA_BR_HELLO_TIME, nl.Uint32Attr(*bridge.HelloTime)) } @@ -2773,6 +3121,9 @@ func parseBridgeData(bridge Link, data []syscall.NetlinkRouteAttr) { br := bridge.(*Bridge) for _, datum := range data { switch datum.Attr.Type { + case nl.IFLA_BR_AGEING_TIME: + ageingTime := native.Uint32(datum.Value[0:4]) + br.AgeingTime = &ageingTime case nl.IFLA_BR_HELLO_TIME: helloTime := native.Uint32(datum.Value[0:4]) br.HelloTime = &helloTime @@ -2852,6 +3203,24 @@ func parseVfInfo(data []syscall.NetlinkRouteAttr, id int) VfInfo { vfr := nl.DeserializeVfRate(element.Value[:]) vf.MaxTxRate = vfr.MaxTxRate vf.MinTxRate = vfr.MinTxRate + case nl.IFLA_VF_STATS: + vfstats := nl.DeserializeVfStats(element.Value[:]) + vf.RxPackets = vfstats.RxPackets + vf.TxPackets = vfstats.TxPackets + vf.RxBytes = vfstats.RxBytes + vf.TxBytes = vfstats.TxBytes + vf.Multicast = vfstats.Multicast + vf.Broadcast = vfstats.Broadcast + vf.RxDropped = vfstats.RxDropped + vf.TxDropped = vfstats.TxDropped + + case nl.IFLA_VF_RSS_QUERY_EN: + result := nl.DeserializeVfRssQueryEn(element.Value) + vf.RssQuery = result.Setting + + case nl.IFLA_VF_TRUST: + result := nl.DeserializeVfTrust(element.Value) + vf.Trust = result.Setting } } return vf @@ -2860,8 +3229,9 @@ func parseVfInfo(data []syscall.NetlinkRouteAttr, id int) VfInfo { func addXfrmiAttrs(xfrmi *Xfrmi, linkInfo *nl.RtAttr) { data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) data.AddRtAttr(nl.IFLA_XFRM_LINK, nl.Uint32Attr(uint32(xfrmi.ParentIndex))) - data.AddRtAttr(nl.IFLA_XFRM_IF_ID, nl.Uint32Attr(xfrmi.Ifid)) - + if xfrmi.Ifid != 0 { + data.AddRtAttr(nl.IFLA_XFRM_IF_ID, nl.Uint32Attr(xfrmi.Ifid)) + } } func parseXfrmiData(link Link, data []syscall.NetlinkRouteAttr) { @@ -3010,9 +3380,86 @@ func parseIPoIBData(link Link, data []syscall.NetlinkRouteAttr) { } } +func parseCanData(link Link, data []syscall.NetlinkRouteAttr) { + can := link.(*Can) + for _, datum := range data { + + switch datum.Attr.Type { + case nl.IFLA_CAN_BITTIMING: + can.BitRate = native.Uint32(datum.Value) + can.SamplePoint = native.Uint32(datum.Value[4:]) + can.TimeQuanta = native.Uint32(datum.Value[8:]) + can.PropagationSegment = native.Uint32(datum.Value[12:]) + can.PhaseSegment1 = native.Uint32(datum.Value[16:]) + can.PhaseSegment2 = native.Uint32(datum.Value[20:]) + can.SyncJumpWidth = native.Uint32(datum.Value[24:]) + can.BitRatePreScaler = native.Uint32(datum.Value[28:]) + case nl.IFLA_CAN_BITTIMING_CONST: + can.Name = string(datum.Value[:16]) + can.TimeSegment1Min = native.Uint32(datum.Value[16:]) + can.TimeSegment1Max = native.Uint32(datum.Value[20:]) + can.TimeSegment2Min = native.Uint32(datum.Value[24:]) + can.TimeSegment2Max = native.Uint32(datum.Value[28:]) + can.SyncJumpWidthMax = native.Uint32(datum.Value[32:]) + can.BitRatePreScalerMin = native.Uint32(datum.Value[36:]) + can.BitRatePreScalerMax = native.Uint32(datum.Value[40:]) + can.BitRatePreScalerInc = native.Uint32(datum.Value[44:]) + case nl.IFLA_CAN_CLOCK: + can.ClockFrequency = native.Uint32(datum.Value) + case nl.IFLA_CAN_STATE: + can.State = native.Uint32(datum.Value) + case nl.IFLA_CAN_CTRLMODE: + can.Mask = native.Uint32(datum.Value) + can.Flags = native.Uint32(datum.Value[4:]) + case nl.IFLA_CAN_BERR_COUNTER: + can.TxError = native.Uint16(datum.Value) + can.RxError = native.Uint16(datum.Value[2:]) + case nl.IFLA_CAN_RESTART_MS: + can.RestartMs = native.Uint32(datum.Value) + case nl.IFLA_CAN_DATA_BITTIMING_CONST: + case nl.IFLA_CAN_RESTART: + case nl.IFLA_CAN_DATA_BITTIMING: + case nl.IFLA_CAN_TERMINATION: + case nl.IFLA_CAN_TERMINATION_CONST: + case nl.IFLA_CAN_BITRATE_CONST: + case nl.IFLA_CAN_DATA_BITRATE_CONST: + case nl.IFLA_CAN_BITRATE_MAX: + } + } +} + func addIPoIBAttrs(ipoib *IPoIB, linkInfo *nl.RtAttr) { data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) data.AddRtAttr(nl.IFLA_IPOIB_PKEY, nl.Uint16Attr(uint16(ipoib.Pkey))) data.AddRtAttr(nl.IFLA_IPOIB_MODE, nl.Uint16Attr(uint16(ipoib.Mode))) data.AddRtAttr(nl.IFLA_IPOIB_UMCAST, nl.Uint16Attr(uint16(ipoib.Umcast))) } + +func addBareUDPAttrs(bareudp *BareUDP, linkInfo *nl.RtAttr) { + data := linkInfo.AddRtAttr(nl.IFLA_INFO_DATA, nil) + + data.AddRtAttr(nl.IFLA_BAREUDP_PORT, nl.Uint16Attr(nl.Swap16(bareudp.Port))) + data.AddRtAttr(nl.IFLA_BAREUDP_ETHERTYPE, nl.Uint16Attr(nl.Swap16(bareudp.EtherType))) + if bareudp.SrcPortMin != 0 { + data.AddRtAttr(nl.IFLA_BAREUDP_SRCPORT_MIN, nl.Uint16Attr(bareudp.SrcPortMin)) + } + if bareudp.MultiProto { + data.AddRtAttr(nl.IFLA_BAREUDP_MULTIPROTO_MODE, []byte{}) + } +} + +func parseBareUDPData(link Link, data []syscall.NetlinkRouteAttr) { + bareudp := link.(*BareUDP) + for _, attr := range data { + switch attr.Attr.Type { + case nl.IFLA_BAREUDP_PORT: + bareudp.Port = binary.BigEndian.Uint16(attr.Value) + case nl.IFLA_BAREUDP_ETHERTYPE: + bareudp.EtherType = binary.BigEndian.Uint16(attr.Value) + case nl.IFLA_BAREUDP_SRCPORT_MIN: + bareudp.SrcPortMin = native.Uint16(attr.Value) + case nl.IFLA_BAREUDP_MULTIPROTO_MODE: + bareudp.MultiProto = true + } + } +} diff --git a/vendor/github.com/vishvananda/netlink/neigh.go b/vendor/github.com/vishvananda/netlink/neigh.go index 379e5655f..32d722e88 100644 --- a/vendor/github.com/vishvananda/netlink/neigh.go +++ b/vendor/github.com/vishvananda/netlink/neigh.go @@ -12,6 +12,7 @@ type Neigh struct { State int Type int Flags int + FlagsExt int IP net.IP HardwareAddr net.HardwareAddr LLIPAddr net.IP //Used in the case of NHRP diff --git a/vendor/github.com/vishvananda/netlink/neigh_linux.go b/vendor/github.com/vishvananda/netlink/neigh_linux.go index cb3b55d35..4c1e76635 100644 --- a/vendor/github.com/vishvananda/netlink/neigh_linux.go +++ b/vendor/github.com/vishvananda/netlink/neigh_linux.go @@ -24,7 +24,11 @@ const ( NDA_MASTER NDA_LINK_NETNSID NDA_SRC_VNI - NDA_MAX = NDA_SRC_VNI + NDA_PROTOCOL + NDA_NH_ID + NDA_FDB_EXT_ATTRS + NDA_FLAGS_EXT + NDA_MAX = NDA_FLAGS_EXT ) // Neighbor Cache Entry States. @@ -42,11 +46,19 @@ const ( // Neighbor Flags const ( - NTF_USE = 0x01 - NTF_SELF = 0x02 - NTF_MASTER = 0x04 - NTF_PROXY = 0x08 - NTF_ROUTER = 0x80 + NTF_USE = 0x01 + NTF_SELF = 0x02 + NTF_MASTER = 0x04 + NTF_PROXY = 0x08 + NTF_EXT_LEARNED = 0x10 + NTF_OFFLOADED = 0x20 + NTF_STICKY = 0x40 + NTF_ROUTER = 0x80 +) + +// Extended Neighbor Flags +const ( + NTF_EXT_MANAGED = 0x00000001 ) // Ndmsg is for adding, removing or receiving information about a neighbor table entry @@ -162,11 +174,16 @@ func neighHandle(neigh *Neigh, req *nl.NetlinkRequest) error { if neigh.LLIPAddr != nil { llIPData := nl.NewRtAttr(NDA_LLADDR, neigh.LLIPAddr.To4()) req.AddData(llIPData) - } else if neigh.Flags != NTF_PROXY || neigh.HardwareAddr != nil { + } else if neigh.HardwareAddr != nil { hwData := nl.NewRtAttr(NDA_LLADDR, []byte(neigh.HardwareAddr)) req.AddData(hwData) } + if neigh.FlagsExt != 0 { + flagsExtData := nl.NewRtAttr(NDA_FLAGS_EXT, nl.Uint32Attr(uint32(neigh.FlagsExt))) + req.AddData(flagsExtData) + } + if neigh.Vlan != 0 { vlanData := nl.NewRtAttr(NDA_VLAN, nl.Uint16Attr(uint16(neigh.Vlan))) req.AddData(vlanData) @@ -243,6 +260,18 @@ func (h *Handle) NeighListExecute(msg Ndmsg) ([]Neigh, error) { // Ignore messages from other interfaces continue } + if msg.Family != 0 && ndm.Family != msg.Family { + continue + } + if msg.State != 0 && ndm.State != msg.State { + continue + } + if msg.Type != 0 && ndm.Type != msg.Type { + continue + } + if msg.Flags != 0 && ndm.Flags != msg.Flags { + continue + } neigh, err := NeighDeserialize(m) if err != nil { @@ -293,6 +322,8 @@ func NeighDeserialize(m []byte) (*Neigh, error) { } else { neigh.HardwareAddr = net.HardwareAddr(attr.Value) } + case NDA_FLAGS_EXT: + neigh.FlagsExt = int(native.Uint32(attr.Value[0:4])) case NDA_VLAN: neigh.Vlan = int(native.Uint16(attr.Value[0:2])) case NDA_VNI: @@ -396,7 +427,6 @@ func neighSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- NeighUpdate, done < continue } if m.Header.Type == unix.NLMSG_ERROR { - native := nl.NativeEndian() error := int32(native.Uint32(m.Data[0:4])) if error == 0 { continue diff --git a/vendor/github.com/vishvananda/netlink/netlink_unspecified.go b/vendor/github.com/vishvananda/netlink/netlink_unspecified.go index 42d3acf91..98d2c0dbf 100644 --- a/vendor/github.com/vishvananda/netlink/netlink_unspecified.go +++ b/vendor/github.com/vishvananda/netlink/netlink_unspecified.go @@ -16,7 +16,7 @@ func LinkSetMTU(link Link, mtu int) error { return ErrNotImplemented } -func LinkSetMaster(link Link, master *Bridge) error { +func LinkSetMaster(link Link, master Link) error { return ErrNotImplemented } @@ -72,6 +72,10 @@ func LinkSetXdpFd(link Link, fd int) error { return ErrNotImplemented } +func LinkSetXdpFdWithFlags(link Link, fd, flags int) error { + return ErrNotImplemented +} + func LinkSetARPOff(link Link) error { return ErrNotImplemented } @@ -176,14 +180,30 @@ func RouteAdd(route *Route) error { return ErrNotImplemented } +func RouteAppend(route *Route) error { + return ErrNotImplemented +} + func RouteDel(route *Route) error { return ErrNotImplemented } +func RouteGet(destination net.IP) ([]Route, error) { + return nil, ErrNotImplemented +} + func RouteList(link Link, family int) ([]Route, error) { return nil, ErrNotImplemented } +func RouteListFiltered(family int, filter *Route, filterMask uint64) ([]Route, error) { + return nil, ErrNotImplemented +} + +func RouteReplace(route *Route) error { + return ErrNotImplemented +} + func XfrmPolicyAdd(policy *XfrmPolicy) error { return ErrNotImplemented } diff --git a/vendor/github.com/vishvananda/netlink/netns_linux.go b/vendor/github.com/vishvananda/netlink/netns_linux.go index 77cf6f469..2eb29c7ce 100644 --- a/vendor/github.com/vishvananda/netlink/netns_linux.go +++ b/vendor/github.com/vishvananda/netlink/netns_linux.go @@ -87,7 +87,7 @@ func (h *Handle) getNetNsId(attrType int, val uint32) (int, error) { rtgen := nl.NewRtGenMsg() req.AddData(rtgen) - b := make([]byte, 4, 4) + b := make([]byte, 4) native.PutUint32(b, val) attr := nl.NewRtAttr(attrType, b) req.AddData(attr) @@ -126,12 +126,12 @@ func (h *Handle) setNetNsId(attrType int, val uint32, newnsid uint32) error { rtgen := nl.NewRtGenMsg() req.AddData(rtgen) - b := make([]byte, 4, 4) + b := make([]byte, 4) native.PutUint32(b, val) attr := nl.NewRtAttr(attrType, b) req.AddData(attr) - b1 := make([]byte, 4, 4) + b1 := make([]byte, 4) native.PutUint32(b1, newnsid) attr1 := nl.NewRtAttr(NETNSA_NSID, b1) req.AddData(attr1) diff --git a/vendor/github.com/vishvananda/netlink/nl/addr_linux.go b/vendor/github.com/vishvananda/netlink/nl/addr_linux.go index 50db3b4cd..6bea4ed02 100644 --- a/vendor/github.com/vishvananda/netlink/nl/addr_linux.go +++ b/vendor/github.com/vishvananda/netlink/nl/addr_linux.go @@ -54,24 +54,18 @@ func (msg *IfAddrmsg) Len() int { // __u32 tstamp; /* updated timestamp, hundredths of seconds */ // }; -const IFA_CACHEINFO = 6 -const SizeofIfaCacheInfo = 0x10 - type IfaCacheInfo struct { - IfaPrefered uint32 - IfaValid uint32 - Cstamp uint32 - Tstamp uint32 + unix.IfaCacheinfo } func (msg *IfaCacheInfo) Len() int { - return SizeofIfaCacheInfo + return unix.SizeofIfaCacheinfo } func DeserializeIfaCacheInfo(b []byte) *IfaCacheInfo { - return (*IfaCacheInfo)(unsafe.Pointer(&b[0:SizeofIfaCacheInfo][0])) + return (*IfaCacheInfo)(unsafe.Pointer(&b[0:unix.SizeofIfaCacheinfo][0])) } func (msg *IfaCacheInfo) Serialize() []byte { - return (*(*[SizeofIfaCacheInfo]byte)(unsafe.Pointer(msg)))[:] + return (*(*[unix.SizeofIfaCacheinfo]byte)(unsafe.Pointer(msg)))[:] } diff --git a/vendor/github.com/vishvananda/netlink/nl/conntrack_linux.go b/vendor/github.com/vishvananda/netlink/nl/conntrack_linux.go index 79d2b6b89..183601803 100644 --- a/vendor/github.com/vishvananda/netlink/nl/conntrack_linux.go +++ b/vendor/github.com/vishvananda/netlink/nl/conntrack_linux.go @@ -40,9 +40,11 @@ const ( NFNETLINK_V0 = 0 ) -// #define NLA_F_NESTED (1 << 15) const ( - NLA_F_NESTED = (1 << 15) + NLA_F_NESTED uint16 = (1 << 15) // #define NLA_F_NESTED (1 << 15) + NLA_F_NET_BYTEORDER uint16 = (1 << 14) // #define NLA_F_NESTED (1 << 14) + NLA_TYPE_MASK = ^(NLA_F_NESTED | NLA_F_NET_BYTEORDER) + NLA_ALIGNTO uint16 = 4 // #define NLA_ALIGNTO 4 ) // enum ctattr_type { diff --git a/vendor/github.com/vishvananda/netlink/nl/devlink_linux.go b/vendor/github.com/vishvananda/netlink/nl/devlink_linux.go index db66faaad..2995da492 100644 --- a/vendor/github.com/vishvananda/netlink/nl/devlink_linux.go +++ b/vendor/github.com/vishvananda/netlink/nl/devlink_linux.go @@ -10,16 +10,38 @@ const ( const ( DEVLINK_CMD_GET = 1 + DEVLINK_CMD_PORT_GET = 5 + DEVLINK_CMD_PORT_SET = 6 + DEVLINK_CMD_PORT_NEW = 7 + DEVLINK_CMD_PORT_DEL = 8 DEVLINK_CMD_ESWITCH_GET = 29 DEVLINK_CMD_ESWITCH_SET = 30 + DEVLINK_CMD_INFO_GET = 51 ) const ( - DEVLINK_ATTR_BUS_NAME = 1 - DEVLINK_ATTR_DEV_NAME = 2 - DEVLINK_ATTR_ESWITCH_MODE = 25 - DEVLINK_ATTR_ESWITCH_INLINE_MODE = 26 - DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 62 + DEVLINK_ATTR_BUS_NAME = 1 + DEVLINK_ATTR_DEV_NAME = 2 + DEVLINK_ATTR_PORT_INDEX = 3 + DEVLINK_ATTR_PORT_TYPE = 4 + DEVLINK_ATTR_PORT_NETDEV_IFINDEX = 6 + DEVLINK_ATTR_PORT_NETDEV_NAME = 7 + DEVLINK_ATTR_PORT_IBDEV_NAME = 8 + DEVLINK_ATTR_ESWITCH_MODE = 25 + DEVLINK_ATTR_ESWITCH_INLINE_MODE = 26 + DEVLINK_ATTR_ESWITCH_ENCAP_MODE = 62 + DEVLINK_ATTR_PORT_FLAVOUR = 77 + DEVLINK_ATTR_INFO_DRIVER_NAME = 98 + DEVLINK_ATTR_INFO_SERIAL_NUMBER = 99 + DEVLINK_ATTR_INFO_VERSION_FIXED = 100 + DEVLINK_ATTR_INFO_VERSION_RUNNING = 101 + DEVLINK_ATTR_INFO_VERSION_STORED = 102 + DEVLINK_ATTR_INFO_VERSION_NAME = 103 + DEVLINK_ATTR_INFO_VERSION_VALUE = 104 + DEVLINK_ATTR_PORT_PCI_PF_NUMBER = 127 + DEVLINK_ATTR_PORT_FUNCTION = 145 + DEVLINK_ATTR_PORT_CONTROLLER_NUMBER = 150 + DEVLINK_ATTR_PORT_PCI_SF_NUMBER = 164 ) const ( @@ -38,3 +60,37 @@ const ( DEVLINK_ESWITCH_ENCAP_MODE_NONE = 0 DEVLINK_ESWITCH_ENCAP_MODE_BASIC = 1 ) + +const ( + DEVLINK_PORT_FLAVOUR_PHYSICAL = 0 + DEVLINK_PORT_FLAVOUR_CPU = 1 + DEVLINK_PORT_FLAVOUR_DSA = 2 + DEVLINK_PORT_FLAVOUR_PCI_PF = 3 + DEVLINK_PORT_FLAVOUR_PCI_VF = 4 + DEVLINK_PORT_FLAVOUR_VIRTUAL = 5 + DEVLINK_PORT_FLAVOUR_UNUSED = 6 + DEVLINK_PORT_FLAVOUR_PCI_SF = 7 +) + +const ( + DEVLINK_PORT_TYPE_NOTSET = 0 + DEVLINK_PORT_TYPE_AUTO = 1 + DEVLINK_PORT_TYPE_ETH = 2 + DEVLINK_PORT_TYPE_IB = 3 +) + +const ( + DEVLINK_PORT_FUNCTION_ATTR_HW_ADDR = 1 + DEVLINK_PORT_FN_ATTR_STATE = 2 + DEVLINK_PORT_FN_ATTR_OPSTATE = 3 +) + +const ( + DEVLINK_PORT_FN_STATE_INACTIVE = 0 + DEVLINK_PORT_FN_STATE_ACTIVE = 1 +) + +const ( + DEVLINK_PORT_FN_OPSTATE_DETACHED = 0 + DEVLINK_PORT_FN_OPSTATE_ATTACHED = 1 +) diff --git a/vendor/github.com/vishvananda/netlink/nl/ipset_linux.go b/vendor/github.com/vishvananda/netlink/nl/ipset_linux.go new file mode 100644 index 000000000..a60b4b09d --- /dev/null +++ b/vendor/github.com/vishvananda/netlink/nl/ipset_linux.go @@ -0,0 +1,222 @@ +package nl + +import ( + "strconv" + + "golang.org/x/sys/unix" +) + +const ( + /* The protocol version */ + IPSET_PROTOCOL = 6 + + /* The max length of strings including NUL: set and type identifiers */ + IPSET_MAXNAMELEN = 32 + + /* The maximum permissible comment length we will accept over netlink */ + IPSET_MAX_COMMENT_SIZE = 255 +) + +const ( + _ = iota + IPSET_CMD_PROTOCOL /* 1: Return protocol version */ + IPSET_CMD_CREATE /* 2: Create a new (empty) set */ + IPSET_CMD_DESTROY /* 3: Destroy a (empty) set */ + IPSET_CMD_FLUSH /* 4: Remove all elements from a set */ + IPSET_CMD_RENAME /* 5: Rename a set */ + IPSET_CMD_SWAP /* 6: Swap two sets */ + IPSET_CMD_LIST /* 7: List sets */ + IPSET_CMD_SAVE /* 8: Save sets */ + IPSET_CMD_ADD /* 9: Add an element to a set */ + IPSET_CMD_DEL /* 10: Delete an element from a set */ + IPSET_CMD_TEST /* 11: Test an element in a set */ + IPSET_CMD_HEADER /* 12: Get set header data only */ + IPSET_CMD_TYPE /* 13: Get set type */ +) + +/* Attributes at command level */ +const ( + _ = iota + IPSET_ATTR_PROTOCOL /* 1: Protocol version */ + IPSET_ATTR_SETNAME /* 2: Name of the set */ + IPSET_ATTR_TYPENAME /* 3: Typename */ + IPSET_ATTR_REVISION /* 4: Settype revision */ + IPSET_ATTR_FAMILY /* 5: Settype family */ + IPSET_ATTR_FLAGS /* 6: Flags at command level */ + IPSET_ATTR_DATA /* 7: Nested attributes */ + IPSET_ATTR_ADT /* 8: Multiple data containers */ + IPSET_ATTR_LINENO /* 9: Restore lineno */ + IPSET_ATTR_PROTOCOL_MIN /* 10: Minimal supported version number */ + + IPSET_ATTR_SETNAME2 = IPSET_ATTR_TYPENAME /* Setname at rename/swap */ + IPSET_ATTR_REVISION_MIN = IPSET_ATTR_PROTOCOL_MIN /* type rev min */ +) + +/* CADT specific attributes */ +const ( + IPSET_ATTR_IP = 1 + IPSET_ATTR_IP_FROM = 1 + IPSET_ATTR_IP_TO = 2 + IPSET_ATTR_CIDR = 3 + IPSET_ATTR_PORT = 4 + IPSET_ATTR_PORT_FROM = 4 + IPSET_ATTR_PORT_TO = 5 + IPSET_ATTR_TIMEOUT = 6 + IPSET_ATTR_PROTO = 7 + IPSET_ATTR_CADT_FLAGS = 8 + IPSET_ATTR_CADT_LINENO = IPSET_ATTR_LINENO /* 9 */ + IPSET_ATTR_MARK = 10 + IPSET_ATTR_MARKMASK = 11 + + /* Reserve empty slots */ + IPSET_ATTR_CADT_MAX = 16 + + /* Create-only specific attributes */ + IPSET_ATTR_GC = 3 + iota + IPSET_ATTR_HASHSIZE + IPSET_ATTR_MAXELEM + IPSET_ATTR_NETMASK + IPSET_ATTR_PROBES + IPSET_ATTR_RESIZE + IPSET_ATTR_SIZE + + /* Kernel-only */ + IPSET_ATTR_ELEMENTS + IPSET_ATTR_REFERENCES + IPSET_ATTR_MEMSIZE + + SET_ATTR_CREATE_MAX +) + +/* ADT specific attributes */ +const ( + IPSET_ATTR_ETHER = IPSET_ATTR_CADT_MAX + iota + 1 + IPSET_ATTR_NAME + IPSET_ATTR_NAMEREF + IPSET_ATTR_IP2 + IPSET_ATTR_CIDR2 + IPSET_ATTR_IP2_TO + IPSET_ATTR_IFACE + IPSET_ATTR_BYTES + IPSET_ATTR_PACKETS + IPSET_ATTR_COMMENT + IPSET_ATTR_SKBMARK + IPSET_ATTR_SKBPRIO + IPSET_ATTR_SKBQUEUE +) + +/* Flags at CADT attribute level, upper half of cmdattrs */ +const ( + IPSET_FLAG_BIT_BEFORE = 0 + IPSET_FLAG_BEFORE = (1 << IPSET_FLAG_BIT_BEFORE) + IPSET_FLAG_BIT_PHYSDEV = 1 + IPSET_FLAG_PHYSDEV = (1 << IPSET_FLAG_BIT_PHYSDEV) + IPSET_FLAG_BIT_NOMATCH = 2 + IPSET_FLAG_NOMATCH = (1 << IPSET_FLAG_BIT_NOMATCH) + IPSET_FLAG_BIT_WITH_COUNTERS = 3 + IPSET_FLAG_WITH_COUNTERS = (1 << IPSET_FLAG_BIT_WITH_COUNTERS) + IPSET_FLAG_BIT_WITH_COMMENT = 4 + IPSET_FLAG_WITH_COMMENT = (1 << IPSET_FLAG_BIT_WITH_COMMENT) + IPSET_FLAG_BIT_WITH_FORCEADD = 5 + IPSET_FLAG_WITH_FORCEADD = (1 << IPSET_FLAG_BIT_WITH_FORCEADD) + IPSET_FLAG_BIT_WITH_SKBINFO = 6 + IPSET_FLAG_WITH_SKBINFO = (1 << IPSET_FLAG_BIT_WITH_SKBINFO) + IPSET_FLAG_CADT_MAX = 15 +) + +const ( + IPSET_ERR_PRIVATE = 4096 + iota + IPSET_ERR_PROTOCOL + IPSET_ERR_FIND_TYPE + IPSET_ERR_MAX_SETS + IPSET_ERR_BUSY + IPSET_ERR_EXIST_SETNAME2 + IPSET_ERR_TYPE_MISMATCH + IPSET_ERR_EXIST + IPSET_ERR_INVALID_CIDR + IPSET_ERR_INVALID_NETMASK + IPSET_ERR_INVALID_FAMILY + IPSET_ERR_TIMEOUT + IPSET_ERR_REFERENCED + IPSET_ERR_IPADDR_IPV4 + IPSET_ERR_IPADDR_IPV6 + IPSET_ERR_COUNTER + IPSET_ERR_COMMENT + IPSET_ERR_INVALID_MARKMASK + IPSET_ERR_SKBINFO + + /* Type specific error codes */ + IPSET_ERR_TYPE_SPECIFIC = 4352 +) + +type IPSetError uintptr + +func (e IPSetError) Error() string { + switch int(e) { + case IPSET_ERR_PRIVATE: + return "private" + case IPSET_ERR_PROTOCOL: + return "invalid protocol" + case IPSET_ERR_FIND_TYPE: + return "invalid type" + case IPSET_ERR_MAX_SETS: + return "max sets reached" + case IPSET_ERR_BUSY: + return "busy" + case IPSET_ERR_EXIST_SETNAME2: + return "exist_setname2" + case IPSET_ERR_TYPE_MISMATCH: + return "type mismatch" + case IPSET_ERR_EXIST: + return "exist" + case IPSET_ERR_INVALID_CIDR: + return "invalid cidr" + case IPSET_ERR_INVALID_NETMASK: + return "invalid netmask" + case IPSET_ERR_INVALID_FAMILY: + return "invalid family" + case IPSET_ERR_TIMEOUT: + return "timeout" + case IPSET_ERR_REFERENCED: + return "referenced" + case IPSET_ERR_IPADDR_IPV4: + return "invalid ipv4 address" + case IPSET_ERR_IPADDR_IPV6: + return "invalid ipv6 address" + case IPSET_ERR_COUNTER: + return "invalid counter" + case IPSET_ERR_COMMENT: + return "invalid comment" + case IPSET_ERR_INVALID_MARKMASK: + return "invalid markmask" + case IPSET_ERR_SKBINFO: + return "skbinfo" + default: + return "errno " + strconv.Itoa(int(e)) + } +} + +func GetIpsetFlags(cmd int) int { + switch cmd { + case IPSET_CMD_CREATE: + return unix.NLM_F_REQUEST | unix.NLM_F_ACK | unix.NLM_F_CREATE + case IPSET_CMD_DESTROY, + IPSET_CMD_FLUSH, + IPSET_CMD_RENAME, + IPSET_CMD_SWAP, + IPSET_CMD_TEST: + return unix.NLM_F_REQUEST | unix.NLM_F_ACK + case IPSET_CMD_LIST, + IPSET_CMD_SAVE: + return unix.NLM_F_REQUEST | unix.NLM_F_ACK | unix.NLM_F_ROOT | unix.NLM_F_MATCH | unix.NLM_F_DUMP + case IPSET_CMD_ADD, + IPSET_CMD_DEL: + return unix.NLM_F_REQUEST | unix.NLM_F_ACK + case IPSET_CMD_HEADER, + IPSET_CMD_TYPE, + IPSET_CMD_PROTOCOL: + return unix.NLM_F_REQUEST + default: + return 0 + } +} diff --git a/vendor/github.com/vishvananda/netlink/nl/link_linux.go b/vendor/github.com/vishvananda/netlink/nl/link_linux.go index afb16a9c1..e10edbc09 100644 --- a/vendor/github.com/vishvananda/netlink/nl/link_linux.go +++ b/vendor/github.com/vishvananda/netlink/nl/link_linux.go @@ -1,6 +1,8 @@ package nl import ( + "bytes" + "encoding/binary" "unsafe" ) @@ -171,6 +173,22 @@ const ( IFLA_BOND_SLAVE_AD_PARTNER_OPER_PORT_STATE ) +const ( + IFLA_GENEVE_UNSPEC = iota + IFLA_GENEVE_ID // vni + IFLA_GENEVE_REMOTE + IFLA_GENEVE_TTL + IFLA_GENEVE_TOS + IFLA_GENEVE_PORT // destination port + IFLA_GENEVE_COLLECT_METADATA + IFLA_GENEVE_REMOTE6 + IFLA_GENEVE_UDP_CSUM + IFLA_GENEVE_UDP_ZERO_CSUM6_TX + IFLA_GENEVE_UDP_ZERO_CSUM6_RX + IFLA_GENEVE_LABEL + IFLA_GENEVE_MAX = IFLA_GENEVE_LABEL +) + const ( IFLA_GRE_UNSPEC = iota IFLA_GRE_LINK @@ -243,7 +261,9 @@ const ( IFLA_VF_STATS_TX_BYTES IFLA_VF_STATS_BROADCAST IFLA_VF_STATS_MULTICAST - IFLA_VF_STATS_MAX = IFLA_VF_STATS_MULTICAST + IFLA_VF_STATS_RX_DROPPED + IFLA_VF_STATS_TX_DROPPED + IFLA_VF_STATS_MAX = IFLA_VF_STATS_TX_DROPPED ) const ( @@ -326,6 +346,59 @@ func (msg *VfTxRate) Serialize() []byte { return (*(*[SizeofVfTxRate]byte)(unsafe.Pointer(msg)))[:] } +//struct ifla_vf_stats { +// __u64 rx_packets; +// __u64 tx_packets; +// __u64 rx_bytes; +// __u64 tx_bytes; +// __u64 broadcast; +// __u64 multicast; +//}; + +type VfStats struct { + RxPackets uint64 + TxPackets uint64 + RxBytes uint64 + TxBytes uint64 + Multicast uint64 + Broadcast uint64 + RxDropped uint64 + TxDropped uint64 +} + +func DeserializeVfStats(b []byte) VfStats { + var vfstat VfStats + stats, err := ParseRouteAttr(b) + if err != nil { + return vfstat + } + var valueVar uint64 + for _, stat := range stats { + if err := binary.Read(bytes.NewBuffer(stat.Value), NativeEndian(), &valueVar); err != nil { + break + } + switch stat.Attr.Type { + case IFLA_VF_STATS_RX_PACKETS: + vfstat.RxPackets = valueVar + case IFLA_VF_STATS_TX_PACKETS: + vfstat.TxPackets = valueVar + case IFLA_VF_STATS_RX_BYTES: + vfstat.RxBytes = valueVar + case IFLA_VF_STATS_TX_BYTES: + vfstat.TxBytes = valueVar + case IFLA_VF_STATS_MULTICAST: + vfstat.Multicast = valueVar + case IFLA_VF_STATS_BROADCAST: + vfstat.Broadcast = valueVar + case IFLA_VF_STATS_RX_DROPPED: + vfstat.RxDropped = valueVar + case IFLA_VF_STATS_TX_DROPPED: + vfstat.TxDropped = valueVar + } + } + return vfstat +} + // struct ifla_vf_rate { // __u32 vf; // __u32 min_tx_rate; /* Min Bandwidth in Mbps */ @@ -478,6 +551,14 @@ const ( IFLA_XDP_MAX = IFLA_XDP_PROG_ID ) +// XDP program attach mode (used as dump value for IFLA_XDP_ATTACHED) +const ( + XDP_ATTACHED_NONE = iota + XDP_ATTACHED_DRV + XDP_ATTACHED_SKB + XDP_ATTACHED_HW +) + const ( IFLA_IPTUN_UNSPEC = iota IFLA_IPTUN_LINK @@ -608,3 +689,32 @@ const ( IFLA_IPOIB_UMCAST IFLA_IPOIB_MAX = IFLA_IPOIB_UMCAST ) + +const ( + IFLA_CAN_UNSPEC = iota + IFLA_CAN_BITTIMING + IFLA_CAN_BITTIMING_CONST + IFLA_CAN_CLOCK + IFLA_CAN_STATE + IFLA_CAN_CTRLMODE + IFLA_CAN_RESTART_MS + IFLA_CAN_RESTART + IFLA_CAN_BERR_COUNTER + IFLA_CAN_DATA_BITTIMING + IFLA_CAN_DATA_BITTIMING_CONST + IFLA_CAN_TERMINATION + IFLA_CAN_TERMINATION_CONST + IFLA_CAN_BITRATE_CONST + IFLA_CAN_DATA_BITRATE_CONST + IFLA_CAN_BITRATE_MAX + IFLA_CAN_MAX = IFLA_CAN_BITRATE_MAX +) + +const ( + IFLA_BAREUDP_UNSPEC = iota + IFLA_BAREUDP_PORT + IFLA_BAREUDP_ETHERTYPE + IFLA_BAREUDP_SRCPORT_MIN + IFLA_BAREUDP_MULTIPROTO_MODE + IFLA_BAREUDP_MAX = IFLA_BAREUDP_MULTIPROTO_MODE +) diff --git a/vendor/github.com/vishvananda/netlink/nl/lwt_linux.go b/vendor/github.com/vishvananda/netlink/nl/lwt_linux.go new file mode 100644 index 000000000..bafd593c4 --- /dev/null +++ b/vendor/github.com/vishvananda/netlink/nl/lwt_linux.go @@ -0,0 +1,29 @@ +package nl + +const ( + LWT_BPF_PROG_UNSPEC = iota + LWT_BPF_PROG_FD + LWT_BPF_PROG_NAME + __LWT_BPF_PROG_MAX +) + +const ( + LWT_BPF_PROG_MAX = __LWT_BPF_PROG_MAX - 1 +) + +const ( + LWT_BPF_UNSPEC = iota + LWT_BPF_IN + LWT_BPF_OUT + LWT_BPF_XMIT + LWT_BPF_XMIT_HEADROOM + __LWT_BPF_MAX +) + +const ( + LWT_BPF_MAX = __LWT_BPF_MAX - 1 +) + +const ( + LWT_BPF_MAX_HEADROOM = 256 +) diff --git a/vendor/github.com/vishvananda/netlink/nl/nl_linux.go b/vendor/github.com/vishvananda/netlink/nl/nl_linux.go index aaf56c671..600b942b1 100644 --- a/vendor/github.com/vishvananda/netlink/nl/nl_linux.go +++ b/vendor/github.com/vishvananda/netlink/nl/nl_linux.go @@ -27,7 +27,8 @@ const ( // tc rules or filters, or other more memory requiring data. RECEIVE_BUFFER_SIZE = 65536 // Kernel netlink pid - PidKernel uint32 = 0 + PidKernel uint32 = 0 + SizeofCnMsgOp = 0x18 ) // SupportedNlFamilies contains the list of netlink families this netlink package supports @@ -35,6 +36,12 @@ var SupportedNlFamilies = []int{unix.NETLINK_ROUTE, unix.NETLINK_XFRM, unix.NETL var nextSeqNr uint32 +// Default netlink socket timeout, 60s +var SocketTimeoutTv = unix.Timeval{Sec: 60, Usec: 0} + +// ErrorMessageReporting is the default error message reporting configuration for the new netlink sockets +var EnableErrorMessageReporting bool = false + // GetIPFamily returns the family type of a net.IP. func GetIPFamily(ip net.IP) int { if len(ip) <= net.IPv4len { @@ -77,11 +84,69 @@ func Swap32(i uint32) uint32 { return (i&0xff000000)>>24 | (i&0xff0000)>>8 | (i&0xff00)<<8 | (i&0xff)<<24 } +const ( + NLMSGERR_ATTR_UNUSED = 0 + NLMSGERR_ATTR_MSG = 1 + NLMSGERR_ATTR_OFFS = 2 + NLMSGERR_ATTR_COOKIE = 3 + NLMSGERR_ATTR_POLICY = 4 +) + type NetlinkRequestData interface { Len() int Serialize() []byte } +const ( + PROC_CN_MCAST_LISTEN = 1 + PROC_CN_MCAST_IGNORE +) + +type CbID struct { + Idx uint32 + Val uint32 +} + +type CnMsg struct { + ID CbID + Seq uint32 + Ack uint32 + Length uint16 + Flags uint16 +} + +type CnMsgOp struct { + CnMsg + // here we differ from the C header + Op uint32 +} + +func NewCnMsg(idx, val, op uint32) *CnMsgOp { + var cm CnMsgOp + + cm.ID.Idx = idx + cm.ID.Val = val + + cm.Ack = 0 + cm.Seq = 1 + cm.Length = uint16(binary.Size(op)) + cm.Op = op + + return &cm +} + +func (msg *CnMsgOp) Serialize() []byte { + return (*(*[SizeofCnMsgOp]byte)(unsafe.Pointer(msg)))[:] +} + +func DeserializeCnMsgOp(b []byte) *CnMsgOp { + return (*CnMsgOp)(unsafe.Pointer(&b[0:SizeofCnMsgOp][0])) +} + +func (msg *CnMsgOp) Len() int { + return SizeofCnMsgOp +} + // IfInfomsg is related to links, but it is used for list requests as well type IfInfomsg struct { unix.IfInfomsg @@ -249,6 +314,12 @@ func (msg *IfInfomsg) EncapType() string { return fmt.Sprintf("unknown%d", msg.Type) } +// Round the length of a netlink message up to align it properly. +// Taken from syscall/netlink_linux.go by The Go Authors under BSD-style license. +func nlmAlignOf(msglen int) int { + return (msglen + syscall.NLMSG_ALIGNTO - 1) & ^(syscall.NLMSG_ALIGNTO - 1) +} + func rtaAlignOf(attrlen int) int { return (attrlen + unix.RTA_ALIGNTO - 1) & ^(unix.RTA_ALIGNTO - 1) } @@ -259,6 +330,29 @@ func NewIfInfomsgChild(parent *RtAttr, family int) *IfInfomsg { return msg } +type Uint32Attribute struct { + Type uint16 + Value uint32 +} + +func (a *Uint32Attribute) Serialize() []byte { + native := NativeEndian() + buf := make([]byte, rtaAlignOf(8)) + native.PutUint16(buf[0:2], 8) + native.PutUint16(buf[2:4], a.Type) + + if a.Type&NLA_F_NET_BYTEORDER != 0 { + binary.BigEndian.PutUint32(buf[4:], a.Value) + } else { + native.PutUint32(buf[4:], a.Value) + } + return buf +} + +func (a *Uint32Attribute) Len() int { + return 8 +} + // Extend RtAttr to handle data and children type RtAttr struct { unix.RtAttr @@ -403,6 +497,19 @@ func (req *NetlinkRequest) Execute(sockType int, resType uint16) ([][]byte, erro if err != nil { return nil, err } + + if err := s.SetSendTimeout(&SocketTimeoutTv); err != nil { + return nil, err + } + if err := s.SetReceiveTimeout(&SocketTimeoutTv); err != nil { + return nil, err + } + if EnableErrorMessageReporting { + if err := s.SetExtAck(true); err != nil { + return nil, err + } + } + defer s.Close() } else { s.Lock() @@ -439,16 +546,39 @@ done: if m.Header.Pid != pid { continue } - if m.Header.Type == unix.NLMSG_DONE { - break done - } - if m.Header.Type == unix.NLMSG_ERROR { + if m.Header.Type == unix.NLMSG_DONE || m.Header.Type == unix.NLMSG_ERROR { native := NativeEndian() - error := int32(native.Uint32(m.Data[0:4])) - if error == 0 { + errno := int32(native.Uint32(m.Data[0:4])) + if errno == 0 { break done } - return nil, syscall.Errno(-error) + var err error + err = syscall.Errno(-errno) + + unreadData := m.Data[4:] + if m.Header.Flags|unix.NLM_F_ACK_TLVS != 0 && len(unreadData) > syscall.SizeofNlMsghdr { + // Skip the echoed request message. + echoReqH := (*syscall.NlMsghdr)(unsafe.Pointer(&unreadData[0])) + unreadData = unreadData[nlmAlignOf(int(echoReqH.Len)):] + + // Annotate `err` using nlmsgerr attributes. + for len(unreadData) >= syscall.SizeofRtAttr { + attr := (*syscall.RtAttr)(unsafe.Pointer(&unreadData[0])) + attrData := unreadData[syscall.SizeofRtAttr:attr.Len] + + switch attr.Type { + case NLMSGERR_ATTR_MSG: + err = fmt.Errorf("%w: %s", err, string(attrData)) + + default: + // TODO: handle other NLMSGERR_ATTR types + } + + unreadData = unreadData[rtaAlignOf(int(attr.Len)):] + } + } + + return nil, err } if resType != 0 && m.Header.Type != resType { continue @@ -663,6 +793,16 @@ func (s *NetlinkSocket) SetReceiveTimeout(timeout *unix.Timeval) error { return unix.SetsockoptTimeval(int(s.fd), unix.SOL_SOCKET, unix.SO_RCVTIMEO, timeout) } +// SetExtAck requests error messages to be reported on the socket +func (s *NetlinkSocket) SetExtAck(enable bool) error { + var enableN int + if enable { + enableN = 1 + } + + return unix.SetsockoptInt(int(s.fd), unix.SOL_NETLINK, unix.NETLINK_EXT_ACK, enableN) +} + func (s *NetlinkSocket) GetPid() (uint32, error) { fd := int(atomic.LoadInt32(&s.fd)) lsa, err := unix.Getsockname(fd) diff --git a/vendor/github.com/vishvananda/netlink/nl/parse_attr_linux.go b/vendor/github.com/vishvananda/netlink/nl/parse_attr_linux.go new file mode 100644 index 000000000..7f49125cf --- /dev/null +++ b/vendor/github.com/vishvananda/netlink/nl/parse_attr_linux.go @@ -0,0 +1,79 @@ +package nl + +import ( + "encoding/binary" + "fmt" + "log" +) + +type Attribute struct { + Type uint16 + Value []byte +} + +func ParseAttributes(data []byte) <-chan Attribute { + native := NativeEndian() + result := make(chan Attribute) + + go func() { + i := 0 + for i+4 < len(data) { + length := int(native.Uint16(data[i : i+2])) + attrType := native.Uint16(data[i+2 : i+4]) + + if length < 4 { + log.Printf("attribute 0x%02x has invalid length of %d bytes", attrType, length) + break + } + + if len(data) < i+length { + log.Printf("attribute 0x%02x of length %d is truncated, only %d bytes remaining", attrType, length, len(data)-i) + break + } + + result <- Attribute{ + Type: attrType, + Value: data[i+4 : i+length], + } + i += rtaAlignOf(length) + } + close(result) + }() + + return result +} + +func PrintAttributes(data []byte) { + printAttributes(data, 0) +} + +func printAttributes(data []byte, level int) { + for attr := range ParseAttributes(data) { + for i := 0; i < level; i++ { + print("> ") + } + nested := attr.Type&NLA_F_NESTED != 0 + fmt.Printf("type=%d nested=%v len=%v %v\n", attr.Type&NLA_TYPE_MASK, nested, len(attr.Value), attr.Value) + if nested { + printAttributes(attr.Value, level+1) + } + } +} + +// Uint32 returns the uint32 value respecting the NET_BYTEORDER flag +func (attr *Attribute) Uint32() uint32 { + if attr.Type&NLA_F_NET_BYTEORDER != 0 { + return binary.BigEndian.Uint32(attr.Value) + } else { + return NativeEndian().Uint32(attr.Value) + } +} + +// Uint64 returns the uint64 value respecting the NET_BYTEORDER flag +func (attr *Attribute) Uint64() uint64 { + if attr.Type&NLA_F_NET_BYTEORDER != 0 { + return binary.BigEndian.Uint64(attr.Value) + } else { + return NativeEndian().Uint64(attr.Value) + } +} diff --git a/vendor/github.com/vishvananda/netlink/nl/rdma_link_linux.go b/vendor/github.com/vishvananda/netlink/nl/rdma_link_linux.go index 1224b747d..ce43ee155 100644 --- a/vendor/github.com/vishvananda/netlink/nl/rdma_link_linux.go +++ b/vendor/github.com/vishvananda/netlink/nl/rdma_link_linux.go @@ -11,6 +11,8 @@ const ( const ( RDMA_NLDEV_CMD_GET = 1 RDMA_NLDEV_CMD_SET = 2 + RDMA_NLDEV_CMD_NEWLINK = 3 + RDMA_NLDEV_CMD_DELLINK = 4 RDMA_NLDEV_CMD_SYS_GET = 6 RDMA_NLDEV_CMD_SYS_SET = 7 ) @@ -30,6 +32,8 @@ const ( RDMA_NLDEV_ATTR_PORT_STATE = 12 RDMA_NLDEV_ATTR_PORT_PHYS_STATE = 13 RDMA_NLDEV_ATTR_DEV_NODE_TYPE = 14 + RDMA_NLDEV_ATTR_NDEV_NAME = 51 + RDMA_NLDEV_ATTR_LINK_TYPE = 65 RDMA_NLDEV_SYS_ATTR_NETNS_MODE = 66 RDMA_NLDEV_NET_NS_FD = 68 ) diff --git a/vendor/github.com/vishvananda/netlink/nl/seg6_linux.go b/vendor/github.com/vishvananda/netlink/nl/seg6_linux.go index 5774cbb15..fe88285f2 100644 --- a/vendor/github.com/vishvananda/netlink/nl/seg6_linux.go +++ b/vendor/github.com/vishvananda/netlink/nl/seg6_linux.go @@ -23,7 +23,7 @@ func (s1 *IPv6SrHdr) Equal(s2 IPv6SrHdr) bool { return false } for i := range s1.Segments { - if s1.Segments[i].Equal(s2.Segments[i]) != true { + if !s1.Segments[i].Equal(s2.Segments[i]) { return false } } @@ -89,7 +89,7 @@ func DecodeSEG6Encap(buf []byte) (int, []net.IP, error) { } buf = buf[12:] if len(buf)%16 != 0 { - err := fmt.Errorf("DecodeSEG6Encap: error parsing Segment List (buf len: %d)\n", len(buf)) + err := fmt.Errorf("DecodeSEG6Encap: error parsing Segment List (buf len: %d)", len(buf)) return mode, nil, err } for len(buf) > 0 { diff --git a/vendor/github.com/vishvananda/netlink/nl/syscall.go b/vendor/github.com/vishvananda/netlink/nl/syscall.go index f7f7f92e6..bdf6ba639 100644 --- a/vendor/github.com/vishvananda/netlink/nl/syscall.go +++ b/vendor/github.com/vishvananda/netlink/nl/syscall.go @@ -1,6 +1,6 @@ package nl -// syscall package lack of rule atributes type. +// syscall package lack of rule attributes type. // Thus there are defined below const ( FRA_UNSPEC = iota @@ -21,6 +21,13 @@ const ( FRA_TABLE /* Extended table id */ FRA_FWMASK /* mask for netfilter mark */ FRA_OIFNAME + FRA_PAD + FRA_L3MDEV /* iif or oif is l3mdev goto its table */ + FRA_UID_RANGE /* UID range */ + FRA_PROTOCOL /* Originator of the rule */ + FRA_IP_PROTO /* ip proto */ + FRA_SPORT_RANGE /* sport */ + FRA_DPORT_RANGE /* dport */ ) // ip rule netlink request types diff --git a/vendor/github.com/vishvananda/netlink/nl/tc_linux.go b/vendor/github.com/vishvananda/netlink/nl/tc_linux.go index 501f554b2..eb05ff1cd 100644 --- a/vendor/github.com/vishvananda/netlink/nl/tc_linux.go +++ b/vendor/github.com/vishvananda/netlink/nl/tc_linux.go @@ -90,10 +90,14 @@ const ( SizeofTcU32Sel = 0x10 // without keys SizeofTcGen = 0x14 SizeofTcConnmark = SizeofTcGen + 0x04 + SizeofTcCsum = SizeofTcGen + 0x04 SizeofTcMirred = SizeofTcGen + 0x08 SizeofTcTunnelKey = SizeofTcGen + 0x04 SizeofTcSkbEdit = SizeofTcGen SizeofTcPolice = 2*SizeofTcRateSpec + 0x20 + SizeofTcSfqQopt = 0x0b + SizeofTcSfqRedStats = 0x18 + SizeofTcSfqQoptV1 = SizeofTcSfqQopt + SizeofTcSfqRedStats + 0x1c ) // struct tcmsg { @@ -691,6 +695,36 @@ func (x *TcConnmark) Serialize() []byte { return (*(*[SizeofTcConnmark]byte)(unsafe.Pointer(x)))[:] } +const ( + TCA_CSUM_UNSPEC = iota + TCA_CSUM_PARMS + TCA_CSUM_TM + TCA_CSUM_PAD + TCA_CSUM_MAX = TCA_CSUM_PAD +) + +// struct tc_csum { +// tc_gen; +// __u32 update_flags; +// } + +type TcCsum struct { + TcGen + UpdateFlags uint32 +} + +func (msg *TcCsum) Len() int { + return SizeofTcCsum +} + +func DeserializeTcCsum(b []byte) *TcCsum { + return (*TcCsum)(unsafe.Pointer(&b[0:SizeofTcCsum][0])) +} + +func (x *TcCsum) Serialize() []byte { + return (*(*[SizeofTcCsum]byte)(unsafe.Pointer(x)))[:] +} + const ( TCA_ACT_MIRRED = 8 ) @@ -735,7 +769,13 @@ const ( TCA_TUNNEL_KEY_ENC_IPV6_SRC TCA_TUNNEL_KEY_ENC_IPV6_DST TCA_TUNNEL_KEY_ENC_KEY_ID - TCA_TUNNEL_KEY_MAX = TCA_TUNNEL_KEY_ENC_KEY_ID + TCA_TUNNEL_KEY_PAD + TCA_TUNNEL_KEY_ENC_DST_PORT + TCA_TUNNEL_KEY_NO_CSUM + TCA_TUNNEL_KEY_ENC_OPTS + TCA_TUNNEL_KEY_ENC_TOS + TCA_TUNNEL_KEY_ENC_TTL + TCA_TUNNEL_KEY_MAX ) type TcTunnelKey struct { @@ -872,3 +912,208 @@ const ( TCA_HFSC_FSC TCA_HFSC_USC ) + +const ( + TCA_FLOWER_UNSPEC = iota + TCA_FLOWER_CLASSID + TCA_FLOWER_INDEV + TCA_FLOWER_ACT + TCA_FLOWER_KEY_ETH_DST /* ETH_ALEN */ + TCA_FLOWER_KEY_ETH_DST_MASK /* ETH_ALEN */ + TCA_FLOWER_KEY_ETH_SRC /* ETH_ALEN */ + TCA_FLOWER_KEY_ETH_SRC_MASK /* ETH_ALEN */ + TCA_FLOWER_KEY_ETH_TYPE /* be16 */ + TCA_FLOWER_KEY_IP_PROTO /* u8 */ + TCA_FLOWER_KEY_IPV4_SRC /* be32 */ + TCA_FLOWER_KEY_IPV4_SRC_MASK /* be32 */ + TCA_FLOWER_KEY_IPV4_DST /* be32 */ + TCA_FLOWER_KEY_IPV4_DST_MASK /* be32 */ + TCA_FLOWER_KEY_IPV6_SRC /* struct in6_addr */ + TCA_FLOWER_KEY_IPV6_SRC_MASK /* struct in6_addr */ + TCA_FLOWER_KEY_IPV6_DST /* struct in6_addr */ + TCA_FLOWER_KEY_IPV6_DST_MASK /* struct in6_addr */ + TCA_FLOWER_KEY_TCP_SRC /* be16 */ + TCA_FLOWER_KEY_TCP_DST /* be16 */ + TCA_FLOWER_KEY_UDP_SRC /* be16 */ + TCA_FLOWER_KEY_UDP_DST /* be16 */ + + TCA_FLOWER_FLAGS + TCA_FLOWER_KEY_VLAN_ID /* be16 */ + TCA_FLOWER_KEY_VLAN_PRIO /* u8 */ + TCA_FLOWER_KEY_VLAN_ETH_TYPE /* be16 */ + + TCA_FLOWER_KEY_ENC_KEY_ID /* be32 */ + TCA_FLOWER_KEY_ENC_IPV4_SRC /* be32 */ + TCA_FLOWER_KEY_ENC_IPV4_SRC_MASK /* be32 */ + TCA_FLOWER_KEY_ENC_IPV4_DST /* be32 */ + TCA_FLOWER_KEY_ENC_IPV4_DST_MASK /* be32 */ + TCA_FLOWER_KEY_ENC_IPV6_SRC /* struct in6_addr */ + TCA_FLOWER_KEY_ENC_IPV6_SRC_MASK /* struct in6_addr */ + TCA_FLOWER_KEY_ENC_IPV6_DST /* struct in6_addr */ + TCA_FLOWER_KEY_ENC_IPV6_DST_MASK /* struct in6_addr */ + + TCA_FLOWER_KEY_TCP_SRC_MASK /* be16 */ + TCA_FLOWER_KEY_TCP_DST_MASK /* be16 */ + TCA_FLOWER_KEY_UDP_SRC_MASK /* be16 */ + TCA_FLOWER_KEY_UDP_DST_MASK /* be16 */ + TCA_FLOWER_KEY_SCTP_SRC_MASK /* be16 */ + TCA_FLOWER_KEY_SCTP_DST_MASK /* be16 */ + + TCA_FLOWER_KEY_SCTP_SRC /* be16 */ + TCA_FLOWER_KEY_SCTP_DST /* be16 */ + + TCA_FLOWER_KEY_ENC_UDP_SRC_PORT /* be16 */ + TCA_FLOWER_KEY_ENC_UDP_SRC_PORT_MASK /* be16 */ + TCA_FLOWER_KEY_ENC_UDP_DST_PORT /* be16 */ + TCA_FLOWER_KEY_ENC_UDP_DST_PORT_MASK /* be16 */ + + TCA_FLOWER_KEY_FLAGS /* be32 */ + TCA_FLOWER_KEY_FLAGS_MASK /* be32 */ + + TCA_FLOWER_KEY_ICMPV4_CODE /* u8 */ + TCA_FLOWER_KEY_ICMPV4_CODE_MASK /* u8 */ + TCA_FLOWER_KEY_ICMPV4_TYPE /* u8 */ + TCA_FLOWER_KEY_ICMPV4_TYPE_MASK /* u8 */ + TCA_FLOWER_KEY_ICMPV6_CODE /* u8 */ + TCA_FLOWER_KEY_ICMPV6_CODE_MASK /* u8 */ + TCA_FLOWER_KEY_ICMPV6_TYPE /* u8 */ + TCA_FLOWER_KEY_ICMPV6_TYPE_MASK /* u8 */ + + TCA_FLOWER_KEY_ARP_SIP /* be32 */ + TCA_FLOWER_KEY_ARP_SIP_MASK /* be32 */ + TCA_FLOWER_KEY_ARP_TIP /* be32 */ + TCA_FLOWER_KEY_ARP_TIP_MASK /* be32 */ + TCA_FLOWER_KEY_ARP_OP /* u8 */ + TCA_FLOWER_KEY_ARP_OP_MASK /* u8 */ + TCA_FLOWER_KEY_ARP_SHA /* ETH_ALEN */ + TCA_FLOWER_KEY_ARP_SHA_MASK /* ETH_ALEN */ + TCA_FLOWER_KEY_ARP_THA /* ETH_ALEN */ + TCA_FLOWER_KEY_ARP_THA_MASK /* ETH_ALEN */ + + TCA_FLOWER_KEY_MPLS_TTL /* u8 - 8 bits */ + TCA_FLOWER_KEY_MPLS_BOS /* u8 - 1 bit */ + TCA_FLOWER_KEY_MPLS_TC /* u8 - 3 bits */ + TCA_FLOWER_KEY_MPLS_LABEL /* be32 - 20 bits */ + + TCA_FLOWER_KEY_TCP_FLAGS /* be16 */ + TCA_FLOWER_KEY_TCP_FLAGS_MASK /* be16 */ + + TCA_FLOWER_KEY_IP_TOS /* u8 */ + TCA_FLOWER_KEY_IP_TOS_MASK /* u8 */ + TCA_FLOWER_KEY_IP_TTL /* u8 */ + TCA_FLOWER_KEY_IP_TTL_MASK /* u8 */ + + TCA_FLOWER_KEY_CVLAN_ID /* be16 */ + TCA_FLOWER_KEY_CVLAN_PRIO /* u8 */ + TCA_FLOWER_KEY_CVLAN_ETH_TYPE /* be16 */ + + TCA_FLOWER_KEY_ENC_IP_TOS /* u8 */ + TCA_FLOWER_KEY_ENC_IP_TOS_MASK /* u8 */ + TCA_FLOWER_KEY_ENC_IP_TTL /* u8 */ + TCA_FLOWER_KEY_ENC_IP_TTL_MASK /* u8 */ + + TCA_FLOWER_KEY_ENC_OPTS + TCA_FLOWER_KEY_ENC_OPTS_MASK + + __TCA_FLOWER_MAX +) + +// struct tc_sfq_qopt { +// unsigned quantum; /* Bytes per round allocated to flow */ +// int perturb_period; /* Period of hash perturbation */ +// __u32 limit; /* Maximal packets in queue */ +// unsigned divisor; /* Hash divisor */ +// unsigned flows; /* Maximal number of flows */ +// }; + +type TcSfqQopt struct { + Quantum uint8 + Perturb int32 + Limit uint32 + Divisor uint8 + Flows uint8 +} + +func (x *TcSfqQopt) Len() int { + return SizeofTcSfqQopt +} + +func DeserializeTcSfqQopt(b []byte) *TcSfqQopt { + return (*TcSfqQopt)(unsafe.Pointer(&b[0:SizeofTcSfqQopt][0])) +} + +func (x *TcSfqQopt) Serialize() []byte { + return (*(*[SizeofTcSfqQopt]byte)(unsafe.Pointer(x)))[:] +} + +// struct tc_sfqred_stats { +// __u32 prob_drop; /* Early drops, below max threshold */ +// __u32 forced_drop; /* Early drops, after max threshold */ +// __u32 prob_mark; /* Marked packets, below max threshold */ +// __u32 forced_mark; /* Marked packets, after max threshold */ +// __u32 prob_mark_head; /* Marked packets, below max threshold */ +// __u32 forced_mark_head;/* Marked packets, after max threshold */ +// }; +type TcSfqRedStats struct { + ProbDrop uint32 + ForcedDrop uint32 + ProbMark uint32 + ForcedMark uint32 + ProbMarkHead uint32 + ForcedMarkHead uint32 +} + +func (x *TcSfqRedStats) Len() int { + return SizeofTcSfqRedStats +} + +func DeserializeTcSfqRedStats(b []byte) *TcSfqRedStats { + return (*TcSfqRedStats)(unsafe.Pointer(&b[0:SizeofTcSfqRedStats][0])) +} + +func (x *TcSfqRedStats) Serialize() []byte { + return (*(*[SizeofTcSfqRedStats]byte)(unsafe.Pointer(x)))[:] +} + +// struct tc_sfq_qopt_v1 { +// struct tc_sfq_qopt v0; +// unsigned int depth; /* max number of packets per flow */ +// unsigned int headdrop; +// /* SFQRED parameters */ +// __u32 limit; /* HARD maximal flow queue length (bytes) */ +// __u32 qth_min; /* Min average length threshold (bytes) */ +// __u32 qth_max; /* Max average length threshold (bytes) */ +// unsigned char Wlog; /* log(W) */ +// unsigned char Plog; /* log(P_max/(qth_max-qth_min)) */ +// unsigned char Scell_log; /* cell size for idle damping */ +// unsigned char flags; +// __u32 max_P; /* probability, high resolution */ +// /* SFQRED stats */ +// struct tc_sfqred_stats stats; +// }; +type TcSfqQoptV1 struct { + TcSfqQopt + Depth uint32 + HeadDrop uint32 + Limit uint32 + QthMin uint32 + QthMax uint32 + Wlog byte + Plog byte + ScellLog byte + Flags byte + MaxP uint32 + TcSfqRedStats +} + +func (x *TcSfqQoptV1) Len() int { + return SizeofTcSfqQoptV1 +} + +func DeserializeTcSfqQoptV1(b []byte) *TcSfqQoptV1 { + return (*TcSfqQoptV1)(unsafe.Pointer(&b[0:SizeofTcSfqQoptV1][0])) +} + +func (x *TcSfqQoptV1) Serialize() []byte { + return (*(*[SizeofTcSfqQoptV1]byte)(unsafe.Pointer(x)))[:] +} diff --git a/vendor/github.com/vishvananda/netlink/nl/xfrm_state_linux.go b/vendor/github.com/vishvananda/netlink/nl/xfrm_state_linux.go index b6290fd54..43a947f22 100644 --- a/vendor/github.com/vishvananda/netlink/nl/xfrm_state_linux.go +++ b/vendor/github.com/vishvananda/netlink/nl/xfrm_state_linux.go @@ -13,7 +13,7 @@ const ( SizeofXfrmAlgoAuth = 0x48 SizeofXfrmAlgoAEAD = 0x48 SizeofXfrmEncapTmpl = 0x18 - SizeofXfrmUsersaFlush = 0x8 + SizeofXfrmUsersaFlush = 0x1 SizeofXfrmReplayStateEsn = 0x18 ) diff --git a/vendor/github.com/vishvananda/netlink/proc_event_linux.go b/vendor/github.com/vishvananda/netlink/proc_event_linux.go new file mode 100644 index 000000000..53bc59a6e --- /dev/null +++ b/vendor/github.com/vishvananda/netlink/proc_event_linux.go @@ -0,0 +1,217 @@ +package netlink + +import ( + "bytes" + "encoding/binary" + "fmt" + "os" + "syscall" + + "github.com/vishvananda/netlink/nl" + "github.com/vishvananda/netns" + "golang.org/x/sys/unix" +) + +const CN_IDX_PROC = 0x1 + +const ( + PROC_EVENT_NONE = 0x00000000 + PROC_EVENT_FORK = 0x00000001 + PROC_EVENT_EXEC = 0x00000002 + PROC_EVENT_UID = 0x00000004 + PROC_EVENT_GID = 0x00000040 + PROC_EVENT_SID = 0x00000080 + PROC_EVENT_PTRACE = 0x00000100 + PROC_EVENT_COMM = 0x00000200 + PROC_EVENT_COREDUMP = 0x40000000 + PROC_EVENT_EXIT = 0x80000000 +) + +const ( + CN_VAL_PROC = 0x1 + PROC_CN_MCAST_LISTEN = 0x1 +) + +type ProcEventMsg interface { + Pid() uint32 + Tgid() uint32 +} + +type ProcEventHeader struct { + What uint32 + CPU uint32 + Timestamp uint64 +} + +type ProcEvent struct { + ProcEventHeader + Msg ProcEventMsg +} + +func (pe *ProcEvent) setHeader(h ProcEventHeader) { + pe.What = h.What + pe.CPU = h.CPU + pe.Timestamp = h.Timestamp +} + +type ExitProcEvent struct { + ProcessPid uint32 + ProcessTgid uint32 + ExitCode uint32 + ExitSignal uint32 + ParentPid uint32 + ParentTgid uint32 +} + +type ExitProcEvent2 struct { + ProcessPid uint32 + ProcessTgid uint32 + ExitCode uint32 + ExitSignal uint32 + ParentPid uint32 + ParentTgid uint32 +} + +func (e *ExitProcEvent) Pid() uint32 { + return e.ProcessPid +} + +func (e *ExitProcEvent) Tgid() uint32 { + return e.ProcessTgid +} + +type ExecProcEvent struct { + ProcessPid uint32 + ProcessTgid uint32 +} + +func (e *ExecProcEvent) Pid() uint32 { + return e.ProcessPid +} + +func (e *ExecProcEvent) Tgid() uint32 { + return e.ProcessTgid +} + +type ForkProcEvent struct { + ParentPid uint32 + ParentTgid uint32 + ChildPid uint32 + ChildTgid uint32 +} + +func (e *ForkProcEvent) Pid() uint32 { + return e.ParentPid +} + +func (e *ForkProcEvent) Tgid() uint32 { + return e.ParentTgid +} + +type CommProcEvent struct { + ProcessPid uint32 + ProcessTgid uint32 + Comm [16]byte +} + +func (e *CommProcEvent) Pid() uint32 { + return e.ProcessPid +} + +func (e *CommProcEvent) Tgid() uint32 { + return e.ProcessTgid +} + +func ProcEventMonitor(ch chan<- ProcEvent, done <-chan struct{}, errorChan chan<- error) error { + h, err := NewHandle() + if err != nil { + return err + } + defer h.Delete() + + s, err := nl.SubscribeAt(netns.None(), netns.None(), unix.NETLINK_CONNECTOR, CN_IDX_PROC) + if err != nil { + return err + } + + var nlmsg nl.NetlinkRequest + + nlmsg.Pid = uint32(os.Getpid()) + nlmsg.Type = unix.NLMSG_DONE + nlmsg.Len = uint32(unix.SizeofNlMsghdr) + + cm := nl.NewCnMsg(CN_IDX_PROC, CN_VAL_PROC, PROC_CN_MCAST_LISTEN) + nlmsg.AddData(cm) + + s.Send(&nlmsg) + + if done != nil { + go func() { + <-done + s.Close() + }() + } + + go func() { + defer close(ch) + for { + msgs, from, err := s.Receive() + if err != nil { + errorChan <- err + return + } + if from.Pid != nl.PidKernel { + errorChan <- fmt.Errorf("Wrong sender portid %d, expected %d", from.Pid, nl.PidKernel) + return + } + + for _, m := range msgs { + e := parseNetlinkMessage(m) + if e != nil { + ch <- *e + } + } + + } + }() + + return nil +} + +func parseNetlinkMessage(m syscall.NetlinkMessage) *ProcEvent { + if m.Header.Type == unix.NLMSG_DONE { + buf := bytes.NewBuffer(m.Data) + msg := &nl.CnMsg{} + hdr := &ProcEventHeader{} + binary.Read(buf, nl.NativeEndian(), msg) + binary.Read(buf, nl.NativeEndian(), hdr) + + pe := &ProcEvent{} + pe.setHeader(*hdr) + switch hdr.What { + case PROC_EVENT_EXIT: + event := &ExitProcEvent{} + binary.Read(buf, nl.NativeEndian(), event) + pe.Msg = event + return pe + case PROC_EVENT_FORK: + event := &ForkProcEvent{} + binary.Read(buf, nl.NativeEndian(), event) + pe.Msg = event + return pe + case PROC_EVENT_EXEC: + event := &ExecProcEvent{} + binary.Read(buf, nl.NativeEndian(), event) + pe.Msg = event + return pe + case PROC_EVENT_COMM: + event := &CommProcEvent{} + binary.Read(buf, nl.NativeEndian(), event) + pe.Msg = event + return pe + } + return nil + } + + return nil +} diff --git a/vendor/github.com/vishvananda/netlink/qdisc.go b/vendor/github.com/vishvananda/netlink/qdisc.go index af78305ac..f594c9c21 100644 --- a/vendor/github.com/vishvananda/netlink/qdisc.go +++ b/vendor/github.com/vishvananda/netlink/qdisc.go @@ -308,13 +308,15 @@ func (qdisc *Fq) Type() string { // FQ_Codel (Fair Queuing Controlled Delay) is queuing discipline that combines Fair Queuing with the CoDel AQM scheme. type FqCodel struct { QdiscAttrs - Target uint32 - Limit uint32 - Interval uint32 - ECN uint32 - Flows uint32 - Quantum uint32 - // There are some more attributes here, but support for them seems not ubiquitous + Target uint32 + Limit uint32 + Interval uint32 + ECN uint32 + Flows uint32 + Quantum uint32 + CEThreshold uint32 + DropBatchSize uint32 + MemoryLimit uint32 } func (fqcodel *FqCodel) String() string { @@ -338,3 +340,27 @@ func (qdisc *FqCodel) Attrs() *QdiscAttrs { func (qdisc *FqCodel) Type() string { return "fq_codel" } + +type Sfq struct { + QdiscAttrs + // TODO: Only the simplified options for SFQ are handled here. Support for the extended one can be added later. + Quantum uint8 + Perturb uint8 + Limit uint32 + Divisor uint8 +} + +func (sfq *Sfq) String() string { + return fmt.Sprintf( + "{%v -- Quantum: %v, Perturb: %v, Limit: %v, Divisor: %v}", + sfq.Attrs(), sfq.Quantum, sfq.Perturb, sfq.Limit, sfq.Divisor, + ) +} + +func (qdisc *Sfq) Attrs() *QdiscAttrs { + return &qdisc.QdiscAttrs +} + +func (qdisc *Sfq) Type() string { + return "sfq" +} diff --git a/vendor/github.com/vishvananda/netlink/qdisc_linux.go b/vendor/github.com/vishvananda/netlink/qdisc_linux.go index e9eee5908..e182e1cfe 100644 --- a/vendor/github.com/vishvananda/netlink/qdisc_linux.go +++ b/vendor/github.com/vishvananda/netlink/qdisc_linux.go @@ -250,7 +250,15 @@ func qdiscPayload(req *nl.NetlinkRequest, qdisc Qdisc) error { if qdisc.Quantum > 0 { options.AddRtAttr(nl.TCA_FQ_CODEL_QUANTUM, nl.Uint32Attr((uint32(qdisc.Quantum)))) } - + if qdisc.CEThreshold > 0 { + options.AddRtAttr(nl.TCA_FQ_CODEL_CE_THRESHOLD, nl.Uint32Attr(qdisc.CEThreshold)) + } + if qdisc.DropBatchSize > 0 { + options.AddRtAttr(nl.TCA_FQ_CODEL_DROP_BATCH_SIZE, nl.Uint32Attr(qdisc.DropBatchSize)) + } + if qdisc.MemoryLimit > 0 { + options.AddRtAttr(nl.TCA_FQ_CODEL_MEMORY_LIMIT, nl.Uint32Attr(qdisc.MemoryLimit)) + } case *Fq: options.AddRtAttr(nl.TCA_FQ_RATE_ENABLE, nl.Uint32Attr((uint32(qdisc.Pacing)))) @@ -278,6 +286,14 @@ func qdiscPayload(req *nl.NetlinkRequest, qdisc Qdisc) error { if qdisc.FlowDefaultRate > 0 { options.AddRtAttr(nl.TCA_FQ_FLOW_DEFAULT_RATE, nl.Uint32Attr((uint32(qdisc.FlowDefaultRate)))) } + case *Sfq: + opt := nl.TcSfqQoptV1{} + opt.TcSfqQopt.Quantum = qdisc.Quantum + opt.TcSfqQopt.Perturb = int32(qdisc.Perturb) + opt.TcSfqQopt.Limit = qdisc.Limit + opt.TcSfqQopt.Divisor = qdisc.Divisor + + options = nl.NewRtAttr(nl.TCA_OPTIONS, opt.Serialize()) default: options = nil } @@ -362,6 +378,8 @@ func (h *Handle) QdiscList(link Link) ([]Qdisc, error) { qdisc = &FqCodel{} case "netem": qdisc = &Netem{} + case "sfq": + qdisc = &Sfq{} default: qdisc = &GenericQdisc{QdiscType: qdiscType} } @@ -417,6 +435,10 @@ func (h *Handle) QdiscList(link Link) ([]Qdisc, error) { if err := parseNetemData(qdisc, attr.Value); err != nil { return nil, err } + case "sfq": + if err := parseSfqData(qdisc, attr.Value); err != nil { + return nil, err + } // no options for ingress } @@ -446,7 +468,6 @@ func parsePrioData(qdisc Qdisc, value []byte) error { } func parseHtbData(qdisc Qdisc, data []syscall.NetlinkRouteAttr) error { - native = nl.NativeEndian() htb := qdisc.(*Htb) for _, datum := range data { switch datum.Attr.Type { @@ -466,7 +487,6 @@ func parseHtbData(qdisc Qdisc, data []syscall.NetlinkRouteAttr) error { } func parseFqCodelData(qdisc Qdisc, data []syscall.NetlinkRouteAttr) error { - native = nl.NativeEndian() fqCodel := qdisc.(*FqCodel) for _, datum := range data { @@ -483,6 +503,12 @@ func parseFqCodelData(qdisc Qdisc, data []syscall.NetlinkRouteAttr) error { fqCodel.Flows = native.Uint32(datum.Value) case nl.TCA_FQ_CODEL_QUANTUM: fqCodel.Quantum = native.Uint32(datum.Value) + case nl.TCA_FQ_CODEL_CE_THRESHOLD: + fqCodel.CEThreshold = native.Uint32(datum.Value) + case nl.TCA_FQ_CODEL_DROP_BATCH_SIZE: + fqCodel.DropBatchSize = native.Uint32(datum.Value) + case nl.TCA_FQ_CODEL_MEMORY_LIMIT: + fqCodel.MemoryLimit = native.Uint32(datum.Value) } } return nil @@ -490,13 +516,11 @@ func parseFqCodelData(qdisc Qdisc, data []syscall.NetlinkRouteAttr) error { func parseHfscData(qdisc Qdisc, data []byte) error { Hfsc := qdisc.(*Hfsc) - native = nl.NativeEndian() Hfsc.Defcls = native.Uint16(data) return nil } func parseFqData(qdisc Qdisc, data []syscall.NetlinkRouteAttr) error { - native = nl.NativeEndian() fq := qdisc.(*Fq) for _, datum := range data { switch datum.Attr.Type { @@ -561,7 +585,6 @@ func parseNetemData(qdisc Qdisc, value []byte) error { } func parseTbfData(qdisc Qdisc, data []syscall.NetlinkRouteAttr) error { - native = nl.NativeEndian() tbf := qdisc.(*Tbf) for _, datum := range data { switch datum.Attr.Type { @@ -582,6 +605,17 @@ func parseTbfData(qdisc Qdisc, data []syscall.NetlinkRouteAttr) error { return nil } +func parseSfqData(qdisc Qdisc, value []byte) error { + sfq := qdisc.(*Sfq) + opt := nl.DeserializeTcSfqQoptV1(value) + sfq.Quantum = opt.TcSfqQopt.Quantum + sfq.Perturb = uint8(opt.TcSfqQopt.Perturb) + sfq.Limit = opt.TcSfqQopt.Limit + sfq.Divisor = opt.TcSfqQopt.Divisor + + return nil +} + const ( TIME_UNITS_PER_SEC = 1000000 ) @@ -598,10 +632,10 @@ func initClock() { return } parts := strings.Split(strings.TrimSpace(string(data)), " ") - if len(parts) < 3 { + if len(parts) < 4 { return } - var vals [3]uint64 + var vals [4]uint64 for i := range vals { val, err := strconv.ParseUint(parts[i], 16, 32) if err != nil { @@ -615,7 +649,12 @@ func initClock() { } clockFactor = float64(vals[2]) / TIME_UNITS_PER_SEC tickInUsec = float64(vals[0]) / float64(vals[1]) * clockFactor - hz = float64(vals[0]) + if vals[2] == 1000000 { + // ref https://git.kernel.org/pub/scm/network/iproute2/iproute2.git/tree/lib/utils.c#n963 + hz = float64(vals[3]) + } else { + hz = 100 + } } func TickInUsec() float64 { @@ -663,6 +702,11 @@ func latency(rate uint64, limit, buffer uint32) float64 { return TIME_UNITS_PER_SEC*(float64(limit)/float64(rate)) - float64(tick2Time(buffer)) } -func Xmittime(rate uint64, size uint32) float64 { - return TickInUsec() * TIME_UNITS_PER_SEC * (float64(size) / float64(rate)) +func Xmittime(rate uint64, size uint32) uint32 { + // https://git.kernel.org/pub/scm/network/iproute2/iproute2.git/tree/tc/tc_core.c#n62 + return time2Tick(uint32(TIME_UNITS_PER_SEC * (float64(size) / float64(rate)))) +} + +func Xmitsize(rate uint64, ticks uint32) uint32 { + return uint32((float64(rate) * float64(tick2Time(ticks))) / TIME_UNITS_PER_SEC) } diff --git a/vendor/github.com/vishvananda/netlink/rdma_link_linux.go b/vendor/github.com/vishvananda/netlink/rdma_link_linux.go index 2d0bdc8c3..036399db6 100644 --- a/vendor/github.com/vishvananda/netlink/rdma_link_linux.go +++ b/vendor/github.com/vishvananda/netlink/rdma_link_linux.go @@ -77,28 +77,39 @@ func executeOneGetRdmaLink(data []byte) (*RdmaLink, error) { return &link, nil } -func execRdmaGetLink(req *nl.NetlinkRequest, name string) (*RdmaLink, error) { +func execRdmaSetLink(req *nl.NetlinkRequest) error { + + _, err := req.Execute(unix.NETLINK_RDMA, 0) + return err +} + +// RdmaLinkList gets a list of RDMA link devices. +// Equivalent to: `rdma dev show` +func RdmaLinkList() ([]*RdmaLink, error) { + return pkgHandle.RdmaLinkList() +} + +// RdmaLinkList gets a list of RDMA link devices. +// Equivalent to: `rdma dev show` +func (h *Handle) RdmaLinkList() ([]*RdmaLink, error) { + proto := getProtoField(nl.RDMA_NL_NLDEV, nl.RDMA_NLDEV_CMD_GET) + req := h.newNetlinkRequest(proto, unix.NLM_F_ACK|unix.NLM_F_DUMP) msgs, err := req.Execute(unix.NETLINK_RDMA, 0) if err != nil { return nil, err } + + var res []*RdmaLink for _, m := range msgs { link, err := executeOneGetRdmaLink(m) if err != nil { return nil, err } - if link.Attrs.Name == name { - return link, nil - } + res = append(res, link) } - return nil, fmt.Errorf("Rdma device %v not found", name) -} - -func execRdmaSetLink(req *nl.NetlinkRequest) error { - _, err := req.Execute(unix.NETLINK_RDMA, 0) - return err + return res, nil } // RdmaLinkByName finds a link by name and returns a pointer to the object if @@ -110,11 +121,16 @@ func RdmaLinkByName(name string) (*RdmaLink, error) { // RdmaLinkByName finds a link by name and returns a pointer to the object if // found and nil error, otherwise returns error code. func (h *Handle) RdmaLinkByName(name string) (*RdmaLink, error) { - - proto := getProtoField(nl.RDMA_NL_NLDEV, nl.RDMA_NLDEV_CMD_GET) - req := h.newNetlinkRequest(proto, unix.NLM_F_ACK|unix.NLM_F_DUMP) - - return execRdmaGetLink(req, name) + links, err := h.RdmaLinkList() + if err != nil { + return nil, err + } + for _, link := range links { + if link.Attrs.Name == name { + return link, nil + } + } + return nil, fmt.Errorf("Rdma device %v not found", name) } // RdmaLinkSetName sets the name of the rdma link device. Return nil on success @@ -262,3 +278,54 @@ func (h *Handle) RdmaLinkSetNsFd(link *RdmaLink, fd uint32) error { return execRdmaSetLink(req) } + +// RdmaLinkDel deletes an rdma link +// +// Similar to: rdma link delete NAME +// REF: https://man7.org/linux/man-pages/man8/rdma-link.8.html +func RdmaLinkDel(name string) error { + return pkgHandle.RdmaLinkDel(name) +} + +// RdmaLinkDel deletes an rdma link. +func (h *Handle) RdmaLinkDel(name string) error { + link, err := h.RdmaLinkByName(name) + if err != nil { + return err + } + + proto := getProtoField(nl.RDMA_NL_NLDEV, nl.RDMA_NLDEV_CMD_DELLINK) + req := h.newNetlinkRequest(proto, unix.NLM_F_ACK) + + b := make([]byte, 4) + native.PutUint32(b, link.Attrs.Index) + req.AddData(nl.NewRtAttr(nl.RDMA_NLDEV_ATTR_DEV_INDEX, b)) + + _, err = req.Execute(unix.NETLINK_RDMA, 0) + return err +} + +// RdmaLinkAdd adds an rdma link for the specified type to the network device. +// Similar to: rdma link add NAME type TYPE netdev NETDEV +// NAME - specifies the new name of the rdma link to add +// TYPE - specifies which rdma type to use. Link types: +// rxe - Soft RoCE driver +// siw - Soft iWARP driver +// NETDEV - specifies the network device to which the link is bound +// +// REF: https://man7.org/linux/man-pages/man8/rdma-link.8.html +func RdmaLinkAdd(linkName, linkType, netdev string) error { + return pkgHandle.RdmaLinkAdd(linkName, linkType, netdev) +} + +// RdmaLinkAdd adds an rdma link for the specified type to the network device. +func (h *Handle) RdmaLinkAdd(linkName string, linkType string, netdev string) error { + proto := getProtoField(nl.RDMA_NL_NLDEV, nl.RDMA_NLDEV_CMD_NEWLINK) + req := h.newNetlinkRequest(proto, unix.NLM_F_ACK) + + req.AddData(nl.NewRtAttr(nl.RDMA_NLDEV_ATTR_DEV_NAME, nl.ZeroTerminated(linkName))) + req.AddData(nl.NewRtAttr(nl.RDMA_NLDEV_ATTR_LINK_TYPE, nl.ZeroTerminated(linkType))) + req.AddData(nl.NewRtAttr(nl.RDMA_NLDEV_ATTR_NDEV_NAME, nl.ZeroTerminated(netdev))) + _, err := req.Execute(unix.NETLINK_RDMA, 0) + return err +} diff --git a/vendor/github.com/vishvananda/netlink/route.go b/vendor/github.com/vishvananda/netlink/route.go index 58ff1af60..79cc218ec 100644 --- a/vendor/github.com/vishvananda/netlink/route.go +++ b/vendor/github.com/vishvananda/netlink/route.go @@ -11,6 +11,24 @@ type Scope uint8 type NextHopFlag int +const ( + RT_FILTER_PROTOCOL uint64 = 1 << (1 + iota) + RT_FILTER_SCOPE + RT_FILTER_TYPE + RT_FILTER_TOS + RT_FILTER_IIF + RT_FILTER_OIF + RT_FILTER_DST + RT_FILTER_SRC + RT_FILTER_GW + RT_FILTER_TABLE + RT_FILTER_HOPLIMIT + RT_FILTER_PRIORITY + RT_FILTER_MARK + RT_FILTER_MASK + RT_FILTER_REALM +) + type Destination interface { Family() int Decode([]byte) error @@ -27,27 +45,46 @@ type Encap interface { Equal(Encap) bool } +//Protocol describe what was the originator of the route +type RouteProtocol int + // Route represents a netlink route. type Route struct { - LinkIndex int - ILinkIndex int - Scope Scope - Dst *net.IPNet - Src net.IP - Gw net.IP - MultiPath []*NexthopInfo - Protocol int - Priority int - Table int - Type int - Tos int - Flags int - MPLSDst *int - NewDst Destination - Encap Encap - MTU int - AdvMSS int - Hoplimit int + LinkIndex int + ILinkIndex int + Scope Scope + Dst *net.IPNet + Src net.IP + Gw net.IP + MultiPath []*NexthopInfo + Protocol RouteProtocol + Priority int + Family int + Table int + Type int + Tos int + Flags int + MPLSDst *int + NewDst Destination + Encap Encap + Via Destination + Realm int + MTU int + Window int + Rtt int + RttVar int + Ssthresh int + Cwnd int + AdvMSS int + Reordering int + Hoplimit int + InitCwnd int + Features int + RtoMin int + InitRwnd int + QuickACK int + Congctl string + FastOpenNoCookie int } func (r Route) String() string { @@ -66,6 +103,9 @@ func (r Route) String() string { if r.Encap != nil { elems = append(elems, fmt.Sprintf("Encap: %s", r.Encap)) } + if r.Via != nil { + elems = append(elems, fmt.Sprintf("Via: %s", r.Via)) + } elems = append(elems, fmt.Sprintf("Src: %s", r.Src)) if len(r.MultiPath) > 0 { elems = append(elems, fmt.Sprintf("Gw: %s", r.MultiPath)) @@ -74,6 +114,7 @@ func (r Route) String() string { } elems = append(elems, fmt.Sprintf("Flags: %s", r.ListFlags())) elems = append(elems, fmt.Sprintf("Table: %d", r.Table)) + elems = append(elems, fmt.Sprintf("Realm: %d", r.Realm)) return fmt.Sprintf("{%s}", strings.Join(elems, " ")) } @@ -87,6 +128,7 @@ func (r Route) Equal(x Route) bool { nexthopInfoSlice(r.MultiPath).Equal(x.MultiPath) && r.Protocol == x.Protocol && r.Priority == x.Priority && + r.Realm == x.Realm && r.Table == x.Table && r.Type == x.Type && r.Tos == x.Tos && @@ -94,6 +136,7 @@ func (r Route) Equal(x Route) bool { r.Flags == x.Flags && (r.MPLSDst == x.MPLSDst || (r.MPLSDst != nil && x.MPLSDst != nil && *r.MPLSDst == *x.MPLSDst)) && (r.NewDst == x.NewDst || (r.NewDst != nil && r.NewDst.Equal(x.NewDst))) && + (r.Via == x.Via || (r.Via != nil && r.Via.Equal(x.Via))) && (r.Encap == x.Encap || (r.Encap != nil && r.Encap.Equal(x.Encap))) } @@ -123,6 +166,7 @@ type NexthopInfo struct { Flags int NewDst Destination Encap Encap + Via Destination } func (n *NexthopInfo) String() string { @@ -134,6 +178,9 @@ func (n *NexthopInfo) String() string { if n.Encap != nil { elems = append(elems, fmt.Sprintf("Encap: %s", n.Encap)) } + if n.Via != nil { + elems = append(elems, fmt.Sprintf("Via: %s", n.Via)) + } elems = append(elems, fmt.Sprintf("Weight: %d", n.Hops+1)) elems = append(elems, fmt.Sprintf("Gw: %s", n.Gw)) elems = append(elems, fmt.Sprintf("Flags: %s", n.ListFlags())) diff --git a/vendor/github.com/vishvananda/netlink/route_linux.go b/vendor/github.com/vishvananda/netlink/route_linux.go index c69c595ed..8da886657 100644 --- a/vendor/github.com/vishvananda/netlink/route_linux.go +++ b/vendor/github.com/vishvananda/netlink/route_linux.go @@ -1,8 +1,11 @@ package netlink import ( + "bytes" + "encoding/binary" "fmt" "net" + "strconv" "strings" "syscall" @@ -21,19 +24,23 @@ const ( SCOPE_NOWHERE Scope = unix.RT_SCOPE_NOWHERE ) -const ( - RT_FILTER_PROTOCOL uint64 = 1 << (1 + iota) - RT_FILTER_SCOPE - RT_FILTER_TYPE - RT_FILTER_TOS - RT_FILTER_IIF - RT_FILTER_OIF - RT_FILTER_DST - RT_FILTER_SRC - RT_FILTER_GW - RT_FILTER_TABLE - RT_FILTER_HOPLIMIT -) +func (s Scope) String() string { + switch s { + case SCOPE_UNIVERSE: + return "universe" + case SCOPE_SITE: + return "site" + case SCOPE_LINK: + return "link" + case SCOPE_HOST: + return "host" + case SCOPE_NOWHERE: + return "nowhere" + default: + return "unknown" + } +} + const ( FLAG_ONLINK NextHopFlag = unix.RTNH_F_ONLINK @@ -128,7 +135,6 @@ func (e *MPLSEncap) Decode(buf []byte) error { if len(buf) < 4 { return fmt.Errorf("lack of bytes") } - native := nl.NativeEndian() l := native.Uint16(buf) if len(buf) < int(l) { return fmt.Errorf("lack of bytes") @@ -144,7 +150,6 @@ func (e *MPLSEncap) Decode(buf []byte) error { func (e *MPLSEncap) Encode() ([]byte, error) { s := nl.EncodeMPLSStack(e.Labels...) - native := nl.NativeEndian() hdr := make([]byte, 4) native.PutUint16(hdr, uint16(len(s)+4)) native.PutUint16(hdr[2:], nl.MPLS_IPTUNNEL_DST) @@ -200,7 +205,6 @@ func (e *SEG6Encap) Decode(buf []byte) error { if len(buf) < 4 { return fmt.Errorf("lack of bytes") } - native := nl.NativeEndian() // Get Length(l) & Type(typ) : 2 + 2 bytes l := native.Uint16(buf) if len(buf) < int(l) { @@ -220,7 +224,6 @@ func (e *SEG6Encap) Decode(buf []byte) error { } func (e *SEG6Encap) Encode() ([]byte, error) { s, err := nl.EncodeSEG6Encap(e.Mode, e.Segments) - native := nl.NativeEndian() hdr := make([]byte, 4) native.PutUint16(hdr, uint16(len(s)+4)) native.PutUint16(hdr[2:], nl.SEG6_IPTUNNEL_SRH) @@ -230,7 +233,7 @@ func (e *SEG6Encap) String() string { segs := make([]string, 0, len(e.Segments)) // append segment backwards (from n to 0) since seg#0 is the last segment. for i := len(e.Segments); i > 0; i-- { - segs = append(segs, fmt.Sprintf("%s", e.Segments[i-1])) + segs = append(segs, e.Segments[i-1].String()) } str := fmt.Sprintf("mode %s segs %d [ %s ]", nl.SEG6EncapModeString(e.Mode), len(e.Segments), strings.Join(segs, " ")) @@ -281,7 +284,6 @@ func (e *SEG6LocalEncap) Decode(buf []byte) error { if err != nil { return err } - native := nl.NativeEndian() for _, attr := range attrs { switch attr.Attr.Type { case nl.SEG6_LOCAL_ACTION: @@ -311,7 +313,6 @@ func (e *SEG6LocalEncap) Decode(buf []byte) error { } func (e *SEG6LocalEncap) Encode() ([]byte, error) { var err error - native := nl.NativeEndian() res := make([]byte, 8) native.PutUint16(res, 8) // length native.PutUint16(res[2:], nl.SEG6_LOCAL_ACTION) @@ -402,7 +403,7 @@ func (e *SEG6LocalEncap) String() string { segs := make([]string, 0, len(e.Segments)) //append segment backwards (from n to 0) since seg#0 is the last segment. for i := len(e.Segments); i > 0; i-- { - segs = append(segs, fmt.Sprintf("%s", e.Segments[i-1])) + segs = append(segs, e.Segments[i-1].String()) } strs = append(strs, fmt.Sprintf("segs %d [ %s ]", len(e.Segments), strings.Join(segs, " "))) } @@ -443,6 +444,207 @@ func (e *SEG6LocalEncap) Equal(x Encap) bool { return true } +// Encap BPF definitions +type bpfObj struct { + progFd int + progName string +} +type BpfEncap struct { + progs [nl.LWT_BPF_MAX]bpfObj + headroom int +} + +// SetProg adds a bpf function to the route via netlink RTA_ENCAP. The fd must be a bpf +// program loaded with bpf(type=BPF_PROG_TYPE_LWT_*) matching the direction the program should +// be applied to (LWT_BPF_IN, LWT_BPF_OUT, LWT_BPF_XMIT). +func (e *BpfEncap) SetProg(mode, progFd int, progName string) error { + if progFd <= 0 { + return fmt.Errorf("lwt bpf SetProg: invalid fd") + } + if mode <= nl.LWT_BPF_UNSPEC || mode >= nl.LWT_BPF_XMIT_HEADROOM { + return fmt.Errorf("lwt bpf SetProg:invalid mode") + } + e.progs[mode].progFd = progFd + e.progs[mode].progName = fmt.Sprintf("%s[fd:%d]", progName, progFd) + return nil +} + +// SetXmitHeadroom sets the xmit headroom (LWT_BPF_MAX_HEADROOM) via netlink RTA_ENCAP. +// maximum headroom is LWT_BPF_MAX_HEADROOM +func (e *BpfEncap) SetXmitHeadroom(headroom int) error { + if headroom > nl.LWT_BPF_MAX_HEADROOM || headroom < 0 { + return fmt.Errorf("invalid headroom size. range is 0 - %d", nl.LWT_BPF_MAX_HEADROOM) + } + e.headroom = headroom + return nil +} + +func (e *BpfEncap) Type() int { + return nl.LWTUNNEL_ENCAP_BPF +} +func (e *BpfEncap) Decode(buf []byte) error { + if len(buf) < 4 { + return fmt.Errorf("lwt bpf decode: lack of bytes") + } + native := nl.NativeEndian() + attrs, err := nl.ParseRouteAttr(buf) + if err != nil { + return fmt.Errorf("lwt bpf decode: failed parsing attribute. err: %v", err) + } + for _, attr := range attrs { + if int(attr.Attr.Type) < 1 { + // nl.LWT_BPF_UNSPEC + continue + } + if int(attr.Attr.Type) > nl.LWT_BPF_MAX { + return fmt.Errorf("lwt bpf decode: received unknown attribute type: %d", attr.Attr.Type) + } + switch int(attr.Attr.Type) { + case nl.LWT_BPF_MAX_HEADROOM: + e.headroom = int(native.Uint32(attr.Value)) + default: + bpfO := bpfObj{} + parsedAttrs, err := nl.ParseRouteAttr(attr.Value) + if err != nil { + return fmt.Errorf("lwt bpf decode: failed parsing route attribute") + } + for _, parsedAttr := range parsedAttrs { + switch int(parsedAttr.Attr.Type) { + case nl.LWT_BPF_PROG_FD: + bpfO.progFd = int(native.Uint32(parsedAttr.Value)) + case nl.LWT_BPF_PROG_NAME: + bpfO.progName = string(parsedAttr.Value) + default: + return fmt.Errorf("lwt bpf decode: received unknown attribute: type: %d, len: %d", parsedAttr.Attr.Type, parsedAttr.Attr.Len) + } + } + e.progs[attr.Attr.Type] = bpfO + } + } + return nil +} + +func (e *BpfEncap) Encode() ([]byte, error) { + buf := make([]byte, 0) + native = nl.NativeEndian() + for index, attr := range e.progs { + nlMsg := nl.NewRtAttr(index, []byte{}) + if attr.progFd != 0 { + nlMsg.AddRtAttr(nl.LWT_BPF_PROG_FD, nl.Uint32Attr(uint32(attr.progFd))) + } + if attr.progName != "" { + nlMsg.AddRtAttr(nl.LWT_BPF_PROG_NAME, nl.ZeroTerminated(attr.progName)) + } + if nlMsg.Len() > 4 { + buf = append(buf, nlMsg.Serialize()...) + } + } + if len(buf) <= 4 { + return nil, fmt.Errorf("lwt bpf encode: bpf obj definitions returned empty buffer") + } + if e.headroom > 0 { + hRoom := nl.NewRtAttr(nl.LWT_BPF_XMIT_HEADROOM, nl.Uint32Attr(uint32(e.headroom))) + buf = append(buf, hRoom.Serialize()...) + } + return buf, nil +} + +func (e *BpfEncap) String() string { + progs := make([]string, 0) + for index, obj := range e.progs { + empty := bpfObj{} + switch index { + case nl.LWT_BPF_IN: + if obj != empty { + progs = append(progs, fmt.Sprintf("in: %s", obj.progName)) + } + case nl.LWT_BPF_OUT: + if obj != empty { + progs = append(progs, fmt.Sprintf("out: %s", obj.progName)) + } + case nl.LWT_BPF_XMIT: + if obj != empty { + progs = append(progs, fmt.Sprintf("xmit: %s", obj.progName)) + } + } + } + if e.headroom > 0 { + progs = append(progs, fmt.Sprintf("xmit headroom: %d", e.headroom)) + } + return strings.Join(progs, " ") +} + +func (e *BpfEncap) Equal(x Encap) bool { + o, ok := x.(*BpfEncap) + if !ok { + return false + } + if e.headroom != o.headroom { + return false + } + for i := range o.progs { + if o.progs[i] != e.progs[i] { + return false + } + } + return true +} + +type Via struct { + AddrFamily int + Addr net.IP +} + +func (v *Via) Equal(x Destination) bool { + o, ok := x.(*Via) + if !ok { + return false + } + if v.AddrFamily == x.Family() && v.Addr.Equal(o.Addr) { + return true + } + return false +} + +func (v *Via) String() string { + return fmt.Sprintf("Family: %d, Address: %s", v.AddrFamily, v.Addr.String()) +} + +func (v *Via) Family() int { + return v.AddrFamily +} + +func (v *Via) Encode() ([]byte, error) { + buf := &bytes.Buffer{} + err := binary.Write(buf, native, uint16(v.AddrFamily)) + if err != nil { + return nil, err + } + err = binary.Write(buf, native, v.Addr) + if err != nil { + return nil, err + } + return buf.Bytes(), nil +} + +func (v *Via) Decode(b []byte) error { + if len(b) < 6 { + return fmt.Errorf("decoding failed: buffer too small (%d bytes)", len(b)) + } + v.AddrFamily = int(native.Uint16(b[0:2])) + if v.AddrFamily == nl.FAMILY_V4 { + v.Addr = net.IP(b[2:6]) + return nil + } else if v.AddrFamily == nl.FAMILY_V6 { + if len(b) < 18 { + return fmt.Errorf("decoding failed: buffer too small (%d bytes)", len(b)) + } + v.Addr = net.IP(b[2:]) + return nil + } + return fmt.Errorf("decoding failed: address family %d unknown", v.AddrFamily) +} + // RouteAdd will add a route to the system. // Equivalent to: `ip route add $route` func RouteAdd(route *Route) error { @@ -457,6 +659,32 @@ func (h *Handle) RouteAdd(route *Route) error { return h.routeHandle(route, req, nl.NewRtMsg()) } +// RouteAppend will append a route to the system. +// Equivalent to: `ip route append $route` +func RouteAppend(route *Route) error { + return pkgHandle.RouteAppend(route) +} + +// RouteAppend will append a route to the system. +// Equivalent to: `ip route append $route` +func (h *Handle) RouteAppend(route *Route) error { + flags := unix.NLM_F_CREATE | unix.NLM_F_APPEND | unix.NLM_F_ACK + req := h.newNetlinkRequest(unix.RTM_NEWROUTE, flags) + return h.routeHandle(route, req, nl.NewRtMsg()) +} + +// RouteAddEcmp will add a route to the system. +func RouteAddEcmp(route *Route) error { + return pkgHandle.RouteAddEcmp(route) +} + +// RouteAddEcmp will add a route to the system. +func (h *Handle) RouteAddEcmp(route *Route) error { + flags := unix.NLM_F_CREATE | unix.NLM_F_ACK + req := h.newNetlinkRequest(unix.RTM_NEWROUTE, flags) + return h.routeHandle(route, req, nl.NewRtMsg()) +} + // RouteReplace will add a route to the system. // Equivalent to: `ip route replace $route` func RouteReplace(route *Route) error { @@ -530,7 +758,13 @@ func (h *Handle) routeHandle(route *Route, req *nl.NetlinkRequest, msg *nl.RtMsg if err != nil { return err } - rtAttrs = append(rtAttrs, nl.NewRtAttr(unix.RTA_ENCAP, buf)) + switch route.Encap.Type() { + case nl.LWTUNNEL_ENCAP_BPF: + rtAttrs = append(rtAttrs, nl.NewRtAttr(unix.RTA_ENCAP|unix.NLA_F_NESTED, buf)) + default: + rtAttrs = append(rtAttrs, nl.NewRtAttr(unix.RTA_ENCAP, buf)) + } + } if route.Src != nil { @@ -564,6 +798,14 @@ func (h *Handle) routeHandle(route *Route, req *nl.NetlinkRequest, msg *nl.RtMsg rtAttrs = append(rtAttrs, nl.NewRtAttr(unix.RTA_GATEWAY, gwData)) } + if route.Via != nil { + buf, err := route.Via.Encode() + if err != nil { + return fmt.Errorf("failed to encode RTA_VIA: %v", err) + } + rtAttrs = append(rtAttrs, nl.NewRtAttr(unix.RTA_VIA, buf)) + } + if len(route.MultiPath) > 0 { buf := []byte{} for _, nh := range route.MultiPath { @@ -606,6 +848,13 @@ func (h *Handle) routeHandle(route *Route, req *nl.NetlinkRequest, msg *nl.RtMsg } children = append(children, nl.NewRtAttr(unix.RTA_ENCAP, buf)) } + if nh.Via != nil { + buf, err := nh.Via.Encode() + if err != nil { + return err + } + children = append(children, nl.NewRtAttr(unix.RTA_VIA, buf)) + } rtnh.Children = children buf = append(buf, rtnh.Serialize()...) } @@ -628,6 +877,11 @@ func (h *Handle) routeHandle(route *Route, req *nl.NetlinkRequest, msg *nl.RtMsg native.PutUint32(b, uint32(route.Priority)) rtAttrs = append(rtAttrs, nl.NewRtAttr(unix.RTA_PRIORITY, b)) } + if route.Realm > 0 { + b := make([]byte, 4) + native.PutUint32(b, uint32(route.Realm)) + rtAttrs = append(rtAttrs, nl.NewRtAttr(unix.RTA_FLOW, b)) + } if route.Tos > 0 { msg.Tos = uint8(route.Tos) } @@ -639,19 +893,70 @@ func (h *Handle) routeHandle(route *Route, req *nl.NetlinkRequest, msg *nl.RtMsg } var metrics []*nl.RtAttr - // TODO: support other rta_metric values if route.MTU > 0 { b := nl.Uint32Attr(uint32(route.MTU)) metrics = append(metrics, nl.NewRtAttr(unix.RTAX_MTU, b)) } + if route.Window > 0 { + b := nl.Uint32Attr(uint32(route.Window)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_WINDOW, b)) + } + if route.Rtt > 0 { + b := nl.Uint32Attr(uint32(route.Rtt)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_RTT, b)) + } + if route.RttVar > 0 { + b := nl.Uint32Attr(uint32(route.RttVar)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_RTTVAR, b)) + } + if route.Ssthresh > 0 { + b := nl.Uint32Attr(uint32(route.Ssthresh)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_SSTHRESH, b)) + } + if route.Cwnd > 0 { + b := nl.Uint32Attr(uint32(route.Cwnd)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_CWND, b)) + } if route.AdvMSS > 0 { b := nl.Uint32Attr(uint32(route.AdvMSS)) metrics = append(metrics, nl.NewRtAttr(unix.RTAX_ADVMSS, b)) } + if route.Reordering > 0 { + b := nl.Uint32Attr(uint32(route.Reordering)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_REORDERING, b)) + } if route.Hoplimit > 0 { b := nl.Uint32Attr(uint32(route.Hoplimit)) metrics = append(metrics, nl.NewRtAttr(unix.RTAX_HOPLIMIT, b)) } + if route.InitCwnd > 0 { + b := nl.Uint32Attr(uint32(route.InitCwnd)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_INITCWND, b)) + } + if route.Features > 0 { + b := nl.Uint32Attr(uint32(route.Features)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_FEATURES, b)) + } + if route.RtoMin > 0 { + b := nl.Uint32Attr(uint32(route.RtoMin)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_RTO_MIN, b)) + } + if route.InitRwnd > 0 { + b := nl.Uint32Attr(uint32(route.InitRwnd)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_INITRWND, b)) + } + if route.QuickACK > 0 { + b := nl.Uint32Attr(uint32(route.QuickACK)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_QUICKACK, b)) + } + if route.Congctl != "" { + b := nl.ZeroTerminated(route.Congctl) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_CC_ALGO, b)) + } + if route.FastOpenNoCookie > 0 { + b := nl.Uint32Attr(uint32(route.FastOpenNoCookie)) + metrics = append(metrics, nl.NewRtAttr(unix.RTAX_FASTOPEN_NO_COOKIE, b)) + } if metrics != nil { attr := nl.NewRtAttr(unix.RTA_METRICS, nil) @@ -669,10 +974,7 @@ func (h *Handle) routeHandle(route *Route, req *nl.NetlinkRequest, msg *nl.RtMsg req.AddData(attr) } - var ( - b = make([]byte, 4) - native = nl.NativeEndian() - ) + b := make([]byte, 4) native.PutUint32(b, uint32(route.LinkIndex)) req.AddData(nl.NewRtAttr(unix.RTA_OIF, b)) @@ -711,8 +1013,9 @@ func RouteListFiltered(family int, filter *Route, filterMask uint64) ([]Route, e // All rules must be defined in RouteFilter struct func (h *Handle) RouteListFiltered(family int, filter *Route, filterMask uint64) ([]Route, error) { req := h.newNetlinkRequest(unix.RTM_GETROUTE, unix.NLM_F_DUMP) - infmsg := nl.NewIfInfomsg(family) - req.AddData(infmsg) + rtmsg := nl.NewRtMsg() + rtmsg.Family = uint8(family) + req.AddData(rtmsg) msgs, err := req.Execute(unix.NETLINK_ROUTE, unix.RTM_NEWROUTE) if err != nil { @@ -748,6 +1051,8 @@ func (h *Handle) RouteListFiltered(family int, filter *Route, filterMask uint64) continue case filterMask&RT_FILTER_TOS != 0 && route.Tos != filter.Tos: continue + case filterMask&RT_FILTER_REALM != 0 && route.Realm != filter.Realm: + continue case filterMask&RT_FILTER_OIF != 0 && route.LinkIndex != filter.LinkIndex: continue case filterMask&RT_FILTER_IIF != 0 && route.ILinkIndex != filter.ILinkIndex: @@ -780,14 +1085,14 @@ func deserializeRoute(m []byte) (Route, error) { } route := Route{ Scope: Scope(msg.Scope), - Protocol: int(msg.Protocol), + Protocol: RouteProtocol(int(msg.Protocol)), Table: int(msg.Table), Type: int(msg.Type), Tos: int(msg.Tos), Flags: int(msg.Flags), + Family: int(msg.Family), } - native := nl.NativeEndian() var encap, encapType syscall.NetlinkRouteAttr for _, attr := range attrs { switch attr.Attr.Type { @@ -814,6 +1119,8 @@ func deserializeRoute(m []byte) (Route, error) { route.ILinkIndex = int(native.Uint32(attr.Value[0:4])) case unix.RTA_PRIORITY: route.Priority = int(native.Uint32(attr.Value[0:4])) + case unix.RTA_FLOW: + route.Realm = int(native.Uint32(attr.Value[0:4])) case unix.RTA_TABLE: route.Table = int(native.Uint32(attr.Value[0:4])) case unix.RTA_MULTIPATH: @@ -853,6 +1160,12 @@ func deserializeRoute(m []byte) (Route, error) { encapType = attr case unix.RTA_ENCAP: encap = attr + case unix.RTA_VIA: + d := &Via{} + if err := d.Decode(attr.Value); err != nil { + return nil, nil, err + } + info.Via = d } } @@ -890,6 +1203,12 @@ func deserializeRoute(m []byte) (Route, error) { return route, err } route.NewDst = d + case unix.RTA_VIA: + v := &Via{} + if err := v.Decode(attr.Value); err != nil { + return route, err + } + route.Via = v case unix.RTA_ENCAP_TYPE: encapType = attr case unix.RTA_ENCAP: @@ -903,10 +1222,36 @@ func deserializeRoute(m []byte) (Route, error) { switch metric.Attr.Type { case unix.RTAX_MTU: route.MTU = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_WINDOW: + route.Window = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_RTT: + route.Rtt = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_RTTVAR: + route.RttVar = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_SSTHRESH: + route.Ssthresh = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_CWND: + route.Cwnd = int(native.Uint32(metric.Value[0:4])) case unix.RTAX_ADVMSS: route.AdvMSS = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_REORDERING: + route.Reordering = int(native.Uint32(metric.Value[0:4])) case unix.RTAX_HOPLIMIT: route.Hoplimit = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_INITCWND: + route.InitCwnd = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_FEATURES: + route.Features = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_RTO_MIN: + route.RtoMin = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_INITRWND: + route.InitRwnd = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_QUICKACK: + route.QuickACK = int(native.Uint32(metric.Value[0:4])) + case unix.RTAX_CC_ALGO: + route.Congctl = nl.BytesToString(metric.Value) + case unix.RTAX_FASTOPEN_NO_COOKIE: + route.FastOpenNoCookie = int(native.Uint32(metric.Value[0:4])) } } } @@ -931,6 +1276,11 @@ func deserializeRoute(m []byte) (Route, error) { if err := e.Decode(encap.Value); err != nil { return route, err } + case nl.LWTUNNEL_ENCAP_BPF: + e = &BpfEncap{} + if err := e.Decode(encap.Value); err != nil { + return route, err + } } route.Encap = e } @@ -938,15 +1288,30 @@ func deserializeRoute(m []byte) (Route, error) { return route, nil } +// RouteGetOptions contains a set of options to use with +// RouteGetWithOptions +type RouteGetOptions struct { + Iif string + Oif string + VrfName string + SrcAddr net.IP +} + +// RouteGetWithOptions gets a route to a specific destination from the host system. +// Equivalent to: 'ip route get <> vrf '. +func RouteGetWithOptions(destination net.IP, options *RouteGetOptions) ([]Route, error) { + return pkgHandle.RouteGetWithOptions(destination, options) +} + // RouteGet gets a route to a specific destination from the host system. // Equivalent to: 'ip route get'. func RouteGet(destination net.IP) ([]Route, error) { return pkgHandle.RouteGet(destination) } -// RouteGet gets a route to a specific destination from the host system. -// Equivalent to: 'ip route get'. -func (h *Handle) RouteGet(destination net.IP) ([]Route, error) { +// RouteGetWithOptions gets a route to a specific destination from the host system. +// Equivalent to: 'ip route get <> vrf '. +func (h *Handle) RouteGetWithOptions(destination net.IP, options *RouteGetOptions) ([]Route, error) { req := h.newNetlinkRequest(unix.RTM_GETROUTE, unix.NLM_F_REQUEST) family := nl.GetIPFamily(destination) var destinationData []byte @@ -961,11 +1326,63 @@ func (h *Handle) RouteGet(destination net.IP) ([]Route, error) { msg := &nl.RtMsg{} msg.Family = uint8(family) msg.Dst_len = bitlen + if options != nil && options.SrcAddr != nil { + msg.Src_len = bitlen + } + msg.Flags = unix.RTM_F_LOOKUP_TABLE req.AddData(msg) rtaDst := nl.NewRtAttr(unix.RTA_DST, destinationData) req.AddData(rtaDst) + if options != nil { + if options.VrfName != "" { + link, err := LinkByName(options.VrfName) + if err != nil { + return nil, err + } + b := make([]byte, 4) + native.PutUint32(b, uint32(link.Attrs().Index)) + + req.AddData(nl.NewRtAttr(unix.RTA_OIF, b)) + } + + if len(options.Iif) > 0 { + link, err := LinkByName(options.Iif) + if err != nil { + return nil, err + } + + b := make([]byte, 4) + native.PutUint32(b, uint32(link.Attrs().Index)) + + req.AddData(nl.NewRtAttr(unix.RTA_IIF, b)) + } + + if len(options.Oif) > 0 { + link, err := LinkByName(options.Oif) + if err != nil { + return nil, err + } + + b := make([]byte, 4) + native.PutUint32(b, uint32(link.Attrs().Index)) + + req.AddData(nl.NewRtAttr(unix.RTA_OIF, b)) + } + + if options.SrcAddr != nil { + var srcAddr []byte + if family == FAMILY_V4 { + srcAddr = options.SrcAddr.To4() + } else { + srcAddr = options.SrcAddr.To16() + } + + req.AddData(nl.NewRtAttr(unix.RTA_SRC, srcAddr)) + } + } + msgs, err := req.Execute(unix.NETLINK_ROUTE, unix.RTM_NEWROUTE) if err != nil { return nil, err @@ -980,7 +1397,12 @@ func (h *Handle) RouteGet(destination net.IP) ([]Route, error) { res = append(res, route) } return res, nil +} +// RouteGet gets a route to a specific destination from the host system. +// Equivalent to: 'ip route get'. +func (h *Handle) RouteGet(destination net.IP) ([]Route, error) { + return h.RouteGetWithOptions(destination, nil) } // RouteSubscribe takes a chan down which notifications will be sent @@ -1040,7 +1462,8 @@ func routeSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- RouteUpdate, done < msgs, from, err := s.Receive() if err != nil { if cberr != nil { - cberr(err) + cberr(fmt.Errorf("Receive failed: %v", + err)) } return } @@ -1055,22 +1478,22 @@ func routeSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- RouteUpdate, done < continue } if m.Header.Type == unix.NLMSG_ERROR { - native := nl.NativeEndian() error := int32(native.Uint32(m.Data[0:4])) if error == 0 { continue } if cberr != nil { - cberr(syscall.Errno(-error)) + cberr(fmt.Errorf("error message: %v", + syscall.Errno(-error))) } - return + continue } route, err := deserializeRoute(m.Data) if err != nil { if cberr != nil { cberr(err) } - return + continue } ch <- RouteUpdate{Type: m.Header.Type, Route: route} } @@ -1079,3 +1502,54 @@ func routeSubscribeAt(newNs, curNs netns.NsHandle, ch chan<- RouteUpdate, done < return nil } + +func (p RouteProtocol) String() string { + switch int(p) { + case unix.RTPROT_BABEL: + return "babel" + case unix.RTPROT_BGP: + return "bgp" + case unix.RTPROT_BIRD: + return "bird" + case unix.RTPROT_BOOT: + return "boot" + case unix.RTPROT_DHCP: + return "dhcp" + case unix.RTPROT_DNROUTED: + return "dnrouted" + case unix.RTPROT_EIGRP: + return "eigrp" + case unix.RTPROT_GATED: + return "gated" + case unix.RTPROT_ISIS: + return "isis" + //case unix.RTPROT_KEEPALIVED: + // return "keepalived" + case unix.RTPROT_KERNEL: + return "kernel" + case unix.RTPROT_MROUTED: + return "mrouted" + case unix.RTPROT_MRT: + return "mrt" + case unix.RTPROT_NTK: + return "ntk" + case unix.RTPROT_OSPF: + return "ospf" + case unix.RTPROT_RA: + return "ra" + case unix.RTPROT_REDIRECT: + return "redirect" + case unix.RTPROT_RIP: + return "rip" + case unix.RTPROT_STATIC: + return "static" + case unix.RTPROT_UNSPEC: + return "unspec" + case unix.RTPROT_XORP: + return "xorp" + case unix.RTPROT_ZEBRA: + return "zebra" + default: + return strconv.Itoa(int(p)) + } +} diff --git a/vendor/github.com/vishvananda/netlink/route_unspecified.go b/vendor/github.com/vishvananda/netlink/route_unspecified.go index 2701862b4..db7372689 100644 --- a/vendor/github.com/vishvananda/netlink/route_unspecified.go +++ b/vendor/github.com/vishvananda/netlink/route_unspecified.go @@ -2,6 +2,8 @@ package netlink +import "strconv" + func (r *Route) ListFlags() []string { return []string{} } @@ -9,3 +11,11 @@ func (r *Route) ListFlags() []string { func (n *NexthopInfo) ListFlags() []string { return []string{} } + +func (s Scope) String() string { + return "unknown" +} + +func (p RouteProtocol) String() string { + return strconv.Itoa(int(p)) +} diff --git a/vendor/github.com/vishvananda/netlink/rule.go b/vendor/github.com/vishvananda/netlink/rule.go index 7fc8ae5df..53cd3d4f6 100644 --- a/vendor/github.com/vishvananda/netlink/rule.go +++ b/vendor/github.com/vishvananda/netlink/rule.go @@ -12,6 +12,7 @@ type Rule struct { Table int Mark int Mask int + Tos uint TunID uint Goto int Src *net.IPNet @@ -22,10 +23,24 @@ type Rule struct { SuppressIfgroup int SuppressPrefixlen int Invert bool + Dport *RulePortRange + Sport *RulePortRange + IPProto int } func (r Rule) String() string { - return fmt.Sprintf("ip rule %d: from %s table %d", r.Priority, r.Src, r.Table) + from := "all" + if r.Src != nil && r.Src.String() != "" { + from = r.Src.String() + } + + to := "all" + if r.Dst != nil && r.Dst.String() != "" { + to = r.Dst.String() + } + + return fmt.Sprintf("ip rule %d: from %s to %s table %d", + r.Priority, from, to, r.Table) } // NewRule return empty rules. @@ -40,3 +55,14 @@ func NewRule() *Rule { Flow: -1, } } + +// NewRulePortRange creates rule sport/dport range. +func NewRulePortRange(start, end uint16) *RulePortRange { + return &RulePortRange{Start: start, End: end} +} + +// RulePortRange represents rule sport/dport range. +type RulePortRange struct { + Start uint16 + End uint16 +} diff --git a/vendor/github.com/vishvananda/netlink/rule_linux.go b/vendor/github.com/vishvananda/netlink/rule_linux.go index e12569fe4..3ae213880 100644 --- a/vendor/github.com/vishvananda/netlink/rule_linux.go +++ b/vendor/github.com/vishvananda/netlink/rule_linux.go @@ -1,6 +1,7 @@ package netlink import ( + "bytes" "fmt" "net" @@ -55,6 +56,9 @@ func ruleHandle(rule *Rule, req *nl.NetlinkRequest) error { if rule.Table >= 0 && rule.Table < 256 { msg.Table = uint8(rule.Table) } + if rule.Tos != 0 { + msg.Tos = uint8(rule.Tos) + } var dstFamily uint8 var rtAttrs []*nl.RtAttr @@ -93,8 +97,6 @@ func ruleHandle(rule *Rule, req *nl.NetlinkRequest) error { req.AddData(rtAttrs[i]) } - native := nl.NativeEndian() - if rule.Priority >= 0 { b := make([]byte, 4) native.PutUint32(b, uint32(rule.Priority)) @@ -138,10 +140,10 @@ func ruleHandle(rule *Rule, req *nl.NetlinkRequest) error { } } if rule.IifName != "" { - req.AddData(nl.NewRtAttr(nl.FRA_IIFNAME, []byte(rule.IifName))) + req.AddData(nl.NewRtAttr(nl.FRA_IIFNAME, []byte(rule.IifName+"\x00"))) } if rule.OifName != "" { - req.AddData(nl.NewRtAttr(nl.FRA_OIFNAME, []byte(rule.OifName))) + req.AddData(nl.NewRtAttr(nl.FRA_OIFNAME, []byte(rule.OifName+"\x00"))) } if rule.Goto >= 0 { msg.Type = nl.FR_ACT_GOTO @@ -150,6 +152,22 @@ func ruleHandle(rule *Rule, req *nl.NetlinkRequest) error { req.AddData(nl.NewRtAttr(nl.FRA_GOTO, b)) } + if rule.IPProto > 0 { + b := make([]byte, 4) + native.PutUint32(b, uint32(rule.IPProto)) + req.AddData(nl.NewRtAttr(nl.FRA_IP_PROTO, b)) + } + + if rule.Dport != nil { + b := rule.Dport.toRtAttrData() + req.AddData(nl.NewRtAttr(nl.FRA_DPORT_RANGE, b)) + } + + if rule.Sport != nil { + b := rule.Sport.toRtAttrData() + req.AddData(nl.NewRtAttr(nl.FRA_SPORT_RANGE, b)) + } + _, err := req.Execute(unix.NETLINK_ROUTE, 0) return err } @@ -163,6 +181,19 @@ func RuleList(family int) ([]Rule, error) { // RuleList lists rules in the system. // Equivalent to: ip rule list func (h *Handle) RuleList(family int) ([]Rule, error) { + return h.RuleListFiltered(family, nil, 0) +} + +// RuleListFiltered gets a list of rules in the system filtered by the +// specified rule template `filter`. +// Equivalent to: ip rule list +func RuleListFiltered(family int, filter *Rule, filterMask uint64) ([]Rule, error) { + return pkgHandle.RuleListFiltered(family, filter, filterMask) +} + +// RuleListFiltered lists rules in the system. +// Equivalent to: ip rule list +func (h *Handle) RuleListFiltered(family int, filter *Rule, filterMask uint64) ([]Rule, error) { req := h.newNetlinkRequest(unix.RTM_GETRULE, unix.NLM_F_DUMP|unix.NLM_F_REQUEST) msg := nl.NewIfInfomsg(family) req.AddData(msg) @@ -172,7 +203,6 @@ func (h *Handle) RuleList(family int) ([]Rule, error) { return nil, err } - native := nl.NativeEndian() var res = make([]Rule, 0) for i := range msgs { msg := nl.DeserializeRtMsg(msgs[i]) @@ -184,6 +214,7 @@ func (h *Handle) RuleList(family int) ([]Rule, error) { rule := NewRule() rule.Invert = msg.Flags&FibRuleInvert > 0 + rule.Tos = uint(msg.Tos) for j := range attrs { switch attrs[j].Attr.Type { @@ -204,7 +235,7 @@ func (h *Handle) RuleList(family int) ([]Rule, error) { case nl.FRA_FWMASK: rule.Mask = int(native.Uint32(attrs[j].Value[0:4])) case nl.FRA_TUN_ID: - rule.TunID = uint(native.Uint64(attrs[j].Value[0:4])) + rule.TunID = uint(native.Uint64(attrs[j].Value[0:8])) case nl.FRA_IIFNAME: rule.IifName = string(attrs[j].Value[:len(attrs[j].Value)-1]) case nl.FRA_OIFNAME: @@ -225,10 +256,46 @@ func (h *Handle) RuleList(family int) ([]Rule, error) { rule.Goto = int(native.Uint32(attrs[j].Value[0:4])) case nl.FRA_PRIORITY: rule.Priority = int(native.Uint32(attrs[j].Value[0:4])) + case nl.FRA_IP_PROTO: + rule.IPProto = int(native.Uint32(attrs[j].Value[0:4])) + case nl.FRA_DPORT_RANGE: + rule.Dport = NewRulePortRange(native.Uint16(attrs[j].Value[0:2]), native.Uint16(attrs[j].Value[2:4])) + case nl.FRA_SPORT_RANGE: + rule.Sport = NewRulePortRange(native.Uint16(attrs[j].Value[0:2]), native.Uint16(attrs[j].Value[2:4])) + } + } + + if filter != nil { + switch { + case filterMask&RT_FILTER_SRC != 0 && + (rule.Src == nil || rule.Src.String() != filter.Src.String()): + continue + case filterMask&RT_FILTER_DST != 0 && + (rule.Dst == nil || rule.Dst.String() != filter.Dst.String()): + continue + case filterMask&RT_FILTER_TABLE != 0 && + filter.Table != unix.RT_TABLE_UNSPEC && rule.Table != filter.Table: + continue + case filterMask&RT_FILTER_TOS != 0 && rule.Tos != filter.Tos: + continue + case filterMask&RT_FILTER_PRIORITY != 0 && rule.Priority != filter.Priority: + continue + case filterMask&RT_FILTER_MARK != 0 && rule.Mark != filter.Mark: + continue + case filterMask&RT_FILTER_MASK != 0 && rule.Mask != filter.Mask: + continue } } + res = append(res, *rule) } return res, nil } + +func (pr *RulePortRange) toRtAttrData() []byte { + b := [][]byte{make([]byte, 2), make([]byte, 2)} + native.PutUint16(b[0], pr.Start) + native.PutUint16(b[1], pr.End) + return bytes.Join(b, []byte{}) +} diff --git a/vendor/github.com/vishvananda/netlink/socket_linux.go b/vendor/github.com/vishvananda/netlink/socket_linux.go index c4d89c17e..b881fe496 100644 --- a/vendor/github.com/vishvananda/netlink/socket_linux.go +++ b/vendor/github.com/vishvananda/netlink/socket_linux.go @@ -4,6 +4,7 @@ import ( "errors" "fmt" "net" + "syscall" "github.com/vishvananda/netlink/nl" "golang.org/x/sys/unix" @@ -49,10 +50,15 @@ func (r *socketRequest) Serialize() []byte { native.PutUint32(b.Next(4), r.States) networkOrder.PutUint16(b.Next(2), r.ID.SourcePort) networkOrder.PutUint16(b.Next(2), r.ID.DestinationPort) - copy(b.Next(4), r.ID.Source.To4()) - b.Next(12) - copy(b.Next(4), r.ID.Destination.To4()) - b.Next(12) + if r.Family == unix.AF_INET6 { + copy(b.Next(16), r.ID.Source) + copy(b.Next(16), r.ID.Destination) + } else { + copy(b.Next(4), r.ID.Source.To4()) + b.Next(12) + copy(b.Next(4), r.ID.Destination.To4()) + b.Next(12) + } native.PutUint32(b.Next(4), r.ID.Interface) native.PutUint32(b.Next(4), r.ID.Cookie[0]) native.PutUint32(b.Next(4), r.ID.Cookie[1]) @@ -89,10 +95,15 @@ func (s *Socket) deserialize(b []byte) error { s.Retrans = rb.Read() s.ID.SourcePort = networkOrder.Uint16(rb.Next(2)) s.ID.DestinationPort = networkOrder.Uint16(rb.Next(2)) - s.ID.Source = net.IPv4(rb.Read(), rb.Read(), rb.Read(), rb.Read()) - rb.Next(12) - s.ID.Destination = net.IPv4(rb.Read(), rb.Read(), rb.Read(), rb.Read()) - rb.Next(12) + if s.Family == unix.AF_INET6 { + s.ID.Source = net.IP(rb.Next(16)) + s.ID.Destination = net.IP(rb.Next(16)) + } else { + s.ID.Source = net.IPv4(rb.Read(), rb.Read(), rb.Read(), rb.Read()) + rb.Next(12) + s.ID.Destination = net.IPv4(rb.Read(), rb.Read(), rb.Read(), rb.Read()) + rb.Next(12) + } s.ID.Interface = native.Uint32(rb.Next(4)) s.ID.Cookie[0] = native.Uint32(rb.Next(4)) s.ID.Cookie[1] = native.Uint32(rb.Next(4)) @@ -160,3 +171,121 @@ func SocketGet(local, remote net.Addr) (*Socket, error) { } return sock, nil } + +// SocketDiagTCPInfo requests INET_DIAG_INFO for TCP protocol for specified family type and return with extension TCP info. +func SocketDiagTCPInfo(family uint8) ([]*InetDiagTCPInfoResp, error) { + var result []*InetDiagTCPInfoResp + err := socketDiagTCPExecutor(family, func(m syscall.NetlinkMessage) error { + sockInfo := &Socket{} + if err := sockInfo.deserialize(m.Data); err != nil { + return err + } + attrs, err := nl.ParseRouteAttr(m.Data[sizeofSocket:]) + if err != nil { + return err + } + + res, err := attrsToInetDiagTCPInfoResp(attrs, sockInfo) + if err != nil { + return err + } + + result = append(result, res) + return nil + }) + if err != nil { + return nil, err + } + return result, nil +} + +// SocketDiagTCP requests INET_DIAG_INFO for TCP protocol for specified family type and return related socket. +func SocketDiagTCP(family uint8) ([]*Socket, error) { + var result []*Socket + err := socketDiagTCPExecutor(family, func(m syscall.NetlinkMessage) error { + sockInfo := &Socket{} + if err := sockInfo.deserialize(m.Data); err != nil { + return err + } + result = append(result, sockInfo) + return nil + }) + if err != nil { + return nil, err + } + return result, nil +} + +// socketDiagTCPExecutor requests INET_DIAG_INFO for TCP protocol for specified family type. +func socketDiagTCPExecutor(family uint8, receiver func(syscall.NetlinkMessage) error) error { + s, err := nl.Subscribe(unix.NETLINK_INET_DIAG) + if err != nil { + return err + } + defer s.Close() + + req := nl.NewNetlinkRequest(nl.SOCK_DIAG_BY_FAMILY, unix.NLM_F_DUMP) + req.AddData(&socketRequest{ + Family: family, + Protocol: unix.IPPROTO_TCP, + Ext: (1 << (INET_DIAG_VEGASINFO - 1)) | (1 << (INET_DIAG_INFO - 1)), + States: uint32(0xfff), // All TCP states + }) + s.Send(req) + +loop: + for { + msgs, from, err := s.Receive() + if err != nil { + return err + } + if from.Pid != nl.PidKernel { + return fmt.Errorf("Wrong sender portid %d, expected %d", from.Pid, nl.PidKernel) + } + if len(msgs) == 0 { + return errors.New("no message nor error from netlink") + } + + for _, m := range msgs { + switch m.Header.Type { + case unix.NLMSG_DONE: + break loop + case unix.NLMSG_ERROR: + error := int32(native.Uint32(m.Data[0:4])) + return syscall.Errno(-error) + } + if err := receiver(m); err != nil { + return err + } + } + } + return nil +} + +func attrsToInetDiagTCPInfoResp(attrs []syscall.NetlinkRouteAttr, sockInfo *Socket) (*InetDiagTCPInfoResp, error) { + var tcpInfo *TCPInfo + var tcpBBRInfo *TCPBBRInfo + for _, a := range attrs { + if a.Attr.Type == INET_DIAG_INFO { + tcpInfo = &TCPInfo{} + if err := tcpInfo.deserialize(a.Value); err != nil { + return nil, err + } + continue + } + + if a.Attr.Type == INET_DIAG_BBRINFO { + tcpBBRInfo = &TCPBBRInfo{} + if err := tcpBBRInfo.deserialize(a.Value); err != nil { + return nil, err + } + continue + } + } + + return &InetDiagTCPInfoResp{ + InetDiagMsg: sockInfo, + TCPInfo: tcpInfo, + TCPBBRInfo: tcpBBRInfo, + }, nil +} diff --git a/vendor/github.com/vishvananda/netlink/tcp.go b/vendor/github.com/vishvananda/netlink/tcp.go new file mode 100644 index 000000000..23ca014d4 --- /dev/null +++ b/vendor/github.com/vishvananda/netlink/tcp.go @@ -0,0 +1,84 @@ +package netlink + +// TCP States +const ( + TCP_ESTABLISHED = iota + 0x01 + TCP_SYN_SENT + TCP_SYN_RECV + TCP_FIN_WAIT1 + TCP_FIN_WAIT2 + TCP_TIME_WAIT + TCP_CLOSE + TCP_CLOSE_WAIT + TCP_LAST_ACK + TCP_LISTEN + TCP_CLOSING + TCP_NEW_SYN_REC + TCP_MAX_STATES +) + +type TCPInfo struct { + State uint8 + Ca_state uint8 + Retransmits uint8 + Probes uint8 + Backoff uint8 + Options uint8 + Snd_wscale uint8 // no uint4 + Rcv_wscale uint8 + Delivery_rate_app_limited uint8 + Fastopen_client_fail uint8 + Rto uint32 + Ato uint32 + Snd_mss uint32 + Rcv_mss uint32 + Unacked uint32 + Sacked uint32 + Lost uint32 + Retrans uint32 + Fackets uint32 + Last_data_sent uint32 + Last_ack_sent uint32 + Last_data_recv uint32 + Last_ack_recv uint32 + Pmtu uint32 + Rcv_ssthresh uint32 + Rtt uint32 + Rttvar uint32 + Snd_ssthresh uint32 + Snd_cwnd uint32 + Advmss uint32 + Reordering uint32 + Rcv_rtt uint32 + Rcv_space uint32 + Total_retrans uint32 + Pacing_rate uint64 + Max_pacing_rate uint64 + Bytes_acked uint64 /* RFC4898 tcpEStatsAppHCThruOctetsAcked */ + Bytes_received uint64 /* RFC4898 tcpEStatsAppHCThruOctetsReceived */ + Segs_out uint32 /* RFC4898 tcpEStatsPerfSegsOut */ + Segs_in uint32 /* RFC4898 tcpEStatsPerfSegsIn */ + Notsent_bytes uint32 + Min_rtt uint32 + Data_segs_in uint32 /* RFC4898 tcpEStatsDataSegsIn */ + Data_segs_out uint32 /* RFC4898 tcpEStatsDataSegsOut */ + Delivery_rate uint64 + Busy_time uint64 /* Time (usec) busy sending data */ + Rwnd_limited uint64 /* Time (usec) limited by receive window */ + Sndbuf_limited uint64 /* Time (usec) limited by send buffer */ + Delivered uint32 + Delivered_ce uint32 + Bytes_sent uint64 /* RFC4898 tcpEStatsPerfHCDataOctetsOut */ + Bytes_retrans uint64 /* RFC4898 tcpEStatsPerfOctetsRetrans */ + Dsack_dups uint32 /* RFC4898 tcpEStatsStackDSACKDups */ + Reord_seen uint32 /* reordering events seen */ + Rcv_ooopack uint32 /* Out-of-order packets received */ + Snd_wnd uint32 /* peer's advertised receive window after * scaling (bytes) */ +} + +type TCPBBRInfo struct { + BBRBW uint64 + BBRMinRTT uint32 + BBRPacingGain uint32 + BBRCwndGain uint32 +} diff --git a/vendor/github.com/vishvananda/netlink/tcp_linux.go b/vendor/github.com/vishvananda/netlink/tcp_linux.go new file mode 100644 index 000000000..293858738 --- /dev/null +++ b/vendor/github.com/vishvananda/netlink/tcp_linux.go @@ -0,0 +1,353 @@ +package netlink + +import ( + "bytes" + "errors" + "io" +) + +const ( + tcpBBRInfoLen = 20 +) + +func checkDeserErr(err error) error { + if err == io.EOF { + return nil + } + return err +} + +func (t *TCPInfo) deserialize(b []byte) error { + var err error + rb := bytes.NewBuffer(b) + + t.State, err = rb.ReadByte() + if err != nil { + return checkDeserErr(err) + } + + t.Ca_state, err = rb.ReadByte() + if err != nil { + return checkDeserErr(err) + } + + t.Retransmits, err = rb.ReadByte() + if err != nil { + return checkDeserErr(err) + } + + t.Probes, err = rb.ReadByte() + if err != nil { + return checkDeserErr(err) + } + + t.Backoff, err = rb.ReadByte() + if err != nil { + return checkDeserErr(err) + } + t.Options, err = rb.ReadByte() + if err != nil { + return checkDeserErr(err) + } + + scales, err := rb.ReadByte() + if err != nil { + return checkDeserErr(err) + } + t.Snd_wscale = scales >> 4 // first 4 bits + t.Rcv_wscale = scales & 0xf // last 4 bits + + rateLimAndFastOpen, err := rb.ReadByte() + if err != nil { + return checkDeserErr(err) + } + t.Delivery_rate_app_limited = rateLimAndFastOpen >> 7 // get first bit + t.Fastopen_client_fail = rateLimAndFastOpen >> 5 & 3 // get next two bits + + next := rb.Next(4) + if len(next) == 0 { + return nil + } + t.Rto = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Ato = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Snd_mss = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Rcv_mss = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Unacked = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Sacked = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Lost = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Retrans = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Fackets = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Last_data_sent = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Last_ack_sent = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Last_data_recv = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Last_ack_recv = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Pmtu = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Rcv_ssthresh = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Rtt = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Rttvar = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Snd_ssthresh = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Snd_cwnd = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Advmss = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Reordering = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Rcv_rtt = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Rcv_space = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Total_retrans = native.Uint32(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Pacing_rate = native.Uint64(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Max_pacing_rate = native.Uint64(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Bytes_acked = native.Uint64(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Bytes_received = native.Uint64(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Segs_out = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Segs_in = native.Uint32(next) + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Notsent_bytes = native.Uint32(next) + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Min_rtt = native.Uint32(next) + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Data_segs_in = native.Uint32(next) + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Data_segs_out = native.Uint32(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Delivery_rate = native.Uint64(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Busy_time = native.Uint64(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Rwnd_limited = native.Uint64(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Sndbuf_limited = native.Uint64(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Delivered = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Delivered_ce = native.Uint32(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Bytes_sent = native.Uint64(next) + + next = rb.Next(8) + if len(next) == 0 { + return nil + } + t.Bytes_retrans = native.Uint64(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Dsack_dups = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Reord_seen = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Rcv_ooopack = native.Uint32(next) + + next = rb.Next(4) + if len(next) == 0 { + return nil + } + t.Snd_wnd = native.Uint32(next) + return nil +} + +func (t *TCPBBRInfo) deserialize(b []byte) error { + if len(b) != tcpBBRInfoLen { + return errors.New("Invalid length") + } + + rb := bytes.NewBuffer(b) + t.BBRBW = native.Uint64(rb.Next(8)) + t.BBRMinRTT = native.Uint32(rb.Next(4)) + t.BBRPacingGain = native.Uint32(rb.Next(4)) + t.BBRCwndGain = native.Uint32(rb.Next(4)) + + return nil +} diff --git a/vendor/github.com/vishvananda/netlink/xfrm_policy.go b/vendor/github.com/vishvananda/netlink/xfrm_policy.go index 6219d2772..b7532b092 100644 --- a/vendor/github.com/vishvananda/netlink/xfrm_policy.go +++ b/vendor/github.com/vishvananda/netlink/xfrm_policy.go @@ -58,12 +58,13 @@ func (a PolicyAction) String() string { // policy. These rules are matched with XfrmState to determine encryption // and authentication algorithms. type XfrmPolicyTmpl struct { - Dst net.IP - Src net.IP - Proto Proto - Mode Mode - Spi int - Reqid int + Dst net.IP + Src net.IP + Proto Proto + Mode Mode + Spi int + Reqid int + Optional int } func (t XfrmPolicyTmpl) String() string { diff --git a/vendor/github.com/vishvananda/netlink/xfrm_policy_linux.go b/vendor/github.com/vishvananda/netlink/xfrm_policy_linux.go index a4e132ef5..358496804 100644 --- a/vendor/github.com/vishvananda/netlink/xfrm_policy_linux.go +++ b/vendor/github.com/vishvananda/netlink/xfrm_policy_linux.go @@ -79,6 +79,7 @@ func (h *Handle) xfrmPolicyAddOrUpdate(policy *XfrmPolicy, nlProto int) error { userTmpl.XfrmId.Spi = nl.Swap32(uint32(tmpl.Spi)) userTmpl.Mode = uint8(tmpl.Mode) userTmpl.Reqid = uint32(tmpl.Reqid) + userTmpl.Optional = uint8(tmpl.Optional) userTmpl.Aalgos = ^uint32(0) userTmpl.Ealgos = ^uint32(0) userTmpl.Calgos = ^uint32(0) @@ -92,8 +93,10 @@ func (h *Handle) xfrmPolicyAddOrUpdate(policy *XfrmPolicy, nlProto int) error { req.AddData(out) } - ifId := nl.NewRtAttr(nl.XFRMA_IF_ID, nl.Uint32Attr(uint32(policy.Ifid))) - req.AddData(ifId) + if policy.Ifid != 0 { + ifId := nl.NewRtAttr(nl.XFRMA_IF_ID, nl.Uint32Attr(uint32(policy.Ifid))) + req.AddData(ifId) + } _, err := req.Execute(unix.NETLINK_XFRM, 0) return err @@ -188,8 +191,10 @@ func (h *Handle) xfrmPolicyGetOrDelete(policy *XfrmPolicy, nlProto int) (*XfrmPo req.AddData(out) } - ifId := nl.NewRtAttr(nl.XFRMA_IF_ID, nl.Uint32Attr(uint32(policy.Ifid))) - req.AddData(ifId) + if policy.Ifid != 0 { + ifId := nl.NewRtAttr(nl.XFRMA_IF_ID, nl.Uint32Attr(uint32(policy.Ifid))) + req.AddData(ifId) + } resType := nl.XFRM_MSG_NEWPOLICY if nlProto == nl.XFRM_MSG_DELPOLICY { @@ -247,6 +252,7 @@ func parseXfrmPolicy(m []byte, family int) (*XfrmPolicy, error) { resTmpl.Mode = Mode(tmpl.Mode) resTmpl.Spi = int(nl.Swap32(tmpl.XfrmId.Spi)) resTmpl.Reqid = int(tmpl.Reqid) + resTmpl.Optional = int(tmpl.Optional) policy.Tmpls = append(policy.Tmpls, resTmpl) } case nl.XFRMA_MARK: diff --git a/vendor/github.com/vishvananda/netlink/xfrm_state.go b/vendor/github.com/vishvananda/netlink/xfrm_state.go index 483d8934a..19df82c76 100644 --- a/vendor/github.com/vishvananda/netlink/xfrm_state.go +++ b/vendor/github.com/vishvananda/netlink/xfrm_state.go @@ -94,7 +94,7 @@ type XfrmState struct { Limits XfrmStateLimits Statistics XfrmStateStats Mark *XfrmMark - OutputMark int + OutputMark *XfrmMark Ifid int Auth *XfrmStateAlgo Crypt *XfrmStateAlgo @@ -104,7 +104,7 @@ type XfrmState struct { } func (sa XfrmState) String() string { - return fmt.Sprintf("Dst: %v, Src: %v, Proto: %s, Mode: %s, SPI: 0x%x, ReqID: 0x%x, ReplayWindow: %d, Mark: %v, OutputMark: %d, Ifid: %d, Auth: %v, Crypt: %v, Aead: %v, Encap: %v, ESN: %t", + return fmt.Sprintf("Dst: %v, Src: %v, Proto: %s, Mode: %s, SPI: 0x%x, ReqID: 0x%x, ReplayWindow: %d, Mark: %v, OutputMark: %v, Ifid: %d, Auth: %v, Crypt: %v, Aead: %v, Encap: %v, ESN: %t", sa.Dst, sa.Src, sa.Proto, sa.Mode, sa.Spi, sa.Reqid, sa.ReplayWindow, sa.Mark, sa.OutputMark, sa.Ifid, sa.Auth, sa.Crypt, sa.Aead, sa.Encap, sa.ESN) } func (sa XfrmState) Print(stats bool) string { diff --git a/vendor/github.com/vishvananda/netlink/xfrm_state_linux.go b/vendor/github.com/vishvananda/netlink/xfrm_state_linux.go index 66c99423c..61a2d2dea 100644 --- a/vendor/github.com/vishvananda/netlink/xfrm_state_linux.go +++ b/vendor/github.com/vishvananda/netlink/xfrm_state_linux.go @@ -111,7 +111,7 @@ func (h *Handle) xfrmStateAddOrUpdate(state *XfrmState, nlProto int) error { // A state with spi 0 can't be deleted so don't allow it to be set if state.Spi == 0 { - return fmt.Errorf("Spi must be set when adding xfrm state.") + return fmt.Errorf("Spi must be set when adding xfrm state") } req := h.newNetlinkRequest(nlProto, unix.NLM_F_CREATE|unix.NLM_F_EXCL|unix.NLM_F_ACK) @@ -158,13 +158,19 @@ func (h *Handle) xfrmStateAddOrUpdate(state *XfrmState, nlProto int) error { out := nl.NewRtAttr(nl.XFRMA_REPLAY_ESN_VAL, writeReplayEsn(state.ReplayWindow)) req.AddData(out) } - if state.OutputMark != 0 { - out := nl.NewRtAttr(nl.XFRMA_OUTPUT_MARK, nl.Uint32Attr(uint32(state.OutputMark))) + if state.OutputMark != nil { + out := nl.NewRtAttr(nl.XFRMA_SET_MARK, nl.Uint32Attr(state.OutputMark.Value)) req.AddData(out) + if state.OutputMark.Mask != 0 { + out = nl.NewRtAttr(nl.XFRMA_SET_MARK_MASK, nl.Uint32Attr(state.OutputMark.Mask)) + req.AddData(out) + } } - ifId := nl.NewRtAttr(nl.XFRMA_IF_ID, nl.Uint32Attr(uint32(state.Ifid))) - req.AddData(ifId) + if state.Ifid != 0 { + ifId := nl.NewRtAttr(nl.XFRMA_IF_ID, nl.Uint32Attr(uint32(state.Ifid))) + req.AddData(ifId) + } _, err := req.Execute(unix.NETLINK_XFRM, 0) return err @@ -277,8 +283,10 @@ func (h *Handle) xfrmStateGetOrDelete(state *XfrmState, nlProto int) (*XfrmState req.AddData(out) } - ifId := nl.NewRtAttr(nl.XFRMA_IF_ID, nl.Uint32Attr(uint32(state.Ifid))) - req.AddData(ifId) + if state.Ifid != 0 { + ifId := nl.NewRtAttr(nl.XFRMA_IF_ID, nl.Uint32Attr(uint32(state.Ifid))) + req.AddData(ifId) + } resType := nl.XFRM_MSG_NEWSA if nlProto == nl.XFRM_MSG_DELSA { @@ -377,8 +385,19 @@ func parseXfrmState(m []byte, family int) (*XfrmState, error) { state.Mark = new(XfrmMark) state.Mark.Value = mark.Value state.Mark.Mask = mark.Mask - case nl.XFRMA_OUTPUT_MARK: - state.OutputMark = int(native.Uint32(attr.Value)) + case nl.XFRMA_SET_MARK: + if state.OutputMark == nil { + state.OutputMark = new(XfrmMark) + } + state.OutputMark.Value = native.Uint32(attr.Value) + case nl.XFRMA_SET_MARK_MASK: + if state.OutputMark == nil { + state.OutputMark = new(XfrmMark) + } + state.OutputMark.Mask = native.Uint32(attr.Value) + if state.OutputMark.Mask == 0xffffffff { + state.OutputMark.Mask = 0 + } case nl.XFRMA_IF_ID: state.Ifid = int(native.Uint32(attr.Value)) } diff --git a/vendor/golang.org/x/mod/LICENSE b/vendor/golang.org/x/mod/LICENSE new file mode 100644 index 000000000..6a66aea5e --- /dev/null +++ b/vendor/golang.org/x/mod/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/mod/PATENTS b/vendor/golang.org/x/mod/PATENTS new file mode 100644 index 000000000..733099041 --- /dev/null +++ b/vendor/golang.org/x/mod/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/mod/semver/semver.go b/vendor/golang.org/x/mod/semver/semver.go new file mode 100644 index 000000000..9a2dfd33a --- /dev/null +++ b/vendor/golang.org/x/mod/semver/semver.go @@ -0,0 +1,401 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package semver implements comparison of semantic version strings. +// In this package, semantic version strings must begin with a leading "v", +// as in "v1.0.0". +// +// The general form of a semantic version string accepted by this package is +// +// vMAJOR[.MINOR[.PATCH[-PRERELEASE][+BUILD]]] +// +// where square brackets indicate optional parts of the syntax; +// MAJOR, MINOR, and PATCH are decimal integers without extra leading zeros; +// PRERELEASE and BUILD are each a series of non-empty dot-separated identifiers +// using only alphanumeric characters and hyphens; and +// all-numeric PRERELEASE identifiers must not have leading zeros. +// +// This package follows Semantic Versioning 2.0.0 (see semver.org) +// with two exceptions. First, it requires the "v" prefix. Second, it recognizes +// vMAJOR and vMAJOR.MINOR (with no prerelease or build suffixes) +// as shorthands for vMAJOR.0.0 and vMAJOR.MINOR.0. +package semver + +import "sort" + +// parsed returns the parsed form of a semantic version string. +type parsed struct { + major string + minor string + patch string + short string + prerelease string + build string +} + +// IsValid reports whether v is a valid semantic version string. +func IsValid(v string) bool { + _, ok := parse(v) + return ok +} + +// Canonical returns the canonical formatting of the semantic version v. +// It fills in any missing .MINOR or .PATCH and discards build metadata. +// Two semantic versions compare equal only if their canonical formattings +// are identical strings. +// The canonical invalid semantic version is the empty string. +func Canonical(v string) string { + p, ok := parse(v) + if !ok { + return "" + } + if p.build != "" { + return v[:len(v)-len(p.build)] + } + if p.short != "" { + return v + p.short + } + return v +} + +// Major returns the major version prefix of the semantic version v. +// For example, Major("v2.1.0") == "v2". +// If v is an invalid semantic version string, Major returns the empty string. +func Major(v string) string { + pv, ok := parse(v) + if !ok { + return "" + } + return v[:1+len(pv.major)] +} + +// MajorMinor returns the major.minor version prefix of the semantic version v. +// For example, MajorMinor("v2.1.0") == "v2.1". +// If v is an invalid semantic version string, MajorMinor returns the empty string. +func MajorMinor(v string) string { + pv, ok := parse(v) + if !ok { + return "" + } + i := 1 + len(pv.major) + if j := i + 1 + len(pv.minor); j <= len(v) && v[i] == '.' && v[i+1:j] == pv.minor { + return v[:j] + } + return v[:i] + "." + pv.minor +} + +// Prerelease returns the prerelease suffix of the semantic version v. +// For example, Prerelease("v2.1.0-pre+meta") == "-pre". +// If v is an invalid semantic version string, Prerelease returns the empty string. +func Prerelease(v string) string { + pv, ok := parse(v) + if !ok { + return "" + } + return pv.prerelease +} + +// Build returns the build suffix of the semantic version v. +// For example, Build("v2.1.0+meta") == "+meta". +// If v is an invalid semantic version string, Build returns the empty string. +func Build(v string) string { + pv, ok := parse(v) + if !ok { + return "" + } + return pv.build +} + +// Compare returns an integer comparing two versions according to +// semantic version precedence. +// The result will be 0 if v == w, -1 if v < w, or +1 if v > w. +// +// An invalid semantic version string is considered less than a valid one. +// All invalid semantic version strings compare equal to each other. +func Compare(v, w string) int { + pv, ok1 := parse(v) + pw, ok2 := parse(w) + if !ok1 && !ok2 { + return 0 + } + if !ok1 { + return -1 + } + if !ok2 { + return +1 + } + if c := compareInt(pv.major, pw.major); c != 0 { + return c + } + if c := compareInt(pv.minor, pw.minor); c != 0 { + return c + } + if c := compareInt(pv.patch, pw.patch); c != 0 { + return c + } + return comparePrerelease(pv.prerelease, pw.prerelease) +} + +// Max canonicalizes its arguments and then returns the version string +// that compares greater. +// +// Deprecated: use [Compare] instead. In most cases, returning a canonicalized +// version is not expected or desired. +func Max(v, w string) string { + v = Canonical(v) + w = Canonical(w) + if Compare(v, w) > 0 { + return v + } + return w +} + +// ByVersion implements [sort.Interface] for sorting semantic version strings. +type ByVersion []string + +func (vs ByVersion) Len() int { return len(vs) } +func (vs ByVersion) Swap(i, j int) { vs[i], vs[j] = vs[j], vs[i] } +func (vs ByVersion) Less(i, j int) bool { + cmp := Compare(vs[i], vs[j]) + if cmp != 0 { + return cmp < 0 + } + return vs[i] < vs[j] +} + +// Sort sorts a list of semantic version strings using [ByVersion]. +func Sort(list []string) { + sort.Sort(ByVersion(list)) +} + +func parse(v string) (p parsed, ok bool) { + if v == "" || v[0] != 'v' { + return + } + p.major, v, ok = parseInt(v[1:]) + if !ok { + return + } + if v == "" { + p.minor = "0" + p.patch = "0" + p.short = ".0.0" + return + } + if v[0] != '.' { + ok = false + return + } + p.minor, v, ok = parseInt(v[1:]) + if !ok { + return + } + if v == "" { + p.patch = "0" + p.short = ".0" + return + } + if v[0] != '.' { + ok = false + return + } + p.patch, v, ok = parseInt(v[1:]) + if !ok { + return + } + if len(v) > 0 && v[0] == '-' { + p.prerelease, v, ok = parsePrerelease(v) + if !ok { + return + } + } + if len(v) > 0 && v[0] == '+' { + p.build, v, ok = parseBuild(v) + if !ok { + return + } + } + if v != "" { + ok = false + return + } + ok = true + return +} + +func parseInt(v string) (t, rest string, ok bool) { + if v == "" { + return + } + if v[0] < '0' || '9' < v[0] { + return + } + i := 1 + for i < len(v) && '0' <= v[i] && v[i] <= '9' { + i++ + } + if v[0] == '0' && i != 1 { + return + } + return v[:i], v[i:], true +} + +func parsePrerelease(v string) (t, rest string, ok bool) { + // "A pre-release version MAY be denoted by appending a hyphen and + // a series of dot separated identifiers immediately following the patch version. + // Identifiers MUST comprise only ASCII alphanumerics and hyphen [0-9A-Za-z-]. + // Identifiers MUST NOT be empty. Numeric identifiers MUST NOT include leading zeroes." + if v == "" || v[0] != '-' { + return + } + i := 1 + start := 1 + for i < len(v) && v[i] != '+' { + if !isIdentChar(v[i]) && v[i] != '.' { + return + } + if v[i] == '.' { + if start == i || isBadNum(v[start:i]) { + return + } + start = i + 1 + } + i++ + } + if start == i || isBadNum(v[start:i]) { + return + } + return v[:i], v[i:], true +} + +func parseBuild(v string) (t, rest string, ok bool) { + if v == "" || v[0] != '+' { + return + } + i := 1 + start := 1 + for i < len(v) { + if !isIdentChar(v[i]) && v[i] != '.' { + return + } + if v[i] == '.' { + if start == i { + return + } + start = i + 1 + } + i++ + } + if start == i { + return + } + return v[:i], v[i:], true +} + +func isIdentChar(c byte) bool { + return 'A' <= c && c <= 'Z' || 'a' <= c && c <= 'z' || '0' <= c && c <= '9' || c == '-' +} + +func isBadNum(v string) bool { + i := 0 + for i < len(v) && '0' <= v[i] && v[i] <= '9' { + i++ + } + return i == len(v) && i > 1 && v[0] == '0' +} + +func isNum(v string) bool { + i := 0 + for i < len(v) && '0' <= v[i] && v[i] <= '9' { + i++ + } + return i == len(v) +} + +func compareInt(x, y string) int { + if x == y { + return 0 + } + if len(x) < len(y) { + return -1 + } + if len(x) > len(y) { + return +1 + } + if x < y { + return -1 + } else { + return +1 + } +} + +func comparePrerelease(x, y string) int { + // "When major, minor, and patch are equal, a pre-release version has + // lower precedence than a normal version. + // Example: 1.0.0-alpha < 1.0.0. + // Precedence for two pre-release versions with the same major, minor, + // and patch version MUST be determined by comparing each dot separated + // identifier from left to right until a difference is found as follows: + // identifiers consisting of only digits are compared numerically and + // identifiers with letters or hyphens are compared lexically in ASCII + // sort order. Numeric identifiers always have lower precedence than + // non-numeric identifiers. A larger set of pre-release fields has a + // higher precedence than a smaller set, if all of the preceding + // identifiers are equal. + // Example: 1.0.0-alpha < 1.0.0-alpha.1 < 1.0.0-alpha.beta < + // 1.0.0-beta < 1.0.0-beta.2 < 1.0.0-beta.11 < 1.0.0-rc.1 < 1.0.0." + if x == y { + return 0 + } + if x == "" { + return +1 + } + if y == "" { + return -1 + } + for x != "" && y != "" { + x = x[1:] // skip - or . + y = y[1:] // skip - or . + var dx, dy string + dx, x = nextIdent(x) + dy, y = nextIdent(y) + if dx != dy { + ix := isNum(dx) + iy := isNum(dy) + if ix != iy { + if ix { + return -1 + } else { + return +1 + } + } + if ix { + if len(dx) < len(dy) { + return -1 + } + if len(dx) > len(dy) { + return +1 + } + } + if dx < dy { + return -1 + } else { + return +1 + } + } + } + if x == "" { + return -1 + } else { + return +1 + } +} + +func nextIdent(x string) (dx, rest string) { + i := 0 + for i < len(x) && x[i] != '.' { + i++ + } + return x[:i], x[i:] +} diff --git a/vendor/golang.org/x/oauth2/deviceauth.go b/vendor/golang.org/x/oauth2/deviceauth.go new file mode 100644 index 000000000..e99c92f39 --- /dev/null +++ b/vendor/golang.org/x/oauth2/deviceauth.go @@ -0,0 +1,198 @@ +package oauth2 + +import ( + "context" + "encoding/json" + "errors" + "fmt" + "io" + "net/http" + "net/url" + "strings" + "time" + + "golang.org/x/oauth2/internal" +) + +// https://datatracker.ietf.org/doc/html/rfc8628#section-3.5 +const ( + errAuthorizationPending = "authorization_pending" + errSlowDown = "slow_down" + errAccessDenied = "access_denied" + errExpiredToken = "expired_token" +) + +// DeviceAuthResponse describes a successful RFC 8628 Device Authorization Response +// https://datatracker.ietf.org/doc/html/rfc8628#section-3.2 +type DeviceAuthResponse struct { + // DeviceCode + DeviceCode string `json:"device_code"` + // UserCode is the code the user should enter at the verification uri + UserCode string `json:"user_code"` + // VerificationURI is where user should enter the user code + VerificationURI string `json:"verification_uri"` + // VerificationURIComplete (if populated) includes the user code in the verification URI. This is typically shown to the user in non-textual form, such as a QR code. + VerificationURIComplete string `json:"verification_uri_complete,omitempty"` + // Expiry is when the device code and user code expire + Expiry time.Time `json:"expires_in,omitempty"` + // Interval is the duration in seconds that Poll should wait between requests + Interval int64 `json:"interval,omitempty"` +} + +func (d DeviceAuthResponse) MarshalJSON() ([]byte, error) { + type Alias DeviceAuthResponse + var expiresIn int64 + if !d.Expiry.IsZero() { + expiresIn = int64(time.Until(d.Expiry).Seconds()) + } + return json.Marshal(&struct { + ExpiresIn int64 `json:"expires_in,omitempty"` + *Alias + }{ + ExpiresIn: expiresIn, + Alias: (*Alias)(&d), + }) + +} + +func (c *DeviceAuthResponse) UnmarshalJSON(data []byte) error { + type Alias DeviceAuthResponse + aux := &struct { + ExpiresIn int64 `json:"expires_in"` + // workaround misspelling of verification_uri + VerificationURL string `json:"verification_url"` + *Alias + }{ + Alias: (*Alias)(c), + } + if err := json.Unmarshal(data, &aux); err != nil { + return err + } + if aux.ExpiresIn != 0 { + c.Expiry = time.Now().UTC().Add(time.Second * time.Duration(aux.ExpiresIn)) + } + if c.VerificationURI == "" { + c.VerificationURI = aux.VerificationURL + } + return nil +} + +// DeviceAuth returns a device auth struct which contains a device code +// and authorization information provided for users to enter on another device. +func (c *Config) DeviceAuth(ctx context.Context, opts ...AuthCodeOption) (*DeviceAuthResponse, error) { + // https://datatracker.ietf.org/doc/html/rfc8628#section-3.1 + v := url.Values{ + "client_id": {c.ClientID}, + } + if len(c.Scopes) > 0 { + v.Set("scope", strings.Join(c.Scopes, " ")) + } + for _, opt := range opts { + opt.setValue(v) + } + return retrieveDeviceAuth(ctx, c, v) +} + +func retrieveDeviceAuth(ctx context.Context, c *Config, v url.Values) (*DeviceAuthResponse, error) { + if c.Endpoint.DeviceAuthURL == "" { + return nil, errors.New("endpoint missing DeviceAuthURL") + } + + req, err := http.NewRequest("POST", c.Endpoint.DeviceAuthURL, strings.NewReader(v.Encode())) + if err != nil { + return nil, err + } + req.Header.Set("Content-Type", "application/x-www-form-urlencoded") + req.Header.Set("Accept", "application/json") + + t := time.Now() + r, err := internal.ContextClient(ctx).Do(req) + if err != nil { + return nil, err + } + + body, err := io.ReadAll(io.LimitReader(r.Body, 1<<20)) + if err != nil { + return nil, fmt.Errorf("oauth2: cannot auth device: %v", err) + } + if code := r.StatusCode; code < 200 || code > 299 { + return nil, &RetrieveError{ + Response: r, + Body: body, + } + } + + da := &DeviceAuthResponse{} + err = json.Unmarshal(body, &da) + if err != nil { + return nil, fmt.Errorf("unmarshal %s", err) + } + + if !da.Expiry.IsZero() { + // Make a small adjustment to account for time taken by the request + da.Expiry = da.Expiry.Add(-time.Since(t)) + } + + return da, nil +} + +// DeviceAccessToken polls the server to exchange a device code for a token. +func (c *Config) DeviceAccessToken(ctx context.Context, da *DeviceAuthResponse, opts ...AuthCodeOption) (*Token, error) { + if !da.Expiry.IsZero() { + var cancel context.CancelFunc + ctx, cancel = context.WithDeadline(ctx, da.Expiry) + defer cancel() + } + + // https://datatracker.ietf.org/doc/html/rfc8628#section-3.4 + v := url.Values{ + "client_id": {c.ClientID}, + "grant_type": {"urn:ietf:params:oauth:grant-type:device_code"}, + "device_code": {da.DeviceCode}, + } + if len(c.Scopes) > 0 { + v.Set("scope", strings.Join(c.Scopes, " ")) + } + for _, opt := range opts { + opt.setValue(v) + } + + // "If no value is provided, clients MUST use 5 as the default." + // https://datatracker.ietf.org/doc/html/rfc8628#section-3.2 + interval := da.Interval + if interval == 0 { + interval = 5 + } + + ticker := time.NewTicker(time.Duration(interval) * time.Second) + defer ticker.Stop() + for { + select { + case <-ctx.Done(): + return nil, ctx.Err() + case <-ticker.C: + tok, err := retrieveToken(ctx, c, v) + if err == nil { + return tok, nil + } + + e, ok := err.(*RetrieveError) + if !ok { + return nil, err + } + switch e.ErrorCode { + case errSlowDown: + // https://datatracker.ietf.org/doc/html/rfc8628#section-3.5 + // "the interval MUST be increased by 5 seconds for this and all subsequent requests" + interval += 5 + ticker.Reset(time.Duration(interval) * time.Second) + case errAuthorizationPending: + // Do nothing. + case errAccessDenied, errExpiredToken: + fallthrough + default: + return tok, err + } + } + } +} diff --git a/vendor/golang.org/x/oauth2/internal/token.go b/vendor/golang.org/x/oauth2/internal/token.go index 58901bda5..e83ddeef0 100644 --- a/vendor/golang.org/x/oauth2/internal/token.go +++ b/vendor/golang.org/x/oauth2/internal/token.go @@ -18,6 +18,7 @@ import ( "strconv" "strings" "sync" + "sync/atomic" "time" ) @@ -115,41 +116,60 @@ const ( AuthStyleInHeader AuthStyle = 2 ) -// authStyleCache is the set of tokenURLs we've successfully used via +// LazyAuthStyleCache is a backwards compatibility compromise to let Configs +// have a lazily-initialized AuthStyleCache. +// +// The two users of this, oauth2.Config and oauth2/clientcredentials.Config, +// both would ideally just embed an unexported AuthStyleCache but because both +// were historically allowed to be copied by value we can't retroactively add an +// uncopyable Mutex to them. +// +// We could use an atomic.Pointer, but that was added recently enough (in Go +// 1.18) that we'd break Go 1.17 users where the tests as of 2023-08-03 +// still pass. By using an atomic.Value, it supports both Go 1.17 and +// copying by value, even if that's not ideal. +type LazyAuthStyleCache struct { + v atomic.Value // of *AuthStyleCache +} + +func (lc *LazyAuthStyleCache) Get() *AuthStyleCache { + if c, ok := lc.v.Load().(*AuthStyleCache); ok { + return c + } + c := new(AuthStyleCache) + if !lc.v.CompareAndSwap(nil, c) { + c = lc.v.Load().(*AuthStyleCache) + } + return c +} + +// AuthStyleCache is the set of tokenURLs we've successfully used via // RetrieveToken and which style auth we ended up using. // It's called a cache, but it doesn't (yet?) shrink. It's expected that // the set of OAuth2 servers a program contacts over time is fixed and // small. -var authStyleCache struct { - sync.Mutex - m map[string]AuthStyle // keyed by tokenURL -} - -// ResetAuthCache resets the global authentication style cache used -// for AuthStyleUnknown token requests. -func ResetAuthCache() { - authStyleCache.Lock() - defer authStyleCache.Unlock() - authStyleCache.m = nil +type AuthStyleCache struct { + mu sync.Mutex + m map[string]AuthStyle // keyed by tokenURL } // lookupAuthStyle reports which auth style we last used with tokenURL // when calling RetrieveToken and whether we have ever done so. -func lookupAuthStyle(tokenURL string) (style AuthStyle, ok bool) { - authStyleCache.Lock() - defer authStyleCache.Unlock() - style, ok = authStyleCache.m[tokenURL] +func (c *AuthStyleCache) lookupAuthStyle(tokenURL string) (style AuthStyle, ok bool) { + c.mu.Lock() + defer c.mu.Unlock() + style, ok = c.m[tokenURL] return } // setAuthStyle adds an entry to authStyleCache, documented above. -func setAuthStyle(tokenURL string, v AuthStyle) { - authStyleCache.Lock() - defer authStyleCache.Unlock() - if authStyleCache.m == nil { - authStyleCache.m = make(map[string]AuthStyle) +func (c *AuthStyleCache) setAuthStyle(tokenURL string, v AuthStyle) { + c.mu.Lock() + defer c.mu.Unlock() + if c.m == nil { + c.m = make(map[string]AuthStyle) } - authStyleCache.m[tokenURL] = v + c.m[tokenURL] = v } // newTokenRequest returns a new *http.Request to retrieve a new token @@ -189,10 +209,10 @@ func cloneURLValues(v url.Values) url.Values { return v2 } -func RetrieveToken(ctx context.Context, clientID, clientSecret, tokenURL string, v url.Values, authStyle AuthStyle) (*Token, error) { +func RetrieveToken(ctx context.Context, clientID, clientSecret, tokenURL string, v url.Values, authStyle AuthStyle, styleCache *AuthStyleCache) (*Token, error) { needsAuthStyleProbe := authStyle == 0 if needsAuthStyleProbe { - if style, ok := lookupAuthStyle(tokenURL); ok { + if style, ok := styleCache.lookupAuthStyle(tokenURL); ok { authStyle = style needsAuthStyleProbe = false } else { @@ -222,7 +242,7 @@ func RetrieveToken(ctx context.Context, clientID, clientSecret, tokenURL string, token, err = doTokenRoundTrip(ctx, req) } if needsAuthStyleProbe && err == nil { - setAuthStyle(tokenURL, authStyle) + styleCache.setAuthStyle(tokenURL, authStyle) } // Don't overwrite `RefreshToken` with an empty value // if this was a token refreshing request. diff --git a/vendor/golang.org/x/oauth2/oauth2.go b/vendor/golang.org/x/oauth2/oauth2.go index 9085fabe3..90a2c3d6d 100644 --- a/vendor/golang.org/x/oauth2/oauth2.go +++ b/vendor/golang.org/x/oauth2/oauth2.go @@ -58,6 +58,10 @@ type Config struct { // Scope specifies optional requested permissions. Scopes []string + + // authStyleCache caches which auth style to use when Endpoint.AuthStyle is + // the zero value (AuthStyleAutoDetect). + authStyleCache internal.LazyAuthStyleCache } // A TokenSource is anything that can return a token. @@ -71,8 +75,9 @@ type TokenSource interface { // Endpoint represents an OAuth 2.0 provider's authorization and token // endpoint URLs. type Endpoint struct { - AuthURL string - TokenURL string + AuthURL string + DeviceAuthURL string + TokenURL string // AuthStyle optionally specifies how the endpoint wants the // client ID & client secret sent. The zero value means to @@ -139,15 +144,19 @@ func SetAuthURLParam(key, value string) AuthCodeOption { // AuthCodeURL returns a URL to OAuth 2.0 provider's consent page // that asks for permissions for the required scopes explicitly. // -// State is a token to protect the user from CSRF attacks. You must -// always provide a non-empty string and validate that it matches the -// state query parameter on your redirect callback. -// See http://tools.ietf.org/html/rfc6749#section-10.12 for more info. +// State is an opaque value used by the client to maintain state between the +// request and callback. The authorization server includes this value when +// redirecting the user agent back to the client. // // Opts may include AccessTypeOnline or AccessTypeOffline, as well // as ApprovalForce. -// It can also be used to pass the PKCE challenge. -// See https://www.oauth.com/oauth2-servers/pkce/ for more info. +// +// To protect against CSRF attacks, opts should include a PKCE challenge +// (S256ChallengeOption). Not all servers support PKCE. An alternative is to +// generate a random state parameter and verify it after exchange. +// See https://datatracker.ietf.org/doc/html/rfc6749#section-10.12 (predating +// PKCE), https://www.oauth.com/oauth2-servers/pkce/ and +// https://www.ietf.org/archive/id/draft-ietf-oauth-v2-1-09.html#name-cross-site-request-forgery (describing both approaches) func (c *Config) AuthCodeURL(state string, opts ...AuthCodeOption) string { var buf bytes.Buffer buf.WriteString(c.Endpoint.AuthURL) @@ -162,7 +171,6 @@ func (c *Config) AuthCodeURL(state string, opts ...AuthCodeOption) string { v.Set("scope", strings.Join(c.Scopes, " ")) } if state != "" { - // TODO(light): Docs say never to omit state; don't allow empty. v.Set("state", state) } for _, opt := range opts { @@ -207,10 +215,11 @@ func (c *Config) PasswordCredentialsToken(ctx context.Context, username, passwor // The provided context optionally controls which HTTP client is used. See the HTTPClient variable. // // The code will be in the *http.Request.FormValue("code"). Before -// calling Exchange, be sure to validate FormValue("state"). +// calling Exchange, be sure to validate FormValue("state") if you are +// using it to protect against CSRF attacks. // -// Opts may include the PKCE verifier code if previously used in AuthCodeURL. -// See https://www.oauth.com/oauth2-servers/pkce/ for more info. +// If using PKCE to protect against CSRF attacks, opts should include a +// VerifierOption. func (c *Config) Exchange(ctx context.Context, code string, opts ...AuthCodeOption) (*Token, error) { v := url.Values{ "grant_type": {"authorization_code"}, diff --git a/vendor/golang.org/x/oauth2/pkce.go b/vendor/golang.org/x/oauth2/pkce.go new file mode 100644 index 000000000..50593b6df --- /dev/null +++ b/vendor/golang.org/x/oauth2/pkce.go @@ -0,0 +1,68 @@ +// Copyright 2023 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. +package oauth2 + +import ( + "crypto/rand" + "crypto/sha256" + "encoding/base64" + "net/url" +) + +const ( + codeChallengeKey = "code_challenge" + codeChallengeMethodKey = "code_challenge_method" + codeVerifierKey = "code_verifier" +) + +// GenerateVerifier generates a PKCE code verifier with 32 octets of randomness. +// This follows recommendations in RFC 7636. +// +// A fresh verifier should be generated for each authorization. +// S256ChallengeOption(verifier) should then be passed to Config.AuthCodeURL +// (or Config.DeviceAccess) and VerifierOption(verifier) to Config.Exchange +// (or Config.DeviceAccessToken). +func GenerateVerifier() string { + // "RECOMMENDED that the output of a suitable random number generator be + // used to create a 32-octet sequence. The octet sequence is then + // base64url-encoded to produce a 43-octet URL-safe string to use as the + // code verifier." + // https://datatracker.ietf.org/doc/html/rfc7636#section-4.1 + data := make([]byte, 32) + if _, err := rand.Read(data); err != nil { + panic(err) + } + return base64.RawURLEncoding.EncodeToString(data) +} + +// VerifierOption returns a PKCE code verifier AuthCodeOption. It should be +// passed to Config.Exchange or Config.DeviceAccessToken only. +func VerifierOption(verifier string) AuthCodeOption { + return setParam{k: codeVerifierKey, v: verifier} +} + +// S256ChallengeFromVerifier returns a PKCE code challenge derived from verifier with method S256. +// +// Prefer to use S256ChallengeOption where possible. +func S256ChallengeFromVerifier(verifier string) string { + sha := sha256.Sum256([]byte(verifier)) + return base64.RawURLEncoding.EncodeToString(sha[:]) +} + +// S256ChallengeOption derives a PKCE code challenge derived from verifier with +// method S256. It should be passed to Config.AuthCodeURL or Config.DeviceAccess +// only. +func S256ChallengeOption(verifier string) AuthCodeOption { + return challengeOption{ + challenge_method: "S256", + challenge: S256ChallengeFromVerifier(verifier), + } +} + +type challengeOption struct{ challenge_method, challenge string } + +func (p challengeOption) setValue(m url.Values) { + m.Set(codeChallengeMethodKey, p.challenge_method) + m.Set(codeChallengeKey, p.challenge) +} diff --git a/vendor/golang.org/x/oauth2/token.go b/vendor/golang.org/x/oauth2/token.go index 5ffce9764..5bbb33217 100644 --- a/vendor/golang.org/x/oauth2/token.go +++ b/vendor/golang.org/x/oauth2/token.go @@ -164,7 +164,7 @@ func tokenFromInternal(t *internal.Token) *Token { // This token is then mapped from *internal.Token into an *oauth2.Token which is returned along // with an error.. func retrieveToken(ctx context.Context, c *Config, v url.Values) (*Token, error) { - tk, err := internal.RetrieveToken(ctx, c.ClientID, c.ClientSecret, c.Endpoint.TokenURL, v, internal.AuthStyle(c.Endpoint.AuthStyle)) + tk, err := internal.RetrieveToken(ctx, c.ClientID, c.ClientSecret, c.Endpoint.TokenURL, v, internal.AuthStyle(c.Endpoint.AuthStyle), c.authStyleCache.Get()) if err != nil { if rErr, ok := err.(*internal.RetrieveError); ok { return nil, (*RetrieveError)(rErr) diff --git a/vendor/golang.org/x/sys/execabs/execabs.go b/vendor/golang.org/x/sys/execabs/execabs.go new file mode 100644 index 000000000..3bf40fdfe --- /dev/null +++ b/vendor/golang.org/x/sys/execabs/execabs.go @@ -0,0 +1,102 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package execabs is a drop-in replacement for os/exec +// that requires PATH lookups to find absolute paths. +// That is, execabs.Command("cmd") runs the same PATH lookup +// as exec.Command("cmd"), but if the result is a path +// which is relative, the Run and Start methods will report +// an error instead of running the executable. +// +// See https://blog.golang.org/path-security for more information +// about when it may be necessary or appropriate to use this package. +package execabs + +import ( + "context" + "fmt" + "os/exec" + "path/filepath" + "reflect" + "unsafe" +) + +// ErrNotFound is the error resulting if a path search failed to find an executable file. +// It is an alias for exec.ErrNotFound. +var ErrNotFound = exec.ErrNotFound + +// Cmd represents an external command being prepared or run. +// It is an alias for exec.Cmd. +type Cmd = exec.Cmd + +// Error is returned by LookPath when it fails to classify a file as an executable. +// It is an alias for exec.Error. +type Error = exec.Error + +// An ExitError reports an unsuccessful exit by a command. +// It is an alias for exec.ExitError. +type ExitError = exec.ExitError + +func relError(file, path string) error { + return fmt.Errorf("%s resolves to executable in current directory (.%c%s)", file, filepath.Separator, path) +} + +// LookPath searches for an executable named file in the directories +// named by the PATH environment variable. If file contains a slash, +// it is tried directly and the PATH is not consulted. The result will be +// an absolute path. +// +// LookPath differs from exec.LookPath in its handling of PATH lookups, +// which are used for file names without slashes. If exec.LookPath's +// PATH lookup would have returned an executable from the current directory, +// LookPath instead returns an error. +func LookPath(file string) (string, error) { + path, err := exec.LookPath(file) + if err != nil && !isGo119ErrDot(err) { + return "", err + } + if filepath.Base(file) == file && !filepath.IsAbs(path) { + return "", relError(file, path) + } + return path, nil +} + +func fixCmd(name string, cmd *exec.Cmd) { + if filepath.Base(name) == name && !filepath.IsAbs(cmd.Path) && !isGo119ErrFieldSet(cmd) { + // exec.Command was called with a bare binary name and + // exec.LookPath returned a path which is not absolute. + // Set cmd.lookPathErr and clear cmd.Path so that it + // cannot be run. + lookPathErr := (*error)(unsafe.Pointer(reflect.ValueOf(cmd).Elem().FieldByName("lookPathErr").Addr().Pointer())) + if *lookPathErr == nil { + *lookPathErr = relError(name, cmd.Path) + } + cmd.Path = "" + } +} + +// CommandContext is like Command but includes a context. +// +// The provided context is used to kill the process (by calling os.Process.Kill) +// if the context becomes done before the command completes on its own. +func CommandContext(ctx context.Context, name string, arg ...string) *exec.Cmd { + cmd := exec.CommandContext(ctx, name, arg...) + fixCmd(name, cmd) + return cmd + +} + +// Command returns the Cmd struct to execute the named program with the given arguments. +// See exec.Command for most details. +// +// Command differs from exec.Command in its handling of PATH lookups, +// which are used when the program name contains no slashes. +// If exec.Command would have returned an exec.Cmd configured to run an +// executable from the current directory, Command instead +// returns an exec.Cmd that will return an error from Start or Run. +func Command(name string, arg ...string) *exec.Cmd { + cmd := exec.Command(name, arg...) + fixCmd(name, cmd) + return cmd +} diff --git a/vendor/golang.org/x/sys/execabs/execabs_go118.go b/vendor/golang.org/x/sys/execabs/execabs_go118.go new file mode 100644 index 000000000..5627d70e3 --- /dev/null +++ b/vendor/golang.org/x/sys/execabs/execabs_go118.go @@ -0,0 +1,17 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.19 + +package execabs + +import "os/exec" + +func isGo119ErrDot(err error) bool { + return false +} + +func isGo119ErrFieldSet(cmd *exec.Cmd) bool { + return false +} diff --git a/vendor/golang.org/x/sys/execabs/execabs_go119.go b/vendor/golang.org/x/sys/execabs/execabs_go119.go new file mode 100644 index 000000000..d60ab1b41 --- /dev/null +++ b/vendor/golang.org/x/sys/execabs/execabs_go119.go @@ -0,0 +1,20 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.19 + +package execabs + +import ( + "errors" + "os/exec" +) + +func isGo119ErrDot(err error) bool { + return errors.Is(err, exec.ErrDot) +} + +func isGo119ErrFieldSet(cmd *exec.Cmd) bool { + return cmd.Err != nil +} diff --git a/vendor/golang.org/x/sys/unix/fcntl.go b/vendor/golang.org/x/sys/unix/fcntl.go index 58c6bfc70..6200876fb 100644 --- a/vendor/golang.org/x/sys/unix/fcntl.go +++ b/vendor/golang.org/x/sys/unix/fcntl.go @@ -2,7 +2,7 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -//go:build dragonfly || freebsd || linux || netbsd || openbsd +//go:build dragonfly || freebsd || linux || netbsd package unix diff --git a/vendor/golang.org/x/sys/unix/ioctl_linux.go b/vendor/golang.org/x/sys/unix/ioctl_linux.go index 0d12c0851..dbe680eab 100644 --- a/vendor/golang.org/x/sys/unix/ioctl_linux.go +++ b/vendor/golang.org/x/sys/unix/ioctl_linux.go @@ -231,3 +231,8 @@ func IoctlLoopGetStatus64(fd int) (*LoopInfo64, error) { func IoctlLoopSetStatus64(fd int, value *LoopInfo64) error { return ioctlPtr(fd, LOOP_SET_STATUS64, unsafe.Pointer(value)) } + +// IoctlLoopConfigure configures all loop device parameters in a single step +func IoctlLoopConfigure(fd int, value *LoopConfig) error { + return ioctlPtr(fd, LOOP_CONFIGURE, unsafe.Pointer(value)) +} diff --git a/vendor/golang.org/x/sys/unix/mkerrors.sh b/vendor/golang.org/x/sys/unix/mkerrors.sh index cbe24150a..6202638ba 100644 --- a/vendor/golang.org/x/sys/unix/mkerrors.sh +++ b/vendor/golang.org/x/sys/unix/mkerrors.sh @@ -519,6 +519,7 @@ ccflags="$@" $2 ~ /^LOCK_(SH|EX|NB|UN)$/ || $2 ~ /^LO_(KEY|NAME)_SIZE$/ || $2 ~ /^LOOP_(CLR|CTL|GET|SET)_/ || + $2 == "LOOP_CONFIGURE" || $2 ~ /^(AF|SOCK|SO|SOL|IPPROTO|IP|IPV6|TCP|MCAST|EVFILT|NOTE|SHUT|PROT|MAP|MREMAP|MFD|T?PACKET|MSG|SCM|MCL|DT|MADV|PR|LOCAL|TCPOPT|UDP)_/ || $2 ~ /^NFC_(GENL|PROTO|COMM|RF|SE|DIRECTION|LLCP|SOCKPROTO)_/ || $2 ~ /^NFC_.*_(MAX)?SIZE$/ || @@ -560,7 +561,7 @@ ccflags="$@" $2 ~ /^RLIMIT_(AS|CORE|CPU|DATA|FSIZE|LOCKS|MEMLOCK|MSGQUEUE|NICE|NOFILE|NPROC|RSS|RTPRIO|RTTIME|SIGPENDING|STACK)|RLIM_INFINITY/ || $2 ~ /^PRIO_(PROCESS|PGRP|USER)/ || $2 ~ /^CLONE_[A-Z_]+/ || - $2 !~ /^(BPF_TIMEVAL|BPF_FIB_LOOKUP_[A-Z]+)$/ && + $2 !~ /^(BPF_TIMEVAL|BPF_FIB_LOOKUP_[A-Z]+|BPF_F_LINK)$/ && $2 ~ /^(BPF|DLT)_/ || $2 ~ /^AUDIT_/ || $2 ~ /^(CLOCK|TIMER)_/ || diff --git a/vendor/golang.org/x/sys/unix/syscall_bsd.go b/vendor/golang.org/x/sys/unix/syscall_bsd.go index 6f328e3a5..a00c3e545 100644 --- a/vendor/golang.org/x/sys/unix/syscall_bsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_bsd.go @@ -316,7 +316,7 @@ func GetsockoptString(fd, level, opt int) (string, error) { if err != nil { return "", err } - return string(buf[:vallen-1]), nil + return ByteSliceToString(buf[:vallen]), nil } //sys recvfrom(fd int, p []byte, flags int, from *RawSockaddrAny, fromlen *_Socklen) (n int, err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux.go b/vendor/golang.org/x/sys/unix/syscall_linux.go index a5e1c10e3..0f85e29e6 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux.go @@ -61,15 +61,23 @@ func FanotifyMark(fd int, flags uint, mask uint64, dirFd int, pathname string) ( } //sys fchmodat(dirfd int, path string, mode uint32) (err error) - -func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { - // Linux fchmodat doesn't support the flags parameter. Mimick glibc's behavior - // and check the flags. Otherwise the mode would be applied to the symlink - // destination which is not what the user expects. - if flags&^AT_SYMLINK_NOFOLLOW != 0 { - return EINVAL - } else if flags&AT_SYMLINK_NOFOLLOW != 0 { - return EOPNOTSUPP +//sys fchmodat2(dirfd int, path string, mode uint32, flags int) (err error) + +func Fchmodat(dirfd int, path string, mode uint32, flags int) error { + // Linux fchmodat doesn't support the flags parameter, but fchmodat2 does. + // Try fchmodat2 if flags are specified. + if flags != 0 { + err := fchmodat2(dirfd, path, mode, flags) + if err == ENOSYS { + // fchmodat2 isn't available. If the flags are known to be valid, + // return EOPNOTSUPP to indicate that fchmodat doesn't support them. + if flags&^(AT_SYMLINK_NOFOLLOW|AT_EMPTY_PATH) != 0 { + return EINVAL + } else if flags&(AT_SYMLINK_NOFOLLOW|AT_EMPTY_PATH) != 0 { + return EOPNOTSUPP + } + } + return err } return fchmodat(dirfd, path, mode) } @@ -1302,7 +1310,7 @@ func GetsockoptString(fd, level, opt int) (string, error) { return "", err } } - return string(buf[:vallen-1]), nil + return ByteSliceToString(buf[:vallen]), nil } func GetsockoptTpacketStats(fd, level, opt int) (*TpacketStats, error) { diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd.go b/vendor/golang.org/x/sys/unix/syscall_openbsd.go index d2882ee04..b25343c71 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd.go @@ -166,6 +166,20 @@ func Getresgid() (rgid, egid, sgid int) { //sys sysctl(mib []_C_int, old *byte, oldlen *uintptr, new *byte, newlen uintptr) (err error) = SYS___SYSCTL +//sys fcntl(fd int, cmd int, arg int) (n int, err error) +//sys fcntlPtr(fd int, cmd int, arg unsafe.Pointer) (n int, err error) = SYS_FCNTL + +// FcntlInt performs a fcntl syscall on fd with the provided command and argument. +func FcntlInt(fd uintptr, cmd, arg int) (int, error) { + return fcntl(int(fd), cmd, arg) +} + +// FcntlFlock performs a fcntl syscall for the F_GETLK, F_SETLK or F_SETLKW command. +func FcntlFlock(fd uintptr, cmd int, lk *Flock_t) error { + _, err := fcntlPtr(int(fd), cmd, unsafe.Pointer(lk)) + return err +} + //sys ppoll(fds *PollFd, nfds int, timeout *Timespec, sigmask *Sigset_t) (n int, err error) func Ppoll(fds []PollFd, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { diff --git a/vendor/golang.org/x/sys/unix/syscall_solaris.go b/vendor/golang.org/x/sys/unix/syscall_solaris.go index 60c8142d4..21974af06 100644 --- a/vendor/golang.org/x/sys/unix/syscall_solaris.go +++ b/vendor/golang.org/x/sys/unix/syscall_solaris.go @@ -158,7 +158,7 @@ func GetsockoptString(fd, level, opt int) (string, error) { if err != nil { return "", err } - return string(buf[:vallen-1]), nil + return ByteSliceToString(buf[:vallen]), nil } const ImplementsGetwd = true diff --git a/vendor/golang.org/x/sys/unix/syscall_zos_s390x.go b/vendor/golang.org/x/sys/unix/syscall_zos_s390x.go index d99d05f1b..b473038c6 100644 --- a/vendor/golang.org/x/sys/unix/syscall_zos_s390x.go +++ b/vendor/golang.org/x/sys/unix/syscall_zos_s390x.go @@ -1104,7 +1104,7 @@ func GetsockoptString(fd, level, opt int) (string, error) { return "", err } - return string(buf[:vallen-1]), nil + return ByteSliceToString(buf[:vallen]), nil } func Recvmsg(fd int, p, oob []byte, flags int) (n, oobn int, recvflags int, from Sockaddr, err error) { diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux.go b/vendor/golang.org/x/sys/unix/zerrors_linux.go index 9c00cbf51..c73cfe2f1 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux.go @@ -486,7 +486,6 @@ const ( BPF_F_ANY_ALIGNMENT = 0x2 BPF_F_BEFORE = 0x8 BPF_F_ID = 0x20 - BPF_F_LINK = 0x2000 BPF_F_NETFILTER_IP_DEFRAG = 0x1 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_REPLACE = 0x4 @@ -1802,6 +1801,7 @@ const ( LOCK_SH = 0x1 LOCK_UN = 0x8 LOOP_CLR_FD = 0x4c01 + LOOP_CONFIGURE = 0x4c0a LOOP_CTL_ADD = 0x4c80 LOOP_CTL_GET_FREE = 0x4c82 LOOP_CTL_REMOVE = 0x4c81 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux.go b/vendor/golang.org/x/sys/unix/zsyscall_linux.go index faca7a557..1488d2712 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux.go @@ -37,6 +37,21 @@ func fchmodat(dirfd int, path string, mode uint32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func fchmodat2(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FCHMODAT2, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ioctl(fd int, req uint, arg uintptr) (err error) { _, _, e1 := Syscall(SYS_IOCTL, uintptr(fd), uintptr(req), uintptr(arg)) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go index 88bfc2885..a1d061597 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go @@ -584,6 +584,32 @@ var libc_sysctl_trampoline_addr uintptr // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func fcntl(fd int, cmd int, arg int) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +var libc_fcntl_trampoline_addr uintptr + +//go:cgo_import_dynamic libc_fcntl fcntl "libc.so" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func fcntlPtr(fd int, cmd int, arg unsafe.Pointer) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ppoll(fds *PollFd, nfds int, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { r0, _, e1 := syscall_syscall6(libc_ppoll_trampoline_addr, uintptr(unsafe.Pointer(fds)), uintptr(nfds), uintptr(unsafe.Pointer(timeout)), uintptr(unsafe.Pointer(sigmask)), 0, 0) n = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.s b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.s index 4cbeff171..41b561731 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.s @@ -178,6 +178,11 @@ TEXT libc_sysctl_trampoline<>(SB),NOSPLIT,$0-0 GLOBL ·libc_sysctl_trampoline_addr(SB), RODATA, $4 DATA ·libc_sysctl_trampoline_addr(SB)/4, $libc_sysctl_trampoline<>(SB) +TEXT libc_fcntl_trampoline<>(SB),NOSPLIT,$0-0 + JMP libc_fcntl(SB) +GLOBL ·libc_fcntl_trampoline_addr(SB), RODATA, $4 +DATA ·libc_fcntl_trampoline_addr(SB)/4, $libc_fcntl_trampoline<>(SB) + TEXT libc_ppoll_trampoline<>(SB),NOSPLIT,$0-0 JMP libc_ppoll(SB) GLOBL ·libc_ppoll_trampoline_addr(SB), RODATA, $4 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go index b8a67b99a..5b2a74097 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go @@ -584,6 +584,32 @@ var libc_sysctl_trampoline_addr uintptr // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func fcntl(fd int, cmd int, arg int) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +var libc_fcntl_trampoline_addr uintptr + +//go:cgo_import_dynamic libc_fcntl fcntl "libc.so" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func fcntlPtr(fd int, cmd int, arg unsafe.Pointer) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ppoll(fds *PollFd, nfds int, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { r0, _, e1 := syscall_syscall6(libc_ppoll_trampoline_addr, uintptr(unsafe.Pointer(fds)), uintptr(nfds), uintptr(unsafe.Pointer(timeout)), uintptr(unsafe.Pointer(sigmask)), 0, 0) n = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.s b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.s index 1123f2757..4019a656f 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.s @@ -178,6 +178,11 @@ TEXT libc_sysctl_trampoline<>(SB),NOSPLIT,$0-0 GLOBL ·libc_sysctl_trampoline_addr(SB), RODATA, $8 DATA ·libc_sysctl_trampoline_addr(SB)/8, $libc_sysctl_trampoline<>(SB) +TEXT libc_fcntl_trampoline<>(SB),NOSPLIT,$0-0 + JMP libc_fcntl(SB) +GLOBL ·libc_fcntl_trampoline_addr(SB), RODATA, $8 +DATA ·libc_fcntl_trampoline_addr(SB)/8, $libc_fcntl_trampoline<>(SB) + TEXT libc_ppoll_trampoline<>(SB),NOSPLIT,$0-0 JMP libc_ppoll(SB) GLOBL ·libc_ppoll_trampoline_addr(SB), RODATA, $8 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go index af50a65c0..f6eda1344 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go @@ -584,6 +584,32 @@ var libc_sysctl_trampoline_addr uintptr // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func fcntl(fd int, cmd int, arg int) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +var libc_fcntl_trampoline_addr uintptr + +//go:cgo_import_dynamic libc_fcntl fcntl "libc.so" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func fcntlPtr(fd int, cmd int, arg unsafe.Pointer) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ppoll(fds *PollFd, nfds int, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { r0, _, e1 := syscall_syscall6(libc_ppoll_trampoline_addr, uintptr(unsafe.Pointer(fds)), uintptr(nfds), uintptr(unsafe.Pointer(timeout)), uintptr(unsafe.Pointer(sigmask)), 0, 0) n = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.s b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.s index 82badae39..ac4af24f9 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.s @@ -178,6 +178,11 @@ TEXT libc_sysctl_trampoline<>(SB),NOSPLIT,$0-0 GLOBL ·libc_sysctl_trampoline_addr(SB), RODATA, $4 DATA ·libc_sysctl_trampoline_addr(SB)/4, $libc_sysctl_trampoline<>(SB) +TEXT libc_fcntl_trampoline<>(SB),NOSPLIT,$0-0 + JMP libc_fcntl(SB) +GLOBL ·libc_fcntl_trampoline_addr(SB), RODATA, $4 +DATA ·libc_fcntl_trampoline_addr(SB)/4, $libc_fcntl_trampoline<>(SB) + TEXT libc_ppoll_trampoline<>(SB),NOSPLIT,$0-0 JMP libc_ppoll(SB) GLOBL ·libc_ppoll_trampoline_addr(SB), RODATA, $4 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go index 8fb4ff36a..55df20ae9 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go @@ -584,6 +584,32 @@ var libc_sysctl_trampoline_addr uintptr // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func fcntl(fd int, cmd int, arg int) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +var libc_fcntl_trampoline_addr uintptr + +//go:cgo_import_dynamic libc_fcntl fcntl "libc.so" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func fcntlPtr(fd int, cmd int, arg unsafe.Pointer) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ppoll(fds *PollFd, nfds int, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { r0, _, e1 := syscall_syscall6(libc_ppoll_trampoline_addr, uintptr(unsafe.Pointer(fds)), uintptr(nfds), uintptr(unsafe.Pointer(timeout)), uintptr(unsafe.Pointer(sigmask)), 0, 0) n = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.s b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.s index 24d7eecb9..f77d53212 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.s @@ -178,6 +178,11 @@ TEXT libc_sysctl_trampoline<>(SB),NOSPLIT,$0-0 GLOBL ·libc_sysctl_trampoline_addr(SB), RODATA, $8 DATA ·libc_sysctl_trampoline_addr(SB)/8, $libc_sysctl_trampoline<>(SB) +TEXT libc_fcntl_trampoline<>(SB),NOSPLIT,$0-0 + JMP libc_fcntl(SB) +GLOBL ·libc_fcntl_trampoline_addr(SB), RODATA, $8 +DATA ·libc_fcntl_trampoline_addr(SB)/8, $libc_fcntl_trampoline<>(SB) + TEXT libc_ppoll_trampoline<>(SB),NOSPLIT,$0-0 JMP libc_ppoll(SB) GLOBL ·libc_ppoll_trampoline_addr(SB), RODATA, $8 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_mips64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_mips64.go index f469a83ee..8c1155cbc 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_mips64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_mips64.go @@ -584,6 +584,32 @@ var libc_sysctl_trampoline_addr uintptr // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func fcntl(fd int, cmd int, arg int) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +var libc_fcntl_trampoline_addr uintptr + +//go:cgo_import_dynamic libc_fcntl fcntl "libc.so" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func fcntlPtr(fd int, cmd int, arg unsafe.Pointer) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ppoll(fds *PollFd, nfds int, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { r0, _, e1 := syscall_syscall6(libc_ppoll_trampoline_addr, uintptr(unsafe.Pointer(fds)), uintptr(nfds), uintptr(unsafe.Pointer(timeout)), uintptr(unsafe.Pointer(sigmask)), 0, 0) n = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_mips64.s b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_mips64.s index 9a498a067..fae140b62 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_mips64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_mips64.s @@ -178,6 +178,11 @@ TEXT libc_sysctl_trampoline<>(SB),NOSPLIT,$0-0 GLOBL ·libc_sysctl_trampoline_addr(SB), RODATA, $8 DATA ·libc_sysctl_trampoline_addr(SB)/8, $libc_sysctl_trampoline<>(SB) +TEXT libc_fcntl_trampoline<>(SB),NOSPLIT,$0-0 + JMP libc_fcntl(SB) +GLOBL ·libc_fcntl_trampoline_addr(SB), RODATA, $8 +DATA ·libc_fcntl_trampoline_addr(SB)/8, $libc_fcntl_trampoline<>(SB) + TEXT libc_ppoll_trampoline<>(SB),NOSPLIT,$0-0 JMP libc_ppoll(SB) GLOBL ·libc_ppoll_trampoline_addr(SB), RODATA, $8 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_ppc64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_ppc64.go index c26ca2e1a..7cc80c58d 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_ppc64.go @@ -584,6 +584,32 @@ var libc_sysctl_trampoline_addr uintptr // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func fcntl(fd int, cmd int, arg int) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +var libc_fcntl_trampoline_addr uintptr + +//go:cgo_import_dynamic libc_fcntl fcntl "libc.so" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func fcntlPtr(fd int, cmd int, arg unsafe.Pointer) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ppoll(fds *PollFd, nfds int, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { r0, _, e1 := syscall_syscall6(libc_ppoll_trampoline_addr, uintptr(unsafe.Pointer(fds)), uintptr(nfds), uintptr(unsafe.Pointer(timeout)), uintptr(unsafe.Pointer(sigmask)), 0, 0) n = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_ppc64.s b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_ppc64.s index 1f224aa41..9d1e0ff06 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_ppc64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_ppc64.s @@ -213,6 +213,12 @@ TEXT libc_sysctl_trampoline<>(SB),NOSPLIT,$0-0 GLOBL ·libc_sysctl_trampoline_addr(SB), RODATA, $8 DATA ·libc_sysctl_trampoline_addr(SB)/8, $libc_sysctl_trampoline<>(SB) +TEXT libc_fcntl_trampoline<>(SB),NOSPLIT,$0-0 + CALL libc_fcntl(SB) + RET +GLOBL ·libc_fcntl_trampoline_addr(SB), RODATA, $8 +DATA ·libc_fcntl_trampoline_addr(SB)/8, $libc_fcntl_trampoline<>(SB) + TEXT libc_ppoll_trampoline<>(SB),NOSPLIT,$0-0 CALL libc_ppoll(SB) RET diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_riscv64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_riscv64.go index bcc920dd2..0688737f4 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_riscv64.go @@ -584,6 +584,32 @@ var libc_sysctl_trampoline_addr uintptr // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func fcntl(fd int, cmd int, arg int) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +var libc_fcntl_trampoline_addr uintptr + +//go:cgo_import_dynamic libc_fcntl fcntl "libc.so" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func fcntlPtr(fd int, cmd int, arg unsafe.Pointer) (n int, err error) { + r0, _, e1 := syscall_syscall(libc_fcntl_trampoline_addr, uintptr(fd), uintptr(cmd), uintptr(arg)) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ppoll(fds *PollFd, nfds int, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { r0, _, e1 := syscall_syscall6(libc_ppoll_trampoline_addr, uintptr(unsafe.Pointer(fds)), uintptr(nfds), uintptr(unsafe.Pointer(timeout)), uintptr(unsafe.Pointer(sigmask)), 0, 0) n = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_riscv64.s b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_riscv64.s index 87a79c709..da115f9a4 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_riscv64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_riscv64.s @@ -178,6 +178,11 @@ TEXT libc_sysctl_trampoline<>(SB),NOSPLIT,$0-0 GLOBL ·libc_sysctl_trampoline_addr(SB), RODATA, $8 DATA ·libc_sysctl_trampoline_addr(SB)/8, $libc_sysctl_trampoline<>(SB) +TEXT libc_fcntl_trampoline<>(SB),NOSPLIT,$0-0 + JMP libc_fcntl(SB) +GLOBL ·libc_fcntl_trampoline_addr(SB), RODATA, $8 +DATA ·libc_fcntl_trampoline_addr(SB)/8, $libc_fcntl_trampoline<>(SB) + TEXT libc_ppoll_trampoline<>(SB),NOSPLIT,$0-0 JMP libc_ppoll(SB) GLOBL ·libc_ppoll_trampoline_addr(SB), RODATA, $8 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux.go b/vendor/golang.org/x/sys/unix/ztypes_linux.go index 997bcd55a..bbf8399ff 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux.go @@ -2671,6 +2671,7 @@ const ( BPF_PROG_TYPE_LSM = 0x1d BPF_PROG_TYPE_SK_LOOKUP = 0x1e BPF_PROG_TYPE_SYSCALL = 0x1f + BPF_PROG_TYPE_NETFILTER = 0x20 BPF_CGROUP_INET_INGRESS = 0x0 BPF_CGROUP_INET_EGRESS = 0x1 BPF_CGROUP_INET_SOCK_CREATE = 0x2 @@ -2715,6 +2716,11 @@ const ( BPF_PERF_EVENT = 0x29 BPF_TRACE_KPROBE_MULTI = 0x2a BPF_LSM_CGROUP = 0x2b + BPF_STRUCT_OPS = 0x2c + BPF_NETFILTER = 0x2d + BPF_TCX_INGRESS = 0x2e + BPF_TCX_EGRESS = 0x2f + BPF_TRACE_UPROBE_MULTI = 0x30 BPF_LINK_TYPE_UNSPEC = 0x0 BPF_LINK_TYPE_RAW_TRACEPOINT = 0x1 BPF_LINK_TYPE_TRACING = 0x2 @@ -2725,6 +2731,18 @@ const ( BPF_LINK_TYPE_PERF_EVENT = 0x7 BPF_LINK_TYPE_KPROBE_MULTI = 0x8 BPF_LINK_TYPE_STRUCT_OPS = 0x9 + BPF_LINK_TYPE_NETFILTER = 0xa + BPF_LINK_TYPE_TCX = 0xb + BPF_LINK_TYPE_UPROBE_MULTI = 0xc + BPF_PERF_EVENT_UNSPEC = 0x0 + BPF_PERF_EVENT_UPROBE = 0x1 + BPF_PERF_EVENT_URETPROBE = 0x2 + BPF_PERF_EVENT_KPROBE = 0x3 + BPF_PERF_EVENT_KRETPROBE = 0x4 + BPF_PERF_EVENT_TRACEPOINT = 0x5 + BPF_PERF_EVENT_EVENT = 0x6 + BPF_F_KPROBE_MULTI_RETURN = 0x1 + BPF_F_UPROBE_MULTI_RETURN = 0x1 BPF_ANY = 0x0 BPF_NOEXIST = 0x1 BPF_EXIST = 0x2 @@ -2742,6 +2760,8 @@ const ( BPF_F_MMAPABLE = 0x400 BPF_F_PRESERVE_ELEMS = 0x800 BPF_F_INNER_MAP = 0x1000 + BPF_F_LINK = 0x2000 + BPF_F_PATH_FD = 0x4000 BPF_STATS_RUN_TIME = 0x0 BPF_STACK_BUILD_ID_EMPTY = 0x0 BPF_STACK_BUILD_ID_VALID = 0x1 @@ -2762,6 +2782,7 @@ const ( BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_DONT_FRAGMENT = 0x4 BPF_F_SEQ_NUMBER = 0x8 + BPF_F_NO_TUNNEL_KEY = 0x10 BPF_F_TUNINFO_FLAGS = 0x10 BPF_F_INDEX_MASK = 0xffffffff BPF_F_CURRENT_CPU = 0xffffffff @@ -2778,6 +2799,8 @@ const ( BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 BPF_F_ADJ_ROOM_NO_CSUM_RESET = 0x20 BPF_F_ADJ_ROOM_ENCAP_L2_ETH = 0x40 + BPF_F_ADJ_ROOM_DECAP_L3_IPV4 = 0x80 + BPF_F_ADJ_ROOM_DECAP_L3_IPV6 = 0x100 BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_F_SYSCTL_BASE_NAME = 0x1 @@ -2866,6 +2889,8 @@ const ( BPF_DEVCG_DEV_CHAR = 0x2 BPF_FIB_LOOKUP_DIRECT = 0x1 BPF_FIB_LOOKUP_OUTPUT = 0x2 + BPF_FIB_LOOKUP_SKIP_NEIGH = 0x4 + BPF_FIB_LOOKUP_TBID = 0x8 BPF_FIB_LKUP_RET_SUCCESS = 0x0 BPF_FIB_LKUP_RET_BLACKHOLE = 0x1 BPF_FIB_LKUP_RET_UNREACHABLE = 0x2 @@ -2901,6 +2926,7 @@ const ( BPF_CORE_ENUMVAL_EXISTS = 0xa BPF_CORE_ENUMVAL_VALUE = 0xb BPF_CORE_TYPE_MATCHES = 0xc + BPF_F_TIMER_ABS = 0x1 ) const ( @@ -2979,6 +3005,12 @@ type LoopInfo64 struct { Encrypt_key [32]uint8 Init [2]uint64 } +type LoopConfig struct { + Fd uint32 + Size uint32 + Info LoopInfo64 + _ [8]uint64 +} type TIPCSocketAddr struct { Ref uint32 diff --git a/vendor/golang.org/x/sys/windows/syscall_windows.go b/vendor/golang.org/x/sys/windows/syscall_windows.go index fb6cfd046..47dc57967 100644 --- a/vendor/golang.org/x/sys/windows/syscall_windows.go +++ b/vendor/golang.org/x/sys/windows/syscall_windows.go @@ -155,6 +155,8 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys GetModuleFileName(module Handle, filename *uint16, size uint32) (n uint32, err error) = kernel32.GetModuleFileNameW //sys GetModuleHandleEx(flags uint32, moduleName *uint16, module *Handle) (err error) = kernel32.GetModuleHandleExW //sys SetDefaultDllDirectories(directoryFlags uint32) (err error) +//sys AddDllDirectory(path *uint16) (cookie uintptr, err error) = kernel32.AddDllDirectory +//sys RemoveDllDirectory(cookie uintptr) (err error) = kernel32.RemoveDllDirectory //sys SetDllDirectory(path string) (err error) = kernel32.SetDllDirectoryW //sys GetVersion() (ver uint32, err error) //sys FormatMessage(flags uint32, msgsrc uintptr, msgid uint32, langid uint32, buf []uint16, args *byte) (n uint32, err error) = FormatMessageW diff --git a/vendor/golang.org/x/sys/windows/zsyscall_windows.go b/vendor/golang.org/x/sys/windows/zsyscall_windows.go index db6282e00..146a1f019 100644 --- a/vendor/golang.org/x/sys/windows/zsyscall_windows.go +++ b/vendor/golang.org/x/sys/windows/zsyscall_windows.go @@ -184,6 +184,7 @@ var ( procGetAdaptersInfo = modiphlpapi.NewProc("GetAdaptersInfo") procGetBestInterfaceEx = modiphlpapi.NewProc("GetBestInterfaceEx") procGetIfEntry = modiphlpapi.NewProc("GetIfEntry") + procAddDllDirectory = modkernel32.NewProc("AddDllDirectory") procAssignProcessToJobObject = modkernel32.NewProc("AssignProcessToJobObject") procCancelIo = modkernel32.NewProc("CancelIo") procCancelIoEx = modkernel32.NewProc("CancelIoEx") @@ -330,6 +331,7 @@ var ( procReadProcessMemory = modkernel32.NewProc("ReadProcessMemory") procReleaseMutex = modkernel32.NewProc("ReleaseMutex") procRemoveDirectoryW = modkernel32.NewProc("RemoveDirectoryW") + procRemoveDllDirectory = modkernel32.NewProc("RemoveDllDirectory") procResetEvent = modkernel32.NewProc("ResetEvent") procResizePseudoConsole = modkernel32.NewProc("ResizePseudoConsole") procResumeThread = modkernel32.NewProc("ResumeThread") @@ -1605,6 +1607,15 @@ func GetIfEntry(pIfRow *MibIfRow) (errcode error) { return } +func AddDllDirectory(path *uint16) (cookie uintptr, err error) { + r0, _, e1 := syscall.Syscall(procAddDllDirectory.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + cookie = uintptr(r0) + if cookie == 0 { + err = errnoErr(e1) + } + return +} + func AssignProcessToJobObject(job Handle, process Handle) (err error) { r1, _, e1 := syscall.Syscall(procAssignProcessToJobObject.Addr(), 2, uintptr(job), uintptr(process), 0) if r1 == 0 { @@ -2879,6 +2890,14 @@ func RemoveDirectory(path *uint16) (err error) { return } +func RemoveDllDirectory(cookie uintptr) (err error) { + r1, _, e1 := syscall.Syscall(procRemoveDllDirectory.Addr(), 1, uintptr(cookie), 0, 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + func ResetEvent(event Handle) (err error) { r1, _, e1 := syscall.Syscall(procResetEvent.Addr(), 1, uintptr(event), 0, 0) if r1 == 0 { diff --git a/vendor/golang.org/x/tools/LICENSE b/vendor/golang.org/x/tools/LICENSE new file mode 100644 index 000000000..6a66aea5e --- /dev/null +++ b/vendor/golang.org/x/tools/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/tools/PATENTS b/vendor/golang.org/x/tools/PATENTS new file mode 100644 index 000000000..733099041 --- /dev/null +++ b/vendor/golang.org/x/tools/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/tools/cmd/stringer/stringer.go b/vendor/golang.org/x/tools/cmd/stringer/stringer.go new file mode 100644 index 000000000..998d1a51b --- /dev/null +++ b/vendor/golang.org/x/tools/cmd/stringer/stringer.go @@ -0,0 +1,657 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Stringer is a tool to automate the creation of methods that satisfy the fmt.Stringer +// interface. Given the name of a (signed or unsigned) integer type T that has constants +// defined, stringer will create a new self-contained Go source file implementing +// +// func (t T) String() string +// +// The file is created in the same package and directory as the package that defines T. +// It has helpful defaults designed for use with go generate. +// +// Stringer works best with constants that are consecutive values such as created using iota, +// but creates good code regardless. In the future it might also provide custom support for +// constant sets that are bit patterns. +// +// For example, given this snippet, +// +// package painkiller +// +// type Pill int +// +// const ( +// Placebo Pill = iota +// Aspirin +// Ibuprofen +// Paracetamol +// Acetaminophen = Paracetamol +// ) +// +// running this command +// +// stringer -type=Pill +// +// in the same directory will create the file pill_string.go, in package painkiller, +// containing a definition of +// +// func (Pill) String() string +// +// That method will translate the value of a Pill constant to the string representation +// of the respective constant name, so that the call fmt.Print(painkiller.Aspirin) will +// print the string "Aspirin". +// +// Typically this process would be run using go generate, like this: +// +// //go:generate stringer -type=Pill +// +// If multiple constants have the same value, the lexically first matching name will +// be used (in the example, Acetaminophen will print as "Paracetamol"). +// +// With no arguments, it processes the package in the current directory. +// Otherwise, the arguments must name a single directory holding a Go package +// or a set of Go source files that represent a single Go package. +// +// The -type flag accepts a comma-separated list of types so a single run can +// generate methods for multiple types. The default output file is t_string.go, +// where t is the lower-cased name of the first type listed. It can be overridden +// with the -output flag. +// +// The -linecomment flag tells stringer to generate the text of any line comment, trimmed +// of leading spaces, instead of the constant name. For instance, if the constants above had a +// Pill prefix, one could write +// +// PillAspirin // Aspirin +// +// to suppress it in the output. +package main // import "golang.org/x/tools/cmd/stringer" + +import ( + "bytes" + "flag" + "fmt" + "go/ast" + "go/constant" + "go/format" + "go/token" + "go/types" + "log" + "os" + "path/filepath" + "sort" + "strings" + + "golang.org/x/tools/go/packages" +) + +var ( + typeNames = flag.String("type", "", "comma-separated list of type names; must be set") + output = flag.String("output", "", "output file name; default srcdir/_string.go") + trimprefix = flag.String("trimprefix", "", "trim the `prefix` from the generated constant names") + linecomment = flag.Bool("linecomment", false, "use line comment text as printed text when present") + buildTags = flag.String("tags", "", "comma-separated list of build tags to apply") +) + +// Usage is a replacement usage function for the flags package. +func Usage() { + fmt.Fprintf(os.Stderr, "Usage of stringer:\n") + fmt.Fprintf(os.Stderr, "\tstringer [flags] -type T [directory]\n") + fmt.Fprintf(os.Stderr, "\tstringer [flags] -type T files... # Must be a single package\n") + fmt.Fprintf(os.Stderr, "For more information, see:\n") + fmt.Fprintf(os.Stderr, "\thttps://pkg.go.dev/golang.org/x/tools/cmd/stringer\n") + fmt.Fprintf(os.Stderr, "Flags:\n") + flag.PrintDefaults() +} + +func main() { + log.SetFlags(0) + log.SetPrefix("stringer: ") + flag.Usage = Usage + flag.Parse() + if len(*typeNames) == 0 { + flag.Usage() + os.Exit(2) + } + types := strings.Split(*typeNames, ",") + var tags []string + if len(*buildTags) > 0 { + tags = strings.Split(*buildTags, ",") + } + + // We accept either one directory or a list of files. Which do we have? + args := flag.Args() + if len(args) == 0 { + // Default: process whole package in current directory. + args = []string{"."} + } + + // Parse the package once. + var dir string + g := Generator{ + trimPrefix: *trimprefix, + lineComment: *linecomment, + } + // TODO(suzmue): accept other patterns for packages (directories, list of files, import paths, etc). + if len(args) == 1 && isDirectory(args[0]) { + dir = args[0] + } else { + if len(tags) != 0 { + log.Fatal("-tags option applies only to directories, not when files are specified") + } + dir = filepath.Dir(args[0]) + } + + g.parsePackage(args, tags) + + // Print the header and package clause. + g.Printf("// Code generated by \"stringer %s\"; DO NOT EDIT.\n", strings.Join(os.Args[1:], " ")) + g.Printf("\n") + g.Printf("package %s", g.pkg.name) + g.Printf("\n") + g.Printf("import \"strconv\"\n") // Used by all methods. + + // Run generate for each type. + for _, typeName := range types { + g.generate(typeName) + } + + // Format the output. + src := g.format() + + // Write to file. + outputName := *output + if outputName == "" { + baseName := fmt.Sprintf("%s_string.go", types[0]) + outputName = filepath.Join(dir, strings.ToLower(baseName)) + } + err := os.WriteFile(outputName, src, 0644) + if err != nil { + log.Fatalf("writing output: %s", err) + } +} + +// isDirectory reports whether the named file is a directory. +func isDirectory(name string) bool { + info, err := os.Stat(name) + if err != nil { + log.Fatal(err) + } + return info.IsDir() +} + +// Generator holds the state of the analysis. Primarily used to buffer +// the output for format.Source. +type Generator struct { + buf bytes.Buffer // Accumulated output. + pkg *Package // Package we are scanning. + + trimPrefix string + lineComment bool +} + +func (g *Generator) Printf(format string, args ...interface{}) { + fmt.Fprintf(&g.buf, format, args...) +} + +// File holds a single parsed file and associated data. +type File struct { + pkg *Package // Package to which this file belongs. + file *ast.File // Parsed AST. + // These fields are reset for each type being generated. + typeName string // Name of the constant type. + values []Value // Accumulator for constant values of that type. + + trimPrefix string + lineComment bool +} + +type Package struct { + name string + defs map[*ast.Ident]types.Object + files []*File +} + +// parsePackage analyzes the single package constructed from the patterns and tags. +// parsePackage exits if there is an error. +func (g *Generator) parsePackage(patterns []string, tags []string) { + cfg := &packages.Config{ + Mode: packages.NeedName | packages.NeedTypes | packages.NeedTypesInfo | packages.NeedSyntax, + // TODO: Need to think about constants in test files. Maybe write type_string_test.go + // in a separate pass? For later. + Tests: false, + BuildFlags: []string{fmt.Sprintf("-tags=%s", strings.Join(tags, " "))}, + } + pkgs, err := packages.Load(cfg, patterns...) + if err != nil { + log.Fatal(err) + } + if len(pkgs) != 1 { + log.Fatalf("error: %d packages found", len(pkgs)) + } + g.addPackage(pkgs[0]) +} + +// addPackage adds a type checked Package and its syntax files to the generator. +func (g *Generator) addPackage(pkg *packages.Package) { + g.pkg = &Package{ + name: pkg.Name, + defs: pkg.TypesInfo.Defs, + files: make([]*File, len(pkg.Syntax)), + } + + for i, file := range pkg.Syntax { + g.pkg.files[i] = &File{ + file: file, + pkg: g.pkg, + trimPrefix: g.trimPrefix, + lineComment: g.lineComment, + } + } +} + +// generate produces the String method for the named type. +func (g *Generator) generate(typeName string) { + values := make([]Value, 0, 100) + for _, file := range g.pkg.files { + // Set the state for this run of the walker. + file.typeName = typeName + file.values = nil + if file.file != nil { + ast.Inspect(file.file, file.genDecl) + values = append(values, file.values...) + } + } + + if len(values) == 0 { + log.Fatalf("no values defined for type %s", typeName) + } + // Generate code that will fail if the constants change value. + g.Printf("func _() {\n") + g.Printf("\t// An \"invalid array index\" compiler error signifies that the constant values have changed.\n") + g.Printf("\t// Re-run the stringer command to generate them again.\n") + g.Printf("\tvar x [1]struct{}\n") + for _, v := range values { + g.Printf("\t_ = x[%s - %s]\n", v.originalName, v.str) + } + g.Printf("}\n") + runs := splitIntoRuns(values) + // The decision of which pattern to use depends on the number of + // runs in the numbers. If there's only one, it's easy. For more than + // one, there's a tradeoff between complexity and size of the data + // and code vs. the simplicity of a map. A map takes more space, + // but so does the code. The decision here (crossover at 10) is + // arbitrary, but considers that for large numbers of runs the cost + // of the linear scan in the switch might become important, and + // rather than use yet another algorithm such as binary search, + // we punt and use a map. In any case, the likelihood of a map + // being necessary for any realistic example other than bitmasks + // is very low. And bitmasks probably deserve their own analysis, + // to be done some other day. + switch { + case len(runs) == 1: + g.buildOneRun(runs, typeName) + case len(runs) <= 10: + g.buildMultipleRuns(runs, typeName) + default: + g.buildMap(runs, typeName) + } +} + +// splitIntoRuns breaks the values into runs of contiguous sequences. +// For example, given 1,2,3,5,6,7 it returns {1,2,3},{5,6,7}. +// The input slice is known to be non-empty. +func splitIntoRuns(values []Value) [][]Value { + // We use stable sort so the lexically first name is chosen for equal elements. + sort.Stable(byValue(values)) + // Remove duplicates. Stable sort has put the one we want to print first, + // so use that one. The String method won't care about which named constant + // was the argument, so the first name for the given value is the only one to keep. + // We need to do this because identical values would cause the switch or map + // to fail to compile. + j := 1 + for i := 1; i < len(values); i++ { + if values[i].value != values[i-1].value { + values[j] = values[i] + j++ + } + } + values = values[:j] + runs := make([][]Value, 0, 10) + for len(values) > 0 { + // One contiguous sequence per outer loop. + i := 1 + for i < len(values) && values[i].value == values[i-1].value+1 { + i++ + } + runs = append(runs, values[:i]) + values = values[i:] + } + return runs +} + +// format returns the gofmt-ed contents of the Generator's buffer. +func (g *Generator) format() []byte { + src, err := format.Source(g.buf.Bytes()) + if err != nil { + // Should never happen, but can arise when developing this code. + // The user can compile the output to see the error. + log.Printf("warning: internal error: invalid Go generated: %s", err) + log.Printf("warning: compile the package to analyze the error") + return g.buf.Bytes() + } + return src +} + +// Value represents a declared constant. +type Value struct { + originalName string // The name of the constant. + name string // The name with trimmed prefix. + // The value is stored as a bit pattern alone. The boolean tells us + // whether to interpret it as an int64 or a uint64; the only place + // this matters is when sorting. + // Much of the time the str field is all we need; it is printed + // by Value.String. + value uint64 // Will be converted to int64 when needed. + signed bool // Whether the constant is a signed type. + str string // The string representation given by the "go/constant" package. +} + +func (v *Value) String() string { + return v.str +} + +// byValue lets us sort the constants into increasing order. +// We take care in the Less method to sort in signed or unsigned order, +// as appropriate. +type byValue []Value + +func (b byValue) Len() int { return len(b) } +func (b byValue) Swap(i, j int) { b[i], b[j] = b[j], b[i] } +func (b byValue) Less(i, j int) bool { + if b[i].signed { + return int64(b[i].value) < int64(b[j].value) + } + return b[i].value < b[j].value +} + +// genDecl processes one declaration clause. +func (f *File) genDecl(node ast.Node) bool { + decl, ok := node.(*ast.GenDecl) + if !ok || decl.Tok != token.CONST { + // We only care about const declarations. + return true + } + // The name of the type of the constants we are declaring. + // Can change if this is a multi-element declaration. + typ := "" + // Loop over the elements of the declaration. Each element is a ValueSpec: + // a list of names possibly followed by a type, possibly followed by values. + // If the type and value are both missing, we carry down the type (and value, + // but the "go/types" package takes care of that). + for _, spec := range decl.Specs { + vspec := spec.(*ast.ValueSpec) // Guaranteed to succeed as this is CONST. + if vspec.Type == nil && len(vspec.Values) > 0 { + // "X = 1". With no type but a value. If the constant is untyped, + // skip this vspec and reset the remembered type. + typ = "" + + // If this is a simple type conversion, remember the type. + // We don't mind if this is actually a call; a qualified call won't + // be matched (that will be SelectorExpr, not Ident), and only unusual + // situations will result in a function call that appears to be + // a type conversion. + ce, ok := vspec.Values[0].(*ast.CallExpr) + if !ok { + continue + } + id, ok := ce.Fun.(*ast.Ident) + if !ok { + continue + } + typ = id.Name + } + if vspec.Type != nil { + // "X T". We have a type. Remember it. + ident, ok := vspec.Type.(*ast.Ident) + if !ok { + continue + } + typ = ident.Name + } + if typ != f.typeName { + // This is not the type we're looking for. + continue + } + // We now have a list of names (from one line of source code) all being + // declared with the desired type. + // Grab their names and actual values and store them in f.values. + for _, name := range vspec.Names { + if name.Name == "_" { + continue + } + // This dance lets the type checker find the values for us. It's a + // bit tricky: look up the object declared by the name, find its + // types.Const, and extract its value. + obj, ok := f.pkg.defs[name] + if !ok { + log.Fatalf("no value for constant %s", name) + } + info := obj.Type().Underlying().(*types.Basic).Info() + if info&types.IsInteger == 0 { + log.Fatalf("can't handle non-integer constant type %s", typ) + } + value := obj.(*types.Const).Val() // Guaranteed to succeed as this is CONST. + if value.Kind() != constant.Int { + log.Fatalf("can't happen: constant is not an integer %s", name) + } + i64, isInt := constant.Int64Val(value) + u64, isUint := constant.Uint64Val(value) + if !isInt && !isUint { + log.Fatalf("internal error: value of %s is not an integer: %s", name, value.String()) + } + if !isInt { + u64 = uint64(i64) + } + v := Value{ + originalName: name.Name, + value: u64, + signed: info&types.IsUnsigned == 0, + str: value.String(), + } + if c := vspec.Comment; f.lineComment && c != nil && len(c.List) == 1 { + v.name = strings.TrimSpace(c.Text()) + } else { + v.name = strings.TrimPrefix(v.originalName, f.trimPrefix) + } + f.values = append(f.values, v) + } + } + return false +} + +// Helpers + +// usize returns the number of bits of the smallest unsigned integer +// type that will hold n. Used to create the smallest possible slice of +// integers to use as indexes into the concatenated strings. +func usize(n int) int { + switch { + case n < 1<<8: + return 8 + case n < 1<<16: + return 16 + default: + // 2^32 is enough constants for anyone. + return 32 + } +} + +// declareIndexAndNameVars declares the index slices and concatenated names +// strings representing the runs of values. +func (g *Generator) declareIndexAndNameVars(runs [][]Value, typeName string) { + var indexes, names []string + for i, run := range runs { + index, name := g.createIndexAndNameDecl(run, typeName, fmt.Sprintf("_%d", i)) + if len(run) != 1 { + indexes = append(indexes, index) + } + names = append(names, name) + } + g.Printf("const (\n") + for _, name := range names { + g.Printf("\t%s\n", name) + } + g.Printf(")\n\n") + + if len(indexes) > 0 { + g.Printf("var (") + for _, index := range indexes { + g.Printf("\t%s\n", index) + } + g.Printf(")\n\n") + } +} + +// declareIndexAndNameVar is the single-run version of declareIndexAndNameVars +func (g *Generator) declareIndexAndNameVar(run []Value, typeName string) { + index, name := g.createIndexAndNameDecl(run, typeName, "") + g.Printf("const %s\n", name) + g.Printf("var %s\n", index) +} + +// createIndexAndNameDecl returns the pair of declarations for the run. The caller will add "const" and "var". +func (g *Generator) createIndexAndNameDecl(run []Value, typeName string, suffix string) (string, string) { + b := new(bytes.Buffer) + indexes := make([]int, len(run)) + for i := range run { + b.WriteString(run[i].name) + indexes[i] = b.Len() + } + nameConst := fmt.Sprintf("_%s_name%s = %q", typeName, suffix, b.String()) + nameLen := b.Len() + b.Reset() + fmt.Fprintf(b, "_%s_index%s = [...]uint%d{0, ", typeName, suffix, usize(nameLen)) + for i, v := range indexes { + if i > 0 { + fmt.Fprintf(b, ", ") + } + fmt.Fprintf(b, "%d", v) + } + fmt.Fprintf(b, "}") + return b.String(), nameConst +} + +// declareNameVars declares the concatenated names string representing all the values in the runs. +func (g *Generator) declareNameVars(runs [][]Value, typeName string, suffix string) { + g.Printf("const _%s_name%s = \"", typeName, suffix) + for _, run := range runs { + for i := range run { + g.Printf("%s", run[i].name) + } + } + g.Printf("\"\n") +} + +// buildOneRun generates the variables and String method for a single run of contiguous values. +func (g *Generator) buildOneRun(runs [][]Value, typeName string) { + values := runs[0] + g.Printf("\n") + g.declareIndexAndNameVar(values, typeName) + // The generated code is simple enough to write as a Printf format. + lessThanZero := "" + if values[0].signed { + lessThanZero = "i < 0 || " + } + if values[0].value == 0 { // Signed or unsigned, 0 is still 0. + g.Printf(stringOneRun, typeName, usize(len(values)), lessThanZero) + } else { + g.Printf(stringOneRunWithOffset, typeName, values[0].String(), usize(len(values)), lessThanZero) + } +} + +// Arguments to format are: +// +// [1]: type name +// [2]: size of index element (8 for uint8 etc.) +// [3]: less than zero check (for signed types) +const stringOneRun = `func (i %[1]s) String() string { + if %[3]si >= %[1]s(len(_%[1]s_index)-1) { + return "%[1]s(" + strconv.FormatInt(int64(i), 10) + ")" + } + return _%[1]s_name[_%[1]s_index[i]:_%[1]s_index[i+1]] +} +` + +// Arguments to format are: +// [1]: type name +// [2]: lowest defined value for type, as a string +// [3]: size of index element (8 for uint8 etc.) +// [4]: less than zero check (for signed types) +/* + */ +const stringOneRunWithOffset = `func (i %[1]s) String() string { + i -= %[2]s + if %[4]si >= %[1]s(len(_%[1]s_index)-1) { + return "%[1]s(" + strconv.FormatInt(int64(i + %[2]s), 10) + ")" + } + return _%[1]s_name[_%[1]s_index[i] : _%[1]s_index[i+1]] +} +` + +// buildMultipleRuns generates the variables and String method for multiple runs of contiguous values. +// For this pattern, a single Printf format won't do. +func (g *Generator) buildMultipleRuns(runs [][]Value, typeName string) { + g.Printf("\n") + g.declareIndexAndNameVars(runs, typeName) + g.Printf("func (i %s) String() string {\n", typeName) + g.Printf("\tswitch {\n") + for i, values := range runs { + if len(values) == 1 { + g.Printf("\tcase i == %s:\n", &values[0]) + g.Printf("\t\treturn _%s_name_%d\n", typeName, i) + continue + } + if values[0].value == 0 && !values[0].signed { + // For an unsigned lower bound of 0, "0 <= i" would be redundant. + g.Printf("\tcase i <= %s:\n", &values[len(values)-1]) + } else { + g.Printf("\tcase %s <= i && i <= %s:\n", &values[0], &values[len(values)-1]) + } + if values[0].value != 0 { + g.Printf("\t\ti -= %s\n", &values[0]) + } + g.Printf("\t\treturn _%s_name_%d[_%s_index_%d[i]:_%s_index_%d[i+1]]\n", + typeName, i, typeName, i, typeName, i) + } + g.Printf("\tdefault:\n") + g.Printf("\t\treturn \"%s(\" + strconv.FormatInt(int64(i), 10) + \")\"\n", typeName) + g.Printf("\t}\n") + g.Printf("}\n") +} + +// buildMap handles the case where the space is so sparse a map is a reasonable fallback. +// It's a rare situation but has simple code. +func (g *Generator) buildMap(runs [][]Value, typeName string) { + g.Printf("\n") + g.declareNameVars(runs, typeName, "") + g.Printf("\nvar _%s_map = map[%s]string{\n", typeName, typeName) + n := 0 + for _, values := range runs { + for _, value := range values { + g.Printf("\t%s: _%s_name[%d:%d],\n", &value, typeName, n, n+len(value.name)) + n += len(value.name) + } + } + g.Printf("}\n\n") + g.Printf(stringMap, typeName) +} + +// Argument to format is the type name. +const stringMap = `func (i %[1]s) String() string { + if str, ok := _%[1]s_map[i]; ok { + return str + } + return "%[1]s(" + strconv.FormatInt(int64(i), 10) + ")" +} +` diff --git a/vendor/golang.org/x/tools/go/gcexportdata/gcexportdata.go b/vendor/golang.org/x/tools/go/gcexportdata/gcexportdata.go new file mode 100644 index 000000000..03543bd4b --- /dev/null +++ b/vendor/golang.org/x/tools/go/gcexportdata/gcexportdata.go @@ -0,0 +1,186 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package gcexportdata provides functions for locating, reading, and +// writing export data files containing type information produced by the +// gc compiler. This package supports go1.7 export data format and all +// later versions. +// +// Although it might seem convenient for this package to live alongside +// go/types in the standard library, this would cause version skew +// problems for developer tools that use it, since they must be able to +// consume the outputs of the gc compiler both before and after a Go +// update such as from Go 1.7 to Go 1.8. Because this package lives in +// golang.org/x/tools, sites can update their version of this repo some +// time before the Go 1.8 release and rebuild and redeploy their +// developer tools, which will then be able to consume both Go 1.7 and +// Go 1.8 export data files, so they will work before and after the +// Go update. (See discussion at https://golang.org/issue/15651.) +package gcexportdata // import "golang.org/x/tools/go/gcexportdata" + +import ( + "bufio" + "bytes" + "encoding/json" + "fmt" + "go/token" + "go/types" + "io" + "os/exec" + + "golang.org/x/tools/internal/gcimporter" +) + +// Find returns the name of an object (.o) or archive (.a) file +// containing type information for the specified import path, +// using the go command. +// If no file was found, an empty filename is returned. +// +// A relative srcDir is interpreted relative to the current working directory. +// +// Find also returns the package's resolved (canonical) import path, +// reflecting the effects of srcDir and vendoring on importPath. +// +// Deprecated: Use the higher-level API in golang.org/x/tools/go/packages, +// which is more efficient. +func Find(importPath, srcDir string) (filename, path string) { + cmd := exec.Command("go", "list", "-json", "-export", "--", importPath) + cmd.Dir = srcDir + out, err := cmd.CombinedOutput() + if err != nil { + return "", "" + } + var data struct { + ImportPath string + Export string + } + json.Unmarshal(out, &data) + return data.Export, data.ImportPath +} + +// NewReader returns a reader for the export data section of an object +// (.o) or archive (.a) file read from r. The new reader may provide +// additional trailing data beyond the end of the export data. +func NewReader(r io.Reader) (io.Reader, error) { + buf := bufio.NewReader(r) + _, size, err := gcimporter.FindExportData(buf) + if err != nil { + return nil, err + } + + if size >= 0 { + // We were given an archive and found the __.PKGDEF in it. + // This tells us the size of the export data, and we don't + // need to return the entire file. + return &io.LimitedReader{ + R: buf, + N: size, + }, nil + } else { + // We were given an object file. As such, we don't know how large + // the export data is and must return the entire file. + return buf, nil + } +} + +// readAll works the same way as io.ReadAll, but avoids allocations and copies +// by preallocating a byte slice of the necessary size if the size is known up +// front. This is always possible when the input is an archive. In that case, +// NewReader will return the known size using an io.LimitedReader. +func readAll(r io.Reader) ([]byte, error) { + if lr, ok := r.(*io.LimitedReader); ok { + data := make([]byte, lr.N) + _, err := io.ReadFull(lr, data) + return data, err + } + return io.ReadAll(r) +} + +// Read reads export data from in, decodes it, and returns type +// information for the package. +// +// The package path (effectively its linker symbol prefix) is +// specified by path, since unlike the package name, this information +// may not be recorded in the export data. +// +// File position information is added to fset. +// +// Read may inspect and add to the imports map to ensure that references +// within the export data to other packages are consistent. The caller +// must ensure that imports[path] does not exist, or exists but is +// incomplete (see types.Package.Complete), and Read inserts the +// resulting package into this map entry. +// +// On return, the state of the reader is undefined. +func Read(in io.Reader, fset *token.FileSet, imports map[string]*types.Package, path string) (*types.Package, error) { + data, err := readAll(in) + if err != nil { + return nil, fmt.Errorf("reading export data for %q: %v", path, err) + } + + if bytes.HasPrefix(data, []byte("!")) { + return nil, fmt.Errorf("can't read export data for %q directly from an archive file (call gcexportdata.NewReader first to extract export data)", path) + } + + // The indexed export format starts with an 'i'; the older + // binary export format starts with a 'c', 'd', or 'v' + // (from "version"). Select appropriate importer. + if len(data) > 0 { + switch data[0] { + case 'v', 'c', 'd': // binary, till go1.10 + return nil, fmt.Errorf("binary (%c) import format is no longer supported", data[0]) + + case 'i': // indexed, till go1.19 + _, pkg, err := gcimporter.IImportData(fset, imports, data[1:], path) + return pkg, err + + case 'u': // unified, from go1.20 + _, pkg, err := gcimporter.UImportData(fset, imports, data[1:], path) + return pkg, err + + default: + l := len(data) + if l > 10 { + l = 10 + } + return nil, fmt.Errorf("unexpected export data with prefix %q for path %s", string(data[:l]), path) + } + } + return nil, fmt.Errorf("empty export data for %s", path) +} + +// Write writes encoded type information for the specified package to out. +// The FileSet provides file position information for named objects. +func Write(out io.Writer, fset *token.FileSet, pkg *types.Package) error { + if _, err := io.WriteString(out, "i"); err != nil { + return err + } + return gcimporter.IExportData(out, fset, pkg) +} + +// ReadBundle reads an export bundle from in, decodes it, and returns type +// information for the packages. +// File position information is added to fset. +// +// ReadBundle may inspect and add to the imports map to ensure that references +// within the export bundle to other packages are consistent. +// +// On return, the state of the reader is undefined. +// +// Experimental: This API is experimental and may change in the future. +func ReadBundle(in io.Reader, fset *token.FileSet, imports map[string]*types.Package) ([]*types.Package, error) { + data, err := readAll(in) + if err != nil { + return nil, fmt.Errorf("reading export bundle: %v", err) + } + return gcimporter.IImportBundle(fset, imports, data) +} + +// WriteBundle writes encoded type information for the specified packages to out. +// The FileSet provides file position information for named objects. +// +// Experimental: This API is experimental and may change in the future. +func WriteBundle(out io.Writer, fset *token.FileSet, pkgs []*types.Package) error { + return gcimporter.IExportBundle(out, fset, pkgs) +} diff --git a/vendor/golang.org/x/tools/go/gcexportdata/importer.go b/vendor/golang.org/x/tools/go/gcexportdata/importer.go new file mode 100644 index 000000000..37a7247e2 --- /dev/null +++ b/vendor/golang.org/x/tools/go/gcexportdata/importer.go @@ -0,0 +1,75 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package gcexportdata + +import ( + "fmt" + "go/token" + "go/types" + "os" +) + +// NewImporter returns a new instance of the types.Importer interface +// that reads type information from export data files written by gc. +// The Importer also satisfies types.ImporterFrom. +// +// Export data files are located using "go build" workspace conventions +// and the build.Default context. +// +// Use this importer instead of go/importer.For("gc", ...) to avoid the +// version-skew problems described in the documentation of this package, +// or to control the FileSet or access the imports map populated during +// package loading. +// +// Deprecated: Use the higher-level API in golang.org/x/tools/go/packages, +// which is more efficient. +func NewImporter(fset *token.FileSet, imports map[string]*types.Package) types.ImporterFrom { + return importer{fset, imports} +} + +type importer struct { + fset *token.FileSet + imports map[string]*types.Package +} + +func (imp importer) Import(importPath string) (*types.Package, error) { + return imp.ImportFrom(importPath, "", 0) +} + +func (imp importer) ImportFrom(importPath, srcDir string, mode types.ImportMode) (_ *types.Package, err error) { + filename, path := Find(importPath, srcDir) + if filename == "" { + if importPath == "unsafe" { + // Even for unsafe, call Find first in case + // the package was vendored. + return types.Unsafe, nil + } + return nil, fmt.Errorf("can't find import: %s", importPath) + } + + if pkg, ok := imp.imports[path]; ok && pkg.Complete() { + return pkg, nil // cache hit + } + + // open file + f, err := os.Open(filename) + if err != nil { + return nil, err + } + defer func() { + f.Close() + if err != nil { + // add file name to error + err = fmt.Errorf("reading export data: %s: %v", filename, err) + } + }() + + r, err := NewReader(f) + if err != nil { + return nil, err + } + + return Read(r, imp.fset, imp.imports, path) +} diff --git a/vendor/golang.org/x/tools/go/internal/packagesdriver/sizes.go b/vendor/golang.org/x/tools/go/internal/packagesdriver/sizes.go new file mode 100644 index 000000000..18a002f82 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/packagesdriver/sizes.go @@ -0,0 +1,49 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package packagesdriver fetches type sizes for go/packages and go/analysis. +package packagesdriver + +import ( + "context" + "fmt" + "go/types" + "strings" + + "golang.org/x/tools/internal/gocommand" +) + +var debug = false + +func GetSizesGolist(ctx context.Context, inv gocommand.Invocation, gocmdRunner *gocommand.Runner) (types.Sizes, error) { + inv.Verb = "list" + inv.Args = []string{"-f", "{{context.GOARCH}} {{context.Compiler}}", "--", "unsafe"} + stdout, stderr, friendlyErr, rawErr := gocmdRunner.RunRaw(ctx, inv) + var goarch, compiler string + if rawErr != nil { + if rawErrMsg := rawErr.Error(); strings.Contains(rawErrMsg, "cannot find main module") || strings.Contains(rawErrMsg, "go.mod file not found") { + // User's running outside of a module. All bets are off. Get GOARCH and guess compiler is gc. + // TODO(matloob): Is this a problem in practice? + inv.Verb = "env" + inv.Args = []string{"GOARCH"} + envout, enverr := gocmdRunner.Run(ctx, inv) + if enverr != nil { + return nil, enverr + } + goarch = strings.TrimSpace(envout.String()) + compiler = "gc" + } else { + return nil, friendlyErr + } + } else { + fields := strings.Fields(stdout.String()) + if len(fields) < 2 { + return nil, fmt.Errorf("could not parse GOARCH and Go compiler in format \" \":\nstdout: <<%s>>\nstderr: <<%s>>", + stdout.String(), stderr.String()) + } + goarch = fields[0] + compiler = fields[1] + } + return types.SizesFor(compiler, goarch), nil +} diff --git a/vendor/golang.org/x/tools/go/packages/doc.go b/vendor/golang.org/x/tools/go/packages/doc.go new file mode 100644 index 000000000..da4ab89fe --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/doc.go @@ -0,0 +1,220 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +/* +Package packages loads Go packages for inspection and analysis. + +The Load function takes as input a list of patterns and return a list of Package +structs describing individual packages matched by those patterns. +The LoadMode controls the amount of detail in the loaded packages. + +Load passes most patterns directly to the underlying build tool, +but all patterns with the prefix "query=", where query is a +non-empty string of letters from [a-z], are reserved and may be +interpreted as query operators. + +Two query operators are currently supported: "file" and "pattern". + +The query "file=path/to/file.go" matches the package or packages enclosing +the Go source file path/to/file.go. For example "file=~/go/src/fmt/print.go" +might return the packages "fmt" and "fmt [fmt.test]". + +The query "pattern=string" causes "string" to be passed directly to +the underlying build tool. In most cases this is unnecessary, +but an application can use Load("pattern=" + x) as an escaping mechanism +to ensure that x is not interpreted as a query operator if it contains '='. + +All other query operators are reserved for future use and currently +cause Load to report an error. + +The Package struct provides basic information about the package, including + + - ID, a unique identifier for the package in the returned set; + - GoFiles, the names of the package's Go source files; + - Imports, a map from source import strings to the Packages they name; + - Types, the type information for the package's exported symbols; + - Syntax, the parsed syntax trees for the package's source code; and + - TypeInfo, the result of a complete type-check of the package syntax trees. + +(See the documentation for type Package for the complete list of fields +and more detailed descriptions.) + +For example, + + Load(nil, "bytes", "unicode...") + +returns four Package structs describing the standard library packages +bytes, unicode, unicode/utf16, and unicode/utf8. Note that one pattern +can match multiple packages and that a package might be matched by +multiple patterns: in general it is not possible to determine which +packages correspond to which patterns. + +Note that the list returned by Load contains only the packages matched +by the patterns. Their dependencies can be found by walking the import +graph using the Imports fields. + +The Load function can be configured by passing a pointer to a Config as +the first argument. A nil Config is equivalent to the zero Config, which +causes Load to run in LoadFiles mode, collecting minimal information. +See the documentation for type Config for details. + +As noted earlier, the Config.Mode controls the amount of detail +reported about the loaded packages. See the documentation for type LoadMode +for details. + +Most tools should pass their command-line arguments (after any flags) +uninterpreted to the loader, so that the loader can interpret them +according to the conventions of the underlying build system. +See the Example function for typical usage. +*/ +package packages // import "golang.org/x/tools/go/packages" + +/* + +Motivation and design considerations + +The new package's design solves problems addressed by two existing +packages: go/build, which locates and describes packages, and +golang.org/x/tools/go/loader, which loads, parses and type-checks them. +The go/build.Package structure encodes too much of the 'go build' way +of organizing projects, leaving us in need of a data type that describes a +package of Go source code independent of the underlying build system. +We wanted something that works equally well with go build and vgo, and +also other build systems such as Bazel and Blaze, making it possible to +construct analysis tools that work in all these environments. +Tools such as errcheck and staticcheck were essentially unavailable to +the Go community at Google, and some of Google's internal tools for Go +are unavailable externally. +This new package provides a uniform way to obtain package metadata by +querying each of these build systems, optionally supporting their +preferred command-line notations for packages, so that tools integrate +neatly with users' build environments. The Metadata query function +executes an external query tool appropriate to the current workspace. + +Loading packages always returns the complete import graph "all the way down", +even if all you want is information about a single package, because the query +mechanisms of all the build systems we currently support ({go,vgo} list, and +blaze/bazel aspect-based query) cannot provide detailed information +about one package without visiting all its dependencies too, so there is +no additional asymptotic cost to providing transitive information. +(This property might not be true of a hypothetical 5th build system.) + +In calls to TypeCheck, all initial packages, and any package that +transitively depends on one of them, must be loaded from source. +Consider A->B->C->D->E: if A,C are initial, A,B,C must be loaded from +source; D may be loaded from export data, and E may not be loaded at all +(though it's possible that D's export data mentions it, so a +types.Package may be created for it and exposed.) + +The old loader had a feature to suppress type-checking of function +bodies on a per-package basis, primarily intended to reduce the work of +obtaining type information for imported packages. Now that imports are +satisfied by export data, the optimization no longer seems necessary. + +Despite some early attempts, the old loader did not exploit export data, +instead always using the equivalent of WholeProgram mode. This was due +to the complexity of mixing source and export data packages (now +resolved by the upward traversal mentioned above), and because export data +files were nearly always missing or stale. Now that 'go build' supports +caching, all the underlying build systems can guarantee to produce +export data in a reasonable (amortized) time. + +Test "main" packages synthesized by the build system are now reported as +first-class packages, avoiding the need for clients (such as go/ssa) to +reinvent this generation logic. + +One way in which go/packages is simpler than the old loader is in its +treatment of in-package tests. In-package tests are packages that +consist of all the files of the library under test, plus the test files. +The old loader constructed in-package tests by a two-phase process of +mutation called "augmentation": first it would construct and type check +all the ordinary library packages and type-check the packages that +depend on them; then it would add more (test) files to the package and +type-check again. This two-phase approach had four major problems: +1) in processing the tests, the loader modified the library package, + leaving no way for a client application to see both the test + package and the library package; one would mutate into the other. +2) because test files can declare additional methods on types defined in + the library portion of the package, the dispatch of method calls in + the library portion was affected by the presence of the test files. + This should have been a clue that the packages were logically + different. +3) this model of "augmentation" assumed at most one in-package test + per library package, which is true of projects using 'go build', + but not other build systems. +4) because of the two-phase nature of test processing, all packages that + import the library package had to be processed before augmentation, + forcing a "one-shot" API and preventing the client from calling Load + in several times in sequence as is now possible in WholeProgram mode. + (TypeCheck mode has a similar one-shot restriction for a different reason.) + +Early drafts of this package supported "multi-shot" operation. +Although it allowed clients to make a sequence of calls (or concurrent +calls) to Load, building up the graph of Packages incrementally, +it was of marginal value: it complicated the API +(since it allowed some options to vary across calls but not others), +it complicated the implementation, +it cannot be made to work in Types mode, as explained above, +and it was less efficient than making one combined call (when this is possible). +Among the clients we have inspected, none made multiple calls to load +but could not be easily and satisfactorily modified to make only a single call. +However, applications changes may be required. +For example, the ssadump command loads the user-specified packages +and in addition the runtime package. It is tempting to simply append +"runtime" to the user-provided list, but that does not work if the user +specified an ad-hoc package such as [a.go b.go]. +Instead, ssadump no longer requests the runtime package, +but seeks it among the dependencies of the user-specified packages, +and emits an error if it is not found. + +Overlays: The Overlay field in the Config allows providing alternate contents +for Go source files, by providing a mapping from file path to contents. +go/packages will pull in new imports added in overlay files when go/packages +is run in LoadImports mode or greater. +Overlay support for the go list driver isn't complete yet: if the file doesn't +exist on disk, it will only be recognized in an overlay if it is a non-test file +and the package would be reported even without the overlay. + +Questions & Tasks + +- Add GOARCH/GOOS? + They are not portable concepts, but could be made portable. + Our goal has been to allow users to express themselves using the conventions + of the underlying build system: if the build system honors GOARCH + during a build and during a metadata query, then so should + applications built atop that query mechanism. + Conversely, if the target architecture of the build is determined by + command-line flags, the application can pass the relevant + flags through to the build system using a command such as: + myapp -query_flag="--cpu=amd64" -query_flag="--os=darwin" + However, this approach is low-level, unwieldy, and non-portable. + GOOS and GOARCH seem important enough to warrant a dedicated option. + +- How should we handle partial failures such as a mixture of good and + malformed patterns, existing and non-existent packages, successful and + failed builds, import failures, import cycles, and so on, in a call to + Load? + +- Support bazel, blaze, and go1.10 list, not just go1.11 list. + +- Handle (and test) various partial success cases, e.g. + a mixture of good packages and: + invalid patterns + nonexistent packages + empty packages + packages with malformed package or import declarations + unreadable files + import cycles + other parse errors + type errors + Make sure we record errors at the correct place in the graph. + +- Missing packages among initial arguments are not reported. + Return bogus packages for them, like golist does. + +- "undeclared name" errors (for example) are reported out of source file + order. I suspect this is due to the breadth-first resolution now used + by go/types. Is that a bug? Discuss with gri. + +*/ diff --git a/vendor/golang.org/x/tools/go/packages/external.go b/vendor/golang.org/x/tools/go/packages/external.go new file mode 100644 index 000000000..7242a0a7d --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/external.go @@ -0,0 +1,101 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This file enables an external tool to intercept package requests. +// If the tool is present then its results are used in preference to +// the go list command. + +package packages + +import ( + "bytes" + "encoding/json" + "fmt" + exec "golang.org/x/sys/execabs" + "os" + "strings" +) + +// The Driver Protocol +// +// The driver, given the inputs to a call to Load, returns metadata about the packages specified. +// This allows for different build systems to support go/packages by telling go/packages how the +// packages' source is organized. +// The driver is a binary, either specified by the GOPACKAGESDRIVER environment variable or in +// the path as gopackagesdriver. It's given the inputs to load in its argv. See the package +// documentation in doc.go for the full description of the patterns that need to be supported. +// A driver receives as a JSON-serialized driverRequest struct in standard input and will +// produce a JSON-serialized driverResponse (see definition in packages.go) in its standard output. + +// driverRequest is used to provide the portion of Load's Config that is needed by a driver. +type driverRequest struct { + Mode LoadMode `json:"mode"` + // Env specifies the environment the underlying build system should be run in. + Env []string `json:"env"` + // BuildFlags are flags that should be passed to the underlying build system. + BuildFlags []string `json:"build_flags"` + // Tests specifies whether the patterns should also return test packages. + Tests bool `json:"tests"` + // Overlay maps file paths (relative to the driver's working directory) to the byte contents + // of overlay files. + Overlay map[string][]byte `json:"overlay"` +} + +// findExternalDriver returns the file path of a tool that supplies +// the build system package structure, or "" if not found." +// If GOPACKAGESDRIVER is set in the environment findExternalTool returns its +// value, otherwise it searches for a binary named gopackagesdriver on the PATH. +func findExternalDriver(cfg *Config) driver { + const toolPrefix = "GOPACKAGESDRIVER=" + tool := "" + for _, env := range cfg.Env { + if val := strings.TrimPrefix(env, toolPrefix); val != env { + tool = val + } + } + if tool != "" && tool == "off" { + return nil + } + if tool == "" { + var err error + tool, err = exec.LookPath("gopackagesdriver") + if err != nil { + return nil + } + } + return func(cfg *Config, words ...string) (*driverResponse, error) { + req, err := json.Marshal(driverRequest{ + Mode: cfg.Mode, + Env: cfg.Env, + BuildFlags: cfg.BuildFlags, + Tests: cfg.Tests, + Overlay: cfg.Overlay, + }) + if err != nil { + return nil, fmt.Errorf("failed to encode message to driver tool: %v", err) + } + + buf := new(bytes.Buffer) + stderr := new(bytes.Buffer) + cmd := exec.CommandContext(cfg.Context, tool, words...) + cmd.Dir = cfg.Dir + cmd.Env = cfg.Env + cmd.Stdin = bytes.NewReader(req) + cmd.Stdout = buf + cmd.Stderr = stderr + + if err := cmd.Run(); err != nil { + return nil, fmt.Errorf("%v: %v: %s", tool, err, cmd.Stderr) + } + if len(stderr.Bytes()) != 0 && os.Getenv("GOPACKAGESPRINTDRIVERERRORS") != "" { + fmt.Fprintf(os.Stderr, "%s stderr: <<%s>>\n", cmdDebugStr(cmd), stderr) + } + + var response driverResponse + if err := json.Unmarshal(buf.Bytes(), &response); err != nil { + return nil, err + } + return &response, nil + } +} diff --git a/vendor/golang.org/x/tools/go/packages/golist.go b/vendor/golang.org/x/tools/go/packages/golist.go new file mode 100644 index 000000000..58230038a --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/golist.go @@ -0,0 +1,1183 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +import ( + "bytes" + "context" + "encoding/json" + "fmt" + "go/types" + "io/ioutil" + "log" + "os" + "path" + "path/filepath" + "reflect" + "sort" + "strconv" + "strings" + "sync" + "unicode" + + exec "golang.org/x/sys/execabs" + "golang.org/x/tools/go/internal/packagesdriver" + "golang.org/x/tools/internal/gocommand" + "golang.org/x/tools/internal/packagesinternal" +) + +// debug controls verbose logging. +var debug, _ = strconv.ParseBool(os.Getenv("GOPACKAGESDEBUG")) + +// A goTooOldError reports that the go command +// found by exec.LookPath is too old to use the new go list behavior. +type goTooOldError struct { + error +} + +// responseDeduper wraps a driverResponse, deduplicating its contents. +type responseDeduper struct { + seenRoots map[string]bool + seenPackages map[string]*Package + dr *driverResponse +} + +func newDeduper() *responseDeduper { + return &responseDeduper{ + dr: &driverResponse{}, + seenRoots: map[string]bool{}, + seenPackages: map[string]*Package{}, + } +} + +// addAll fills in r with a driverResponse. +func (r *responseDeduper) addAll(dr *driverResponse) { + for _, pkg := range dr.Packages { + r.addPackage(pkg) + } + for _, root := range dr.Roots { + r.addRoot(root) + } + r.dr.GoVersion = dr.GoVersion +} + +func (r *responseDeduper) addPackage(p *Package) { + if r.seenPackages[p.ID] != nil { + return + } + r.seenPackages[p.ID] = p + r.dr.Packages = append(r.dr.Packages, p) +} + +func (r *responseDeduper) addRoot(id string) { + if r.seenRoots[id] { + return + } + r.seenRoots[id] = true + r.dr.Roots = append(r.dr.Roots, id) +} + +type golistState struct { + cfg *Config + ctx context.Context + + envOnce sync.Once + goEnvError error + goEnv map[string]string + + rootsOnce sync.Once + rootDirsError error + rootDirs map[string]string + + goVersionOnce sync.Once + goVersionError error + goVersion int // The X in Go 1.X. + + // vendorDirs caches the (non)existence of vendor directories. + vendorDirs map[string]bool +} + +// getEnv returns Go environment variables. Only specific variables are +// populated -- computing all of them is slow. +func (state *golistState) getEnv() (map[string]string, error) { + state.envOnce.Do(func() { + var b *bytes.Buffer + b, state.goEnvError = state.invokeGo("env", "-json", "GOMOD", "GOPATH") + if state.goEnvError != nil { + return + } + + state.goEnv = make(map[string]string) + decoder := json.NewDecoder(b) + if state.goEnvError = decoder.Decode(&state.goEnv); state.goEnvError != nil { + return + } + }) + return state.goEnv, state.goEnvError +} + +// mustGetEnv is a convenience function that can be used if getEnv has already succeeded. +func (state *golistState) mustGetEnv() map[string]string { + env, err := state.getEnv() + if err != nil { + panic(fmt.Sprintf("mustGetEnv: %v", err)) + } + return env +} + +// goListDriver uses the go list command to interpret the patterns and produce +// the build system package structure. +// See driver for more details. +func goListDriver(cfg *Config, patterns ...string) (*driverResponse, error) { + // Make sure that any asynchronous go commands are killed when we return. + parentCtx := cfg.Context + if parentCtx == nil { + parentCtx = context.Background() + } + ctx, cancel := context.WithCancel(parentCtx) + defer cancel() + + response := newDeduper() + + state := &golistState{ + cfg: cfg, + ctx: ctx, + vendorDirs: map[string]bool{}, + } + + // Fill in response.Sizes asynchronously if necessary. + var sizeserr error + var sizeswg sync.WaitGroup + if cfg.Mode&NeedTypesSizes != 0 || cfg.Mode&NeedTypes != 0 { + sizeswg.Add(1) + go func() { + var sizes types.Sizes + sizes, sizeserr = packagesdriver.GetSizesGolist(ctx, state.cfgInvocation(), cfg.gocmdRunner) + // types.SizesFor always returns nil or a *types.StdSizes. + response.dr.Sizes, _ = sizes.(*types.StdSizes) + sizeswg.Done() + }() + } + + // Determine files requested in contains patterns + var containFiles []string + restPatterns := make([]string, 0, len(patterns)) + // Extract file= and other [querytype]= patterns. Report an error if querytype + // doesn't exist. +extractQueries: + for _, pattern := range patterns { + eqidx := strings.Index(pattern, "=") + if eqidx < 0 { + restPatterns = append(restPatterns, pattern) + } else { + query, value := pattern[:eqidx], pattern[eqidx+len("="):] + switch query { + case "file": + containFiles = append(containFiles, value) + case "pattern": + restPatterns = append(restPatterns, value) + case "": // not a reserved query + restPatterns = append(restPatterns, pattern) + default: + for _, rune := range query { + if rune < 'a' || rune > 'z' { // not a reserved query + restPatterns = append(restPatterns, pattern) + continue extractQueries + } + } + // Reject all other patterns containing "=" + return nil, fmt.Errorf("invalid query type %q in query pattern %q", query, pattern) + } + } + } + + // See if we have any patterns to pass through to go list. Zero initial + // patterns also requires a go list call, since it's the equivalent of + // ".". + if len(restPatterns) > 0 || len(patterns) == 0 { + dr, err := state.createDriverResponse(restPatterns...) + if err != nil { + return nil, err + } + response.addAll(dr) + } + + if len(containFiles) != 0 { + if err := state.runContainsQueries(response, containFiles); err != nil { + return nil, err + } + } + + // Only use go/packages' overlay processing if we're using a Go version + // below 1.16. Otherwise, go list handles it. + if goVersion, err := state.getGoVersion(); err == nil && goVersion < 16 { + modifiedPkgs, needPkgs, err := state.processGolistOverlay(response) + if err != nil { + return nil, err + } + + var containsCandidates []string + if len(containFiles) > 0 { + containsCandidates = append(containsCandidates, modifiedPkgs...) + containsCandidates = append(containsCandidates, needPkgs...) + } + if err := state.addNeededOverlayPackages(response, needPkgs); err != nil { + return nil, err + } + // Check candidate packages for containFiles. + if len(containFiles) > 0 { + for _, id := range containsCandidates { + pkg, ok := response.seenPackages[id] + if !ok { + response.addPackage(&Package{ + ID: id, + Errors: []Error{{ + Kind: ListError, + Msg: fmt.Sprintf("package %s expected but not seen", id), + }}, + }) + continue + } + for _, f := range containFiles { + for _, g := range pkg.GoFiles { + if sameFile(f, g) { + response.addRoot(id) + } + } + } + } + } + // Add root for any package that matches a pattern. This applies only to + // packages that are modified by overlays, since they are not added as + // roots automatically. + for _, pattern := range restPatterns { + match := matchPattern(pattern) + for _, pkgID := range modifiedPkgs { + pkg, ok := response.seenPackages[pkgID] + if !ok { + continue + } + if match(pkg.PkgPath) { + response.addRoot(pkg.ID) + } + } + } + } + + sizeswg.Wait() + if sizeserr != nil { + return nil, sizeserr + } + return response.dr, nil +} + +func (state *golistState) addNeededOverlayPackages(response *responseDeduper, pkgs []string) error { + if len(pkgs) == 0 { + return nil + } + dr, err := state.createDriverResponse(pkgs...) + if err != nil { + return err + } + for _, pkg := range dr.Packages { + response.addPackage(pkg) + } + _, needPkgs, err := state.processGolistOverlay(response) + if err != nil { + return err + } + return state.addNeededOverlayPackages(response, needPkgs) +} + +func (state *golistState) runContainsQueries(response *responseDeduper, queries []string) error { + for _, query := range queries { + // TODO(matloob): Do only one query per directory. + fdir := filepath.Dir(query) + // Pass absolute path of directory to go list so that it knows to treat it as a directory, + // not a package path. + pattern, err := filepath.Abs(fdir) + if err != nil { + return fmt.Errorf("could not determine absolute path of file= query path %q: %v", query, err) + } + dirResponse, err := state.createDriverResponse(pattern) + + // If there was an error loading the package, or no packages are returned, + // or the package is returned with errors, try to load the file as an + // ad-hoc package. + // Usually the error will appear in a returned package, but may not if we're + // in module mode and the ad-hoc is located outside a module. + if err != nil || len(dirResponse.Packages) == 0 || len(dirResponse.Packages) == 1 && len(dirResponse.Packages[0].GoFiles) == 0 && + len(dirResponse.Packages[0].Errors) == 1 { + var queryErr error + if dirResponse, queryErr = state.adhocPackage(pattern, query); queryErr != nil { + return err // return the original error + } + } + isRoot := make(map[string]bool, len(dirResponse.Roots)) + for _, root := range dirResponse.Roots { + isRoot[root] = true + } + for _, pkg := range dirResponse.Packages { + // Add any new packages to the main set + // We don't bother to filter packages that will be dropped by the changes of roots, + // that will happen anyway during graph construction outside this function. + // Over-reporting packages is not a problem. + response.addPackage(pkg) + // if the package was not a root one, it cannot have the file + if !isRoot[pkg.ID] { + continue + } + for _, pkgFile := range pkg.GoFiles { + if filepath.Base(query) == filepath.Base(pkgFile) { + response.addRoot(pkg.ID) + break + } + } + } + } + return nil +} + +// adhocPackage attempts to load or construct an ad-hoc package for a given +// query, if the original call to the driver produced inadequate results. +func (state *golistState) adhocPackage(pattern, query string) (*driverResponse, error) { + response, err := state.createDriverResponse(query) + if err != nil { + return nil, err + } + // If we get nothing back from `go list`, + // try to make this file into its own ad-hoc package. + // TODO(rstambler): Should this check against the original response? + if len(response.Packages) == 0 { + response.Packages = append(response.Packages, &Package{ + ID: "command-line-arguments", + PkgPath: query, + GoFiles: []string{query}, + CompiledGoFiles: []string{query}, + Imports: make(map[string]*Package), + }) + response.Roots = append(response.Roots, "command-line-arguments") + } + // Handle special cases. + if len(response.Packages) == 1 { + // golang/go#33482: If this is a file= query for ad-hoc packages where + // the file only exists on an overlay, and exists outside of a module, + // add the file to the package and remove the errors. + if response.Packages[0].ID == "command-line-arguments" || + filepath.ToSlash(response.Packages[0].PkgPath) == filepath.ToSlash(query) { + if len(response.Packages[0].GoFiles) == 0 { + filename := filepath.Join(pattern, filepath.Base(query)) // avoid recomputing abspath + // TODO(matloob): check if the file is outside of a root dir? + for path := range state.cfg.Overlay { + if path == filename { + response.Packages[0].Errors = nil + response.Packages[0].GoFiles = []string{path} + response.Packages[0].CompiledGoFiles = []string{path} + } + } + } + } + } + return response, nil +} + +// Fields must match go list; +// see $GOROOT/src/cmd/go/internal/load/pkg.go. +type jsonPackage struct { + ImportPath string + Dir string + Name string + Export string + GoFiles []string + CompiledGoFiles []string + IgnoredGoFiles []string + IgnoredOtherFiles []string + EmbedPatterns []string + EmbedFiles []string + CFiles []string + CgoFiles []string + CXXFiles []string + MFiles []string + HFiles []string + FFiles []string + SFiles []string + SwigFiles []string + SwigCXXFiles []string + SysoFiles []string + Imports []string + ImportMap map[string]string + Deps []string + Module *Module + TestGoFiles []string + TestImports []string + XTestGoFiles []string + XTestImports []string + ForTest string // q in a "p [q.test]" package, else "" + DepOnly bool + + Error *packagesinternal.PackageError + DepsErrors []*packagesinternal.PackageError +} + +type jsonPackageError struct { + ImportStack []string + Pos string + Err string +} + +func otherFiles(p *jsonPackage) [][]string { + return [][]string{p.CFiles, p.CXXFiles, p.MFiles, p.HFiles, p.FFiles, p.SFiles, p.SwigFiles, p.SwigCXXFiles, p.SysoFiles} +} + +// createDriverResponse uses the "go list" command to expand the pattern +// words and return a response for the specified packages. +func (state *golistState) createDriverResponse(words ...string) (*driverResponse, error) { + // go list uses the following identifiers in ImportPath and Imports: + // + // "p" -- importable package or main (command) + // "q.test" -- q's test executable + // "p [q.test]" -- variant of p as built for q's test executable + // "q_test [q.test]" -- q's external test package + // + // The packages p that are built differently for a test q.test + // are q itself, plus any helpers used by the external test q_test, + // typically including "testing" and all its dependencies. + + // Run "go list" for complete + // information on the specified packages. + goVersion, err := state.getGoVersion() + if err != nil { + return nil, err + } + buf, err := state.invokeGo("list", golistargs(state.cfg, words, goVersion)...) + if err != nil { + return nil, err + } + + seen := make(map[string]*jsonPackage) + pkgs := make(map[string]*Package) + additionalErrors := make(map[string][]Error) + // Decode the JSON and convert it to Package form. + response := &driverResponse{ + GoVersion: goVersion, + } + for dec := json.NewDecoder(buf); dec.More(); { + p := new(jsonPackage) + if err := dec.Decode(p); err != nil { + return nil, fmt.Errorf("JSON decoding failed: %v", err) + } + + if p.ImportPath == "" { + // The documentation for go list says that “[e]rroneous packages will have + // a non-empty ImportPath”. If for some reason it comes back empty, we + // prefer to error out rather than silently discarding data or handing + // back a package without any way to refer to it. + if p.Error != nil { + return nil, Error{ + Pos: p.Error.Pos, + Msg: p.Error.Err, + } + } + return nil, fmt.Errorf("package missing import path: %+v", p) + } + + // Work around https://golang.org/issue/33157: + // go list -e, when given an absolute path, will find the package contained at + // that directory. But when no package exists there, it will return a fake package + // with an error and the ImportPath set to the absolute path provided to go list. + // Try to convert that absolute path to what its package path would be if it's + // contained in a known module or GOPATH entry. This will allow the package to be + // properly "reclaimed" when overlays are processed. + if filepath.IsAbs(p.ImportPath) && p.Error != nil { + pkgPath, ok, err := state.getPkgPath(p.ImportPath) + if err != nil { + return nil, err + } + if ok { + p.ImportPath = pkgPath + } + } + + if old, found := seen[p.ImportPath]; found { + // If one version of the package has an error, and the other doesn't, assume + // that this is a case where go list is reporting a fake dependency variant + // of the imported package: When a package tries to invalidly import another + // package, go list emits a variant of the imported package (with the same + // import path, but with an error on it, and the package will have a + // DepError set on it). An example of when this can happen is for imports of + // main packages: main packages can not be imported, but they may be + // separately matched and listed by another pattern. + // See golang.org/issue/36188 for more details. + + // The plan is that eventually, hopefully in Go 1.15, the error will be + // reported on the importing package rather than the duplicate "fake" + // version of the imported package. Once all supported versions of Go + // have the new behavior this logic can be deleted. + // TODO(matloob): delete the workaround logic once all supported versions of + // Go return the errors on the proper package. + + // There should be exactly one version of a package that doesn't have an + // error. + if old.Error == nil && p.Error == nil { + if !reflect.DeepEqual(p, old) { + return nil, fmt.Errorf("internal error: go list gives conflicting information for package %v", p.ImportPath) + } + continue + } + + // Determine if this package's error needs to be bubbled up. + // This is a hack, and we expect for go list to eventually set the error + // on the package. + if old.Error != nil { + var errkind string + if strings.Contains(old.Error.Err, "not an importable package") { + errkind = "not an importable package" + } else if strings.Contains(old.Error.Err, "use of internal package") && strings.Contains(old.Error.Err, "not allowed") { + errkind = "use of internal package not allowed" + } + if errkind != "" { + if len(old.Error.ImportStack) < 1 { + return nil, fmt.Errorf(`internal error: go list gave a %q error with empty import stack`, errkind) + } + importingPkg := old.Error.ImportStack[len(old.Error.ImportStack)-1] + if importingPkg == old.ImportPath { + // Using an older version of Go which put this package itself on top of import + // stack, instead of the importer. Look for importer in second from top + // position. + if len(old.Error.ImportStack) < 2 { + return nil, fmt.Errorf(`internal error: go list gave a %q error with an import stack without importing package`, errkind) + } + importingPkg = old.Error.ImportStack[len(old.Error.ImportStack)-2] + } + additionalErrors[importingPkg] = append(additionalErrors[importingPkg], Error{ + Pos: old.Error.Pos, + Msg: old.Error.Err, + Kind: ListError, + }) + } + } + + // Make sure that if there's a version of the package without an error, + // that's the one reported to the user. + if old.Error == nil { + continue + } + + // This package will replace the old one at the end of the loop. + } + seen[p.ImportPath] = p + + pkg := &Package{ + Name: p.Name, + ID: p.ImportPath, + GoFiles: absJoin(p.Dir, p.GoFiles, p.CgoFiles), + CompiledGoFiles: absJoin(p.Dir, p.CompiledGoFiles), + OtherFiles: absJoin(p.Dir, otherFiles(p)...), + EmbedFiles: absJoin(p.Dir, p.EmbedFiles), + EmbedPatterns: absJoin(p.Dir, p.EmbedPatterns), + IgnoredFiles: absJoin(p.Dir, p.IgnoredGoFiles, p.IgnoredOtherFiles), + forTest: p.ForTest, + depsErrors: p.DepsErrors, + Module: p.Module, + } + + if (state.cfg.Mode&typecheckCgo) != 0 && len(p.CgoFiles) != 0 { + if len(p.CompiledGoFiles) > len(p.GoFiles) { + // We need the cgo definitions, which are in the first + // CompiledGoFile after the non-cgo ones. This is a hack but there + // isn't currently a better way to find it. We also need the pure + // Go files and unprocessed cgo files, all of which are already + // in pkg.GoFiles. + cgoTypes := p.CompiledGoFiles[len(p.GoFiles)] + pkg.CompiledGoFiles = append([]string{cgoTypes}, pkg.GoFiles...) + } else { + // golang/go#38990: go list silently fails to do cgo processing + pkg.CompiledGoFiles = nil + pkg.Errors = append(pkg.Errors, Error{ + Msg: "go list failed to return CompiledGoFiles. This may indicate failure to perform cgo processing; try building at the command line. See https://golang.org/issue/38990.", + Kind: ListError, + }) + } + } + + // Work around https://golang.org/issue/28749: + // cmd/go puts assembly, C, and C++ files in CompiledGoFiles. + // Remove files from CompiledGoFiles that are non-go files + // (or are not files that look like they are from the cache). + if len(pkg.CompiledGoFiles) > 0 { + out := pkg.CompiledGoFiles[:0] + for _, f := range pkg.CompiledGoFiles { + if ext := filepath.Ext(f); ext != ".go" && ext != "" { // ext == "" means the file is from the cache, so probably cgo-processed file + continue + } + out = append(out, f) + } + pkg.CompiledGoFiles = out + } + + // Extract the PkgPath from the package's ID. + if i := strings.IndexByte(pkg.ID, ' '); i >= 0 { + pkg.PkgPath = pkg.ID[:i] + } else { + pkg.PkgPath = pkg.ID + } + + if pkg.PkgPath == "unsafe" { + pkg.CompiledGoFiles = nil // ignore fake unsafe.go file (#59929) + } else if len(pkg.CompiledGoFiles) == 0 { + // Work around for pre-go.1.11 versions of go list. + // TODO(matloob): they should be handled by the fallback. + // Can we delete this? + pkg.CompiledGoFiles = pkg.GoFiles + } + + // Assume go list emits only absolute paths for Dir. + if p.Dir != "" && !filepath.IsAbs(p.Dir) { + log.Fatalf("internal error: go list returned non-absolute Package.Dir: %s", p.Dir) + } + + if p.Export != "" && !filepath.IsAbs(p.Export) { + pkg.ExportFile = filepath.Join(p.Dir, p.Export) + } else { + pkg.ExportFile = p.Export + } + + // imports + // + // Imports contains the IDs of all imported packages. + // ImportsMap records (path, ID) only where they differ. + ids := make(map[string]bool) + for _, id := range p.Imports { + ids[id] = true + } + pkg.Imports = make(map[string]*Package) + for path, id := range p.ImportMap { + pkg.Imports[path] = &Package{ID: id} // non-identity import + delete(ids, id) + } + for id := range ids { + if id == "C" { + continue + } + + pkg.Imports[id] = &Package{ID: id} // identity import + } + if !p.DepOnly { + response.Roots = append(response.Roots, pkg.ID) + } + + // Temporary work-around for golang/go#39986. Parse filenames out of + // error messages. This happens if there are unrecoverable syntax + // errors in the source, so we can't match on a specific error message. + // + // TODO(rfindley): remove this heuristic, in favor of considering + // InvalidGoFiles from the list driver. + if err := p.Error; err != nil && state.shouldAddFilenameFromError(p) { + addFilenameFromPos := func(pos string) bool { + split := strings.Split(pos, ":") + if len(split) < 1 { + return false + } + filename := strings.TrimSpace(split[0]) + if filename == "" { + return false + } + if !filepath.IsAbs(filename) { + filename = filepath.Join(state.cfg.Dir, filename) + } + info, _ := os.Stat(filename) + if info == nil { + return false + } + pkg.CompiledGoFiles = append(pkg.CompiledGoFiles, filename) + pkg.GoFiles = append(pkg.GoFiles, filename) + return true + } + found := addFilenameFromPos(err.Pos) + // In some cases, go list only reports the error position in the + // error text, not the error position. One such case is when the + // file's package name is a keyword (see golang.org/issue/39763). + if !found { + addFilenameFromPos(err.Err) + } + } + + if p.Error != nil { + msg := strings.TrimSpace(p.Error.Err) // Trim to work around golang.org/issue/32363. + // Address golang.org/issue/35964 by appending import stack to error message. + if msg == "import cycle not allowed" && len(p.Error.ImportStack) != 0 { + msg += fmt.Sprintf(": import stack: %v", p.Error.ImportStack) + } + pkg.Errors = append(pkg.Errors, Error{ + Pos: p.Error.Pos, + Msg: msg, + Kind: ListError, + }) + } + + pkgs[pkg.ID] = pkg + } + + for id, errs := range additionalErrors { + if p, ok := pkgs[id]; ok { + p.Errors = append(p.Errors, errs...) + } + } + for _, pkg := range pkgs { + response.Packages = append(response.Packages, pkg) + } + sort.Slice(response.Packages, func(i, j int) bool { return response.Packages[i].ID < response.Packages[j].ID }) + + return response, nil +} + +func (state *golistState) shouldAddFilenameFromError(p *jsonPackage) bool { + if len(p.GoFiles) > 0 || len(p.CompiledGoFiles) > 0 { + return false + } + + goV, err := state.getGoVersion() + if err != nil { + return false + } + + // On Go 1.14 and earlier, only add filenames from errors if the import stack is empty. + // The import stack behaves differently for these versions than newer Go versions. + if goV < 15 { + return len(p.Error.ImportStack) == 0 + } + + // On Go 1.15 and later, only parse filenames out of error if there's no import stack, + // or the current package is at the top of the import stack. This is not guaranteed + // to work perfectly, but should avoid some cases where files in errors don't belong to this + // package. + return len(p.Error.ImportStack) == 0 || p.Error.ImportStack[len(p.Error.ImportStack)-1] == p.ImportPath +} + +// getGoVersion returns the effective minor version of the go command. +func (state *golistState) getGoVersion() (int, error) { + state.goVersionOnce.Do(func() { + state.goVersion, state.goVersionError = gocommand.GoVersion(state.ctx, state.cfgInvocation(), state.cfg.gocmdRunner) + }) + return state.goVersion, state.goVersionError +} + +// getPkgPath finds the package path of a directory if it's relative to a root +// directory. +func (state *golistState) getPkgPath(dir string) (string, bool, error) { + absDir, err := filepath.Abs(dir) + if err != nil { + return "", false, err + } + roots, err := state.determineRootDirs() + if err != nil { + return "", false, err + } + + for rdir, rpath := range roots { + // Make sure that the directory is in the module, + // to avoid creating a path relative to another module. + if !strings.HasPrefix(absDir, rdir) { + continue + } + // TODO(matloob): This doesn't properly handle symlinks. + r, err := filepath.Rel(rdir, dir) + if err != nil { + continue + } + if rpath != "" { + // We choose only one root even though the directory even it can belong in multiple modules + // or GOPATH entries. This is okay because we only need to work with absolute dirs when a + // file is missing from disk, for instance when gopls calls go/packages in an overlay. + // Once the file is saved, gopls, or the next invocation of the tool will get the correct + // result straight from golist. + // TODO(matloob): Implement module tiebreaking? + return path.Join(rpath, filepath.ToSlash(r)), true, nil + } + return filepath.ToSlash(r), true, nil + } + return "", false, nil +} + +// absJoin absolutizes and flattens the lists of files. +func absJoin(dir string, fileses ...[]string) (res []string) { + for _, files := range fileses { + for _, file := range files { + if !filepath.IsAbs(file) { + file = filepath.Join(dir, file) + } + res = append(res, file) + } + } + return res +} + +func jsonFlag(cfg *Config, goVersion int) string { + if goVersion < 19 { + return "-json" + } + var fields []string + added := make(map[string]bool) + addFields := func(fs ...string) { + for _, f := range fs { + if !added[f] { + added[f] = true + fields = append(fields, f) + } + } + } + addFields("Name", "ImportPath", "Error") // These fields are always needed + if cfg.Mode&NeedFiles != 0 || cfg.Mode&NeedTypes != 0 { + addFields("Dir", "GoFiles", "IgnoredGoFiles", "IgnoredOtherFiles", "CFiles", + "CgoFiles", "CXXFiles", "MFiles", "HFiles", "FFiles", "SFiles", + "SwigFiles", "SwigCXXFiles", "SysoFiles") + if cfg.Tests { + addFields("TestGoFiles", "XTestGoFiles") + } + } + if cfg.Mode&NeedTypes != 0 { + // CompiledGoFiles seems to be required for the test case TestCgoNoSyntax, + // even when -compiled isn't passed in. + // TODO(#52435): Should we make the test ask for -compiled, or automatically + // request CompiledGoFiles in certain circumstances? + addFields("Dir", "CompiledGoFiles") + } + if cfg.Mode&NeedCompiledGoFiles != 0 { + addFields("Dir", "CompiledGoFiles", "Export") + } + if cfg.Mode&NeedImports != 0 { + // When imports are requested, DepOnly is used to distinguish between packages + // explicitly requested and transitive imports of those packages. + addFields("DepOnly", "Imports", "ImportMap") + if cfg.Tests { + addFields("TestImports", "XTestImports") + } + } + if cfg.Mode&NeedDeps != 0 { + addFields("DepOnly") + } + if usesExportData(cfg) { + // Request Dir in the unlikely case Export is not absolute. + addFields("Dir", "Export") + } + if cfg.Mode&needInternalForTest != 0 { + addFields("ForTest") + } + if cfg.Mode&needInternalDepsErrors != 0 { + addFields("DepsErrors") + } + if cfg.Mode&NeedModule != 0 { + addFields("Module") + } + if cfg.Mode&NeedEmbedFiles != 0 { + addFields("EmbedFiles") + } + if cfg.Mode&NeedEmbedPatterns != 0 { + addFields("EmbedPatterns") + } + return "-json=" + strings.Join(fields, ",") +} + +func golistargs(cfg *Config, words []string, goVersion int) []string { + const findFlags = NeedImports | NeedTypes | NeedSyntax | NeedTypesInfo + fullargs := []string{ + "-e", jsonFlag(cfg, goVersion), + fmt.Sprintf("-compiled=%t", cfg.Mode&(NeedCompiledGoFiles|NeedSyntax|NeedTypes|NeedTypesInfo|NeedTypesSizes) != 0), + fmt.Sprintf("-test=%t", cfg.Tests), + fmt.Sprintf("-export=%t", usesExportData(cfg)), + fmt.Sprintf("-deps=%t", cfg.Mode&NeedImports != 0), + // go list doesn't let you pass -test and -find together, + // probably because you'd just get the TestMain. + fmt.Sprintf("-find=%t", !cfg.Tests && cfg.Mode&findFlags == 0 && !usesExportData(cfg)), + } + + // golang/go#60456: with go1.21 and later, go list serves pgo variants, which + // can be costly to compute and may result in redundant processing for the + // caller. Disable these variants. If someone wants to add e.g. a NeedPGO + // mode flag, that should be a separate proposal. + if goVersion >= 21 { + fullargs = append(fullargs, "-pgo=off") + } + + fullargs = append(fullargs, cfg.BuildFlags...) + fullargs = append(fullargs, "--") + fullargs = append(fullargs, words...) + return fullargs +} + +// cfgInvocation returns an Invocation that reflects cfg's settings. +func (state *golistState) cfgInvocation() gocommand.Invocation { + cfg := state.cfg + return gocommand.Invocation{ + BuildFlags: cfg.BuildFlags, + ModFile: cfg.modFile, + ModFlag: cfg.modFlag, + CleanEnv: cfg.Env != nil, + Env: cfg.Env, + Logf: cfg.Logf, + WorkingDir: cfg.Dir, + } +} + +// invokeGo returns the stdout of a go command invocation. +func (state *golistState) invokeGo(verb string, args ...string) (*bytes.Buffer, error) { + cfg := state.cfg + + inv := state.cfgInvocation() + + // For Go versions 1.16 and above, `go list` accepts overlays directly via + // the -overlay flag. Set it, if it's available. + // + // The check for "list" is not necessarily required, but we should avoid + // getting the go version if possible. + if verb == "list" { + goVersion, err := state.getGoVersion() + if err != nil { + return nil, err + } + if goVersion >= 16 { + filename, cleanup, err := state.writeOverlays() + if err != nil { + return nil, err + } + defer cleanup() + inv.Overlay = filename + } + } + inv.Verb = verb + inv.Args = args + gocmdRunner := cfg.gocmdRunner + if gocmdRunner == nil { + gocmdRunner = &gocommand.Runner{} + } + stdout, stderr, friendlyErr, err := gocmdRunner.RunRaw(cfg.Context, inv) + if err != nil { + // Check for 'go' executable not being found. + if ee, ok := err.(*exec.Error); ok && ee.Err == exec.ErrNotFound { + return nil, fmt.Errorf("'go list' driver requires 'go', but %s", exec.ErrNotFound) + } + + exitErr, ok := err.(*exec.ExitError) + if !ok { + // Catastrophic error: + // - context cancellation + return nil, fmt.Errorf("couldn't run 'go': %w", err) + } + + // Old go version? + if strings.Contains(stderr.String(), "flag provided but not defined") { + return nil, goTooOldError{fmt.Errorf("unsupported version of go: %s: %s", exitErr, stderr)} + } + + // Related to #24854 + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "unexpected directory layout") { + return nil, friendlyErr + } + + // Is there an error running the C compiler in cgo? This will be reported in the "Error" field + // and should be suppressed by go list -e. + // + // This condition is not perfect yet because the error message can include other error messages than runtime/cgo. + isPkgPathRune := func(r rune) bool { + // From https://golang.org/ref/spec#Import_declarations: + // Implementation restriction: A compiler may restrict ImportPaths to non-empty strings + // using only characters belonging to Unicode's L, M, N, P, and S general categories + // (the Graphic characters without spaces) and may also exclude the + // characters !"#$%&'()*,:;<=>?[\]^`{|} and the Unicode replacement character U+FFFD. + return unicode.IsOneOf([]*unicode.RangeTable{unicode.L, unicode.M, unicode.N, unicode.P, unicode.S}, r) && + !strings.ContainsRune("!\"#$%&'()*,:;<=>?[\\]^`{|}\uFFFD", r) + } + // golang/go#36770: Handle case where cmd/go prints module download messages before the error. + msg := stderr.String() + for strings.HasPrefix(msg, "go: downloading") { + msg = msg[strings.IndexRune(msg, '\n')+1:] + } + if len(stderr.String()) > 0 && strings.HasPrefix(stderr.String(), "# ") { + msg := msg[len("# "):] + if strings.HasPrefix(strings.TrimLeftFunc(msg, isPkgPathRune), "\n") { + return stdout, nil + } + // Treat pkg-config errors as a special case (golang.org/issue/36770). + if strings.HasPrefix(msg, "pkg-config") { + return stdout, nil + } + } + + // This error only appears in stderr. See golang.org/cl/166398 for a fix in go list to show + // the error in the Err section of stdout in case -e option is provided. + // This fix is provided for backwards compatibility. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "named files must be .go files") { + output := fmt.Sprintf(`{"ImportPath": "command-line-arguments","Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Similar to the previous error, but currently lacks a fix in Go. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "named files must all be in one directory") { + output := fmt.Sprintf(`{"ImportPath": "command-line-arguments","Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Backwards compatibility for Go 1.11 because 1.12 and 1.13 put the directory in the ImportPath. + // If the package doesn't exist, put the absolute path of the directory into the error message, + // as Go 1.13 list does. + const noSuchDirectory = "no such directory" + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), noSuchDirectory) { + errstr := stderr.String() + abspath := strings.TrimSpace(errstr[strings.Index(errstr, noSuchDirectory)+len(noSuchDirectory):]) + output := fmt.Sprintf(`{"ImportPath": %q,"Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + abspath, strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Workaround for #29280: go list -e has incorrect behavior when an ad-hoc package doesn't exist. + // Note that the error message we look for in this case is different that the one looked for above. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "no such file or directory") { + output := fmt.Sprintf(`{"ImportPath": "command-line-arguments","Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Workaround for #34273. go list -e with GO111MODULE=on has incorrect behavior when listing a + // directory outside any module. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "outside available modules") { + output := fmt.Sprintf(`{"ImportPath": %q,"Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + // TODO(matloob): command-line-arguments isn't correct here. + "command-line-arguments", strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Another variation of the previous error + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "outside module root") { + output := fmt.Sprintf(`{"ImportPath": %q,"Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + // TODO(matloob): command-line-arguments isn't correct here. + "command-line-arguments", strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Workaround for an instance of golang.org/issue/26755: go list -e will return a non-zero exit + // status if there's a dependency on a package that doesn't exist. But it should return + // a zero exit status and set an error on that package. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "no Go files in") { + // Don't clobber stdout if `go list` actually returned something. + if len(stdout.String()) > 0 { + return stdout, nil + } + // try to extract package name from string + stderrStr := stderr.String() + var importPath string + colon := strings.Index(stderrStr, ":") + if colon > 0 && strings.HasPrefix(stderrStr, "go build ") { + importPath = stderrStr[len("go build "):colon] + } + output := fmt.Sprintf(`{"ImportPath": %q,"Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + importPath, strings.Trim(stderrStr, "\n")) + return bytes.NewBufferString(output), nil + } + + // Export mode entails a build. + // If that build fails, errors appear on stderr + // (despite the -e flag) and the Export field is blank. + // Do not fail in that case. + // The same is true if an ad-hoc package given to go list doesn't exist. + // TODO(matloob): Remove these once we can depend on go list to exit with a zero status with -e even when + // packages don't exist or a build fails. + if !usesExportData(cfg) && !containsGoFile(args) { + return nil, friendlyErr + } + } + return stdout, nil +} + +// OverlayJSON is the format overlay files are expected to be in. +// The Replace map maps from overlaid paths to replacement paths: +// the Go command will forward all reads trying to open +// each overlaid path to its replacement path, or consider the overlaid +// path not to exist if the replacement path is empty. +// +// From golang/go#39958. +type OverlayJSON struct { + Replace map[string]string `json:"replace,omitempty"` +} + +// writeOverlays writes out files for go list's -overlay flag, as described +// above. +func (state *golistState) writeOverlays() (filename string, cleanup func(), err error) { + // Do nothing if there are no overlays in the config. + if len(state.cfg.Overlay) == 0 { + return "", func() {}, nil + } + dir, err := ioutil.TempDir("", "gopackages-*") + if err != nil { + return "", nil, err + } + // The caller must clean up this directory, unless this function returns an + // error. + cleanup = func() { + os.RemoveAll(dir) + } + defer func() { + if err != nil { + cleanup() + } + }() + overlays := map[string]string{} + for k, v := range state.cfg.Overlay { + // Create a unique filename for the overlaid files, to avoid + // creating nested directories. + noSeparator := strings.Join(strings.Split(filepath.ToSlash(k), "/"), "") + f, err := ioutil.TempFile(dir, fmt.Sprintf("*-%s", noSeparator)) + if err != nil { + return "", func() {}, err + } + if _, err := f.Write(v); err != nil { + return "", func() {}, err + } + if err := f.Close(); err != nil { + return "", func() {}, err + } + overlays[k] = f.Name() + } + b, err := json.Marshal(OverlayJSON{Replace: overlays}) + if err != nil { + return "", func() {}, err + } + // Write out the overlay file that contains the filepath mappings. + filename = filepath.Join(dir, "overlay.json") + if err := ioutil.WriteFile(filename, b, 0665); err != nil { + return "", func() {}, err + } + return filename, cleanup, nil +} + +func containsGoFile(s []string) bool { + for _, f := range s { + if strings.HasSuffix(f, ".go") { + return true + } + } + return false +} + +func cmdDebugStr(cmd *exec.Cmd) string { + env := make(map[string]string) + for _, kv := range cmd.Env { + split := strings.SplitN(kv, "=", 2) + k, v := split[0], split[1] + env[k] = v + } + + var args []string + for _, arg := range cmd.Args { + quoted := strconv.Quote(arg) + if quoted[1:len(quoted)-1] != arg || strings.Contains(arg, " ") { + args = append(args, quoted) + } else { + args = append(args, arg) + } + } + return fmt.Sprintf("GOROOT=%v GOPATH=%v GO111MODULE=%v GOPROXY=%v PWD=%v %v", env["GOROOT"], env["GOPATH"], env["GO111MODULE"], env["GOPROXY"], env["PWD"], strings.Join(args, " ")) +} diff --git a/vendor/golang.org/x/tools/go/packages/golist_overlay.go b/vendor/golang.org/x/tools/go/packages/golist_overlay.go new file mode 100644 index 000000000..9576b472f --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/golist_overlay.go @@ -0,0 +1,575 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +import ( + "encoding/json" + "fmt" + "go/parser" + "go/token" + "os" + "path/filepath" + "regexp" + "sort" + "strconv" + "strings" + + "golang.org/x/tools/internal/gocommand" +) + +// processGolistOverlay provides rudimentary support for adding +// files that don't exist on disk to an overlay. The results can be +// sometimes incorrect. +// TODO(matloob): Handle unsupported cases, including the following: +// - determining the correct package to add given a new import path +func (state *golistState) processGolistOverlay(response *responseDeduper) (modifiedPkgs, needPkgs []string, err error) { + havePkgs := make(map[string]string) // importPath -> non-test package ID + needPkgsSet := make(map[string]bool) + modifiedPkgsSet := make(map[string]bool) + + pkgOfDir := make(map[string][]*Package) + for _, pkg := range response.dr.Packages { + // This is an approximation of import path to id. This can be + // wrong for tests, vendored packages, and a number of other cases. + havePkgs[pkg.PkgPath] = pkg.ID + dir, err := commonDir(pkg.GoFiles) + if err != nil { + return nil, nil, err + } + if dir != "" { + pkgOfDir[dir] = append(pkgOfDir[dir], pkg) + } + } + + // If no new imports are added, it is safe to avoid loading any needPkgs. + // Otherwise, it's hard to tell which package is actually being loaded + // (due to vendoring) and whether any modified package will show up + // in the transitive set of dependencies (because new imports are added, + // potentially modifying the transitive set of dependencies). + var overlayAddsImports bool + + // If both a package and its test package are created by the overlay, we + // need the real package first. Process all non-test files before test + // files, and make the whole process deterministic while we're at it. + var overlayFiles []string + for opath := range state.cfg.Overlay { + overlayFiles = append(overlayFiles, opath) + } + sort.Slice(overlayFiles, func(i, j int) bool { + iTest := strings.HasSuffix(overlayFiles[i], "_test.go") + jTest := strings.HasSuffix(overlayFiles[j], "_test.go") + if iTest != jTest { + return !iTest // non-tests are before tests. + } + return overlayFiles[i] < overlayFiles[j] + }) + for _, opath := range overlayFiles { + contents := state.cfg.Overlay[opath] + base := filepath.Base(opath) + dir := filepath.Dir(opath) + var pkg *Package // if opath belongs to both a package and its test variant, this will be the test variant + var testVariantOf *Package // if opath is a test file, this is the package it is testing + var fileExists bool + isTestFile := strings.HasSuffix(opath, "_test.go") + pkgName, ok := extractPackageName(opath, contents) + if !ok { + // Don't bother adding a file that doesn't even have a parsable package statement + // to the overlay. + continue + } + // If all the overlay files belong to a different package, change the + // package name to that package. + maybeFixPackageName(pkgName, isTestFile, pkgOfDir[dir]) + nextPackage: + for _, p := range response.dr.Packages { + if pkgName != p.Name && p.ID != "command-line-arguments" { + continue + } + for _, f := range p.GoFiles { + if !sameFile(filepath.Dir(f), dir) { + continue + } + // Make sure to capture information on the package's test variant, if needed. + if isTestFile && !hasTestFiles(p) { + // TODO(matloob): Are there packages other than the 'production' variant + // of a package that this can match? This shouldn't match the test main package + // because the file is generated in another directory. + testVariantOf = p + continue nextPackage + } else if !isTestFile && hasTestFiles(p) { + // We're examining a test variant, but the overlaid file is + // a non-test file. Because the overlay implementation + // (currently) only adds a file to one package, skip this + // package, so that we can add the file to the production + // variant of the package. (https://golang.org/issue/36857 + // tracks handling overlays on both the production and test + // variant of a package). + continue nextPackage + } + if pkg != nil && p != pkg && pkg.PkgPath == p.PkgPath { + // We have already seen the production version of the + // for which p is a test variant. + if hasTestFiles(p) { + testVariantOf = pkg + } + } + pkg = p + if filepath.Base(f) == base { + fileExists = true + } + } + } + // The overlay could have included an entirely new package or an + // ad-hoc package. An ad-hoc package is one that we have manually + // constructed from inadequate `go list` results for a file= query. + // It will have the ID command-line-arguments. + if pkg == nil || pkg.ID == "command-line-arguments" { + // Try to find the module or gopath dir the file is contained in. + // Then for modules, add the module opath to the beginning. + pkgPath, ok, err := state.getPkgPath(dir) + if err != nil { + return nil, nil, err + } + if !ok { + break + } + var forTest string // only set for x tests + isXTest := strings.HasSuffix(pkgName, "_test") + if isXTest { + forTest = pkgPath + pkgPath += "_test" + } + id := pkgPath + if isTestFile { + if isXTest { + id = fmt.Sprintf("%s [%s.test]", pkgPath, forTest) + } else { + id = fmt.Sprintf("%s [%s.test]", pkgPath, pkgPath) + } + } + if pkg != nil { + // TODO(rstambler): We should change the package's path and ID + // here. The only issue is that this messes with the roots. + } else { + // Try to reclaim a package with the same ID, if it exists in the response. + for _, p := range response.dr.Packages { + if reclaimPackage(p, id, opath, contents) { + pkg = p + break + } + } + // Otherwise, create a new package. + if pkg == nil { + pkg = &Package{ + PkgPath: pkgPath, + ID: id, + Name: pkgName, + Imports: make(map[string]*Package), + } + response.addPackage(pkg) + havePkgs[pkg.PkgPath] = id + // Add the production package's sources for a test variant. + if isTestFile && !isXTest && testVariantOf != nil { + pkg.GoFiles = append(pkg.GoFiles, testVariantOf.GoFiles...) + pkg.CompiledGoFiles = append(pkg.CompiledGoFiles, testVariantOf.CompiledGoFiles...) + // Add the package under test and its imports to the test variant. + pkg.forTest = testVariantOf.PkgPath + for k, v := range testVariantOf.Imports { + pkg.Imports[k] = &Package{ID: v.ID} + } + } + if isXTest { + pkg.forTest = forTest + } + } + } + } + if !fileExists { + pkg.GoFiles = append(pkg.GoFiles, opath) + // TODO(matloob): Adding the file to CompiledGoFiles can exhibit the wrong behavior + // if the file will be ignored due to its build tags. + pkg.CompiledGoFiles = append(pkg.CompiledGoFiles, opath) + modifiedPkgsSet[pkg.ID] = true + } + imports, err := extractImports(opath, contents) + if err != nil { + // Let the parser or type checker report errors later. + continue + } + for _, imp := range imports { + // TODO(rstambler): If the package is an x test and the import has + // a test variant, make sure to replace it. + if _, found := pkg.Imports[imp]; found { + continue + } + overlayAddsImports = true + id, ok := havePkgs[imp] + if !ok { + var err error + id, err = state.resolveImport(dir, imp) + if err != nil { + return nil, nil, err + } + } + pkg.Imports[imp] = &Package{ID: id} + // Add dependencies to the non-test variant version of this package as well. + if testVariantOf != nil { + testVariantOf.Imports[imp] = &Package{ID: id} + } + } + } + + // toPkgPath guesses the package path given the id. + toPkgPath := func(sourceDir, id string) (string, error) { + if i := strings.IndexByte(id, ' '); i >= 0 { + return state.resolveImport(sourceDir, id[:i]) + } + return state.resolveImport(sourceDir, id) + } + + // Now that new packages have been created, do another pass to determine + // the new set of missing packages. + for _, pkg := range response.dr.Packages { + for _, imp := range pkg.Imports { + if len(pkg.GoFiles) == 0 { + return nil, nil, fmt.Errorf("cannot resolve imports for package %q with no Go files", pkg.PkgPath) + } + pkgPath, err := toPkgPath(filepath.Dir(pkg.GoFiles[0]), imp.ID) + if err != nil { + return nil, nil, err + } + if _, ok := havePkgs[pkgPath]; !ok { + needPkgsSet[pkgPath] = true + } + } + } + + if overlayAddsImports { + needPkgs = make([]string, 0, len(needPkgsSet)) + for pkg := range needPkgsSet { + needPkgs = append(needPkgs, pkg) + } + } + modifiedPkgs = make([]string, 0, len(modifiedPkgsSet)) + for pkg := range modifiedPkgsSet { + modifiedPkgs = append(modifiedPkgs, pkg) + } + return modifiedPkgs, needPkgs, err +} + +// resolveImport finds the ID of a package given its import path. +// In particular, it will find the right vendored copy when in GOPATH mode. +func (state *golistState) resolveImport(sourceDir, importPath string) (string, error) { + env, err := state.getEnv() + if err != nil { + return "", err + } + if env["GOMOD"] != "" { + return importPath, nil + } + + searchDir := sourceDir + for { + vendorDir := filepath.Join(searchDir, "vendor") + exists, ok := state.vendorDirs[vendorDir] + if !ok { + info, err := os.Stat(vendorDir) + exists = err == nil && info.IsDir() + state.vendorDirs[vendorDir] = exists + } + + if exists { + vendoredPath := filepath.Join(vendorDir, importPath) + if info, err := os.Stat(vendoredPath); err == nil && info.IsDir() { + // We should probably check for .go files here, but shame on anyone who fools us. + path, ok, err := state.getPkgPath(vendoredPath) + if err != nil { + return "", err + } + if ok { + return path, nil + } + } + } + + // We know we've hit the top of the filesystem when we Dir / and get /, + // or C:\ and get C:\, etc. + next := filepath.Dir(searchDir) + if next == searchDir { + break + } + searchDir = next + } + return importPath, nil +} + +func hasTestFiles(p *Package) bool { + for _, f := range p.GoFiles { + if strings.HasSuffix(f, "_test.go") { + return true + } + } + return false +} + +// determineRootDirs returns a mapping from absolute directories that could +// contain code to their corresponding import path prefixes. +func (state *golistState) determineRootDirs() (map[string]string, error) { + env, err := state.getEnv() + if err != nil { + return nil, err + } + if env["GOMOD"] != "" { + state.rootsOnce.Do(func() { + state.rootDirs, state.rootDirsError = state.determineRootDirsModules() + }) + } else { + state.rootsOnce.Do(func() { + state.rootDirs, state.rootDirsError = state.determineRootDirsGOPATH() + }) + } + return state.rootDirs, state.rootDirsError +} + +func (state *golistState) determineRootDirsModules() (map[string]string, error) { + // List all of the modules--the first will be the directory for the main + // module. Any replaced modules will also need to be treated as roots. + // Editing files in the module cache isn't a great idea, so we don't + // plan to ever support that. + out, err := state.invokeGo("list", "-m", "-json", "all") + if err != nil { + // 'go list all' will fail if we're outside of a module and + // GO111MODULE=on. Try falling back without 'all'. + var innerErr error + out, innerErr = state.invokeGo("list", "-m", "-json") + if innerErr != nil { + return nil, err + } + } + roots := map[string]string{} + modules := map[string]string{} + var i int + for dec := json.NewDecoder(out); dec.More(); { + mod := new(gocommand.ModuleJSON) + if err := dec.Decode(mod); err != nil { + return nil, err + } + if mod.Dir != "" && mod.Path != "" { + // This is a valid module; add it to the map. + absDir, err := filepath.Abs(mod.Dir) + if err != nil { + return nil, err + } + modules[absDir] = mod.Path + // The first result is the main module. + if i == 0 || mod.Replace != nil && mod.Replace.Path != "" { + roots[absDir] = mod.Path + } + } + i++ + } + return roots, nil +} + +func (state *golistState) determineRootDirsGOPATH() (map[string]string, error) { + m := map[string]string{} + for _, dir := range filepath.SplitList(state.mustGetEnv()["GOPATH"]) { + absDir, err := filepath.Abs(dir) + if err != nil { + return nil, err + } + m[filepath.Join(absDir, "src")] = "" + } + return m, nil +} + +func extractImports(filename string, contents []byte) ([]string, error) { + f, err := parser.ParseFile(token.NewFileSet(), filename, contents, parser.ImportsOnly) // TODO(matloob): reuse fileset? + if err != nil { + return nil, err + } + var res []string + for _, imp := range f.Imports { + quotedPath := imp.Path.Value + path, err := strconv.Unquote(quotedPath) + if err != nil { + return nil, err + } + res = append(res, path) + } + return res, nil +} + +// reclaimPackage attempts to reuse a package that failed to load in an overlay. +// +// If the package has errors and has no Name, GoFiles, or Imports, +// then it's possible that it doesn't yet exist on disk. +func reclaimPackage(pkg *Package, id string, filename string, contents []byte) bool { + // TODO(rstambler): Check the message of the actual error? + // It differs between $GOPATH and module mode. + if pkg.ID != id { + return false + } + if len(pkg.Errors) != 1 { + return false + } + if pkg.Name != "" || pkg.ExportFile != "" { + return false + } + if len(pkg.GoFiles) > 0 || len(pkg.CompiledGoFiles) > 0 || len(pkg.OtherFiles) > 0 { + return false + } + if len(pkg.Imports) > 0 { + return false + } + pkgName, ok := extractPackageName(filename, contents) + if !ok { + return false + } + pkg.Name = pkgName + pkg.Errors = nil + return true +} + +func extractPackageName(filename string, contents []byte) (string, bool) { + // TODO(rstambler): Check the message of the actual error? + // It differs between $GOPATH and module mode. + f, err := parser.ParseFile(token.NewFileSet(), filename, contents, parser.PackageClauseOnly) // TODO(matloob): reuse fileset? + if err != nil { + return "", false + } + return f.Name.Name, true +} + +// commonDir returns the directory that all files are in, "" if files is empty, +// or an error if they aren't in the same directory. +func commonDir(files []string) (string, error) { + seen := make(map[string]bool) + for _, f := range files { + seen[filepath.Dir(f)] = true + } + if len(seen) > 1 { + return "", fmt.Errorf("files (%v) are in more than one directory: %v", files, seen) + } + for k := range seen { + // seen has only one element; return it. + return k, nil + } + return "", nil // no files +} + +// It is possible that the files in the disk directory dir have a different package +// name from newName, which is deduced from the overlays. If they all have a different +// package name, and they all have the same package name, then that name becomes +// the package name. +// It returns true if it changes the package name, false otherwise. +func maybeFixPackageName(newName string, isTestFile bool, pkgsOfDir []*Package) { + names := make(map[string]int) + for _, p := range pkgsOfDir { + names[p.Name]++ + } + if len(names) != 1 { + // some files are in different packages + return + } + var oldName string + for k := range names { + oldName = k + } + if newName == oldName { + return + } + // We might have a case where all of the package names in the directory are + // the same, but the overlay file is for an x test, which belongs to its + // own package. If the x test does not yet exist on disk, we may not yet + // have its package name on disk, but we should not rename the packages. + // + // We use a heuristic to determine if this file belongs to an x test: + // The test file should have a package name whose package name has a _test + // suffix or looks like "newName_test". + maybeXTest := strings.HasPrefix(oldName+"_test", newName) || strings.HasSuffix(newName, "_test") + if isTestFile && maybeXTest { + return + } + for _, p := range pkgsOfDir { + p.Name = newName + } +} + +// This function is copy-pasted from +// https://github.com/golang/go/blob/9706f510a5e2754595d716bd64be8375997311fb/src/cmd/go/internal/search/search.go#L360. +// It should be deleted when we remove support for overlays from go/packages. +// +// NOTE: This does not handle any ./... or ./ style queries, as this function +// doesn't know the working directory. +// +// matchPattern(pattern)(name) reports whether +// name matches pattern. Pattern is a limited glob +// pattern in which '...' means 'any string' and there +// is no other special syntax. +// Unfortunately, there are two special cases. Quoting "go help packages": +// +// First, /... at the end of the pattern can match an empty string, +// so that net/... matches both net and packages in its subdirectories, like net/http. +// Second, any slash-separated pattern element containing a wildcard never +// participates in a match of the "vendor" element in the path of a vendored +// package, so that ./... does not match packages in subdirectories of +// ./vendor or ./mycode/vendor, but ./vendor/... and ./mycode/vendor/... do. +// Note, however, that a directory named vendor that itself contains code +// is not a vendored package: cmd/vendor would be a command named vendor, +// and the pattern cmd/... matches it. +func matchPattern(pattern string) func(name string) bool { + // Convert pattern to regular expression. + // The strategy for the trailing /... is to nest it in an explicit ? expression. + // The strategy for the vendor exclusion is to change the unmatchable + // vendor strings to a disallowed code point (vendorChar) and to use + // "(anything but that codepoint)*" as the implementation of the ... wildcard. + // This is a bit complicated but the obvious alternative, + // namely a hand-written search like in most shell glob matchers, + // is too easy to make accidentally exponential. + // Using package regexp guarantees linear-time matching. + + const vendorChar = "\x00" + + if strings.Contains(pattern, vendorChar) { + return func(name string) bool { return false } + } + + re := regexp.QuoteMeta(pattern) + re = replaceVendor(re, vendorChar) + switch { + case strings.HasSuffix(re, `/`+vendorChar+`/\.\.\.`): + re = strings.TrimSuffix(re, `/`+vendorChar+`/\.\.\.`) + `(/vendor|/` + vendorChar + `/\.\.\.)` + case re == vendorChar+`/\.\.\.`: + re = `(/vendor|/` + vendorChar + `/\.\.\.)` + case strings.HasSuffix(re, `/\.\.\.`): + re = strings.TrimSuffix(re, `/\.\.\.`) + `(/\.\.\.)?` + } + re = strings.ReplaceAll(re, `\.\.\.`, `[^`+vendorChar+`]*`) + + reg := regexp.MustCompile(`^` + re + `$`) + + return func(name string) bool { + if strings.Contains(name, vendorChar) { + return false + } + return reg.MatchString(replaceVendor(name, vendorChar)) + } +} + +// replaceVendor returns the result of replacing +// non-trailing vendor path elements in x with repl. +func replaceVendor(x, repl string) string { + if !strings.Contains(x, "vendor") { + return x + } + elem := strings.Split(x, "/") + for i := 0; i < len(elem)-1; i++ { + if elem[i] == "vendor" { + elem[i] = repl + } + } + return strings.Join(elem, "/") +} diff --git a/vendor/golang.org/x/tools/go/packages/loadmode_string.go b/vendor/golang.org/x/tools/go/packages/loadmode_string.go new file mode 100644 index 000000000..5c080d21b --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/loadmode_string.go @@ -0,0 +1,57 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +import ( + "fmt" + "strings" +) + +var allModes = []LoadMode{ + NeedName, + NeedFiles, + NeedCompiledGoFiles, + NeedImports, + NeedDeps, + NeedExportFile, + NeedTypes, + NeedSyntax, + NeedTypesInfo, + NeedTypesSizes, +} + +var modeStrings = []string{ + "NeedName", + "NeedFiles", + "NeedCompiledGoFiles", + "NeedImports", + "NeedDeps", + "NeedExportFile", + "NeedTypes", + "NeedSyntax", + "NeedTypesInfo", + "NeedTypesSizes", +} + +func (mod LoadMode) String() string { + m := mod + if m == 0 { + return "LoadMode(0)" + } + var out []string + for i, x := range allModes { + if x > m { + break + } + if (m & x) != 0 { + out = append(out, modeStrings[i]) + m = m ^ x + } + } + if m != 0 { + out = append(out, "Unknown") + } + return fmt.Sprintf("LoadMode(%s)", strings.Join(out, "|")) +} diff --git a/vendor/golang.org/x/tools/go/packages/packages.go b/vendor/golang.org/x/tools/go/packages/packages.go new file mode 100644 index 000000000..da1a27eea --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/packages.go @@ -0,0 +1,1332 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +// See doc.go for package documentation and implementation notes. + +import ( + "context" + "encoding/json" + "fmt" + "go/ast" + "go/parser" + "go/scanner" + "go/token" + "go/types" + "io" + "io/ioutil" + "log" + "os" + "path/filepath" + "runtime" + "strings" + "sync" + "time" + + "golang.org/x/tools/go/gcexportdata" + "golang.org/x/tools/internal/gocommand" + "golang.org/x/tools/internal/packagesinternal" + "golang.org/x/tools/internal/typeparams" + "golang.org/x/tools/internal/typesinternal" +) + +// A LoadMode controls the amount of detail to return when loading. +// The bits below can be combined to specify which fields should be +// filled in the result packages. +// The zero value is a special case, equivalent to combining +// the NeedName, NeedFiles, and NeedCompiledGoFiles bits. +// ID and Errors (if present) will always be filled. +// Load may return more information than requested. +type LoadMode int + +const ( + // NeedName adds Name and PkgPath. + NeedName LoadMode = 1 << iota + + // NeedFiles adds GoFiles and OtherFiles. + NeedFiles + + // NeedCompiledGoFiles adds CompiledGoFiles. + NeedCompiledGoFiles + + // NeedImports adds Imports. If NeedDeps is not set, the Imports field will contain + // "placeholder" Packages with only the ID set. + NeedImports + + // NeedDeps adds the fields requested by the LoadMode in the packages in Imports. + NeedDeps + + // NeedExportFile adds ExportFile. + NeedExportFile + + // NeedTypes adds Types, Fset, and IllTyped. + NeedTypes + + // NeedSyntax adds Syntax. + NeedSyntax + + // NeedTypesInfo adds TypesInfo. + NeedTypesInfo + + // NeedTypesSizes adds TypesSizes. + NeedTypesSizes + + // needInternalDepsErrors adds the internal deps errors field for use by gopls. + needInternalDepsErrors + + // needInternalForTest adds the internal forTest field. + // Tests must also be set on the context for this field to be populated. + needInternalForTest + + // typecheckCgo enables full support for type checking cgo. Requires Go 1.15+. + // Modifies CompiledGoFiles and Types, and has no effect on its own. + typecheckCgo + + // NeedModule adds Module. + NeedModule + + // NeedEmbedFiles adds EmbedFiles. + NeedEmbedFiles + + // NeedEmbedPatterns adds EmbedPatterns. + NeedEmbedPatterns +) + +const ( + // Deprecated: LoadFiles exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadFiles = NeedName | NeedFiles | NeedCompiledGoFiles + + // Deprecated: LoadImports exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadImports = LoadFiles | NeedImports + + // Deprecated: LoadTypes exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadTypes = LoadImports | NeedTypes | NeedTypesSizes + + // Deprecated: LoadSyntax exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadSyntax = LoadTypes | NeedSyntax | NeedTypesInfo + + // Deprecated: LoadAllSyntax exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadAllSyntax = LoadSyntax | NeedDeps + + // Deprecated: NeedExportsFile is a historical misspelling of NeedExportFile. + NeedExportsFile = NeedExportFile +) + +// A Config specifies details about how packages should be loaded. +// The zero value is a valid configuration. +// Calls to Load do not modify this struct. +type Config struct { + // Mode controls the level of information returned for each package. + Mode LoadMode + + // Context specifies the context for the load operation. + // If the context is cancelled, the loader may stop early + // and return an ErrCancelled error. + // If Context is nil, the load cannot be cancelled. + Context context.Context + + // Logf is the logger for the config. + // If the user provides a logger, debug logging is enabled. + // If the GOPACKAGESDEBUG environment variable is set to true, + // but the logger is nil, default to log.Printf. + Logf func(format string, args ...interface{}) + + // Dir is the directory in which to run the build system's query tool + // that provides information about the packages. + // If Dir is empty, the tool is run in the current directory. + Dir string + + // Env is the environment to use when invoking the build system's query tool. + // If Env is nil, the current environment is used. + // As in os/exec's Cmd, only the last value in the slice for + // each environment key is used. To specify the setting of only + // a few variables, append to the current environment, as in: + // + // opt.Env = append(os.Environ(), "GOOS=plan9", "GOARCH=386") + // + Env []string + + // gocmdRunner guards go command calls from concurrency errors. + gocmdRunner *gocommand.Runner + + // BuildFlags is a list of command-line flags to be passed through to + // the build system's query tool. + BuildFlags []string + + // modFile will be used for -modfile in go command invocations. + modFile string + + // modFlag will be used for -modfile in go command invocations. + modFlag string + + // Fset provides source position information for syntax trees and types. + // If Fset is nil, Load will use a new fileset, but preserve Fset's value. + Fset *token.FileSet + + // ParseFile is called to read and parse each file + // when preparing a package's type-checked syntax tree. + // It must be safe to call ParseFile simultaneously from multiple goroutines. + // If ParseFile is nil, the loader will uses parser.ParseFile. + // + // ParseFile should parse the source from src and use filename only for + // recording position information. + // + // An application may supply a custom implementation of ParseFile + // to change the effective file contents or the behavior of the parser, + // or to modify the syntax tree. For example, selectively eliminating + // unwanted function bodies can significantly accelerate type checking. + ParseFile func(fset *token.FileSet, filename string, src []byte) (*ast.File, error) + + // If Tests is set, the loader includes not just the packages + // matching a particular pattern but also any related test packages, + // including test-only variants of the package and the test executable. + // + // For example, when using the go command, loading "fmt" with Tests=true + // returns four packages, with IDs "fmt" (the standard package), + // "fmt [fmt.test]" (the package as compiled for the test), + // "fmt_test" (the test functions from source files in package fmt_test), + // and "fmt.test" (the test binary). + // + // In build systems with explicit names for tests, + // setting Tests may have no effect. + Tests bool + + // Overlay provides a mapping of absolute file paths to file contents. + // If the file with the given path already exists, the parser will use the + // alternative file contents provided by the map. + // + // Overlays provide incomplete support for when a given file doesn't + // already exist on disk. See the package doc above for more details. + Overlay map[string][]byte +} + +// driver is the type for functions that query the build system for the +// packages named by the patterns. +type driver func(cfg *Config, patterns ...string) (*driverResponse, error) + +// driverResponse contains the results for a driver query. +type driverResponse struct { + // NotHandled is returned if the request can't be handled by the current + // driver. If an external driver returns a response with NotHandled, the + // rest of the driverResponse is ignored, and go/packages will fallback + // to the next driver. If go/packages is extended in the future to support + // lists of multiple drivers, go/packages will fall back to the next driver. + NotHandled bool + + // Sizes, if not nil, is the types.Sizes to use when type checking. + Sizes *types.StdSizes + + // Roots is the set of package IDs that make up the root packages. + // We have to encode this separately because when we encode a single package + // we cannot know if it is one of the roots as that requires knowledge of the + // graph it is part of. + Roots []string `json:",omitempty"` + + // Packages is the full set of packages in the graph. + // The packages are not connected into a graph. + // The Imports if populated will be stubs that only have their ID set. + // Imports will be connected and then type and syntax information added in a + // later pass (see refine). + Packages []*Package + + // GoVersion is the minor version number used by the driver + // (e.g. the go command on the PATH) when selecting .go files. + // Zero means unknown. + GoVersion int +} + +// Load loads and returns the Go packages named by the given patterns. +// +// Config specifies loading options; +// nil behaves the same as an empty Config. +// +// Load returns an error if any of the patterns was invalid +// as defined by the underlying build system. +// It may return an empty list of packages without an error, +// for instance for an empty expansion of a valid wildcard. +// Errors associated with a particular package are recorded in the +// corresponding Package's Errors list, and do not cause Load to +// return an error. Clients may need to handle such errors before +// proceeding with further analysis. The PrintErrors function is +// provided for convenient display of all errors. +func Load(cfg *Config, patterns ...string) ([]*Package, error) { + l := newLoader(cfg) + response, err := defaultDriver(&l.Config, patterns...) + if err != nil { + return nil, err + } + l.sizes = response.Sizes + return l.refine(response) +} + +// defaultDriver is a driver that implements go/packages' fallback behavior. +// It will try to request to an external driver, if one exists. If there's +// no external driver, or the driver returns a response with NotHandled set, +// defaultDriver will fall back to the go list driver. +func defaultDriver(cfg *Config, patterns ...string) (*driverResponse, error) { + driver := findExternalDriver(cfg) + if driver == nil { + driver = goListDriver + } + response, err := driver(cfg, patterns...) + if err != nil { + return response, err + } else if response.NotHandled { + return goListDriver(cfg, patterns...) + } + return response, nil +} + +// A Package describes a loaded Go package. +type Package struct { + // ID is a unique identifier for a package, + // in a syntax provided by the underlying build system. + // + // Because the syntax varies based on the build system, + // clients should treat IDs as opaque and not attempt to + // interpret them. + ID string + + // Name is the package name as it appears in the package source code. + Name string + + // PkgPath is the package path as used by the go/types package. + PkgPath string + + // Errors contains any errors encountered querying the metadata + // of the package, or while parsing or type-checking its files. + Errors []Error + + // TypeErrors contains the subset of errors produced during type checking. + TypeErrors []types.Error + + // GoFiles lists the absolute file paths of the package's Go source files. + // It may include files that should not be compiled, for example because + // they contain non-matching build tags, are documentary pseudo-files such as + // unsafe/unsafe.go or builtin/builtin.go, or are subject to cgo preprocessing. + GoFiles []string + + // CompiledGoFiles lists the absolute file paths of the package's source + // files that are suitable for type checking. + // This may differ from GoFiles if files are processed before compilation. + CompiledGoFiles []string + + // OtherFiles lists the absolute file paths of the package's non-Go source files, + // including assembly, C, C++, Fortran, Objective-C, SWIG, and so on. + OtherFiles []string + + // EmbedFiles lists the absolute file paths of the package's files + // embedded with go:embed. + EmbedFiles []string + + // EmbedPatterns lists the absolute file patterns of the package's + // files embedded with go:embed. + EmbedPatterns []string + + // IgnoredFiles lists source files that are not part of the package + // using the current build configuration but that might be part of + // the package using other build configurations. + IgnoredFiles []string + + // ExportFile is the absolute path to a file containing type + // information for the package as provided by the build system. + ExportFile string + + // Imports maps import paths appearing in the package's Go source files + // to corresponding loaded Packages. + Imports map[string]*Package + + // Types provides type information for the package. + // The NeedTypes LoadMode bit sets this field for packages matching the + // patterns; type information for dependencies may be missing or incomplete, + // unless NeedDeps and NeedImports are also set. + Types *types.Package + + // Fset provides position information for Types, TypesInfo, and Syntax. + // It is set only when Types is set. + Fset *token.FileSet + + // IllTyped indicates whether the package or any dependency contains errors. + // It is set only when Types is set. + IllTyped bool + + // Syntax is the package's syntax trees, for the files listed in CompiledGoFiles. + // + // The NeedSyntax LoadMode bit populates this field for packages matching the patterns. + // If NeedDeps and NeedImports are also set, this field will also be populated + // for dependencies. + // + // Syntax is kept in the same order as CompiledGoFiles, with the caveat that nils are + // removed. If parsing returned nil, Syntax may be shorter than CompiledGoFiles. + Syntax []*ast.File + + // TypesInfo provides type information about the package's syntax trees. + // It is set only when Syntax is set. + TypesInfo *types.Info + + // TypesSizes provides the effective size function for types in TypesInfo. + TypesSizes types.Sizes + + // forTest is the package under test, if any. + forTest string + + // depsErrors is the DepsErrors field from the go list response, if any. + depsErrors []*packagesinternal.PackageError + + // module is the module information for the package if it exists. + Module *Module +} + +// Module provides module information for a package. +type Module struct { + Path string // module path + Version string // module version + Replace *Module // replaced by this module + Time *time.Time // time version was created + Main bool // is this the main module? + Indirect bool // is this module only an indirect dependency of main module? + Dir string // directory holding files for this module, if any + GoMod string // path to go.mod file used when loading this module, if any + GoVersion string // go version used in module + Error *ModuleError // error loading module +} + +// ModuleError holds errors loading a module. +type ModuleError struct { + Err string // the error itself +} + +func init() { + packagesinternal.GetForTest = func(p interface{}) string { + return p.(*Package).forTest + } + packagesinternal.GetDepsErrors = func(p interface{}) []*packagesinternal.PackageError { + return p.(*Package).depsErrors + } + packagesinternal.GetGoCmdRunner = func(config interface{}) *gocommand.Runner { + return config.(*Config).gocmdRunner + } + packagesinternal.SetGoCmdRunner = func(config interface{}, runner *gocommand.Runner) { + config.(*Config).gocmdRunner = runner + } + packagesinternal.SetModFile = func(config interface{}, value string) { + config.(*Config).modFile = value + } + packagesinternal.SetModFlag = func(config interface{}, value string) { + config.(*Config).modFlag = value + } + packagesinternal.TypecheckCgo = int(typecheckCgo) + packagesinternal.DepsErrors = int(needInternalDepsErrors) + packagesinternal.ForTest = int(needInternalForTest) +} + +// An Error describes a problem with a package's metadata, syntax, or types. +type Error struct { + Pos string // "file:line:col" or "file:line" or "" or "-" + Msg string + Kind ErrorKind +} + +// ErrorKind describes the source of the error, allowing the user to +// differentiate between errors generated by the driver, the parser, or the +// type-checker. +type ErrorKind int + +const ( + UnknownError ErrorKind = iota + ListError + ParseError + TypeError +) + +func (err Error) Error() string { + pos := err.Pos + if pos == "" { + pos = "-" // like token.Position{}.String() + } + return pos + ": " + err.Msg +} + +// flatPackage is the JSON form of Package +// It drops all the type and syntax fields, and transforms the Imports +// +// TODO(adonovan): identify this struct with Package, effectively +// publishing the JSON protocol. +type flatPackage struct { + ID string + Name string `json:",omitempty"` + PkgPath string `json:",omitempty"` + Errors []Error `json:",omitempty"` + GoFiles []string `json:",omitempty"` + CompiledGoFiles []string `json:",omitempty"` + OtherFiles []string `json:",omitempty"` + EmbedFiles []string `json:",omitempty"` + EmbedPatterns []string `json:",omitempty"` + IgnoredFiles []string `json:",omitempty"` + ExportFile string `json:",omitempty"` + Imports map[string]string `json:",omitempty"` +} + +// MarshalJSON returns the Package in its JSON form. +// For the most part, the structure fields are written out unmodified, and +// the type and syntax fields are skipped. +// The imports are written out as just a map of path to package id. +// The errors are written using a custom type that tries to preserve the +// structure of error types we know about. +// +// This method exists to enable support for additional build systems. It is +// not intended for use by clients of the API and we may change the format. +func (p *Package) MarshalJSON() ([]byte, error) { + flat := &flatPackage{ + ID: p.ID, + Name: p.Name, + PkgPath: p.PkgPath, + Errors: p.Errors, + GoFiles: p.GoFiles, + CompiledGoFiles: p.CompiledGoFiles, + OtherFiles: p.OtherFiles, + EmbedFiles: p.EmbedFiles, + EmbedPatterns: p.EmbedPatterns, + IgnoredFiles: p.IgnoredFiles, + ExportFile: p.ExportFile, + } + if len(p.Imports) > 0 { + flat.Imports = make(map[string]string, len(p.Imports)) + for path, ipkg := range p.Imports { + flat.Imports[path] = ipkg.ID + } + } + return json.Marshal(flat) +} + +// UnmarshalJSON reads in a Package from its JSON format. +// See MarshalJSON for details about the format accepted. +func (p *Package) UnmarshalJSON(b []byte) error { + flat := &flatPackage{} + if err := json.Unmarshal(b, &flat); err != nil { + return err + } + *p = Package{ + ID: flat.ID, + Name: flat.Name, + PkgPath: flat.PkgPath, + Errors: flat.Errors, + GoFiles: flat.GoFiles, + CompiledGoFiles: flat.CompiledGoFiles, + OtherFiles: flat.OtherFiles, + EmbedFiles: flat.EmbedFiles, + EmbedPatterns: flat.EmbedPatterns, + ExportFile: flat.ExportFile, + } + if len(flat.Imports) > 0 { + p.Imports = make(map[string]*Package, len(flat.Imports)) + for path, id := range flat.Imports { + p.Imports[path] = &Package{ID: id} + } + } + return nil +} + +func (p *Package) String() string { return p.ID } + +// loaderPackage augments Package with state used during the loading phase +type loaderPackage struct { + *Package + importErrors map[string]error // maps each bad import to its error + loadOnce sync.Once + color uint8 // for cycle detection + needsrc bool // load from source (Mode >= LoadTypes) + needtypes bool // type information is either requested or depended on + initial bool // package was matched by a pattern + goVersion int // minor version number of go command on PATH +} + +// loader holds the working state of a single call to load. +type loader struct { + pkgs map[string]*loaderPackage + Config + sizes types.Sizes + parseCache map[string]*parseValue + parseCacheMu sync.Mutex + exportMu sync.Mutex // enforces mutual exclusion of exportdata operations + + // Config.Mode contains the implied mode (see impliedLoadMode). + // Implied mode contains all the fields we need the data for. + // In requestedMode there are the actually requested fields. + // We'll zero them out before returning packages to the user. + // This makes it easier for us to get the conditions where + // we need certain modes right. + requestedMode LoadMode +} + +type parseValue struct { + f *ast.File + err error + ready chan struct{} +} + +func newLoader(cfg *Config) *loader { + ld := &loader{ + parseCache: map[string]*parseValue{}, + } + if cfg != nil { + ld.Config = *cfg + // If the user has provided a logger, use it. + ld.Config.Logf = cfg.Logf + } + if ld.Config.Logf == nil { + // If the GOPACKAGESDEBUG environment variable is set to true, + // but the user has not provided a logger, default to log.Printf. + if debug { + ld.Config.Logf = log.Printf + } else { + ld.Config.Logf = func(format string, args ...interface{}) {} + } + } + if ld.Config.Mode == 0 { + ld.Config.Mode = NeedName | NeedFiles | NeedCompiledGoFiles // Preserve zero behavior of Mode for backwards compatibility. + } + if ld.Config.Env == nil { + ld.Config.Env = os.Environ() + } + if ld.Config.gocmdRunner == nil { + ld.Config.gocmdRunner = &gocommand.Runner{} + } + if ld.Context == nil { + ld.Context = context.Background() + } + if ld.Dir == "" { + if dir, err := os.Getwd(); err == nil { + ld.Dir = dir + } + } + + // Save the actually requested fields. We'll zero them out before returning packages to the user. + ld.requestedMode = ld.Mode + ld.Mode = impliedLoadMode(ld.Mode) + + if ld.Mode&NeedTypes != 0 || ld.Mode&NeedSyntax != 0 { + if ld.Fset == nil { + ld.Fset = token.NewFileSet() + } + + // ParseFile is required even in LoadTypes mode + // because we load source if export data is missing. + if ld.ParseFile == nil { + ld.ParseFile = func(fset *token.FileSet, filename string, src []byte) (*ast.File, error) { + const mode = parser.AllErrors | parser.ParseComments + return parser.ParseFile(fset, filename, src, mode) + } + } + } + + return ld +} + +// refine connects the supplied packages into a graph and then adds type +// and syntax information as requested by the LoadMode. +func (ld *loader) refine(response *driverResponse) ([]*Package, error) { + roots := response.Roots + rootMap := make(map[string]int, len(roots)) + for i, root := range roots { + rootMap[root] = i + } + ld.pkgs = make(map[string]*loaderPackage) + // first pass, fixup and build the map and roots + var initial = make([]*loaderPackage, len(roots)) + for _, pkg := range response.Packages { + rootIndex := -1 + if i, found := rootMap[pkg.ID]; found { + rootIndex = i + } + + // Overlays can invalidate export data. + // TODO(matloob): make this check fine-grained based on dependencies on overlaid files + exportDataInvalid := len(ld.Overlay) > 0 || pkg.ExportFile == "" && pkg.PkgPath != "unsafe" + // This package needs type information if the caller requested types and the package is + // either a root, or it's a non-root and the user requested dependencies ... + needtypes := (ld.Mode&NeedTypes|NeedTypesInfo != 0 && (rootIndex >= 0 || ld.Mode&NeedDeps != 0)) + // This package needs source if the call requested source (or types info, which implies source) + // and the package is either a root, or itas a non- root and the user requested dependencies... + needsrc := ((ld.Mode&(NeedSyntax|NeedTypesInfo) != 0 && (rootIndex >= 0 || ld.Mode&NeedDeps != 0)) || + // ... or if we need types and the exportData is invalid. We fall back to (incompletely) + // typechecking packages from source if they fail to compile. + (ld.Mode&(NeedTypes|NeedTypesInfo) != 0 && exportDataInvalid)) && pkg.PkgPath != "unsafe" + lpkg := &loaderPackage{ + Package: pkg, + needtypes: needtypes, + needsrc: needsrc, + goVersion: response.GoVersion, + } + ld.pkgs[lpkg.ID] = lpkg + if rootIndex >= 0 { + initial[rootIndex] = lpkg + lpkg.initial = true + } + } + for i, root := range roots { + if initial[i] == nil { + return nil, fmt.Errorf("root package %v is missing", root) + } + } + + // Materialize the import graph. + + const ( + white = 0 // new + grey = 1 // in progress + black = 2 // complete + ) + + // visit traverses the import graph, depth-first, + // and materializes the graph as Packages.Imports. + // + // Valid imports are saved in the Packages.Import map. + // Invalid imports (cycles and missing nodes) are saved in the importErrors map. + // Thus, even in the presence of both kinds of errors, the Import graph remains a DAG. + // + // visit returns whether the package needs src or has a transitive + // dependency on a package that does. These are the only packages + // for which we load source code. + var stack []*loaderPackage + var visit func(lpkg *loaderPackage) bool + var srcPkgs []*loaderPackage + visit = func(lpkg *loaderPackage) bool { + switch lpkg.color { + case black: + return lpkg.needsrc + case grey: + panic("internal error: grey node") + } + lpkg.color = grey + stack = append(stack, lpkg) // push + stubs := lpkg.Imports // the structure form has only stubs with the ID in the Imports + // If NeedImports isn't set, the imports fields will all be zeroed out. + if ld.Mode&NeedImports != 0 { + lpkg.Imports = make(map[string]*Package, len(stubs)) + for importPath, ipkg := range stubs { + var importErr error + imp := ld.pkgs[ipkg.ID] + if imp == nil { + // (includes package "C" when DisableCgo) + importErr = fmt.Errorf("missing package: %q", ipkg.ID) + } else if imp.color == grey { + importErr = fmt.Errorf("import cycle: %s", stack) + } + if importErr != nil { + if lpkg.importErrors == nil { + lpkg.importErrors = make(map[string]error) + } + lpkg.importErrors[importPath] = importErr + continue + } + + if visit(imp) { + lpkg.needsrc = true + } + lpkg.Imports[importPath] = imp.Package + } + } + if lpkg.needsrc { + srcPkgs = append(srcPkgs, lpkg) + } + if ld.Mode&NeedTypesSizes != 0 { + lpkg.TypesSizes = ld.sizes + } + stack = stack[:len(stack)-1] // pop + lpkg.color = black + + return lpkg.needsrc + } + + if ld.Mode&NeedImports == 0 { + // We do this to drop the stub import packages that we are not even going to try to resolve. + for _, lpkg := range initial { + lpkg.Imports = nil + } + } else { + // For each initial package, create its import DAG. + for _, lpkg := range initial { + visit(lpkg) + } + } + if ld.Mode&NeedImports != 0 && ld.Mode&NeedTypes != 0 { + for _, lpkg := range srcPkgs { + // Complete type information is required for the + // immediate dependencies of each source package. + for _, ipkg := range lpkg.Imports { + imp := ld.pkgs[ipkg.ID] + imp.needtypes = true + } + } + } + // Load type data and syntax if needed, starting at + // the initial packages (roots of the import DAG). + if ld.Mode&NeedTypes != 0 || ld.Mode&NeedSyntax != 0 { + var wg sync.WaitGroup + for _, lpkg := range initial { + wg.Add(1) + go func(lpkg *loaderPackage) { + ld.loadRecursive(lpkg) + wg.Done() + }(lpkg) + } + wg.Wait() + } + + result := make([]*Package, len(initial)) + for i, lpkg := range initial { + result[i] = lpkg.Package + } + for i := range ld.pkgs { + // Clear all unrequested fields, + // to catch programs that use more than they request. + if ld.requestedMode&NeedName == 0 { + ld.pkgs[i].Name = "" + ld.pkgs[i].PkgPath = "" + } + if ld.requestedMode&NeedFiles == 0 { + ld.pkgs[i].GoFiles = nil + ld.pkgs[i].OtherFiles = nil + ld.pkgs[i].IgnoredFiles = nil + } + if ld.requestedMode&NeedEmbedFiles == 0 { + ld.pkgs[i].EmbedFiles = nil + } + if ld.requestedMode&NeedEmbedPatterns == 0 { + ld.pkgs[i].EmbedPatterns = nil + } + if ld.requestedMode&NeedCompiledGoFiles == 0 { + ld.pkgs[i].CompiledGoFiles = nil + } + if ld.requestedMode&NeedImports == 0 { + ld.pkgs[i].Imports = nil + } + if ld.requestedMode&NeedExportFile == 0 { + ld.pkgs[i].ExportFile = "" + } + if ld.requestedMode&NeedTypes == 0 { + ld.pkgs[i].Types = nil + ld.pkgs[i].Fset = nil + ld.pkgs[i].IllTyped = false + } + if ld.requestedMode&NeedSyntax == 0 { + ld.pkgs[i].Syntax = nil + } + if ld.requestedMode&NeedTypesInfo == 0 { + ld.pkgs[i].TypesInfo = nil + } + if ld.requestedMode&NeedTypesSizes == 0 { + ld.pkgs[i].TypesSizes = nil + } + if ld.requestedMode&NeedModule == 0 { + ld.pkgs[i].Module = nil + } + } + + return result, nil +} + +// loadRecursive loads the specified package and its dependencies, +// recursively, in parallel, in topological order. +// It is atomic and idempotent. +// Precondition: ld.Mode&NeedTypes. +func (ld *loader) loadRecursive(lpkg *loaderPackage) { + lpkg.loadOnce.Do(func() { + // Load the direct dependencies, in parallel. + var wg sync.WaitGroup + for _, ipkg := range lpkg.Imports { + imp := ld.pkgs[ipkg.ID] + wg.Add(1) + go func(imp *loaderPackage) { + ld.loadRecursive(imp) + wg.Done() + }(imp) + } + wg.Wait() + ld.loadPackage(lpkg) + }) +} + +// loadPackage loads the specified package. +// It must be called only once per Package, +// after immediate dependencies are loaded. +// Precondition: ld.Mode & NeedTypes. +func (ld *loader) loadPackage(lpkg *loaderPackage) { + if lpkg.PkgPath == "unsafe" { + // Fill in the blanks to avoid surprises. + lpkg.Types = types.Unsafe + lpkg.Fset = ld.Fset + lpkg.Syntax = []*ast.File{} + lpkg.TypesInfo = new(types.Info) + lpkg.TypesSizes = ld.sizes + return + } + + // Call NewPackage directly with explicit name. + // This avoids skew between golist and go/types when the files' + // package declarations are inconsistent. + lpkg.Types = types.NewPackage(lpkg.PkgPath, lpkg.Name) + lpkg.Fset = ld.Fset + + // Subtle: we populate all Types fields with an empty Package + // before loading export data so that export data processing + // never has to create a types.Package for an indirect dependency, + // which would then require that such created packages be explicitly + // inserted back into the Import graph as a final step after export data loading. + // (Hence this return is after the Types assignment.) + // The Diamond test exercises this case. + if !lpkg.needtypes && !lpkg.needsrc { + return + } + if !lpkg.needsrc { + if err := ld.loadFromExportData(lpkg); err != nil { + lpkg.Errors = append(lpkg.Errors, Error{ + Pos: "-", + Msg: err.Error(), + Kind: UnknownError, // e.g. can't find/open/parse export data + }) + } + return // not a source package, don't get syntax trees + } + + appendError := func(err error) { + // Convert various error types into the one true Error. + var errs []Error + switch err := err.(type) { + case Error: + // from driver + errs = append(errs, err) + + case *os.PathError: + // from parser + errs = append(errs, Error{ + Pos: err.Path + ":1", + Msg: err.Err.Error(), + Kind: ParseError, + }) + + case scanner.ErrorList: + // from parser + for _, err := range err { + errs = append(errs, Error{ + Pos: err.Pos.String(), + Msg: err.Msg, + Kind: ParseError, + }) + } + + case types.Error: + // from type checker + lpkg.TypeErrors = append(lpkg.TypeErrors, err) + errs = append(errs, Error{ + Pos: err.Fset.Position(err.Pos).String(), + Msg: err.Msg, + Kind: TypeError, + }) + + default: + // unexpected impoverished error from parser? + errs = append(errs, Error{ + Pos: "-", + Msg: err.Error(), + Kind: UnknownError, + }) + + // If you see this error message, please file a bug. + log.Printf("internal error: error %q (%T) without position", err, err) + } + + lpkg.Errors = append(lpkg.Errors, errs...) + } + + // If the go command on the PATH is newer than the runtime, + // then the go/{scanner,ast,parser,types} packages from the + // standard library may be unable to process the files + // selected by go list. + // + // There is currently no way to downgrade the effective + // version of the go command (see issue 52078), so we proceed + // with the newer go command but, in case of parse or type + // errors, we emit an additional diagnostic. + // + // See: + // - golang.org/issue/52078 (flag to set release tags) + // - golang.org/issue/50825 (gopls legacy version support) + // - golang.org/issue/55883 (go/packages confusing error) + // + // Should we assert a hard minimum of (currently) go1.16 here? + var runtimeVersion int + if _, err := fmt.Sscanf(runtime.Version(), "go1.%d", &runtimeVersion); err == nil && runtimeVersion < lpkg.goVersion { + defer func() { + if len(lpkg.Errors) > 0 { + appendError(Error{ + Pos: "-", + Msg: fmt.Sprintf("This application uses version go1.%d of the source-processing packages but runs version go1.%d of 'go list'. It may fail to process source files that rely on newer language features. If so, rebuild the application using a newer version of Go.", runtimeVersion, lpkg.goVersion), + Kind: UnknownError, + }) + } + }() + } + + if ld.Config.Mode&NeedTypes != 0 && len(lpkg.CompiledGoFiles) == 0 && lpkg.ExportFile != "" { + // The config requested loading sources and types, but sources are missing. + // Add an error to the package and fall back to loading from export data. + appendError(Error{"-", fmt.Sprintf("sources missing for package %s", lpkg.ID), ParseError}) + _ = ld.loadFromExportData(lpkg) // ignore any secondary errors + + return // can't get syntax trees for this package + } + + files, errs := ld.parseFiles(lpkg.CompiledGoFiles) + for _, err := range errs { + appendError(err) + } + + lpkg.Syntax = files + if ld.Config.Mode&NeedTypes == 0 { + return + } + + lpkg.TypesInfo = &types.Info{ + Types: make(map[ast.Expr]types.TypeAndValue), + Defs: make(map[*ast.Ident]types.Object), + Uses: make(map[*ast.Ident]types.Object), + Implicits: make(map[ast.Node]types.Object), + Scopes: make(map[ast.Node]*types.Scope), + Selections: make(map[*ast.SelectorExpr]*types.Selection), + } + typeparams.InitInstanceInfo(lpkg.TypesInfo) + lpkg.TypesSizes = ld.sizes + + importer := importerFunc(func(path string) (*types.Package, error) { + if path == "unsafe" { + return types.Unsafe, nil + } + + // The imports map is keyed by import path. + ipkg := lpkg.Imports[path] + if ipkg == nil { + if err := lpkg.importErrors[path]; err != nil { + return nil, err + } + // There was skew between the metadata and the + // import declarations, likely due to an edit + // race, or because the ParseFile feature was + // used to supply alternative file contents. + return nil, fmt.Errorf("no metadata for %s", path) + } + + if ipkg.Types != nil && ipkg.Types.Complete() { + return ipkg.Types, nil + } + log.Fatalf("internal error: package %q without types was imported from %q", path, lpkg) + panic("unreachable") + }) + + // type-check + tc := &types.Config{ + Importer: importer, + + // Type-check bodies of functions only in initial packages. + // Example: for import graph A->B->C and initial packages {A,C}, + // we can ignore function bodies in B. + IgnoreFuncBodies: ld.Mode&NeedDeps == 0 && !lpkg.initial, + + Error: appendError, + Sizes: ld.sizes, + } + if lpkg.Module != nil && lpkg.Module.GoVersion != "" { + typesinternal.SetGoVersion(tc, "go"+lpkg.Module.GoVersion) + } + if (ld.Mode & typecheckCgo) != 0 { + if !typesinternal.SetUsesCgo(tc) { + appendError(Error{ + Msg: "typecheckCgo requires Go 1.15+", + Kind: ListError, + }) + return + } + } + types.NewChecker(tc, ld.Fset, lpkg.Types, lpkg.TypesInfo).Files(lpkg.Syntax) + + lpkg.importErrors = nil // no longer needed + + // If !Cgo, the type-checker uses FakeImportC mode, so + // it doesn't invoke the importer for import "C", + // nor report an error for the import, + // or for any undefined C.f reference. + // We must detect this explicitly and correctly + // mark the package as IllTyped (by reporting an error). + // TODO(adonovan): if these errors are annoying, + // we could just set IllTyped quietly. + if tc.FakeImportC { + outer: + for _, f := range lpkg.Syntax { + for _, imp := range f.Imports { + if imp.Path.Value == `"C"` { + err := types.Error{Fset: ld.Fset, Pos: imp.Pos(), Msg: `import "C" ignored`} + appendError(err) + break outer + } + } + } + } + + // Record accumulated errors. + illTyped := len(lpkg.Errors) > 0 + if !illTyped { + for _, imp := range lpkg.Imports { + if imp.IllTyped { + illTyped = true + break + } + } + } + lpkg.IllTyped = illTyped +} + +// An importFunc is an implementation of the single-method +// types.Importer interface based on a function value. +type importerFunc func(path string) (*types.Package, error) + +func (f importerFunc) Import(path string) (*types.Package, error) { return f(path) } + +// We use a counting semaphore to limit +// the number of parallel I/O calls per process. +var ioLimit = make(chan bool, 20) + +func (ld *loader) parseFile(filename string) (*ast.File, error) { + ld.parseCacheMu.Lock() + v, ok := ld.parseCache[filename] + if ok { + // cache hit + ld.parseCacheMu.Unlock() + <-v.ready + } else { + // cache miss + v = &parseValue{ready: make(chan struct{})} + ld.parseCache[filename] = v + ld.parseCacheMu.Unlock() + + var src []byte + for f, contents := range ld.Config.Overlay { + if sameFile(f, filename) { + src = contents + } + } + var err error + if src == nil { + ioLimit <- true // wait + src, err = ioutil.ReadFile(filename) + <-ioLimit // signal + } + if err != nil { + v.err = err + } else { + v.f, v.err = ld.ParseFile(ld.Fset, filename, src) + } + + close(v.ready) + } + return v.f, v.err +} + +// parseFiles reads and parses the Go source files and returns the ASTs +// of the ones that could be at least partially parsed, along with a +// list of I/O and parse errors encountered. +// +// Because files are scanned in parallel, the token.Pos +// positions of the resulting ast.Files are not ordered. +func (ld *loader) parseFiles(filenames []string) ([]*ast.File, []error) { + var wg sync.WaitGroup + n := len(filenames) + parsed := make([]*ast.File, n) + errors := make([]error, n) + for i, file := range filenames { + if ld.Config.Context.Err() != nil { + parsed[i] = nil + errors[i] = ld.Config.Context.Err() + continue + } + wg.Add(1) + go func(i int, filename string) { + parsed[i], errors[i] = ld.parseFile(filename) + wg.Done() + }(i, file) + } + wg.Wait() + + // Eliminate nils, preserving order. + var o int + for _, f := range parsed { + if f != nil { + parsed[o] = f + o++ + } + } + parsed = parsed[:o] + + o = 0 + for _, err := range errors { + if err != nil { + errors[o] = err + o++ + } + } + errors = errors[:o] + + return parsed, errors +} + +// sameFile returns true if x and y have the same basename and denote +// the same file. +func sameFile(x, y string) bool { + if x == y { + // It could be the case that y doesn't exist. + // For instance, it may be an overlay file that + // hasn't been written to disk. To handle that case + // let x == y through. (We added the exact absolute path + // string to the CompiledGoFiles list, so the unwritten + // overlay case implies x==y.) + return true + } + if strings.EqualFold(filepath.Base(x), filepath.Base(y)) { // (optimisation) + if xi, err := os.Stat(x); err == nil { + if yi, err := os.Stat(y); err == nil { + return os.SameFile(xi, yi) + } + } + } + return false +} + +// loadFromExportData ensures that type information is present for the specified +// package, loading it from an export data file on the first request. +// On success it sets lpkg.Types to a new Package. +func (ld *loader) loadFromExportData(lpkg *loaderPackage) error { + if lpkg.PkgPath == "" { + log.Fatalf("internal error: Package %s has no PkgPath", lpkg) + } + + // Because gcexportdata.Read has the potential to create or + // modify the types.Package for each node in the transitive + // closure of dependencies of lpkg, all exportdata operations + // must be sequential. (Finer-grained locking would require + // changes to the gcexportdata API.) + // + // The exportMu lock guards the lpkg.Types field and the + // types.Package it points to, for each loaderPackage in the graph. + // + // Not all accesses to Package.Pkg need to be protected by exportMu: + // graph ordering ensures that direct dependencies of source + // packages are fully loaded before the importer reads their Pkg field. + ld.exportMu.Lock() + defer ld.exportMu.Unlock() + + if tpkg := lpkg.Types; tpkg != nil && tpkg.Complete() { + return nil // cache hit + } + + lpkg.IllTyped = true // fail safe + + if lpkg.ExportFile == "" { + // Errors while building export data will have been printed to stderr. + return fmt.Errorf("no export data file") + } + f, err := os.Open(lpkg.ExportFile) + if err != nil { + return err + } + defer f.Close() + + // Read gc export data. + // + // We don't currently support gccgo export data because all + // underlying workspaces use the gc toolchain. (Even build + // systems that support gccgo don't use it for workspace + // queries.) + r, err := gcexportdata.NewReader(f) + if err != nil { + return fmt.Errorf("reading %s: %v", lpkg.ExportFile, err) + } + + // Build the view. + // + // The gcexportdata machinery has no concept of package ID. + // It identifies packages by their PkgPath, which although not + // globally unique is unique within the scope of one invocation + // of the linker, type-checker, or gcexportdata. + // + // So, we must build a PkgPath-keyed view of the global + // (conceptually ID-keyed) cache of packages and pass it to + // gcexportdata. The view must contain every existing + // package that might possibly be mentioned by the + // current package---its transitive closure. + // + // In loadPackage, we unconditionally create a types.Package for + // each dependency so that export data loading does not + // create new ones. + // + // TODO(adonovan): it would be simpler and more efficient + // if the export data machinery invoked a callback to + // get-or-create a package instead of a map. + // + view := make(map[string]*types.Package) // view seen by gcexportdata + seen := make(map[*loaderPackage]bool) // all visited packages + var visit func(pkgs map[string]*Package) + visit = func(pkgs map[string]*Package) { + for _, p := range pkgs { + lpkg := ld.pkgs[p.ID] + if !seen[lpkg] { + seen[lpkg] = true + view[lpkg.PkgPath] = lpkg.Types + visit(lpkg.Imports) + } + } + } + visit(lpkg.Imports) + + viewLen := len(view) + 1 // adding the self package + // Parse the export data. + // (May modify incomplete packages in view but not create new ones.) + tpkg, err := gcexportdata.Read(r, ld.Fset, view, lpkg.PkgPath) + if err != nil { + return fmt.Errorf("reading %s: %v", lpkg.ExportFile, err) + } + if _, ok := view["go.shape"]; ok { + // Account for the pseudopackage "go.shape" that gets + // created by generic code. + viewLen++ + } + if viewLen != len(view) { + log.Panicf("golang.org/x/tools/go/packages: unexpected new packages during load of %s", lpkg.PkgPath) + } + + lpkg.Types = tpkg + lpkg.IllTyped = false + return nil +} + +// impliedLoadMode returns loadMode with its dependencies. +func impliedLoadMode(loadMode LoadMode) LoadMode { + if loadMode&(NeedDeps|NeedTypes|NeedTypesInfo) != 0 { + // All these things require knowing the import graph. + loadMode |= NeedImports + } + + return loadMode +} + +func usesExportData(cfg *Config) bool { + return cfg.Mode&NeedExportFile != 0 || cfg.Mode&NeedTypes != 0 && cfg.Mode&NeedDeps == 0 +} + +var _ interface{} = io.Discard // assert build toolchain is go1.16 or later diff --git a/vendor/golang.org/x/tools/go/packages/visit.go b/vendor/golang.org/x/tools/go/packages/visit.go new file mode 100644 index 000000000..a1dcc40b7 --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/visit.go @@ -0,0 +1,59 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +import ( + "fmt" + "os" + "sort" +) + +// Visit visits all the packages in the import graph whose roots are +// pkgs, calling the optional pre function the first time each package +// is encountered (preorder), and the optional post function after a +// package's dependencies have been visited (postorder). +// The boolean result of pre(pkg) determines whether +// the imports of package pkg are visited. +func Visit(pkgs []*Package, pre func(*Package) bool, post func(*Package)) { + seen := make(map[*Package]bool) + var visit func(*Package) + visit = func(pkg *Package) { + if !seen[pkg] { + seen[pkg] = true + + if pre == nil || pre(pkg) { + paths := make([]string, 0, len(pkg.Imports)) + for path := range pkg.Imports { + paths = append(paths, path) + } + sort.Strings(paths) // Imports is a map, this makes visit stable + for _, path := range paths { + visit(pkg.Imports[path]) + } + } + + if post != nil { + post(pkg) + } + } + } + for _, pkg := range pkgs { + visit(pkg) + } +} + +// PrintErrors prints to os.Stderr the accumulated errors of all +// packages in the import graph rooted at pkgs, dependencies first. +// PrintErrors returns the number of errors printed. +func PrintErrors(pkgs []*Package) int { + var n int + Visit(pkgs, nil, func(pkg *Package) { + for _, err := range pkg.Errors { + fmt.Fprintln(os.Stderr, err) + n++ + } + }) + return n +} diff --git a/vendor/golang.org/x/tools/go/types/objectpath/objectpath.go b/vendor/golang.org/x/tools/go/types/objectpath/objectpath.go new file mode 100644 index 000000000..c725d839b --- /dev/null +++ b/vendor/golang.org/x/tools/go/types/objectpath/objectpath.go @@ -0,0 +1,824 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package objectpath defines a naming scheme for types.Objects +// (that is, named entities in Go programs) relative to their enclosing +// package. +// +// Type-checker objects are canonical, so they are usually identified by +// their address in memory (a pointer), but a pointer has meaning only +// within one address space. By contrast, objectpath names allow the +// identity of an object to be sent from one program to another, +// establishing a correspondence between types.Object variables that are +// distinct but logically equivalent. +// +// A single object may have multiple paths. In this example, +// +// type A struct{ X int } +// type B A +// +// the field X has two paths due to its membership of both A and B. +// The For(obj) function always returns one of these paths, arbitrarily +// but consistently. +package objectpath + +import ( + "fmt" + "go/types" + "sort" + "strconv" + "strings" + _ "unsafe" + + "golang.org/x/tools/internal/typeparams" +) + +// A Path is an opaque name that identifies a types.Object +// relative to its package. Conceptually, the name consists of a +// sequence of destructuring operations applied to the package scope +// to obtain the original object. +// The name does not include the package itself. +type Path string + +// Encoding +// +// An object path is a textual and (with training) human-readable encoding +// of a sequence of destructuring operators, starting from a types.Package. +// The sequences represent a path through the package/object/type graph. +// We classify these operators by their type: +// +// PO package->object Package.Scope.Lookup +// OT object->type Object.Type +// TT type->type Type.{Elem,Key,Params,Results,Underlying} [EKPRU] +// TO type->object Type.{At,Field,Method,Obj} [AFMO] +// +// All valid paths start with a package and end at an object +// and thus may be defined by the regular language: +// +// objectpath = PO (OT TT* TO)* +// +// The concrete encoding follows directly: +// - The only PO operator is Package.Scope.Lookup, which requires an identifier. +// - The only OT operator is Object.Type, +// which we encode as '.' because dot cannot appear in an identifier. +// - The TT operators are encoded as [EKPRUTC]; +// one of these (TypeParam) requires an integer operand, +// which is encoded as a string of decimal digits. +// - The TO operators are encoded as [AFMO]; +// three of these (At,Field,Method) require an integer operand, +// which is encoded as a string of decimal digits. +// These indices are stable across different representations +// of the same package, even source and export data. +// The indices used are implementation specific and may not correspond to +// the argument to the go/types function. +// +// In the example below, +// +// package p +// +// type T interface { +// f() (a string, b struct{ X int }) +// } +// +// field X has the path "T.UM0.RA1.F0", +// representing the following sequence of operations: +// +// p.Lookup("T") T +// .Type().Underlying().Method(0). f +// .Type().Results().At(1) b +// .Type().Field(0) X +// +// The encoding is not maximally compact---every R or P is +// followed by an A, for example---but this simplifies the +// encoder and decoder. +const ( + // object->type operators + opType = '.' // .Type() (Object) + + // type->type operators + opElem = 'E' // .Elem() (Pointer, Slice, Array, Chan, Map) + opKey = 'K' // .Key() (Map) + opParams = 'P' // .Params() (Signature) + opResults = 'R' // .Results() (Signature) + opUnderlying = 'U' // .Underlying() (Named) + opTypeParam = 'T' // .TypeParams.At(i) (Named, Signature) + opConstraint = 'C' // .Constraint() (TypeParam) + + // type->object operators + opAt = 'A' // .At(i) (Tuple) + opField = 'F' // .Field(i) (Struct) + opMethod = 'M' // .Method(i) (Named or Interface; not Struct: "promoted" names are ignored) + opObj = 'O' // .Obj() (Named, TypeParam) +) + +// For is equivalent to new(Encoder).For(obj). +// +// It may be more efficient to reuse a single Encoder across several calls. +func For(obj types.Object) (Path, error) { + return new(Encoder).For(obj) +} + +// An Encoder amortizes the cost of encoding the paths of multiple objects. +// The zero value of an Encoder is ready to use. +type Encoder struct { + scopeMemo map[*types.Scope][]types.Object // memoization of scopeObjects + namedMethodsMemo map[*types.Named][]*types.Func // memoization of namedMethods() + skipMethodSorting bool +} + +// Exposed to gopls via golang.org/x/tools/internal/typesinternal +// TODO(golang/go#61443): eliminate this parameter one way or the other. +// +//go:linkname skipMethodSorting +func skipMethodSorting(enc *Encoder) { + enc.skipMethodSorting = true +} + +// For returns the path to an object relative to its package, +// or an error if the object is not accessible from the package's Scope. +// +// The For function guarantees to return a path only for the following objects: +// - package-level types +// - exported package-level non-types +// - methods +// - parameter and result variables +// - struct fields +// These objects are sufficient to define the API of their package. +// The objects described by a package's export data are drawn from this set. +// +// The set of objects accessible from a package's Scope depends on +// whether the package was produced by type-checking syntax, or +// reading export data; the latter may have a smaller Scope since +// export data trims objects that are not reachable from an exported +// declaration. For example, the For function will return a path for +// an exported method of an unexported type that is not reachable +// from any public declaration; this path will cause the Object +// function to fail if called on a package loaded from export data. +// TODO(adonovan): is this a bug or feature? Should this package +// compute accessibility in the same way? +// +// For does not return a path for predeclared names, imported package +// names, local names, and unexported package-level names (except +// types). +// +// Example: given this definition, +// +// package p +// +// type T interface { +// f() (a string, b struct{ X int }) +// } +// +// For(X) would return a path that denotes the following sequence of operations: +// +// p.Scope().Lookup("T") (TypeName T) +// .Type().Underlying().Method(0). (method Func f) +// .Type().Results().At(1) (field Var b) +// .Type().Field(0) (field Var X) +// +// where p is the package (*types.Package) to which X belongs. +func (enc *Encoder) For(obj types.Object) (Path, error) { + pkg := obj.Pkg() + + // This table lists the cases of interest. + // + // Object Action + // ------ ------ + // nil reject + // builtin reject + // pkgname reject + // label reject + // var + // package-level accept + // func param/result accept + // local reject + // struct field accept + // const + // package-level accept + // local reject + // func + // package-level accept + // init functions reject + // concrete method accept + // interface method accept + // type + // package-level accept + // local reject + // + // The only accessible package-level objects are members of pkg itself. + // + // The cases are handled in four steps: + // + // 1. reject nil and builtin + // 2. accept package-level objects + // 3. reject obviously invalid objects + // 4. search the API for the path to the param/result/field/method. + + // 1. reference to nil or builtin? + if pkg == nil { + return "", fmt.Errorf("predeclared %s has no path", obj) + } + scope := pkg.Scope() + + // 2. package-level object? + if scope.Lookup(obj.Name()) == obj { + // Only exported objects (and non-exported types) have a path. + // Non-exported types may be referenced by other objects. + if _, ok := obj.(*types.TypeName); !ok && !obj.Exported() { + return "", fmt.Errorf("no path for non-exported %v", obj) + } + return Path(obj.Name()), nil + } + + // 3. Not a package-level object. + // Reject obviously non-viable cases. + switch obj := obj.(type) { + case *types.TypeName: + if _, ok := obj.Type().(*typeparams.TypeParam); !ok { + // With the exception of type parameters, only package-level type names + // have a path. + return "", fmt.Errorf("no path for %v", obj) + } + case *types.Const, // Only package-level constants have a path. + *types.Label, // Labels are function-local. + *types.PkgName: // PkgNames are file-local. + return "", fmt.Errorf("no path for %v", obj) + + case *types.Var: + // Could be: + // - a field (obj.IsField()) + // - a func parameter or result + // - a local var. + // Sadly there is no way to distinguish + // a param/result from a local + // so we must proceed to the find. + + case *types.Func: + // A func, if not package-level, must be a method. + if recv := obj.Type().(*types.Signature).Recv(); recv == nil { + return "", fmt.Errorf("func is not a method: %v", obj) + } + + if path, ok := enc.concreteMethod(obj); ok { + // Fast path for concrete methods that avoids looping over scope. + return path, nil + } + + default: + panic(obj) + } + + // 4. Search the API for the path to the var (field/param/result) or method. + + // First inspect package-level named types. + // In the presence of path aliases, these give + // the best paths because non-types may + // refer to types, but not the reverse. + empty := make([]byte, 0, 48) // initial space + objs := enc.scopeObjects(scope) + for _, o := range objs { + tname, ok := o.(*types.TypeName) + if !ok { + continue // handle non-types in second pass + } + + path := append(empty, o.Name()...) + path = append(path, opType) + + T := o.Type() + + if tname.IsAlias() { + // type alias + if r := find(obj, T, path, nil); r != nil { + return Path(r), nil + } + } else { + if named, _ := T.(*types.Named); named != nil { + if r := findTypeParam(obj, typeparams.ForNamed(named), path, nil); r != nil { + // generic named type + return Path(r), nil + } + } + // defined (named) type + if r := find(obj, T.Underlying(), append(path, opUnderlying), nil); r != nil { + return Path(r), nil + } + } + } + + // Then inspect everything else: + // non-types, and declared methods of defined types. + for _, o := range objs { + path := append(empty, o.Name()...) + if _, ok := o.(*types.TypeName); !ok { + if o.Exported() { + // exported non-type (const, var, func) + if r := find(obj, o.Type(), append(path, opType), nil); r != nil { + return Path(r), nil + } + } + continue + } + + // Inspect declared methods of defined types. + if T, ok := o.Type().(*types.Named); ok { + path = append(path, opType) + if !enc.skipMethodSorting { + // Note that method index here is always with respect + // to canonical ordering of methods, regardless of how + // they appear in the underlying type. + for i, m := range enc.namedMethods(T) { + path2 := appendOpArg(path, opMethod, i) + if m == obj { + return Path(path2), nil // found declared method + } + if r := find(obj, m.Type(), append(path2, opType), nil); r != nil { + return Path(r), nil + } + } + } else { + // This branch must match the logic in the branch above, using go/types + // APIs without sorting. + for i := 0; i < T.NumMethods(); i++ { + m := T.Method(i) + path2 := appendOpArg(path, opMethod, i) + if m == obj { + return Path(path2), nil // found declared method + } + if r := find(obj, m.Type(), append(path2, opType), nil); r != nil { + return Path(r), nil + } + } + } + } + } + + return "", fmt.Errorf("can't find path for %v in %s", obj, pkg.Path()) +} + +func appendOpArg(path []byte, op byte, arg int) []byte { + path = append(path, op) + path = strconv.AppendInt(path, int64(arg), 10) + return path +} + +// concreteMethod returns the path for meth, which must have a non-nil receiver. +// The second return value indicates success and may be false if the method is +// an interface method or if it is an instantiated method. +// +// This function is just an optimization that avoids the general scope walking +// approach. You are expected to fall back to the general approach if this +// function fails. +func (enc *Encoder) concreteMethod(meth *types.Func) (Path, bool) { + // Concrete methods can only be declared on package-scoped named types. For + // that reason we can skip the expensive walk over the package scope: the + // path will always be package -> named type -> method. We can trivially get + // the type name from the receiver, and only have to look over the type's + // methods to find the method index. + // + // Methods on generic types require special consideration, however. Consider + // the following package: + // + // L1: type S[T any] struct{} + // L2: func (recv S[A]) Foo() { recv.Bar() } + // L3: func (recv S[B]) Bar() { } + // L4: type Alias = S[int] + // L5: func _[T any]() { var s S[int]; s.Foo() } + // + // The receivers of methods on generic types are instantiations. L2 and L3 + // instantiate S with the type-parameters A and B, which are scoped to the + // respective methods. L4 and L5 each instantiate S with int. Each of these + // instantiations has its own method set, full of methods (and thus objects) + // with receivers whose types are the respective instantiations. In other + // words, we have + // + // S[A].Foo, S[A].Bar + // S[B].Foo, S[B].Bar + // S[int].Foo, S[int].Bar + // + // We may thus be trying to produce object paths for any of these objects. + // + // S[A].Foo and S[B].Bar are the origin methods, and their paths are S.Foo + // and S.Bar, which are the paths that this function naturally produces. + // + // S[A].Bar, S[B].Foo, and both methods on S[int] are instantiations that + // don't correspond to the origin methods. For S[int], this is significant. + // The most precise object path for S[int].Foo, for example, is Alias.Foo, + // not S.Foo. Our function, however, would produce S.Foo, which would + // resolve to a different object. + // + // For S[A].Bar and S[B].Foo it could be argued that S.Bar and S.Foo are + // still the correct paths, since only the origin methods have meaningful + // paths. But this is likely only true for trivial cases and has edge cases. + // Since this function is only an optimization, we err on the side of giving + // up, deferring to the slower but definitely correct algorithm. Most users + // of objectpath will only be giving us origin methods, anyway, as referring + // to instantiated methods is usually not useful. + + if typeparams.OriginMethod(meth) != meth { + return "", false + } + + recvT := meth.Type().(*types.Signature).Recv().Type() + if ptr, ok := recvT.(*types.Pointer); ok { + recvT = ptr.Elem() + } + + named, ok := recvT.(*types.Named) + if !ok { + return "", false + } + + if types.IsInterface(named) { + // Named interfaces don't have to be package-scoped + // + // TODO(dominikh): opt: if scope.Lookup(name) == named, then we can apply this optimization to interface + // methods, too, I think. + return "", false + } + + // Preallocate space for the name, opType, opMethod, and some digits. + name := named.Obj().Name() + path := make([]byte, 0, len(name)+8) + path = append(path, name...) + path = append(path, opType) + + if !enc.skipMethodSorting { + for i, m := range enc.namedMethods(named) { + if m == meth { + path = appendOpArg(path, opMethod, i) + return Path(path), true + } + } + } else { + // This branch must match the logic of the branch above, using go/types + // APIs without sorting. + for i := 0; i < named.NumMethods(); i++ { + m := named.Method(i) + if m == meth { + path = appendOpArg(path, opMethod, i) + return Path(path), true + } + } + } + + // Due to golang/go#59944, go/types fails to associate the receiver with + // certain methods on cgo types. + // + // TODO(rfindley): replace this panic once golang/go#59944 is fixed in all Go + // versions gopls supports. + return "", false + // panic(fmt.Sprintf("couldn't find method %s on type %s; methods: %#v", meth, named, enc.namedMethods(named))) +} + +// find finds obj within type T, returning the path to it, or nil if not found. +// +// The seen map is used to short circuit cycles through type parameters. If +// nil, it will be allocated as necessary. +func find(obj types.Object, T types.Type, path []byte, seen map[*types.TypeName]bool) []byte { + switch T := T.(type) { + case *types.Basic, *types.Named: + // Named types belonging to pkg were handled already, + // so T must belong to another package. No path. + return nil + case *types.Pointer: + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Slice: + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Array: + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Chan: + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Map: + if r := find(obj, T.Key(), append(path, opKey), seen); r != nil { + return r + } + return find(obj, T.Elem(), append(path, opElem), seen) + case *types.Signature: + if r := findTypeParam(obj, typeparams.ForSignature(T), path, seen); r != nil { + return r + } + if r := find(obj, T.Params(), append(path, opParams), seen); r != nil { + return r + } + return find(obj, T.Results(), append(path, opResults), seen) + case *types.Struct: + for i := 0; i < T.NumFields(); i++ { + fld := T.Field(i) + path2 := appendOpArg(path, opField, i) + if fld == obj { + return path2 // found field var + } + if r := find(obj, fld.Type(), append(path2, opType), seen); r != nil { + return r + } + } + return nil + case *types.Tuple: + for i := 0; i < T.Len(); i++ { + v := T.At(i) + path2 := appendOpArg(path, opAt, i) + if v == obj { + return path2 // found param/result var + } + if r := find(obj, v.Type(), append(path2, opType), seen); r != nil { + return r + } + } + return nil + case *types.Interface: + for i := 0; i < T.NumMethods(); i++ { + m := T.Method(i) + path2 := appendOpArg(path, opMethod, i) + if m == obj { + return path2 // found interface method + } + if r := find(obj, m.Type(), append(path2, opType), seen); r != nil { + return r + } + } + return nil + case *typeparams.TypeParam: + name := T.Obj() + if name == obj { + return append(path, opObj) + } + if seen[name] { + return nil + } + if seen == nil { + seen = make(map[*types.TypeName]bool) + } + seen[name] = true + if r := find(obj, T.Constraint(), append(path, opConstraint), seen); r != nil { + return r + } + return nil + } + panic(T) +} + +func findTypeParam(obj types.Object, list *typeparams.TypeParamList, path []byte, seen map[*types.TypeName]bool) []byte { + for i := 0; i < list.Len(); i++ { + tparam := list.At(i) + path2 := appendOpArg(path, opTypeParam, i) + if r := find(obj, tparam, path2, seen); r != nil { + return r + } + } + return nil +} + +// Object returns the object denoted by path p within the package pkg. +func Object(pkg *types.Package, p Path) (types.Object, error) { + return object(pkg, p, false) +} + +// Note: the skipMethodSorting parameter must match the value of +// Encoder.skipMethodSorting used during encoding. +func object(pkg *types.Package, p Path, skipMethodSorting bool) (types.Object, error) { + if p == "" { + return nil, fmt.Errorf("empty path") + } + + pathstr := string(p) + var pkgobj, suffix string + if dot := strings.IndexByte(pathstr, opType); dot < 0 { + pkgobj = pathstr + } else { + pkgobj = pathstr[:dot] + suffix = pathstr[dot:] // suffix starts with "." + } + + obj := pkg.Scope().Lookup(pkgobj) + if obj == nil { + return nil, fmt.Errorf("package %s does not contain %q", pkg.Path(), pkgobj) + } + + // abstraction of *types.{Pointer,Slice,Array,Chan,Map} + type hasElem interface { + Elem() types.Type + } + // abstraction of *types.{Named,Signature} + type hasTypeParams interface { + TypeParams() *typeparams.TypeParamList + } + // abstraction of *types.{Named,TypeParam} + type hasObj interface { + Obj() *types.TypeName + } + + // The loop state is the pair (t, obj), + // exactly one of which is non-nil, initially obj. + // All suffixes start with '.' (the only object->type operation), + // followed by optional type->type operations, + // then a type->object operation. + // The cycle then repeats. + var t types.Type + for suffix != "" { + code := suffix[0] + suffix = suffix[1:] + + // Codes [AFM] have an integer operand. + var index int + switch code { + case opAt, opField, opMethod, opTypeParam: + rest := strings.TrimLeft(suffix, "0123456789") + numerals := suffix[:len(suffix)-len(rest)] + suffix = rest + i, err := strconv.Atoi(numerals) + if err != nil { + return nil, fmt.Errorf("invalid path: bad numeric operand %q for code %q", numerals, code) + } + index = int(i) + case opObj: + // no operand + default: + // The suffix must end with a type->object operation. + if suffix == "" { + return nil, fmt.Errorf("invalid path: ends with %q, want [AFMO]", code) + } + } + + if code == opType { + if t != nil { + return nil, fmt.Errorf("invalid path: unexpected %q in type context", opType) + } + t = obj.Type() + obj = nil + continue + } + + if t == nil { + return nil, fmt.Errorf("invalid path: code %q in object context", code) + } + + // Inv: t != nil, obj == nil + + switch code { + case opElem: + hasElem, ok := t.(hasElem) // Pointer, Slice, Array, Chan, Map + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want pointer, slice, array, chan or map)", code, t, t) + } + t = hasElem.Elem() + + case opKey: + mapType, ok := t.(*types.Map) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want map)", code, t, t) + } + t = mapType.Key() + + case opParams: + sig, ok := t.(*types.Signature) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want signature)", code, t, t) + } + t = sig.Params() + + case opResults: + sig, ok := t.(*types.Signature) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want signature)", code, t, t) + } + t = sig.Results() + + case opUnderlying: + named, ok := t.(*types.Named) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want named)", code, t, t) + } + t = named.Underlying() + + case opTypeParam: + hasTypeParams, ok := t.(hasTypeParams) // Named, Signature + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want named or signature)", code, t, t) + } + tparams := hasTypeParams.TypeParams() + if n := tparams.Len(); index >= n { + return nil, fmt.Errorf("tuple index %d out of range [0-%d)", index, n) + } + t = tparams.At(index) + + case opConstraint: + tparam, ok := t.(*typeparams.TypeParam) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want type parameter)", code, t, t) + } + t = tparam.Constraint() + + case opAt: + tuple, ok := t.(*types.Tuple) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want tuple)", code, t, t) + } + if n := tuple.Len(); index >= n { + return nil, fmt.Errorf("tuple index %d out of range [0-%d)", index, n) + } + obj = tuple.At(index) + t = nil + + case opField: + structType, ok := t.(*types.Struct) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want struct)", code, t, t) + } + if n := structType.NumFields(); index >= n { + return nil, fmt.Errorf("field index %d out of range [0-%d)", index, n) + } + obj = structType.Field(index) + t = nil + + case opMethod: + switch t := t.(type) { + case *types.Interface: + if index >= t.NumMethods() { + return nil, fmt.Errorf("method index %d out of range [0-%d)", index, t.NumMethods()) + } + obj = t.Method(index) // Id-ordered + + case *types.Named: + if index >= t.NumMethods() { + return nil, fmt.Errorf("method index %d out of range [0-%d)", index, t.NumMethods()) + } + if skipMethodSorting { + obj = t.Method(index) + } else { + methods := namedMethods(t) // (unmemoized) + obj = methods[index] // Id-ordered + } + + default: + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want interface or named)", code, t, t) + } + t = nil + + case opObj: + hasObj, ok := t.(hasObj) + if !ok { + return nil, fmt.Errorf("cannot apply %q to %s (got %T, want named or type param)", code, t, t) + } + obj = hasObj.Obj() + t = nil + + default: + return nil, fmt.Errorf("invalid path: unknown code %q", code) + } + } + + if obj.Pkg() != pkg { + return nil, fmt.Errorf("path denotes %s, which belongs to a different package", obj) + } + + return obj, nil // success +} + +// namedMethods returns the methods of a Named type in ascending Id order. +func namedMethods(named *types.Named) []*types.Func { + methods := make([]*types.Func, named.NumMethods()) + for i := range methods { + methods[i] = named.Method(i) + } + sort.Slice(methods, func(i, j int) bool { + return methods[i].Id() < methods[j].Id() + }) + return methods +} + +// namedMethods is a memoization of the namedMethods function. Callers must not modify the result. +func (enc *Encoder) namedMethods(named *types.Named) []*types.Func { + m := enc.namedMethodsMemo + if m == nil { + m = make(map[*types.Named][]*types.Func) + enc.namedMethodsMemo = m + } + methods, ok := m[named] + if !ok { + methods = namedMethods(named) // allocates and sorts + m[named] = methods + } + return methods +} + +// scopeObjects is a memoization of scope objects. +// Callers must not modify the result. +func (enc *Encoder) scopeObjects(scope *types.Scope) []types.Object { + m := enc.scopeMemo + if m == nil { + m = make(map[*types.Scope][]types.Object) + enc.scopeMemo = m + } + objs, ok := m[scope] + if !ok { + names := scope.Names() // allocates and sorts + objs = make([]types.Object, len(names)) + for i, name := range names { + objs[i] = scope.Lookup(name) + } + m[scope] = objs + } + return objs +} diff --git a/vendor/golang.org/x/tools/internal/event/core/event.go b/vendor/golang.org/x/tools/internal/event/core/event.go new file mode 100644 index 000000000..a6cf0e64a --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/core/event.go @@ -0,0 +1,85 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package core provides support for event based telemetry. +package core + +import ( + "fmt" + "time" + + "golang.org/x/tools/internal/event/label" +) + +// Event holds the information about an event of note that occurred. +type Event struct { + at time.Time + + // As events are often on the stack, storing the first few labels directly + // in the event can avoid an allocation at all for the very common cases of + // simple events. + // The length needs to be large enough to cope with the majority of events + // but no so large as to cause undue stack pressure. + // A log message with two values will use 3 labels (one for each value and + // one for the message itself). + + static [3]label.Label // inline storage for the first few labels + dynamic []label.Label // dynamically sized storage for remaining labels +} + +// eventLabelMap implements label.Map for a the labels of an Event. +type eventLabelMap struct { + event Event +} + +func (ev Event) At() time.Time { return ev.at } + +func (ev Event) Format(f fmt.State, r rune) { + if !ev.at.IsZero() { + fmt.Fprint(f, ev.at.Format("2006/01/02 15:04:05 ")) + } + for index := 0; ev.Valid(index); index++ { + if l := ev.Label(index); l.Valid() { + fmt.Fprintf(f, "\n\t%v", l) + } + } +} + +func (ev Event) Valid(index int) bool { + return index >= 0 && index < len(ev.static)+len(ev.dynamic) +} + +func (ev Event) Label(index int) label.Label { + if index < len(ev.static) { + return ev.static[index] + } + return ev.dynamic[index-len(ev.static)] +} + +func (ev Event) Find(key label.Key) label.Label { + for _, l := range ev.static { + if l.Key() == key { + return l + } + } + for _, l := range ev.dynamic { + if l.Key() == key { + return l + } + } + return label.Label{} +} + +func MakeEvent(static [3]label.Label, labels []label.Label) Event { + return Event{ + static: static, + dynamic: labels, + } +} + +// CloneEvent event returns a copy of the event with the time adjusted to at. +func CloneEvent(ev Event, at time.Time) Event { + ev.at = at + return ev +} diff --git a/vendor/golang.org/x/tools/internal/event/core/export.go b/vendor/golang.org/x/tools/internal/event/core/export.go new file mode 100644 index 000000000..05f3a9a57 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/core/export.go @@ -0,0 +1,70 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package core + +import ( + "context" + "sync/atomic" + "time" + "unsafe" + + "golang.org/x/tools/internal/event/label" +) + +// Exporter is a function that handles events. +// It may return a modified context and event. +type Exporter func(context.Context, Event, label.Map) context.Context + +var ( + exporter unsafe.Pointer +) + +// SetExporter sets the global exporter function that handles all events. +// The exporter is called synchronously from the event call site, so it should +// return quickly so as not to hold up user code. +func SetExporter(e Exporter) { + p := unsafe.Pointer(&e) + if e == nil { + // &e is always valid, and so p is always valid, but for the early abort + // of ProcessEvent to be efficient it needs to make the nil check on the + // pointer without having to dereference it, so we make the nil function + // also a nil pointer + p = nil + } + atomic.StorePointer(&exporter, p) +} + +// deliver is called to deliver an event to the supplied exporter. +// it will fill in the time. +func deliver(ctx context.Context, exporter Exporter, ev Event) context.Context { + // add the current time to the event + ev.at = time.Now() + // hand the event off to the current exporter + return exporter(ctx, ev, ev) +} + +// Export is called to deliver an event to the global exporter if set. +func Export(ctx context.Context, ev Event) context.Context { + // get the global exporter and abort early if there is not one + exporterPtr := (*Exporter)(atomic.LoadPointer(&exporter)) + if exporterPtr == nil { + return ctx + } + return deliver(ctx, *exporterPtr, ev) +} + +// ExportPair is called to deliver a start event to the supplied exporter. +// It also returns a function that will deliver the end event to the same +// exporter. +// It will fill in the time. +func ExportPair(ctx context.Context, begin, end Event) (context.Context, func()) { + // get the global exporter and abort early if there is not one + exporterPtr := (*Exporter)(atomic.LoadPointer(&exporter)) + if exporterPtr == nil { + return ctx, func() {} + } + ctx = deliver(ctx, *exporterPtr, begin) + return ctx, func() { deliver(ctx, *exporterPtr, end) } +} diff --git a/vendor/golang.org/x/tools/internal/event/core/fast.go b/vendor/golang.org/x/tools/internal/event/core/fast.go new file mode 100644 index 000000000..06c1d4615 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/core/fast.go @@ -0,0 +1,77 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package core + +import ( + "context" + + "golang.org/x/tools/internal/event/keys" + "golang.org/x/tools/internal/event/label" +) + +// Log1 takes a message and one label delivers a log event to the exporter. +// It is a customized version of Print that is faster and does no allocation. +func Log1(ctx context.Context, message string, t1 label.Label) { + Export(ctx, MakeEvent([3]label.Label{ + keys.Msg.Of(message), + t1, + }, nil)) +} + +// Log2 takes a message and two labels and delivers a log event to the exporter. +// It is a customized version of Print that is faster and does no allocation. +func Log2(ctx context.Context, message string, t1 label.Label, t2 label.Label) { + Export(ctx, MakeEvent([3]label.Label{ + keys.Msg.Of(message), + t1, + t2, + }, nil)) +} + +// Metric1 sends a label event to the exporter with the supplied labels. +func Metric1(ctx context.Context, t1 label.Label) context.Context { + return Export(ctx, MakeEvent([3]label.Label{ + keys.Metric.New(), + t1, + }, nil)) +} + +// Metric2 sends a label event to the exporter with the supplied labels. +func Metric2(ctx context.Context, t1, t2 label.Label) context.Context { + return Export(ctx, MakeEvent([3]label.Label{ + keys.Metric.New(), + t1, + t2, + }, nil)) +} + +// Start1 sends a span start event with the supplied label list to the exporter. +// It also returns a function that will end the span, which should normally be +// deferred. +func Start1(ctx context.Context, name string, t1 label.Label) (context.Context, func()) { + return ExportPair(ctx, + MakeEvent([3]label.Label{ + keys.Start.Of(name), + t1, + }, nil), + MakeEvent([3]label.Label{ + keys.End.New(), + }, nil)) +} + +// Start2 sends a span start event with the supplied label list to the exporter. +// It also returns a function that will end the span, which should normally be +// deferred. +func Start2(ctx context.Context, name string, t1, t2 label.Label) (context.Context, func()) { + return ExportPair(ctx, + MakeEvent([3]label.Label{ + keys.Start.Of(name), + t1, + t2, + }, nil), + MakeEvent([3]label.Label{ + keys.End.New(), + }, nil)) +} diff --git a/vendor/golang.org/x/tools/internal/event/doc.go b/vendor/golang.org/x/tools/internal/event/doc.go new file mode 100644 index 000000000..5dc6e6bab --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/doc.go @@ -0,0 +1,7 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package event provides a set of packages that cover the main +// concepts of telemetry in an implementation agnostic way. +package event diff --git a/vendor/golang.org/x/tools/internal/event/event.go b/vendor/golang.org/x/tools/internal/event/event.go new file mode 100644 index 000000000..4d55e577d --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/event.go @@ -0,0 +1,127 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package event + +import ( + "context" + + "golang.org/x/tools/internal/event/core" + "golang.org/x/tools/internal/event/keys" + "golang.org/x/tools/internal/event/label" +) + +// Exporter is a function that handles events. +// It may return a modified context and event. +type Exporter func(context.Context, core.Event, label.Map) context.Context + +// SetExporter sets the global exporter function that handles all events. +// The exporter is called synchronously from the event call site, so it should +// return quickly so as not to hold up user code. +func SetExporter(e Exporter) { + core.SetExporter(core.Exporter(e)) +} + +// Log takes a message and a label list and combines them into a single event +// before delivering them to the exporter. +func Log(ctx context.Context, message string, labels ...label.Label) { + core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Msg.Of(message), + }, labels)) +} + +// IsLog returns true if the event was built by the Log function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsLog(ev core.Event) bool { + return ev.Label(0).Key() == keys.Msg +} + +// Error takes a message and a label list and combines them into a single event +// before delivering them to the exporter. It captures the error in the +// delivered event. +func Error(ctx context.Context, message string, err error, labels ...label.Label) { + core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Msg.Of(message), + keys.Err.Of(err), + }, labels)) +} + +// IsError returns true if the event was built by the Error function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsError(ev core.Event) bool { + return ev.Label(0).Key() == keys.Msg && + ev.Label(1).Key() == keys.Err +} + +// Metric sends a label event to the exporter with the supplied labels. +func Metric(ctx context.Context, labels ...label.Label) { + core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Metric.New(), + }, labels)) +} + +// IsMetric returns true if the event was built by the Metric function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsMetric(ev core.Event) bool { + return ev.Label(0).Key() == keys.Metric +} + +// Label sends a label event to the exporter with the supplied labels. +func Label(ctx context.Context, labels ...label.Label) context.Context { + return core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Label.New(), + }, labels)) +} + +// IsLabel returns true if the event was built by the Label function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsLabel(ev core.Event) bool { + return ev.Label(0).Key() == keys.Label +} + +// Start sends a span start event with the supplied label list to the exporter. +// It also returns a function that will end the span, which should normally be +// deferred. +func Start(ctx context.Context, name string, labels ...label.Label) (context.Context, func()) { + return core.ExportPair(ctx, + core.MakeEvent([3]label.Label{ + keys.Start.Of(name), + }, labels), + core.MakeEvent([3]label.Label{ + keys.End.New(), + }, nil)) +} + +// IsStart returns true if the event was built by the Start function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsStart(ev core.Event) bool { + return ev.Label(0).Key() == keys.Start +} + +// IsEnd returns true if the event was built by the End function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsEnd(ev core.Event) bool { + return ev.Label(0).Key() == keys.End +} + +// Detach returns a context without an associated span. +// This allows the creation of spans that are not children of the current span. +func Detach(ctx context.Context) context.Context { + return core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Detach.New(), + }, nil)) +} + +// IsDetach returns true if the event was built by the Detach function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsDetach(ev core.Event) bool { + return ev.Label(0).Key() == keys.Detach +} diff --git a/vendor/golang.org/x/tools/internal/event/keys/keys.go b/vendor/golang.org/x/tools/internal/event/keys/keys.go new file mode 100644 index 000000000..a02206e30 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/keys/keys.go @@ -0,0 +1,564 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package keys + +import ( + "fmt" + "io" + "math" + "strconv" + + "golang.org/x/tools/internal/event/label" +) + +// Value represents a key for untyped values. +type Value struct { + name string + description string +} + +// New creates a new Key for untyped values. +func New(name, description string) *Value { + return &Value{name: name, description: description} +} + +func (k *Value) Name() string { return k.name } +func (k *Value) Description() string { return k.description } + +func (k *Value) Format(w io.Writer, buf []byte, l label.Label) { + fmt.Fprint(w, k.From(l)) +} + +// Get can be used to get a label for the key from a label.Map. +func (k *Value) Get(lm label.Map) interface{} { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return nil +} + +// From can be used to get a value from a Label. +func (k *Value) From(t label.Label) interface{} { return t.UnpackValue() } + +// Of creates a new Label with this key and the supplied value. +func (k *Value) Of(value interface{}) label.Label { return label.OfValue(k, value) } + +// Tag represents a key for tagging labels that have no value. +// These are used when the existence of the label is the entire information it +// carries, such as marking events to be of a specific kind, or from a specific +// package. +type Tag struct { + name string + description string +} + +// NewTag creates a new Key for tagging labels. +func NewTag(name, description string) *Tag { + return &Tag{name: name, description: description} +} + +func (k *Tag) Name() string { return k.name } +func (k *Tag) Description() string { return k.description } + +func (k *Tag) Format(w io.Writer, buf []byte, l label.Label) {} + +// New creates a new Label with this key. +func (k *Tag) New() label.Label { return label.OfValue(k, nil) } + +// Int represents a key +type Int struct { + name string + description string +} + +// NewInt creates a new Key for int values. +func NewInt(name, description string) *Int { + return &Int{name: name, description: description} +} + +func (k *Int) Name() string { return k.name } +func (k *Int) Description() string { return k.description } + +func (k *Int) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, int64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int) Of(v int) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int) Get(lm label.Map) int { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int) From(t label.Label) int { return int(t.Unpack64()) } + +// Int8 represents a key +type Int8 struct { + name string + description string +} + +// NewInt8 creates a new Key for int8 values. +func NewInt8(name, description string) *Int8 { + return &Int8{name: name, description: description} +} + +func (k *Int8) Name() string { return k.name } +func (k *Int8) Description() string { return k.description } + +func (k *Int8) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, int64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int8) Of(v int8) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int8) Get(lm label.Map) int8 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int8) From(t label.Label) int8 { return int8(t.Unpack64()) } + +// Int16 represents a key +type Int16 struct { + name string + description string +} + +// NewInt16 creates a new Key for int16 values. +func NewInt16(name, description string) *Int16 { + return &Int16{name: name, description: description} +} + +func (k *Int16) Name() string { return k.name } +func (k *Int16) Description() string { return k.description } + +func (k *Int16) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, int64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int16) Of(v int16) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int16) Get(lm label.Map) int16 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int16) From(t label.Label) int16 { return int16(t.Unpack64()) } + +// Int32 represents a key +type Int32 struct { + name string + description string +} + +// NewInt32 creates a new Key for int32 values. +func NewInt32(name, description string) *Int32 { + return &Int32{name: name, description: description} +} + +func (k *Int32) Name() string { return k.name } +func (k *Int32) Description() string { return k.description } + +func (k *Int32) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, int64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int32) Of(v int32) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int32) Get(lm label.Map) int32 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int32) From(t label.Label) int32 { return int32(t.Unpack64()) } + +// Int64 represents a key +type Int64 struct { + name string + description string +} + +// NewInt64 creates a new Key for int64 values. +func NewInt64(name, description string) *Int64 { + return &Int64{name: name, description: description} +} + +func (k *Int64) Name() string { return k.name } +func (k *Int64) Description() string { return k.description } + +func (k *Int64) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, k.From(l), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int64) Of(v int64) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int64) Get(lm label.Map) int64 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int64) From(t label.Label) int64 { return int64(t.Unpack64()) } + +// UInt represents a key +type UInt struct { + name string + description string +} + +// NewUInt creates a new Key for uint values. +func NewUInt(name, description string) *UInt { + return &UInt{name: name, description: description} +} + +func (k *UInt) Name() string { return k.name } +func (k *UInt) Description() string { return k.description } + +func (k *UInt) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, uint64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt) Of(v uint) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt) Get(lm label.Map) uint { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt) From(t label.Label) uint { return uint(t.Unpack64()) } + +// UInt8 represents a key +type UInt8 struct { + name string + description string +} + +// NewUInt8 creates a new Key for uint8 values. +func NewUInt8(name, description string) *UInt8 { + return &UInt8{name: name, description: description} +} + +func (k *UInt8) Name() string { return k.name } +func (k *UInt8) Description() string { return k.description } + +func (k *UInt8) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, uint64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt8) Of(v uint8) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt8) Get(lm label.Map) uint8 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt8) From(t label.Label) uint8 { return uint8(t.Unpack64()) } + +// UInt16 represents a key +type UInt16 struct { + name string + description string +} + +// NewUInt16 creates a new Key for uint16 values. +func NewUInt16(name, description string) *UInt16 { + return &UInt16{name: name, description: description} +} + +func (k *UInt16) Name() string { return k.name } +func (k *UInt16) Description() string { return k.description } + +func (k *UInt16) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, uint64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt16) Of(v uint16) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt16) Get(lm label.Map) uint16 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt16) From(t label.Label) uint16 { return uint16(t.Unpack64()) } + +// UInt32 represents a key +type UInt32 struct { + name string + description string +} + +// NewUInt32 creates a new Key for uint32 values. +func NewUInt32(name, description string) *UInt32 { + return &UInt32{name: name, description: description} +} + +func (k *UInt32) Name() string { return k.name } +func (k *UInt32) Description() string { return k.description } + +func (k *UInt32) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, uint64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt32) Of(v uint32) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt32) Get(lm label.Map) uint32 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt32) From(t label.Label) uint32 { return uint32(t.Unpack64()) } + +// UInt64 represents a key +type UInt64 struct { + name string + description string +} + +// NewUInt64 creates a new Key for uint64 values. +func NewUInt64(name, description string) *UInt64 { + return &UInt64{name: name, description: description} +} + +func (k *UInt64) Name() string { return k.name } +func (k *UInt64) Description() string { return k.description } + +func (k *UInt64) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, k.From(l), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt64) Of(v uint64) label.Label { return label.Of64(k, v) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt64) Get(lm label.Map) uint64 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt64) From(t label.Label) uint64 { return t.Unpack64() } + +// Float32 represents a key +type Float32 struct { + name string + description string +} + +// NewFloat32 creates a new Key for float32 values. +func NewFloat32(name, description string) *Float32 { + return &Float32{name: name, description: description} +} + +func (k *Float32) Name() string { return k.name } +func (k *Float32) Description() string { return k.description } + +func (k *Float32) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendFloat(buf, float64(k.From(l)), 'E', -1, 32)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Float32) Of(v float32) label.Label { + return label.Of64(k, uint64(math.Float32bits(v))) +} + +// Get can be used to get a label for the key from a label.Map. +func (k *Float32) Get(lm label.Map) float32 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Float32) From(t label.Label) float32 { + return math.Float32frombits(uint32(t.Unpack64())) +} + +// Float64 represents a key +type Float64 struct { + name string + description string +} + +// NewFloat64 creates a new Key for int64 values. +func NewFloat64(name, description string) *Float64 { + return &Float64{name: name, description: description} +} + +func (k *Float64) Name() string { return k.name } +func (k *Float64) Description() string { return k.description } + +func (k *Float64) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendFloat(buf, k.From(l), 'E', -1, 64)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Float64) Of(v float64) label.Label { + return label.Of64(k, math.Float64bits(v)) +} + +// Get can be used to get a label for the key from a label.Map. +func (k *Float64) Get(lm label.Map) float64 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Float64) From(t label.Label) float64 { + return math.Float64frombits(t.Unpack64()) +} + +// String represents a key +type String struct { + name string + description string +} + +// NewString creates a new Key for int64 values. +func NewString(name, description string) *String { + return &String{name: name, description: description} +} + +func (k *String) Name() string { return k.name } +func (k *String) Description() string { return k.description } + +func (k *String) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendQuote(buf, k.From(l))) +} + +// Of creates a new Label with this key and the supplied value. +func (k *String) Of(v string) label.Label { return label.OfString(k, v) } + +// Get can be used to get a label for the key from a label.Map. +func (k *String) Get(lm label.Map) string { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return "" +} + +// From can be used to get a value from a Label. +func (k *String) From(t label.Label) string { return t.UnpackString() } + +// Boolean represents a key +type Boolean struct { + name string + description string +} + +// NewBoolean creates a new Key for bool values. +func NewBoolean(name, description string) *Boolean { + return &Boolean{name: name, description: description} +} + +func (k *Boolean) Name() string { return k.name } +func (k *Boolean) Description() string { return k.description } + +func (k *Boolean) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendBool(buf, k.From(l))) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Boolean) Of(v bool) label.Label { + if v { + return label.Of64(k, 1) + } + return label.Of64(k, 0) +} + +// Get can be used to get a label for the key from a label.Map. +func (k *Boolean) Get(lm label.Map) bool { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return false +} + +// From can be used to get a value from a Label. +func (k *Boolean) From(t label.Label) bool { return t.Unpack64() > 0 } + +// Error represents a key +type Error struct { + name string + description string +} + +// NewError creates a new Key for int64 values. +func NewError(name, description string) *Error { + return &Error{name: name, description: description} +} + +func (k *Error) Name() string { return k.name } +func (k *Error) Description() string { return k.description } + +func (k *Error) Format(w io.Writer, buf []byte, l label.Label) { + io.WriteString(w, k.From(l).Error()) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Error) Of(v error) label.Label { return label.OfValue(k, v) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Error) Get(lm label.Map) error { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return nil +} + +// From can be used to get a value from a Label. +func (k *Error) From(t label.Label) error { + err, _ := t.UnpackValue().(error) + return err +} diff --git a/vendor/golang.org/x/tools/internal/event/keys/standard.go b/vendor/golang.org/x/tools/internal/event/keys/standard.go new file mode 100644 index 000000000..7e9586659 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/keys/standard.go @@ -0,0 +1,22 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package keys + +var ( + // Msg is a key used to add message strings to label lists. + Msg = NewString("message", "a readable message") + // Label is a key used to indicate an event adds labels to the context. + Label = NewTag("label", "a label context marker") + // Start is used for things like traces that have a name. + Start = NewString("start", "span start") + // Metric is a key used to indicate an event records metrics. + End = NewTag("end", "a span end marker") + // Metric is a key used to indicate an event records metrics. + Detach = NewTag("detach", "a span detach marker") + // Err is a key used to add error values to label lists. + Err = NewError("error", "an error that occurred") + // Metric is a key used to indicate an event records metrics. + Metric = NewTag("metric", "a metric event marker") +) diff --git a/vendor/golang.org/x/tools/internal/event/label/label.go b/vendor/golang.org/x/tools/internal/event/label/label.go new file mode 100644 index 000000000..0f526e1f9 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/label/label.go @@ -0,0 +1,215 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package label + +import ( + "fmt" + "io" + "reflect" + "unsafe" +) + +// Key is used as the identity of a Label. +// Keys are intended to be compared by pointer only, the name should be unique +// for communicating with external systems, but it is not required or enforced. +type Key interface { + // Name returns the key name. + Name() string + // Description returns a string that can be used to describe the value. + Description() string + + // Format is used in formatting to append the value of the label to the + // supplied buffer. + // The formatter may use the supplied buf as a scratch area to avoid + // allocations. + Format(w io.Writer, buf []byte, l Label) +} + +// Label holds a key and value pair. +// It is normally used when passing around lists of labels. +type Label struct { + key Key + packed uint64 + untyped interface{} +} + +// Map is the interface to a collection of Labels indexed by key. +type Map interface { + // Find returns the label that matches the supplied key. + Find(key Key) Label +} + +// List is the interface to something that provides an iterable +// list of labels. +// Iteration should start from 0 and continue until Valid returns false. +type List interface { + // Valid returns true if the index is within range for the list. + // It does not imply the label at that index will itself be valid. + Valid(index int) bool + // Label returns the label at the given index. + Label(index int) Label +} + +// list implements LabelList for a list of Labels. +type list struct { + labels []Label +} + +// filter wraps a LabelList filtering out specific labels. +type filter struct { + keys []Key + underlying List +} + +// listMap implements LabelMap for a simple list of labels. +type listMap struct { + labels []Label +} + +// mapChain implements LabelMap for a list of underlying LabelMap. +type mapChain struct { + maps []Map +} + +// OfValue creates a new label from the key and value. +// This method is for implementing new key types, label creation should +// normally be done with the Of method of the key. +func OfValue(k Key, value interface{}) Label { return Label{key: k, untyped: value} } + +// UnpackValue assumes the label was built using LabelOfValue and returns the value +// that was passed to that constructor. +// This method is for implementing new key types, for type safety normal +// access should be done with the From method of the key. +func (t Label) UnpackValue() interface{} { return t.untyped } + +// Of64 creates a new label from a key and a uint64. This is often +// used for non uint64 values that can be packed into a uint64. +// This method is for implementing new key types, label creation should +// normally be done with the Of method of the key. +func Of64(k Key, v uint64) Label { return Label{key: k, packed: v} } + +// Unpack64 assumes the label was built using LabelOf64 and returns the value that +// was passed to that constructor. +// This method is for implementing new key types, for type safety normal +// access should be done with the From method of the key. +func (t Label) Unpack64() uint64 { return t.packed } + +type stringptr unsafe.Pointer + +// OfString creates a new label from a key and a string. +// This method is for implementing new key types, label creation should +// normally be done with the Of method of the key. +func OfString(k Key, v string) Label { + hdr := (*reflect.StringHeader)(unsafe.Pointer(&v)) + return Label{ + key: k, + packed: uint64(hdr.Len), + untyped: stringptr(hdr.Data), + } +} + +// UnpackString assumes the label was built using LabelOfString and returns the +// value that was passed to that constructor. +// This method is for implementing new key types, for type safety normal +// access should be done with the From method of the key. +func (t Label) UnpackString() string { + var v string + hdr := (*reflect.StringHeader)(unsafe.Pointer(&v)) + hdr.Data = uintptr(t.untyped.(stringptr)) + hdr.Len = int(t.packed) + return v +} + +// Valid returns true if the Label is a valid one (it has a key). +func (t Label) Valid() bool { return t.key != nil } + +// Key returns the key of this Label. +func (t Label) Key() Key { return t.key } + +// Format is used for debug printing of labels. +func (t Label) Format(f fmt.State, r rune) { + if !t.Valid() { + io.WriteString(f, `nil`) + return + } + io.WriteString(f, t.Key().Name()) + io.WriteString(f, "=") + var buf [128]byte + t.Key().Format(f, buf[:0], t) +} + +func (l *list) Valid(index int) bool { + return index >= 0 && index < len(l.labels) +} + +func (l *list) Label(index int) Label { + return l.labels[index] +} + +func (f *filter) Valid(index int) bool { + return f.underlying.Valid(index) +} + +func (f *filter) Label(index int) Label { + l := f.underlying.Label(index) + for _, f := range f.keys { + if l.Key() == f { + return Label{} + } + } + return l +} + +func (lm listMap) Find(key Key) Label { + for _, l := range lm.labels { + if l.Key() == key { + return l + } + } + return Label{} +} + +func (c mapChain) Find(key Key) Label { + for _, src := range c.maps { + l := src.Find(key) + if l.Valid() { + return l + } + } + return Label{} +} + +var emptyList = &list{} + +func NewList(labels ...Label) List { + if len(labels) == 0 { + return emptyList + } + return &list{labels: labels} +} + +func Filter(l List, keys ...Key) List { + if len(keys) == 0 { + return l + } + return &filter{keys: keys, underlying: l} +} + +func NewMap(labels ...Label) Map { + return listMap{labels: labels} +} + +func MergeMaps(srcs ...Map) Map { + var nonNil []Map + for _, src := range srcs { + if src != nil { + nonNil = append(nonNil, src) + } + } + if len(nonNil) == 1 { + return nonNil[0] + } + return mapChain{maps: nonNil} +} diff --git a/vendor/golang.org/x/tools/internal/event/tag/tag.go b/vendor/golang.org/x/tools/internal/event/tag/tag.go new file mode 100644 index 000000000..581b26c20 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/tag/tag.go @@ -0,0 +1,59 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package tag provides the labels used for telemetry throughout gopls. +package tag + +import ( + "golang.org/x/tools/internal/event/keys" +) + +var ( + // create the label keys we use + Method = keys.NewString("method", "") + StatusCode = keys.NewString("status.code", "") + StatusMessage = keys.NewString("status.message", "") + RPCID = keys.NewString("id", "") + RPCDirection = keys.NewString("direction", "") + File = keys.NewString("file", "") + Directory = keys.New("directory", "") + URI = keys.New("URI", "") + Package = keys.NewString("package", "") // sorted comma-separated list of Package IDs + PackagePath = keys.NewString("package_path", "") + Query = keys.New("query", "") + Snapshot = keys.NewUInt64("snapshot", "") + Operation = keys.NewString("operation", "") + + Position = keys.New("position", "") + Category = keys.NewString("category", "") + PackageCount = keys.NewInt("packages", "") + Files = keys.New("files", "") + Port = keys.NewInt("port", "") + Type = keys.New("type", "") + HoverKind = keys.NewString("hoverkind", "") + + NewServer = keys.NewString("new_server", "A new server was added") + EndServer = keys.NewString("end_server", "A server was shut down") + + ServerID = keys.NewString("server", "The server ID an event is related to") + Logfile = keys.NewString("logfile", "") + DebugAddress = keys.NewString("debug_address", "") + GoplsPath = keys.NewString("gopls_path", "") + ClientID = keys.NewString("client_id", "") + + Level = keys.NewInt("level", "The logging level") +) + +var ( + // create the stats we measure + Started = keys.NewInt64("started", "Count of started RPCs.") + ReceivedBytes = keys.NewInt64("received_bytes", "Bytes received.") //, unit.Bytes) + SentBytes = keys.NewInt64("sent_bytes", "Bytes sent.") //, unit.Bytes) + Latency = keys.NewFloat64("latency_ms", "Elapsed time in milliseconds") //, unit.Milliseconds) +) + +const ( + Inbound = "in" + Outbound = "out" +) diff --git a/vendor/golang.org/x/tools/internal/gcimporter/bimport.go b/vendor/golang.org/x/tools/internal/gcimporter/bimport.go new file mode 100644 index 000000000..d98b0db2a --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/bimport.go @@ -0,0 +1,150 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This file contains the remaining vestiges of +// $GOROOT/src/go/internal/gcimporter/bimport.go. + +package gcimporter + +import ( + "fmt" + "go/token" + "go/types" + "sync" +) + +func errorf(format string, args ...interface{}) { + panic(fmt.Sprintf(format, args...)) +} + +const deltaNewFile = -64 // see cmd/compile/internal/gc/bexport.go + +// Synthesize a token.Pos +type fakeFileSet struct { + fset *token.FileSet + files map[string]*fileInfo +} + +type fileInfo struct { + file *token.File + lastline int +} + +const maxlines = 64 * 1024 + +func (s *fakeFileSet) pos(file string, line, column int) token.Pos { + // TODO(mdempsky): Make use of column. + + // Since we don't know the set of needed file positions, we reserve maxlines + // positions per file. We delay calling token.File.SetLines until all + // positions have been calculated (by way of fakeFileSet.setLines), so that + // we can avoid setting unnecessary lines. See also golang/go#46586. + f := s.files[file] + if f == nil { + f = &fileInfo{file: s.fset.AddFile(file, -1, maxlines)} + s.files[file] = f + } + if line > maxlines { + line = 1 + } + if line > f.lastline { + f.lastline = line + } + + // Return a fake position assuming that f.file consists only of newlines. + return token.Pos(f.file.Base() + line - 1) +} + +func (s *fakeFileSet) setLines() { + fakeLinesOnce.Do(func() { + fakeLines = make([]int, maxlines) + for i := range fakeLines { + fakeLines[i] = i + } + }) + for _, f := range s.files { + f.file.SetLines(fakeLines[:f.lastline]) + } +} + +var ( + fakeLines []int + fakeLinesOnce sync.Once +) + +func chanDir(d int) types.ChanDir { + // tag values must match the constants in cmd/compile/internal/gc/go.go + switch d { + case 1 /* Crecv */ : + return types.RecvOnly + case 2 /* Csend */ : + return types.SendOnly + case 3 /* Cboth */ : + return types.SendRecv + default: + errorf("unexpected channel dir %d", d) + return 0 + } +} + +var predeclOnce sync.Once +var predecl []types.Type // initialized lazily + +func predeclared() []types.Type { + predeclOnce.Do(func() { + // initialize lazily to be sure that all + // elements have been initialized before + predecl = []types.Type{ // basic types + types.Typ[types.Bool], + types.Typ[types.Int], + types.Typ[types.Int8], + types.Typ[types.Int16], + types.Typ[types.Int32], + types.Typ[types.Int64], + types.Typ[types.Uint], + types.Typ[types.Uint8], + types.Typ[types.Uint16], + types.Typ[types.Uint32], + types.Typ[types.Uint64], + types.Typ[types.Uintptr], + types.Typ[types.Float32], + types.Typ[types.Float64], + types.Typ[types.Complex64], + types.Typ[types.Complex128], + types.Typ[types.String], + + // basic type aliases + types.Universe.Lookup("byte").Type(), + types.Universe.Lookup("rune").Type(), + + // error + types.Universe.Lookup("error").Type(), + + // untyped types + types.Typ[types.UntypedBool], + types.Typ[types.UntypedInt], + types.Typ[types.UntypedRune], + types.Typ[types.UntypedFloat], + types.Typ[types.UntypedComplex], + types.Typ[types.UntypedString], + types.Typ[types.UntypedNil], + + // package unsafe + types.Typ[types.UnsafePointer], + + // invalid type + types.Typ[types.Invalid], // only appears in packages with errors + + // used internally by gc; never used by this package or in .a files + anyType{}, + } + predecl = append(predecl, additionalPredeclared()...) + }) + return predecl +} + +type anyType struct{} + +func (t anyType) Underlying() types.Type { return t } +func (t anyType) String() string { return "any" } diff --git a/vendor/golang.org/x/tools/internal/gcimporter/exportdata.go b/vendor/golang.org/x/tools/internal/gcimporter/exportdata.go new file mode 100644 index 000000000..f6437feb1 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/exportdata.go @@ -0,0 +1,99 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This file is a copy of $GOROOT/src/go/internal/gcimporter/exportdata.go. + +// This file implements FindExportData. + +package gcimporter + +import ( + "bufio" + "fmt" + "io" + "strconv" + "strings" +) + +func readGopackHeader(r *bufio.Reader) (name string, size int64, err error) { + // See $GOROOT/include/ar.h. + hdr := make([]byte, 16+12+6+6+8+10+2) + _, err = io.ReadFull(r, hdr) + if err != nil { + return + } + // leave for debugging + if false { + fmt.Printf("header: %s", hdr) + } + s := strings.TrimSpace(string(hdr[16+12+6+6+8:][:10])) + length, err := strconv.Atoi(s) + size = int64(length) + if err != nil || hdr[len(hdr)-2] != '`' || hdr[len(hdr)-1] != '\n' { + err = fmt.Errorf("invalid archive header") + return + } + name = strings.TrimSpace(string(hdr[:16])) + return +} + +// FindExportData positions the reader r at the beginning of the +// export data section of an underlying GC-created object/archive +// file by reading from it. The reader must be positioned at the +// start of the file before calling this function. The hdr result +// is the string before the export data, either "$$" or "$$B". +// The size result is the length of the export data in bytes, or -1 if not known. +func FindExportData(r *bufio.Reader) (hdr string, size int64, err error) { + // Read first line to make sure this is an object file. + line, err := r.ReadSlice('\n') + if err != nil { + err = fmt.Errorf("can't find export data (%v)", err) + return + } + + if string(line) == "!\n" { + // Archive file. Scan to __.PKGDEF. + var name string + if name, size, err = readGopackHeader(r); err != nil { + return + } + + // First entry should be __.PKGDEF. + if name != "__.PKGDEF" { + err = fmt.Errorf("go archive is missing __.PKGDEF") + return + } + + // Read first line of __.PKGDEF data, so that line + // is once again the first line of the input. + if line, err = r.ReadSlice('\n'); err != nil { + err = fmt.Errorf("can't find export data (%v)", err) + return + } + size -= int64(len(line)) + } + + // Now at __.PKGDEF in archive or still at beginning of file. + // Either way, line should begin with "go object ". + if !strings.HasPrefix(string(line), "go object ") { + err = fmt.Errorf("not a Go object file") + return + } + + // Skip over object header to export data. + // Begins after first line starting with $$. + for line[0] != '$' { + if line, err = r.ReadSlice('\n'); err != nil { + err = fmt.Errorf("can't find export data (%v)", err) + return + } + size -= int64(len(line)) + } + hdr = string(line) + if size < 0 { + size = -1 + } + + return +} diff --git a/vendor/golang.org/x/tools/internal/gcimporter/gcimporter.go b/vendor/golang.org/x/tools/internal/gcimporter/gcimporter.go new file mode 100644 index 000000000..b1223713b --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/gcimporter.go @@ -0,0 +1,274 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This file is a reduced copy of $GOROOT/src/go/internal/gcimporter/gcimporter.go. + +// Package gcimporter provides various functions for reading +// gc-generated object files that can be used to implement the +// Importer interface defined by the Go 1.5 standard library package. +// +// The encoding is deterministic: if the encoder is applied twice to +// the same types.Package data structure, both encodings are equal. +// This property may be important to avoid spurious changes in +// applications such as build systems. +// +// However, the encoder is not necessarily idempotent. Importing an +// exported package may yield a types.Package that, while it +// represents the same set of Go types as the original, may differ in +// the details of its internal representation. Because of these +// differences, re-encoding the imported package may yield a +// different, but equally valid, encoding of the package. +package gcimporter // import "golang.org/x/tools/internal/gcimporter" + +import ( + "bufio" + "bytes" + "fmt" + "go/build" + "go/token" + "go/types" + "io" + "io/ioutil" + "os" + "os/exec" + "path/filepath" + "strings" + "sync" +) + +const ( + // Enable debug during development: it adds some additional checks, and + // prevents errors from being recovered. + debug = false + + // If trace is set, debugging output is printed to std out. + trace = false +) + +var exportMap sync.Map // package dir → func() (string, bool) + +// lookupGorootExport returns the location of the export data +// (normally found in the build cache, but located in GOROOT/pkg +// in prior Go releases) for the package located in pkgDir. +// +// (We use the package's directory instead of its import path +// mainly to simplify handling of the packages in src/vendor +// and cmd/vendor.) +func lookupGorootExport(pkgDir string) (string, bool) { + f, ok := exportMap.Load(pkgDir) + if !ok { + var ( + listOnce sync.Once + exportPath string + ) + f, _ = exportMap.LoadOrStore(pkgDir, func() (string, bool) { + listOnce.Do(func() { + cmd := exec.Command("go", "list", "-export", "-f", "{{.Export}}", pkgDir) + cmd.Dir = build.Default.GOROOT + var output []byte + output, err := cmd.Output() + if err != nil { + return + } + + exports := strings.Split(string(bytes.TrimSpace(output)), "\n") + if len(exports) != 1 { + return + } + + exportPath = exports[0] + }) + + return exportPath, exportPath != "" + }) + } + + return f.(func() (string, bool))() +} + +var pkgExts = [...]string{".a", ".o"} + +// FindPkg returns the filename and unique package id for an import +// path based on package information provided by build.Import (using +// the build.Default build.Context). A relative srcDir is interpreted +// relative to the current working directory. +// If no file was found, an empty filename is returned. +func FindPkg(path, srcDir string) (filename, id string) { + if path == "" { + return + } + + var noext string + switch { + default: + // "x" -> "$GOPATH/pkg/$GOOS_$GOARCH/x.ext", "x" + // Don't require the source files to be present. + if abs, err := filepath.Abs(srcDir); err == nil { // see issue 14282 + srcDir = abs + } + bp, _ := build.Import(path, srcDir, build.FindOnly|build.AllowBinary) + if bp.PkgObj == "" { + var ok bool + if bp.Goroot && bp.Dir != "" { + filename, ok = lookupGorootExport(bp.Dir) + } + if !ok { + id = path // make sure we have an id to print in error message + return + } + } else { + noext = strings.TrimSuffix(bp.PkgObj, ".a") + id = bp.ImportPath + } + + case build.IsLocalImport(path): + // "./x" -> "/this/directory/x.ext", "/this/directory/x" + noext = filepath.Join(srcDir, path) + id = noext + + case filepath.IsAbs(path): + // for completeness only - go/build.Import + // does not support absolute imports + // "/x" -> "/x.ext", "/x" + noext = path + id = path + } + + if false { // for debugging + if path != id { + fmt.Printf("%s -> %s\n", path, id) + } + } + + if filename != "" { + if f, err := os.Stat(filename); err == nil && !f.IsDir() { + return + } + } + + // try extensions + for _, ext := range pkgExts { + filename = noext + ext + if f, err := os.Stat(filename); err == nil && !f.IsDir() { + return + } + } + + filename = "" // not found + return +} + +// Import imports a gc-generated package given its import path and srcDir, adds +// the corresponding package object to the packages map, and returns the object. +// The packages map must contain all packages already imported. +func Import(packages map[string]*types.Package, path, srcDir string, lookup func(path string) (io.ReadCloser, error)) (pkg *types.Package, err error) { + var rc io.ReadCloser + var filename, id string + if lookup != nil { + // With custom lookup specified, assume that caller has + // converted path to a canonical import path for use in the map. + if path == "unsafe" { + return types.Unsafe, nil + } + id = path + + // No need to re-import if the package was imported completely before. + if pkg = packages[id]; pkg != nil && pkg.Complete() { + return + } + f, err := lookup(path) + if err != nil { + return nil, err + } + rc = f + } else { + filename, id = FindPkg(path, srcDir) + if filename == "" { + if path == "unsafe" { + return types.Unsafe, nil + } + return nil, fmt.Errorf("can't find import: %q", id) + } + + // no need to re-import if the package was imported completely before + if pkg = packages[id]; pkg != nil && pkg.Complete() { + return + } + + // open file + f, err := os.Open(filename) + if err != nil { + return nil, err + } + defer func() { + if err != nil { + // add file name to error + err = fmt.Errorf("%s: %v", filename, err) + } + }() + rc = f + } + defer rc.Close() + + var hdr string + var size int64 + buf := bufio.NewReader(rc) + if hdr, size, err = FindExportData(buf); err != nil { + return + } + + switch hdr { + case "$$B\n": + var data []byte + data, err = ioutil.ReadAll(buf) + if err != nil { + break + } + + // TODO(gri): allow clients of go/importer to provide a FileSet. + // Or, define a new standard go/types/gcexportdata package. + fset := token.NewFileSet() + + // Select appropriate importer. + if len(data) > 0 { + switch data[0] { + case 'v', 'c', 'd': // binary, till go1.10 + return nil, fmt.Errorf("binary (%c) import format is no longer supported", data[0]) + + case 'i': // indexed, till go1.19 + _, pkg, err := IImportData(fset, packages, data[1:], id) + return pkg, err + + case 'u': // unified, from go1.20 + _, pkg, err := UImportData(fset, packages, data[1:size], id) + return pkg, err + + default: + l := len(data) + if l > 10 { + l = 10 + } + return nil, fmt.Errorf("unexpected export data with prefix %q for path %s", string(data[:l]), id) + } + } + + default: + err = fmt.Errorf("unknown export data header: %q", hdr) + } + + return +} + +func deref(typ types.Type) types.Type { + if p, _ := typ.(*types.Pointer); p != nil { + return p.Elem() + } + return typ +} + +type byPath []*types.Package + +func (a byPath) Len() int { return len(a) } +func (a byPath) Swap(i, j int) { a[i], a[j] = a[j], a[i] } +func (a byPath) Less(i, j int) bool { return a[i].Path() < a[j].Path() } diff --git a/vendor/golang.org/x/tools/internal/gcimporter/iexport.go b/vendor/golang.org/x/tools/internal/gcimporter/iexport.go new file mode 100644 index 000000000..6103dd710 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/iexport.go @@ -0,0 +1,1322 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Indexed binary package export. +// This file was derived from $GOROOT/src/cmd/compile/internal/gc/iexport.go; +// see that file for specification of the format. + +package gcimporter + +import ( + "bytes" + "encoding/binary" + "fmt" + "go/constant" + "go/token" + "go/types" + "io" + "math/big" + "reflect" + "sort" + "strconv" + "strings" + + "golang.org/x/tools/go/types/objectpath" + "golang.org/x/tools/internal/tokeninternal" + "golang.org/x/tools/internal/typeparams" +) + +// IExportShallow encodes "shallow" export data for the specified package. +// +// No promises are made about the encoding other than that it can be decoded by +// the same version of IIExportShallow. If you plan to save export data in the +// file system, be sure to include a cryptographic digest of the executable in +// the key to avoid version skew. +// +// If the provided reportf func is non-nil, it will be used for reporting bugs +// encountered during export. +// TODO(rfindley): remove reportf when we are confident enough in the new +// objectpath encoding. +func IExportShallow(fset *token.FileSet, pkg *types.Package, reportf ReportFunc) ([]byte, error) { + // In principle this operation can only fail if out.Write fails, + // but that's impossible for bytes.Buffer---and as a matter of + // fact iexportCommon doesn't even check for I/O errors. + // TODO(adonovan): handle I/O errors properly. + // TODO(adonovan): use byte slices throughout, avoiding copying. + const bundle, shallow = false, true + var out bytes.Buffer + err := iexportCommon(&out, fset, bundle, shallow, iexportVersion, []*types.Package{pkg}) + return out.Bytes(), err +} + +// IImportShallow decodes "shallow" types.Package data encoded by +// IExportShallow in the same executable. This function cannot import data from +// cmd/compile or gcexportdata.Write. +// +// The importer calls getPackages to obtain package symbols for all +// packages mentioned in the export data, including the one being +// decoded. +// +// If the provided reportf func is non-nil, it will be used for reporting bugs +// encountered during import. +// TODO(rfindley): remove reportf when we are confident enough in the new +// objectpath encoding. +func IImportShallow(fset *token.FileSet, getPackages GetPackagesFunc, data []byte, path string, reportf ReportFunc) (*types.Package, error) { + const bundle = false + const shallow = true + pkgs, err := iimportCommon(fset, getPackages, data, bundle, path, shallow, reportf) + if err != nil { + return nil, err + } + return pkgs[0], nil +} + +// ReportFunc is the type of a function used to report formatted bugs. +type ReportFunc = func(string, ...interface{}) + +// Current bundled export format version. Increase with each format change. +// 0: initial implementation +const bundleVersion = 0 + +// IExportData writes indexed export data for pkg to out. +// +// If no file set is provided, position info will be missing. +// The package path of the top-level package will not be recorded, +// so that calls to IImportData can override with a provided package path. +func IExportData(out io.Writer, fset *token.FileSet, pkg *types.Package) error { + const bundle, shallow = false, false + return iexportCommon(out, fset, bundle, shallow, iexportVersion, []*types.Package{pkg}) +} + +// IExportBundle writes an indexed export bundle for pkgs to out. +func IExportBundle(out io.Writer, fset *token.FileSet, pkgs []*types.Package) error { + const bundle, shallow = true, false + return iexportCommon(out, fset, bundle, shallow, iexportVersion, pkgs) +} + +func iexportCommon(out io.Writer, fset *token.FileSet, bundle, shallow bool, version int, pkgs []*types.Package) (err error) { + if !debug { + defer func() { + if e := recover(); e != nil { + if ierr, ok := e.(internalError); ok { + err = ierr + return + } + // Not an internal error; panic again. + panic(e) + } + }() + } + + p := iexporter{ + fset: fset, + version: version, + shallow: shallow, + allPkgs: map[*types.Package]bool{}, + stringIndex: map[string]uint64{}, + declIndex: map[types.Object]uint64{}, + tparamNames: map[types.Object]string{}, + typIndex: map[types.Type]uint64{}, + } + if !bundle { + p.localpkg = pkgs[0] + } + + for i, pt := range predeclared() { + p.typIndex[pt] = uint64(i) + } + if len(p.typIndex) > predeclReserved { + panic(internalErrorf("too many predeclared types: %d > %d", len(p.typIndex), predeclReserved)) + } + + // Initialize work queue with exported declarations. + for _, pkg := range pkgs { + scope := pkg.Scope() + for _, name := range scope.Names() { + if token.IsExported(name) { + p.pushDecl(scope.Lookup(name)) + } + } + + if bundle { + // Ensure pkg and its imports are included in the index. + p.allPkgs[pkg] = true + for _, imp := range pkg.Imports() { + p.allPkgs[imp] = true + } + } + } + + // Loop until no more work. + for !p.declTodo.empty() { + p.doDecl(p.declTodo.popHead()) + } + + // Produce index of offset of each file record in files. + var files intWriter + var fileOffset []uint64 // fileOffset[i] is offset in files of file encoded as i + if p.shallow { + fileOffset = make([]uint64, len(p.fileInfos)) + for i, info := range p.fileInfos { + fileOffset[i] = uint64(files.Len()) + p.encodeFile(&files, info.file, info.needed) + } + } + + // Append indices to data0 section. + dataLen := uint64(p.data0.Len()) + w := p.newWriter() + w.writeIndex(p.declIndex) + + if bundle { + w.uint64(uint64(len(pkgs))) + for _, pkg := range pkgs { + w.pkg(pkg) + imps := pkg.Imports() + w.uint64(uint64(len(imps))) + for _, imp := range imps { + w.pkg(imp) + } + } + } + w.flush() + + // Assemble header. + var hdr intWriter + if bundle { + hdr.uint64(bundleVersion) + } + hdr.uint64(uint64(p.version)) + hdr.uint64(uint64(p.strings.Len())) + if p.shallow { + hdr.uint64(uint64(files.Len())) + hdr.uint64(uint64(len(fileOffset))) + for _, offset := range fileOffset { + hdr.uint64(offset) + } + } + hdr.uint64(dataLen) + + // Flush output. + io.Copy(out, &hdr) + io.Copy(out, &p.strings) + if p.shallow { + io.Copy(out, &files) + } + io.Copy(out, &p.data0) + + return nil +} + +// encodeFile writes to w a representation of the file sufficient to +// faithfully restore position information about all needed offsets. +// Mutates the needed array. +func (p *iexporter) encodeFile(w *intWriter, file *token.File, needed []uint64) { + _ = needed[0] // precondition: needed is non-empty + + w.uint64(p.stringOff(file.Name())) + + size := uint64(file.Size()) + w.uint64(size) + + // Sort the set of needed offsets. Duplicates are harmless. + sort.Slice(needed, func(i, j int) bool { return needed[i] < needed[j] }) + + lines := tokeninternal.GetLines(file) // byte offset of each line start + w.uint64(uint64(len(lines))) + + // Rather than record the entire array of line start offsets, + // we save only a sparse list of (index, offset) pairs for + // the start of each line that contains a needed position. + var sparse [][2]int // (index, offset) pairs +outer: + for i, lineStart := range lines { + lineEnd := size + if i < len(lines)-1 { + lineEnd = uint64(lines[i+1]) + } + // Does this line contains a needed offset? + if needed[0] < lineEnd { + sparse = append(sparse, [2]int{i, lineStart}) + for needed[0] < lineEnd { + needed = needed[1:] + if len(needed) == 0 { + break outer + } + } + } + } + + // Delta-encode the columns. + w.uint64(uint64(len(sparse))) + var prev [2]int + for _, pair := range sparse { + w.uint64(uint64(pair[0] - prev[0])) + w.uint64(uint64(pair[1] - prev[1])) + prev = pair + } +} + +// writeIndex writes out an object index. mainIndex indicates whether +// we're writing out the main index, which is also read by +// non-compiler tools and includes a complete package description +// (i.e., name and height). +func (w *exportWriter) writeIndex(index map[types.Object]uint64) { + type pkgObj struct { + obj types.Object + name string // qualified name; differs from obj.Name for type params + } + // Build a map from packages to objects from that package. + pkgObjs := map[*types.Package][]pkgObj{} + + // For the main index, make sure to include every package that + // we reference, even if we're not exporting (or reexporting) + // any symbols from it. + if w.p.localpkg != nil { + pkgObjs[w.p.localpkg] = nil + } + for pkg := range w.p.allPkgs { + pkgObjs[pkg] = nil + } + + for obj := range index { + name := w.p.exportName(obj) + pkgObjs[obj.Pkg()] = append(pkgObjs[obj.Pkg()], pkgObj{obj, name}) + } + + var pkgs []*types.Package + for pkg, objs := range pkgObjs { + pkgs = append(pkgs, pkg) + + sort.Slice(objs, func(i, j int) bool { + return objs[i].name < objs[j].name + }) + } + + sort.Slice(pkgs, func(i, j int) bool { + return w.exportPath(pkgs[i]) < w.exportPath(pkgs[j]) + }) + + w.uint64(uint64(len(pkgs))) + for _, pkg := range pkgs { + w.string(w.exportPath(pkg)) + w.string(pkg.Name()) + w.uint64(uint64(0)) // package height is not needed for go/types + + objs := pkgObjs[pkg] + w.uint64(uint64(len(objs))) + for _, obj := range objs { + w.string(obj.name) + w.uint64(index[obj.obj]) + } + } +} + +// exportName returns the 'exported' name of an object. It differs from +// obj.Name() only for type parameters (see tparamExportName for details). +func (p *iexporter) exportName(obj types.Object) (res string) { + if name := p.tparamNames[obj]; name != "" { + return name + } + return obj.Name() +} + +type iexporter struct { + fset *token.FileSet + out *bytes.Buffer + version int + + shallow bool // don't put types from other packages in the index + objEncoder *objectpath.Encoder // encodes objects from other packages in shallow mode; lazily allocated + localpkg *types.Package // (nil in bundle mode) + + // allPkgs tracks all packages that have been referenced by + // the export data, so we can ensure to include them in the + // main index. + allPkgs map[*types.Package]bool + + declTodo objQueue + + strings intWriter + stringIndex map[string]uint64 + + // In shallow mode, object positions are encoded as (file, offset). + // Each file is recorded as a line-number table. + // Only the lines of needed positions are saved faithfully. + fileInfo map[*token.File]uint64 // value is index in fileInfos + fileInfos []*filePositions + + data0 intWriter + declIndex map[types.Object]uint64 + tparamNames map[types.Object]string // typeparam->exported name + typIndex map[types.Type]uint64 + + indent int // for tracing support +} + +type filePositions struct { + file *token.File + needed []uint64 // unordered list of needed file offsets +} + +func (p *iexporter) trace(format string, args ...interface{}) { + if !trace { + // Call sites should also be guarded, but having this check here allows + // easily enabling/disabling debug trace statements. + return + } + fmt.Printf(strings.Repeat("..", p.indent)+format+"\n", args...) +} + +// objectpathEncoder returns the lazily allocated objectpath.Encoder to use +// when encoding objects in other packages during shallow export. +// +// Using a shared Encoder amortizes some of cost of objectpath search. +func (p *iexporter) objectpathEncoder() *objectpath.Encoder { + if p.objEncoder == nil { + p.objEncoder = new(objectpath.Encoder) + } + return p.objEncoder +} + +// stringOff returns the offset of s within the string section. +// If not already present, it's added to the end. +func (p *iexporter) stringOff(s string) uint64 { + off, ok := p.stringIndex[s] + if !ok { + off = uint64(p.strings.Len()) + p.stringIndex[s] = off + + p.strings.uint64(uint64(len(s))) + p.strings.WriteString(s) + } + return off +} + +// fileIndexAndOffset returns the index of the token.File and the byte offset of pos within it. +func (p *iexporter) fileIndexAndOffset(file *token.File, pos token.Pos) (uint64, uint64) { + index, ok := p.fileInfo[file] + if !ok { + index = uint64(len(p.fileInfo)) + p.fileInfos = append(p.fileInfos, &filePositions{file: file}) + if p.fileInfo == nil { + p.fileInfo = make(map[*token.File]uint64) + } + p.fileInfo[file] = index + } + // Record each needed offset. + info := p.fileInfos[index] + offset := uint64(file.Offset(pos)) + info.needed = append(info.needed, offset) + + return index, offset +} + +// pushDecl adds n to the declaration work queue, if not already present. +func (p *iexporter) pushDecl(obj types.Object) { + // Package unsafe is known to the compiler and predeclared. + // Caller should not ask us to do export it. + if obj.Pkg() == types.Unsafe { + panic("cannot export package unsafe") + } + + // Shallow export data: don't index decls from other packages. + if p.shallow && obj.Pkg() != p.localpkg { + return + } + + if _, ok := p.declIndex[obj]; ok { + return + } + + p.declIndex[obj] = ^uint64(0) // mark obj present in work queue + p.declTodo.pushTail(obj) +} + +// exportWriter handles writing out individual data section chunks. +type exportWriter struct { + p *iexporter + + data intWriter + prevFile string + prevLine int64 + prevColumn int64 +} + +func (w *exportWriter) exportPath(pkg *types.Package) string { + if pkg == w.p.localpkg { + return "" + } + return pkg.Path() +} + +func (p *iexporter) doDecl(obj types.Object) { + if trace { + p.trace("exporting decl %v (%T)", obj, obj) + p.indent++ + defer func() { + p.indent-- + p.trace("=> %s", obj) + }() + } + w := p.newWriter() + + switch obj := obj.(type) { + case *types.Var: + w.tag('V') + w.pos(obj.Pos()) + w.typ(obj.Type(), obj.Pkg()) + + case *types.Func: + sig, _ := obj.Type().(*types.Signature) + if sig.Recv() != nil { + // We shouldn't see methods in the package scope, + // but the type checker may repair "func () F() {}" + // to "func (Invalid) F()" and then treat it like "func F()", + // so allow that. See golang/go#57729. + if sig.Recv().Type() != types.Typ[types.Invalid] { + panic(internalErrorf("unexpected method: %v", sig)) + } + } + + // Function. + if typeparams.ForSignature(sig).Len() == 0 { + w.tag('F') + } else { + w.tag('G') + } + w.pos(obj.Pos()) + // The tparam list of the function type is the declaration of the type + // params. So, write out the type params right now. Then those type params + // will be referenced via their type offset (via typOff) in all other + // places in the signature and function where they are used. + // + // While importing the type parameters, tparamList computes and records + // their export name, so that it can be later used when writing the index. + if tparams := typeparams.ForSignature(sig); tparams.Len() > 0 { + w.tparamList(obj.Name(), tparams, obj.Pkg()) + } + w.signature(sig) + + case *types.Const: + w.tag('C') + w.pos(obj.Pos()) + w.value(obj.Type(), obj.Val()) + + case *types.TypeName: + t := obj.Type() + + if tparam, ok := t.(*typeparams.TypeParam); ok { + w.tag('P') + w.pos(obj.Pos()) + constraint := tparam.Constraint() + if p.version >= iexportVersionGo1_18 { + implicit := false + if iface, _ := constraint.(*types.Interface); iface != nil { + implicit = typeparams.IsImplicit(iface) + } + w.bool(implicit) + } + w.typ(constraint, obj.Pkg()) + break + } + + if obj.IsAlias() { + w.tag('A') + w.pos(obj.Pos()) + w.typ(t, obj.Pkg()) + break + } + + // Defined type. + named, ok := t.(*types.Named) + if !ok { + panic(internalErrorf("%s is not a defined type", t)) + } + + if typeparams.ForNamed(named).Len() == 0 { + w.tag('T') + } else { + w.tag('U') + } + w.pos(obj.Pos()) + + if typeparams.ForNamed(named).Len() > 0 { + // While importing the type parameters, tparamList computes and records + // their export name, so that it can be later used when writing the index. + w.tparamList(obj.Name(), typeparams.ForNamed(named), obj.Pkg()) + } + + underlying := obj.Type().Underlying() + w.typ(underlying, obj.Pkg()) + + if types.IsInterface(t) { + break + } + + n := named.NumMethods() + w.uint64(uint64(n)) + for i := 0; i < n; i++ { + m := named.Method(i) + w.pos(m.Pos()) + w.string(m.Name()) + sig, _ := m.Type().(*types.Signature) + + // Receiver type parameters are type arguments of the receiver type, so + // their name must be qualified before exporting recv. + if rparams := typeparams.RecvTypeParams(sig); rparams.Len() > 0 { + prefix := obj.Name() + "." + m.Name() + for i := 0; i < rparams.Len(); i++ { + rparam := rparams.At(i) + name := tparamExportName(prefix, rparam) + w.p.tparamNames[rparam.Obj()] = name + } + } + w.param(sig.Recv()) + w.signature(sig) + } + + default: + panic(internalErrorf("unexpected object: %v", obj)) + } + + p.declIndex[obj] = w.flush() +} + +func (w *exportWriter) tag(tag byte) { + w.data.WriteByte(tag) +} + +func (w *exportWriter) pos(pos token.Pos) { + if w.p.shallow { + w.posV2(pos) + } else if w.p.version >= iexportVersionPosCol { + w.posV1(pos) + } else { + w.posV0(pos) + } +} + +// posV2 encoding (used only in shallow mode) records positions as +// (file, offset), where file is the index in the token.File table +// (which records the file name and newline offsets) and offset is a +// byte offset. It effectively ignores //line directives. +func (w *exportWriter) posV2(pos token.Pos) { + if pos == token.NoPos { + w.uint64(0) + return + } + file := w.p.fset.File(pos) // fset must be non-nil + index, offset := w.p.fileIndexAndOffset(file, pos) + w.uint64(1 + index) + w.uint64(offset) +} + +func (w *exportWriter) posV1(pos token.Pos) { + if w.p.fset == nil { + w.int64(0) + return + } + + p := w.p.fset.Position(pos) + file := p.Filename + line := int64(p.Line) + column := int64(p.Column) + + deltaColumn := (column - w.prevColumn) << 1 + deltaLine := (line - w.prevLine) << 1 + + if file != w.prevFile { + deltaLine |= 1 + } + if deltaLine != 0 { + deltaColumn |= 1 + } + + w.int64(deltaColumn) + if deltaColumn&1 != 0 { + w.int64(deltaLine) + if deltaLine&1 != 0 { + w.string(file) + } + } + + w.prevFile = file + w.prevLine = line + w.prevColumn = column +} + +func (w *exportWriter) posV0(pos token.Pos) { + if w.p.fset == nil { + w.int64(0) + return + } + + p := w.p.fset.Position(pos) + file := p.Filename + line := int64(p.Line) + + // When file is the same as the last position (common case), + // we can save a few bytes by delta encoding just the line + // number. + // + // Note: Because data objects may be read out of order (or not + // at all), we can only apply delta encoding within a single + // object. This is handled implicitly by tracking prevFile and + // prevLine as fields of exportWriter. + + if file == w.prevFile { + delta := line - w.prevLine + w.int64(delta) + if delta == deltaNewFile { + w.int64(-1) + } + } else { + w.int64(deltaNewFile) + w.int64(line) // line >= 0 + w.string(file) + w.prevFile = file + } + w.prevLine = line +} + +func (w *exportWriter) pkg(pkg *types.Package) { + // Ensure any referenced packages are declared in the main index. + w.p.allPkgs[pkg] = true + + w.string(w.exportPath(pkg)) +} + +func (w *exportWriter) qualifiedType(obj *types.TypeName) { + name := w.p.exportName(obj) + + // Ensure any referenced declarations are written out too. + w.p.pushDecl(obj) + w.string(name) + w.pkg(obj.Pkg()) +} + +// TODO(rfindley): what does 'pkg' even mean here? It would be better to pass +// it in explicitly into signatures and structs that may use it for +// constructing fields. +func (w *exportWriter) typ(t types.Type, pkg *types.Package) { + w.data.uint64(w.p.typOff(t, pkg)) +} + +func (p *iexporter) newWriter() *exportWriter { + return &exportWriter{p: p} +} + +func (w *exportWriter) flush() uint64 { + off := uint64(w.p.data0.Len()) + io.Copy(&w.p.data0, &w.data) + return off +} + +func (p *iexporter) typOff(t types.Type, pkg *types.Package) uint64 { + off, ok := p.typIndex[t] + if !ok { + w := p.newWriter() + w.doTyp(t, pkg) + off = predeclReserved + w.flush() + p.typIndex[t] = off + } + return off +} + +func (w *exportWriter) startType(k itag) { + w.data.uint64(uint64(k)) +} + +func (w *exportWriter) doTyp(t types.Type, pkg *types.Package) { + if trace { + w.p.trace("exporting type %s (%T)", t, t) + w.p.indent++ + defer func() { + w.p.indent-- + w.p.trace("=> %s", t) + }() + } + switch t := t.(type) { + case *types.Named: + if targs := typeparams.NamedTypeArgs(t); targs.Len() > 0 { + w.startType(instanceType) + // TODO(rfindley): investigate if this position is correct, and if it + // matters. + w.pos(t.Obj().Pos()) + w.typeList(targs, pkg) + w.typ(typeparams.NamedTypeOrigin(t), pkg) + return + } + w.startType(definedType) + w.qualifiedType(t.Obj()) + + case *typeparams.TypeParam: + w.startType(typeParamType) + w.qualifiedType(t.Obj()) + + case *types.Pointer: + w.startType(pointerType) + w.typ(t.Elem(), pkg) + + case *types.Slice: + w.startType(sliceType) + w.typ(t.Elem(), pkg) + + case *types.Array: + w.startType(arrayType) + w.uint64(uint64(t.Len())) + w.typ(t.Elem(), pkg) + + case *types.Chan: + w.startType(chanType) + // 1 RecvOnly; 2 SendOnly; 3 SendRecv + var dir uint64 + switch t.Dir() { + case types.RecvOnly: + dir = 1 + case types.SendOnly: + dir = 2 + case types.SendRecv: + dir = 3 + } + w.uint64(dir) + w.typ(t.Elem(), pkg) + + case *types.Map: + w.startType(mapType) + w.typ(t.Key(), pkg) + w.typ(t.Elem(), pkg) + + case *types.Signature: + w.startType(signatureType) + w.pkg(pkg) + w.signature(t) + + case *types.Struct: + w.startType(structType) + n := t.NumFields() + // Even for struct{} we must emit some qualifying package, because that's + // what the compiler does, and thus that's what the importer expects. + fieldPkg := pkg + if n > 0 { + fieldPkg = t.Field(0).Pkg() + } + if fieldPkg == nil { + // TODO(rfindley): improve this very hacky logic. + // + // The importer expects a package to be set for all struct types, even + // those with no fields. A better encoding might be to set NumFields + // before pkg. setPkg panics with a nil package, which may be possible + // to reach with invalid packages (and perhaps valid packages, too?), so + // (arbitrarily) set the localpkg if available. + // + // Alternatively, we may be able to simply guarantee that pkg != nil, by + // reconsidering the encoding of constant values. + if w.p.shallow { + fieldPkg = w.p.localpkg + } else { + panic(internalErrorf("no package to set for empty struct")) + } + } + w.pkg(fieldPkg) + w.uint64(uint64(n)) + + for i := 0; i < n; i++ { + f := t.Field(i) + if w.p.shallow { + w.objectPath(f) + } + w.pos(f.Pos()) + w.string(f.Name()) // unexported fields implicitly qualified by prior setPkg + w.typ(f.Type(), fieldPkg) + w.bool(f.Anonymous()) + w.string(t.Tag(i)) // note (or tag) + } + + case *types.Interface: + w.startType(interfaceType) + w.pkg(pkg) + + n := t.NumEmbeddeds() + w.uint64(uint64(n)) + for i := 0; i < n; i++ { + ft := t.EmbeddedType(i) + tPkg := pkg + if named, _ := ft.(*types.Named); named != nil { + w.pos(named.Obj().Pos()) + } else { + w.pos(token.NoPos) + } + w.typ(ft, tPkg) + } + + // See comment for struct fields. In shallow mode we change the encoding + // for interface methods that are promoted from other packages. + + n = t.NumExplicitMethods() + w.uint64(uint64(n)) + for i := 0; i < n; i++ { + m := t.ExplicitMethod(i) + if w.p.shallow { + w.objectPath(m) + } + w.pos(m.Pos()) + w.string(m.Name()) + sig, _ := m.Type().(*types.Signature) + w.signature(sig) + } + + case *typeparams.Union: + w.startType(unionType) + nt := t.Len() + w.uint64(uint64(nt)) + for i := 0; i < nt; i++ { + term := t.Term(i) + w.bool(term.Tilde()) + w.typ(term.Type(), pkg) + } + + default: + panic(internalErrorf("unexpected type: %v, %v", t, reflect.TypeOf(t))) + } +} + +// objectPath writes the package and objectPath to use to look up obj in a +// different package, when encoding in "shallow" mode. +// +// When doing a shallow import, the importer creates only the local package, +// and requests package symbols for dependencies from the client. +// However, certain types defined in the local package may hold objects defined +// (perhaps deeply) within another package. +// +// For example, consider the following: +// +// package a +// func F() chan * map[string] struct { X int } +// +// package b +// import "a" +// var B = a.F() +// +// In this example, the type of b.B holds fields defined in package a. +// In order to have the correct canonical objects for the field defined in the +// type of B, they are encoded as objectPaths and later looked up in the +// importer. The same problem applies to interface methods. +func (w *exportWriter) objectPath(obj types.Object) { + if obj.Pkg() == nil || obj.Pkg() == w.p.localpkg { + // obj.Pkg() may be nil for the builtin error.Error. + // In this case, or if obj is declared in the local package, no need to + // encode. + w.string("") + return + } + objectPath, err := w.p.objectpathEncoder().For(obj) + if err != nil { + // Fall back to the empty string, which will cause the importer to create a + // new object, which matches earlier behavior. Creating a new object is + // sufficient for many purposes (such as type checking), but causes certain + // references algorithms to fail (golang/go#60819). However, we didn't + // notice this problem during months of gopls@v0.12.0 testing. + // + // TODO(golang/go#61674): this workaround is insufficient, as in the case + // where the field forwarded from an instantiated type that may not appear + // in the export data of the original package: + // + // // package a + // type A[P any] struct{ F P } + // + // // package b + // type B a.A[int] + // + // We need to update references algorithms not to depend on this + // de-duplication, at which point we may want to simply remove the + // workaround here. + w.string("") + return + } + w.string(string(objectPath)) + w.pkg(obj.Pkg()) +} + +func (w *exportWriter) signature(sig *types.Signature) { + w.paramList(sig.Params()) + w.paramList(sig.Results()) + if sig.Params().Len() > 0 { + w.bool(sig.Variadic()) + } +} + +func (w *exportWriter) typeList(ts *typeparams.TypeList, pkg *types.Package) { + w.uint64(uint64(ts.Len())) + for i := 0; i < ts.Len(); i++ { + w.typ(ts.At(i), pkg) + } +} + +func (w *exportWriter) tparamList(prefix string, list *typeparams.TypeParamList, pkg *types.Package) { + ll := uint64(list.Len()) + w.uint64(ll) + for i := 0; i < list.Len(); i++ { + tparam := list.At(i) + // Set the type parameter exportName before exporting its type. + exportName := tparamExportName(prefix, tparam) + w.p.tparamNames[tparam.Obj()] = exportName + w.typ(list.At(i), pkg) + } +} + +const blankMarker = "$" + +// tparamExportName returns the 'exported' name of a type parameter, which +// differs from its actual object name: it is prefixed with a qualifier, and +// blank type parameter names are disambiguated by their index in the type +// parameter list. +func tparamExportName(prefix string, tparam *typeparams.TypeParam) string { + assert(prefix != "") + name := tparam.Obj().Name() + if name == "_" { + name = blankMarker + strconv.Itoa(tparam.Index()) + } + return prefix + "." + name +} + +// tparamName returns the real name of a type parameter, after stripping its +// qualifying prefix and reverting blank-name encoding. See tparamExportName +// for details. +func tparamName(exportName string) string { + // Remove the "path" from the type param name that makes it unique. + ix := strings.LastIndex(exportName, ".") + if ix < 0 { + errorf("malformed type parameter export name %s: missing prefix", exportName) + } + name := exportName[ix+1:] + if strings.HasPrefix(name, blankMarker) { + return "_" + } + return name +} + +func (w *exportWriter) paramList(tup *types.Tuple) { + n := tup.Len() + w.uint64(uint64(n)) + for i := 0; i < n; i++ { + w.param(tup.At(i)) + } +} + +func (w *exportWriter) param(obj types.Object) { + w.pos(obj.Pos()) + w.localIdent(obj) + w.typ(obj.Type(), obj.Pkg()) +} + +func (w *exportWriter) value(typ types.Type, v constant.Value) { + w.typ(typ, nil) + if w.p.version >= iexportVersionGo1_18 { + w.int64(int64(v.Kind())) + } + + if v.Kind() == constant.Unknown { + // golang/go#60605: treat unknown constant values as if they have invalid type + // + // This loses some fidelity over the package type-checked from source, but that + // is acceptable. + // + // TODO(rfindley): we should switch on the recorded constant kind rather + // than the constant type + return + } + + switch b := typ.Underlying().(*types.Basic); b.Info() & types.IsConstType { + case types.IsBoolean: + w.bool(constant.BoolVal(v)) + case types.IsInteger: + var i big.Int + if i64, exact := constant.Int64Val(v); exact { + i.SetInt64(i64) + } else if ui64, exact := constant.Uint64Val(v); exact { + i.SetUint64(ui64) + } else { + i.SetString(v.ExactString(), 10) + } + w.mpint(&i, typ) + case types.IsFloat: + f := constantToFloat(v) + w.mpfloat(f, typ) + case types.IsComplex: + w.mpfloat(constantToFloat(constant.Real(v)), typ) + w.mpfloat(constantToFloat(constant.Imag(v)), typ) + case types.IsString: + w.string(constant.StringVal(v)) + default: + if b.Kind() == types.Invalid { + // package contains type errors + break + } + panic(internalErrorf("unexpected type %v (%v)", typ, typ.Underlying())) + } +} + +// constantToFloat converts a constant.Value with kind constant.Float to a +// big.Float. +func constantToFloat(x constant.Value) *big.Float { + x = constant.ToFloat(x) + // Use the same floating-point precision (512) as cmd/compile + // (see Mpprec in cmd/compile/internal/gc/mpfloat.go). + const mpprec = 512 + var f big.Float + f.SetPrec(mpprec) + if v, exact := constant.Float64Val(x); exact { + // float64 + f.SetFloat64(v) + } else if num, denom := constant.Num(x), constant.Denom(x); num.Kind() == constant.Int { + // TODO(gri): add big.Rat accessor to constant.Value. + n := valueToRat(num) + d := valueToRat(denom) + f.SetRat(n.Quo(n, d)) + } else { + // Value too large to represent as a fraction => inaccessible. + // TODO(gri): add big.Float accessor to constant.Value. + _, ok := f.SetString(x.ExactString()) + assert(ok) + } + return &f +} + +func valueToRat(x constant.Value) *big.Rat { + // Convert little-endian to big-endian. + // I can't believe this is necessary. + bytes := constant.Bytes(x) + for i := 0; i < len(bytes)/2; i++ { + bytes[i], bytes[len(bytes)-1-i] = bytes[len(bytes)-1-i], bytes[i] + } + return new(big.Rat).SetInt(new(big.Int).SetBytes(bytes)) +} + +// mpint exports a multi-precision integer. +// +// For unsigned types, small values are written out as a single +// byte. Larger values are written out as a length-prefixed big-endian +// byte string, where the length prefix is encoded as its complement. +// For example, bytes 0, 1, and 2 directly represent the integer +// values 0, 1, and 2; while bytes 255, 254, and 253 indicate a 1-, +// 2-, and 3-byte big-endian string follow. +// +// Encoding for signed types use the same general approach as for +// unsigned types, except small values use zig-zag encoding and the +// bottom bit of length prefix byte for large values is reserved as a +// sign bit. +// +// The exact boundary between small and large encodings varies +// according to the maximum number of bytes needed to encode a value +// of type typ. As a special case, 8-bit types are always encoded as a +// single byte. +// +// TODO(mdempsky): Is this level of complexity really worthwhile? +func (w *exportWriter) mpint(x *big.Int, typ types.Type) { + basic, ok := typ.Underlying().(*types.Basic) + if !ok { + panic(internalErrorf("unexpected type %v (%T)", typ.Underlying(), typ.Underlying())) + } + + signed, maxBytes := intSize(basic) + + negative := x.Sign() < 0 + if !signed && negative { + panic(internalErrorf("negative unsigned integer; type %v, value %v", typ, x)) + } + + b := x.Bytes() + if len(b) > 0 && b[0] == 0 { + panic(internalErrorf("leading zeros")) + } + if uint(len(b)) > maxBytes { + panic(internalErrorf("bad mpint length: %d > %d (type %v, value %v)", len(b), maxBytes, typ, x)) + } + + maxSmall := 256 - maxBytes + if signed { + maxSmall = 256 - 2*maxBytes + } + if maxBytes == 1 { + maxSmall = 256 + } + + // Check if x can use small value encoding. + if len(b) <= 1 { + var ux uint + if len(b) == 1 { + ux = uint(b[0]) + } + if signed { + ux <<= 1 + if negative { + ux-- + } + } + if ux < maxSmall { + w.data.WriteByte(byte(ux)) + return + } + } + + n := 256 - uint(len(b)) + if signed { + n = 256 - 2*uint(len(b)) + if negative { + n |= 1 + } + } + if n < maxSmall || n >= 256 { + panic(internalErrorf("encoding mistake: %d, %v, %v => %d", len(b), signed, negative, n)) + } + + w.data.WriteByte(byte(n)) + w.data.Write(b) +} + +// mpfloat exports a multi-precision floating point number. +// +// The number's value is decomposed into mantissa × 2**exponent, where +// mantissa is an integer. The value is written out as mantissa (as a +// multi-precision integer) and then the exponent, except exponent is +// omitted if mantissa is zero. +func (w *exportWriter) mpfloat(f *big.Float, typ types.Type) { + if f.IsInf() { + panic("infinite constant") + } + + // Break into f = mant × 2**exp, with 0.5 <= mant < 1. + var mant big.Float + exp := int64(f.MantExp(&mant)) + + // Scale so that mant is an integer. + prec := mant.MinPrec() + mant.SetMantExp(&mant, int(prec)) + exp -= int64(prec) + + manti, acc := mant.Int(nil) + if acc != big.Exact { + panic(internalErrorf("mantissa scaling failed for %f (%s)", f, acc)) + } + w.mpint(manti, typ) + if manti.Sign() != 0 { + w.int64(exp) + } +} + +func (w *exportWriter) bool(b bool) bool { + var x uint64 + if b { + x = 1 + } + w.uint64(x) + return b +} + +func (w *exportWriter) int64(x int64) { w.data.int64(x) } +func (w *exportWriter) uint64(x uint64) { w.data.uint64(x) } +func (w *exportWriter) string(s string) { w.uint64(w.p.stringOff(s)) } + +func (w *exportWriter) localIdent(obj types.Object) { + // Anonymous parameters. + if obj == nil { + w.string("") + return + } + + name := obj.Name() + if name == "_" { + w.string("_") + return + } + + w.string(name) +} + +type intWriter struct { + bytes.Buffer +} + +func (w *intWriter) int64(x int64) { + var buf [binary.MaxVarintLen64]byte + n := binary.PutVarint(buf[:], x) + w.Write(buf[:n]) +} + +func (w *intWriter) uint64(x uint64) { + var buf [binary.MaxVarintLen64]byte + n := binary.PutUvarint(buf[:], x) + w.Write(buf[:n]) +} + +func assert(cond bool) { + if !cond { + panic("internal error: assertion failed") + } +} + +// The below is copied from go/src/cmd/compile/internal/gc/syntax.go. + +// objQueue is a FIFO queue of types.Object. The zero value of objQueue is +// a ready-to-use empty queue. +type objQueue struct { + ring []types.Object + head, tail int +} + +// empty returns true if q contains no Nodes. +func (q *objQueue) empty() bool { + return q.head == q.tail +} + +// pushTail appends n to the tail of the queue. +func (q *objQueue) pushTail(obj types.Object) { + if len(q.ring) == 0 { + q.ring = make([]types.Object, 16) + } else if q.head+len(q.ring) == q.tail { + // Grow the ring. + nring := make([]types.Object, len(q.ring)*2) + // Copy the old elements. + part := q.ring[q.head%len(q.ring):] + if q.tail-q.head <= len(part) { + part = part[:q.tail-q.head] + copy(nring, part) + } else { + pos := copy(nring, part) + copy(nring[pos:], q.ring[:q.tail%len(q.ring)]) + } + q.ring, q.head, q.tail = nring, 0, q.tail-q.head + } + + q.ring[q.tail%len(q.ring)] = obj + q.tail++ +} + +// popHead pops a node from the head of the queue. It panics if q is empty. +func (q *objQueue) popHead() types.Object { + if q.empty() { + panic("dequeue empty") + } + obj := q.ring[q.head%len(q.ring)] + q.head++ + return obj +} + +// internalError represents an error generated inside this package. +type internalError string + +func (e internalError) Error() string { return "gcimporter: " + string(e) } + +// TODO(adonovan): make this call panic, so that it's symmetric with errorf. +// Otherwise it's easy to forget to do anything with the error. +// +// TODO(adonovan): also, consider switching the names "errorf" and +// "internalErrorf" as the former is used for bugs, whose cause is +// internal inconsistency, whereas the latter is used for ordinary +// situations like bad input, whose cause is external. +func internalErrorf(format string, args ...interface{}) error { + return internalError(fmt.Sprintf(format, args...)) +} diff --git a/vendor/golang.org/x/tools/internal/gcimporter/iimport.go b/vendor/golang.org/x/tools/internal/gcimporter/iimport.go new file mode 100644 index 000000000..8e64cf644 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/iimport.go @@ -0,0 +1,1083 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Indexed package import. +// See cmd/compile/internal/gc/iexport.go for the export data format. + +// This file is a copy of $GOROOT/src/go/internal/gcimporter/iimport.go. + +package gcimporter + +import ( + "bytes" + "encoding/binary" + "fmt" + "go/constant" + "go/token" + "go/types" + "io" + "math/big" + "sort" + "strings" + + "golang.org/x/tools/go/types/objectpath" + "golang.org/x/tools/internal/typeparams" +) + +type intReader struct { + *bytes.Reader + path string +} + +func (r *intReader) int64() int64 { + i, err := binary.ReadVarint(r.Reader) + if err != nil { + errorf("import %q: read varint error: %v", r.path, err) + } + return i +} + +func (r *intReader) uint64() uint64 { + i, err := binary.ReadUvarint(r.Reader) + if err != nil { + errorf("import %q: read varint error: %v", r.path, err) + } + return i +} + +// Keep this in sync with constants in iexport.go. +const ( + iexportVersionGo1_11 = 0 + iexportVersionPosCol = 1 + iexportVersionGo1_18 = 2 + iexportVersionGenerics = 2 + + iexportVersionCurrent = 2 +) + +type ident struct { + pkg *types.Package + name string +} + +const predeclReserved = 32 + +type itag uint64 + +const ( + // Types + definedType itag = iota + pointerType + sliceType + arrayType + chanType + mapType + signatureType + structType + interfaceType + typeParamType + instanceType + unionType +) + +// IImportData imports a package from the serialized package data +// and returns 0 and a reference to the package. +// If the export data version is not recognized or the format is otherwise +// compromised, an error is returned. +func IImportData(fset *token.FileSet, imports map[string]*types.Package, data []byte, path string) (int, *types.Package, error) { + pkgs, err := iimportCommon(fset, GetPackagesFromMap(imports), data, false, path, false, nil) + if err != nil { + return 0, nil, err + } + return 0, pkgs[0], nil +} + +// IImportBundle imports a set of packages from the serialized package bundle. +func IImportBundle(fset *token.FileSet, imports map[string]*types.Package, data []byte) ([]*types.Package, error) { + return iimportCommon(fset, GetPackagesFromMap(imports), data, true, "", false, nil) +} + +// A GetPackagesFunc function obtains the non-nil symbols for a set of +// packages, creating and recursively importing them as needed. An +// implementation should store each package symbol is in the Pkg +// field of the items array. +// +// Any error causes importing to fail. This can be used to quickly read +// the import manifest of an export data file without fully decoding it. +type GetPackagesFunc = func(items []GetPackagesItem) error + +// A GetPackagesItem is a request from the importer for the package +// symbol of the specified name and path. +type GetPackagesItem struct { + Name, Path string + Pkg *types.Package // to be filled in by GetPackagesFunc call + + // private importer state + pathOffset uint64 + nameIndex map[string]uint64 +} + +// GetPackagesFromMap returns a GetPackagesFunc that retrieves +// packages from the given map of package path to package. +// +// The returned function may mutate m: each requested package that is not +// found is created with types.NewPackage and inserted into m. +func GetPackagesFromMap(m map[string]*types.Package) GetPackagesFunc { + return func(items []GetPackagesItem) error { + for i, item := range items { + pkg, ok := m[item.Path] + if !ok { + pkg = types.NewPackage(item.Path, item.Name) + m[item.Path] = pkg + } + items[i].Pkg = pkg + } + return nil + } +} + +func iimportCommon(fset *token.FileSet, getPackages GetPackagesFunc, data []byte, bundle bool, path string, shallow bool, reportf ReportFunc) (pkgs []*types.Package, err error) { + const currentVersion = iexportVersionCurrent + version := int64(-1) + if !debug { + defer func() { + if e := recover(); e != nil { + if bundle { + err = fmt.Errorf("%v", e) + } else if version > currentVersion { + err = fmt.Errorf("cannot import %q (%v), export data is newer version - update tool", path, e) + } else { + err = fmt.Errorf("internal error while importing %q (%v); please report an issue", path, e) + } + } + }() + } + + r := &intReader{bytes.NewReader(data), path} + + if bundle { + if v := r.uint64(); v != bundleVersion { + errorf("unknown bundle format version %d", v) + } + } + + version = int64(r.uint64()) + switch version { + case iexportVersionGo1_18, iexportVersionPosCol, iexportVersionGo1_11: + default: + if version > iexportVersionGo1_18 { + errorf("unstable iexport format version %d, just rebuild compiler and std library", version) + } else { + errorf("unknown iexport format version %d", version) + } + } + + sLen := int64(r.uint64()) + var fLen int64 + var fileOffset []uint64 + if shallow { + // Shallow mode uses a different position encoding. + fLen = int64(r.uint64()) + fileOffset = make([]uint64, r.uint64()) + for i := range fileOffset { + fileOffset[i] = r.uint64() + } + } + dLen := int64(r.uint64()) + + whence, _ := r.Seek(0, io.SeekCurrent) + stringData := data[whence : whence+sLen] + fileData := data[whence+sLen : whence+sLen+fLen] + declData := data[whence+sLen+fLen : whence+sLen+fLen+dLen] + r.Seek(sLen+fLen+dLen, io.SeekCurrent) + + p := iimporter{ + version: int(version), + ipath: path, + shallow: shallow, + reportf: reportf, + + stringData: stringData, + stringCache: make(map[uint64]string), + fileOffset: fileOffset, + fileData: fileData, + fileCache: make([]*token.File, len(fileOffset)), + pkgCache: make(map[uint64]*types.Package), + + declData: declData, + pkgIndex: make(map[*types.Package]map[string]uint64), + typCache: make(map[uint64]types.Type), + // Separate map for typeparams, keyed by their package and unique + // name. + tparamIndex: make(map[ident]types.Type), + + fake: fakeFileSet{ + fset: fset, + files: make(map[string]*fileInfo), + }, + } + defer p.fake.setLines() // set lines for files in fset + + for i, pt := range predeclared() { + p.typCache[uint64(i)] = pt + } + + // Gather the relevant packages from the manifest. + items := make([]GetPackagesItem, r.uint64()) + for i := range items { + pkgPathOff := r.uint64() + pkgPath := p.stringAt(pkgPathOff) + pkgName := p.stringAt(r.uint64()) + _ = r.uint64() // package height; unused by go/types + + if pkgPath == "" { + pkgPath = path + } + items[i].Name = pkgName + items[i].Path = pkgPath + items[i].pathOffset = pkgPathOff + + // Read index for package. + nameIndex := make(map[string]uint64) + nSyms := r.uint64() + // In shallow mode, only the current package (i=0) has an index. + assert(!(shallow && i > 0 && nSyms != 0)) + for ; nSyms > 0; nSyms-- { + name := p.stringAt(r.uint64()) + nameIndex[name] = r.uint64() + } + + items[i].nameIndex = nameIndex + } + + // Request packages all at once from the client, + // enabling a parallel implementation. + if err := getPackages(items); err != nil { + return nil, err // don't wrap this error + } + + // Check the results and complete the index. + pkgList := make([]*types.Package, len(items)) + for i, item := range items { + pkg := item.Pkg + if pkg == nil { + errorf("internal error: getPackages returned nil package for %q", item.Path) + } else if pkg.Path() != item.Path { + errorf("internal error: getPackages returned wrong path %q, want %q", pkg.Path(), item.Path) + } else if pkg.Name() != item.Name { + errorf("internal error: getPackages returned wrong name %s for package %q, want %s", pkg.Name(), item.Path, item.Name) + } + p.pkgCache[item.pathOffset] = pkg + p.pkgIndex[pkg] = item.nameIndex + pkgList[i] = pkg + } + + if bundle { + pkgs = make([]*types.Package, r.uint64()) + for i := range pkgs { + pkg := p.pkgAt(r.uint64()) + imps := make([]*types.Package, r.uint64()) + for j := range imps { + imps[j] = p.pkgAt(r.uint64()) + } + pkg.SetImports(imps) + pkgs[i] = pkg + } + } else { + if len(pkgList) == 0 { + errorf("no packages found for %s", path) + panic("unreachable") + } + pkgs = pkgList[:1] + + // record all referenced packages as imports + list := append(([]*types.Package)(nil), pkgList[1:]...) + sort.Sort(byPath(list)) + pkgs[0].SetImports(list) + } + + for _, pkg := range pkgs { + if pkg.Complete() { + continue + } + + names := make([]string, 0, len(p.pkgIndex[pkg])) + for name := range p.pkgIndex[pkg] { + names = append(names, name) + } + sort.Strings(names) + for _, name := range names { + p.doDecl(pkg, name) + } + + // package was imported completely and without errors + pkg.MarkComplete() + } + + // SetConstraint can't be called if the constraint type is not yet complete. + // When type params are created in the 'P' case of (*importReader).obj(), + // the associated constraint type may not be complete due to recursion. + // Therefore, we defer calling SetConstraint there, and call it here instead + // after all types are complete. + for _, d := range p.later { + typeparams.SetTypeParamConstraint(d.t, d.constraint) + } + + for _, typ := range p.interfaceList { + typ.Complete() + } + + // Workaround for golang/go#61561. See the doc for instanceList for details. + for _, typ := range p.instanceList { + if iface, _ := typ.Underlying().(*types.Interface); iface != nil { + iface.Complete() + } + } + + return pkgs, nil +} + +type setConstraintArgs struct { + t *typeparams.TypeParam + constraint types.Type +} + +type iimporter struct { + version int + ipath string + + shallow bool + reportf ReportFunc // if non-nil, used to report bugs + + stringData []byte + stringCache map[uint64]string + fileOffset []uint64 // fileOffset[i] is offset in fileData for info about file encoded as i + fileData []byte + fileCache []*token.File // memoized decoding of file encoded as i + pkgCache map[uint64]*types.Package + + declData []byte + pkgIndex map[*types.Package]map[string]uint64 + typCache map[uint64]types.Type + tparamIndex map[ident]types.Type + + fake fakeFileSet + interfaceList []*types.Interface + + // Workaround for the go/types bug golang/go#61561: instances produced during + // instantiation may contain incomplete interfaces. Here we only complete the + // underlying type of the instance, which is the most common case but doesn't + // handle parameterized interface literals defined deeper in the type. + instanceList []types.Type // instances for later completion (see golang/go#61561) + + // Arguments for calls to SetConstraint that are deferred due to recursive types + later []setConstraintArgs + + indent int // for tracing support +} + +func (p *iimporter) trace(format string, args ...interface{}) { + if !trace { + // Call sites should also be guarded, but having this check here allows + // easily enabling/disabling debug trace statements. + return + } + fmt.Printf(strings.Repeat("..", p.indent)+format+"\n", args...) +} + +func (p *iimporter) doDecl(pkg *types.Package, name string) { + if debug { + p.trace("import decl %s", name) + p.indent++ + defer func() { + p.indent-- + p.trace("=> %s", name) + }() + } + // See if we've already imported this declaration. + if obj := pkg.Scope().Lookup(name); obj != nil { + return + } + + off, ok := p.pkgIndex[pkg][name] + if !ok { + // In deep mode, the index should be complete. In shallow + // mode, we should have already recursively loaded necessary + // dependencies so the above Lookup succeeds. + errorf("%v.%v not in index", pkg, name) + } + + r := &importReader{p: p, currPkg: pkg} + r.declReader.Reset(p.declData[off:]) + + r.obj(name) +} + +func (p *iimporter) stringAt(off uint64) string { + if s, ok := p.stringCache[off]; ok { + return s + } + + slen, n := binary.Uvarint(p.stringData[off:]) + if n <= 0 { + errorf("varint failed") + } + spos := off + uint64(n) + s := string(p.stringData[spos : spos+slen]) + p.stringCache[off] = s + return s +} + +func (p *iimporter) fileAt(index uint64) *token.File { + file := p.fileCache[index] + if file == nil { + off := p.fileOffset[index] + file = p.decodeFile(intReader{bytes.NewReader(p.fileData[off:]), p.ipath}) + p.fileCache[index] = file + } + return file +} + +func (p *iimporter) decodeFile(rd intReader) *token.File { + filename := p.stringAt(rd.uint64()) + size := int(rd.uint64()) + file := p.fake.fset.AddFile(filename, -1, size) + + // SetLines requires a nondecreasing sequence. + // Because it is common for clients to derive the interval + // [start, start+len(name)] from a start position, and we + // want to ensure that the end offset is on the same line, + // we fill in the gaps of the sparse encoding with values + // that strictly increase by the largest possible amount. + // This allows us to avoid having to record the actual end + // offset of each needed line. + + lines := make([]int, int(rd.uint64())) + var index, offset int + for i, n := 0, int(rd.uint64()); i < n; i++ { + index += int(rd.uint64()) + offset += int(rd.uint64()) + lines[index] = offset + + // Ensure monotonicity between points. + for j := index - 1; j > 0 && lines[j] == 0; j-- { + lines[j] = lines[j+1] - 1 + } + } + + // Ensure monotonicity after last point. + for j := len(lines) - 1; j > 0 && lines[j] == 0; j-- { + size-- + lines[j] = size + } + + if !file.SetLines(lines) { + errorf("SetLines failed: %d", lines) // can't happen + } + return file +} + +func (p *iimporter) pkgAt(off uint64) *types.Package { + if pkg, ok := p.pkgCache[off]; ok { + return pkg + } + path := p.stringAt(off) + errorf("missing package %q in %q", path, p.ipath) + return nil +} + +func (p *iimporter) typAt(off uint64, base *types.Named) types.Type { + if t, ok := p.typCache[off]; ok && canReuse(base, t) { + return t + } + + if off < predeclReserved { + errorf("predeclared type missing from cache: %v", off) + } + + r := &importReader{p: p} + r.declReader.Reset(p.declData[off-predeclReserved:]) + t := r.doType(base) + + if canReuse(base, t) { + p.typCache[off] = t + } + return t +} + +// canReuse reports whether the type rhs on the RHS of the declaration for def +// may be re-used. +// +// Specifically, if def is non-nil and rhs is an interface type with methods, it +// may not be re-used because we have a convention of setting the receiver type +// for interface methods to def. +func canReuse(def *types.Named, rhs types.Type) bool { + if def == nil { + return true + } + iface, _ := rhs.(*types.Interface) + if iface == nil { + return true + } + // Don't use iface.Empty() here as iface may not be complete. + return iface.NumEmbeddeds() == 0 && iface.NumExplicitMethods() == 0 +} + +type importReader struct { + p *iimporter + declReader bytes.Reader + currPkg *types.Package + prevFile string + prevLine int64 + prevColumn int64 +} + +func (r *importReader) obj(name string) { + tag := r.byte() + pos := r.pos() + + switch tag { + case 'A': + typ := r.typ() + + r.declare(types.NewTypeName(pos, r.currPkg, name, typ)) + + case 'C': + typ, val := r.value() + + r.declare(types.NewConst(pos, r.currPkg, name, typ, val)) + + case 'F', 'G': + var tparams []*typeparams.TypeParam + if tag == 'G' { + tparams = r.tparamList() + } + sig := r.signature(nil, nil, tparams) + r.declare(types.NewFunc(pos, r.currPkg, name, sig)) + + case 'T', 'U': + // Types can be recursive. We need to setup a stub + // declaration before recursing. + obj := types.NewTypeName(pos, r.currPkg, name, nil) + named := types.NewNamed(obj, nil, nil) + // Declare obj before calling r.tparamList, so the new type name is recognized + // if used in the constraint of one of its own typeparams (see #48280). + r.declare(obj) + if tag == 'U' { + tparams := r.tparamList() + typeparams.SetForNamed(named, tparams) + } + + underlying := r.p.typAt(r.uint64(), named).Underlying() + named.SetUnderlying(underlying) + + if !isInterface(underlying) { + for n := r.uint64(); n > 0; n-- { + mpos := r.pos() + mname := r.ident() + recv := r.param() + + // If the receiver has any targs, set those as the + // rparams of the method (since those are the + // typeparams being used in the method sig/body). + base := baseType(recv.Type()) + assert(base != nil) + targs := typeparams.NamedTypeArgs(base) + var rparams []*typeparams.TypeParam + if targs.Len() > 0 { + rparams = make([]*typeparams.TypeParam, targs.Len()) + for i := range rparams { + rparams[i] = targs.At(i).(*typeparams.TypeParam) + } + } + msig := r.signature(recv, rparams, nil) + + named.AddMethod(types.NewFunc(mpos, r.currPkg, mname, msig)) + } + } + + case 'P': + // We need to "declare" a typeparam in order to have a name that + // can be referenced recursively (if needed) in the type param's + // bound. + if r.p.version < iexportVersionGenerics { + errorf("unexpected type param type") + } + name0 := tparamName(name) + tn := types.NewTypeName(pos, r.currPkg, name0, nil) + t := typeparams.NewTypeParam(tn, nil) + + // To handle recursive references to the typeparam within its + // bound, save the partial type in tparamIndex before reading the bounds. + id := ident{r.currPkg, name} + r.p.tparamIndex[id] = t + var implicit bool + if r.p.version >= iexportVersionGo1_18 { + implicit = r.bool() + } + constraint := r.typ() + if implicit { + iface, _ := constraint.(*types.Interface) + if iface == nil { + errorf("non-interface constraint marked implicit") + } + typeparams.MarkImplicit(iface) + } + // The constraint type may not be complete, if we + // are in the middle of a type recursion involving type + // constraints. So, we defer SetConstraint until we have + // completely set up all types in ImportData. + r.p.later = append(r.p.later, setConstraintArgs{t: t, constraint: constraint}) + + case 'V': + typ := r.typ() + + r.declare(types.NewVar(pos, r.currPkg, name, typ)) + + default: + errorf("unexpected tag: %v", tag) + } +} + +func (r *importReader) declare(obj types.Object) { + obj.Pkg().Scope().Insert(obj) +} + +func (r *importReader) value() (typ types.Type, val constant.Value) { + typ = r.typ() + if r.p.version >= iexportVersionGo1_18 { + // TODO: add support for using the kind. + _ = constant.Kind(r.int64()) + } + + switch b := typ.Underlying().(*types.Basic); b.Info() & types.IsConstType { + case types.IsBoolean: + val = constant.MakeBool(r.bool()) + + case types.IsString: + val = constant.MakeString(r.string()) + + case types.IsInteger: + var x big.Int + r.mpint(&x, b) + val = constant.Make(&x) + + case types.IsFloat: + val = r.mpfloat(b) + + case types.IsComplex: + re := r.mpfloat(b) + im := r.mpfloat(b) + val = constant.BinaryOp(re, token.ADD, constant.MakeImag(im)) + + default: + if b.Kind() == types.Invalid { + val = constant.MakeUnknown() + return + } + errorf("unexpected type %v", typ) // panics + panic("unreachable") + } + + return +} + +func intSize(b *types.Basic) (signed bool, maxBytes uint) { + if (b.Info() & types.IsUntyped) != 0 { + return true, 64 + } + + switch b.Kind() { + case types.Float32, types.Complex64: + return true, 3 + case types.Float64, types.Complex128: + return true, 7 + } + + signed = (b.Info() & types.IsUnsigned) == 0 + switch b.Kind() { + case types.Int8, types.Uint8: + maxBytes = 1 + case types.Int16, types.Uint16: + maxBytes = 2 + case types.Int32, types.Uint32: + maxBytes = 4 + default: + maxBytes = 8 + } + + return +} + +func (r *importReader) mpint(x *big.Int, typ *types.Basic) { + signed, maxBytes := intSize(typ) + + maxSmall := 256 - maxBytes + if signed { + maxSmall = 256 - 2*maxBytes + } + if maxBytes == 1 { + maxSmall = 256 + } + + n, _ := r.declReader.ReadByte() + if uint(n) < maxSmall { + v := int64(n) + if signed { + v >>= 1 + if n&1 != 0 { + v = ^v + } + } + x.SetInt64(v) + return + } + + v := -n + if signed { + v = -(n &^ 1) >> 1 + } + if v < 1 || uint(v) > maxBytes { + errorf("weird decoding: %v, %v => %v", n, signed, v) + } + b := make([]byte, v) + io.ReadFull(&r.declReader, b) + x.SetBytes(b) + if signed && n&1 != 0 { + x.Neg(x) + } +} + +func (r *importReader) mpfloat(typ *types.Basic) constant.Value { + var mant big.Int + r.mpint(&mant, typ) + var f big.Float + f.SetInt(&mant) + if f.Sign() != 0 { + f.SetMantExp(&f, int(r.int64())) + } + return constant.Make(&f) +} + +func (r *importReader) ident() string { + return r.string() +} + +func (r *importReader) qualifiedIdent() (*types.Package, string) { + name := r.string() + pkg := r.pkg() + return pkg, name +} + +func (r *importReader) pos() token.Pos { + if r.p.shallow { + // precise offsets are encoded only in shallow mode + return r.posv2() + } + if r.p.version >= iexportVersionPosCol { + r.posv1() + } else { + r.posv0() + } + + if r.prevFile == "" && r.prevLine == 0 && r.prevColumn == 0 { + return token.NoPos + } + return r.p.fake.pos(r.prevFile, int(r.prevLine), int(r.prevColumn)) +} + +func (r *importReader) posv0() { + delta := r.int64() + if delta != deltaNewFile { + r.prevLine += delta + } else if l := r.int64(); l == -1 { + r.prevLine += deltaNewFile + } else { + r.prevFile = r.string() + r.prevLine = l + } +} + +func (r *importReader) posv1() { + delta := r.int64() + r.prevColumn += delta >> 1 + if delta&1 != 0 { + delta = r.int64() + r.prevLine += delta >> 1 + if delta&1 != 0 { + r.prevFile = r.string() + } + } +} + +func (r *importReader) posv2() token.Pos { + file := r.uint64() + if file == 0 { + return token.NoPos + } + tf := r.p.fileAt(file - 1) + return tf.Pos(int(r.uint64())) +} + +func (r *importReader) typ() types.Type { + return r.p.typAt(r.uint64(), nil) +} + +func isInterface(t types.Type) bool { + _, ok := t.(*types.Interface) + return ok +} + +func (r *importReader) pkg() *types.Package { return r.p.pkgAt(r.uint64()) } +func (r *importReader) string() string { return r.p.stringAt(r.uint64()) } + +func (r *importReader) doType(base *types.Named) (res types.Type) { + k := r.kind() + if debug { + r.p.trace("importing type %d (base: %s)", k, base) + r.p.indent++ + defer func() { + r.p.indent-- + r.p.trace("=> %s", res) + }() + } + switch k { + default: + errorf("unexpected kind tag in %q: %v", r.p.ipath, k) + return nil + + case definedType: + pkg, name := r.qualifiedIdent() + r.p.doDecl(pkg, name) + return pkg.Scope().Lookup(name).(*types.TypeName).Type() + case pointerType: + return types.NewPointer(r.typ()) + case sliceType: + return types.NewSlice(r.typ()) + case arrayType: + n := r.uint64() + return types.NewArray(r.typ(), int64(n)) + case chanType: + dir := chanDir(int(r.uint64())) + return types.NewChan(dir, r.typ()) + case mapType: + return types.NewMap(r.typ(), r.typ()) + case signatureType: + r.currPkg = r.pkg() + return r.signature(nil, nil, nil) + + case structType: + r.currPkg = r.pkg() + + fields := make([]*types.Var, r.uint64()) + tags := make([]string, len(fields)) + for i := range fields { + var field *types.Var + if r.p.shallow { + field, _ = r.objectPathObject().(*types.Var) + } + + fpos := r.pos() + fname := r.ident() + ftyp := r.typ() + emb := r.bool() + tag := r.string() + + // Either this is not a shallow import, the field is local, or the + // encoded objectPath failed to produce an object (a bug). + // + // Even in this last, buggy case, fall back on creating a new field. As + // discussed in iexport.go, this is not correct, but mostly works and is + // preferable to failing (for now at least). + if field == nil { + field = types.NewField(fpos, r.currPkg, fname, ftyp, emb) + } + + fields[i] = field + tags[i] = tag + } + return types.NewStruct(fields, tags) + + case interfaceType: + r.currPkg = r.pkg() + + embeddeds := make([]types.Type, r.uint64()) + for i := range embeddeds { + _ = r.pos() + embeddeds[i] = r.typ() + } + + methods := make([]*types.Func, r.uint64()) + for i := range methods { + var method *types.Func + if r.p.shallow { + method, _ = r.objectPathObject().(*types.Func) + } + + mpos := r.pos() + mname := r.ident() + + // TODO(mdempsky): Matches bimport.go, but I + // don't agree with this. + var recv *types.Var + if base != nil { + recv = types.NewVar(token.NoPos, r.currPkg, "", base) + } + msig := r.signature(recv, nil, nil) + + if method == nil { + method = types.NewFunc(mpos, r.currPkg, mname, msig) + } + methods[i] = method + } + + typ := newInterface(methods, embeddeds) + r.p.interfaceList = append(r.p.interfaceList, typ) + return typ + + case typeParamType: + if r.p.version < iexportVersionGenerics { + errorf("unexpected type param type") + } + pkg, name := r.qualifiedIdent() + id := ident{pkg, name} + if t, ok := r.p.tparamIndex[id]; ok { + // We're already in the process of importing this typeparam. + return t + } + // Otherwise, import the definition of the typeparam now. + r.p.doDecl(pkg, name) + return r.p.tparamIndex[id] + + case instanceType: + if r.p.version < iexportVersionGenerics { + errorf("unexpected instantiation type") + } + // pos does not matter for instances: they are positioned on the original + // type. + _ = r.pos() + len := r.uint64() + targs := make([]types.Type, len) + for i := range targs { + targs[i] = r.typ() + } + baseType := r.typ() + // The imported instantiated type doesn't include any methods, so + // we must always use the methods of the base (orig) type. + // TODO provide a non-nil *Environment + t, _ := typeparams.Instantiate(nil, baseType, targs, false) + + // Workaround for golang/go#61561. See the doc for instanceList for details. + r.p.instanceList = append(r.p.instanceList, t) + return t + + case unionType: + if r.p.version < iexportVersionGenerics { + errorf("unexpected instantiation type") + } + terms := make([]*typeparams.Term, r.uint64()) + for i := range terms { + terms[i] = typeparams.NewTerm(r.bool(), r.typ()) + } + return typeparams.NewUnion(terms) + } +} + +func (r *importReader) kind() itag { + return itag(r.uint64()) +} + +// objectPathObject is the inverse of exportWriter.objectPath. +// +// In shallow mode, certain fields and methods may need to be looked up in an +// imported package. See the doc for exportWriter.objectPath for a full +// explanation. +func (r *importReader) objectPathObject() types.Object { + objPath := objectpath.Path(r.string()) + if objPath == "" { + return nil + } + pkg := r.pkg() + obj, err := objectpath.Object(pkg, objPath) + if err != nil { + if r.p.reportf != nil { + r.p.reportf("failed to find object for objectPath %q: %v", objPath, err) + } + } + return obj +} + +func (r *importReader) signature(recv *types.Var, rparams []*typeparams.TypeParam, tparams []*typeparams.TypeParam) *types.Signature { + params := r.paramList() + results := r.paramList() + variadic := params.Len() > 0 && r.bool() + return typeparams.NewSignatureType(recv, rparams, tparams, params, results, variadic) +} + +func (r *importReader) tparamList() []*typeparams.TypeParam { + n := r.uint64() + if n == 0 { + return nil + } + xs := make([]*typeparams.TypeParam, n) + for i := range xs { + // Note: the standard library importer is tolerant of nil types here, + // though would panic in SetTypeParams. + xs[i] = r.typ().(*typeparams.TypeParam) + } + return xs +} + +func (r *importReader) paramList() *types.Tuple { + xs := make([]*types.Var, r.uint64()) + for i := range xs { + xs[i] = r.param() + } + return types.NewTuple(xs...) +} + +func (r *importReader) param() *types.Var { + pos := r.pos() + name := r.ident() + typ := r.typ() + return types.NewParam(pos, r.currPkg, name, typ) +} + +func (r *importReader) bool() bool { + return r.uint64() != 0 +} + +func (r *importReader) int64() int64 { + n, err := binary.ReadVarint(&r.declReader) + if err != nil { + errorf("readVarint: %v", err) + } + return n +} + +func (r *importReader) uint64() uint64 { + n, err := binary.ReadUvarint(&r.declReader) + if err != nil { + errorf("readUvarint: %v", err) + } + return n +} + +func (r *importReader) byte() byte { + x, err := r.declReader.ReadByte() + if err != nil { + errorf("declReader.ReadByte: %v", err) + } + return x +} + +func baseType(typ types.Type) *types.Named { + // pointer receivers are never types.Named types + if p, _ := typ.(*types.Pointer); p != nil { + typ = p.Elem() + } + // receiver base types are always (possibly generic) types.Named types + n, _ := typ.(*types.Named) + return n +} diff --git a/vendor/golang.org/x/tools/internal/gcimporter/newInterface10.go b/vendor/golang.org/x/tools/internal/gcimporter/newInterface10.go new file mode 100644 index 000000000..8b163e3d0 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/newInterface10.go @@ -0,0 +1,22 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.11 +// +build !go1.11 + +package gcimporter + +import "go/types" + +func newInterface(methods []*types.Func, embeddeds []types.Type) *types.Interface { + named := make([]*types.Named, len(embeddeds)) + for i, e := range embeddeds { + var ok bool + named[i], ok = e.(*types.Named) + if !ok { + panic("embedding of non-defined interfaces in interfaces is not supported before Go 1.11") + } + } + return types.NewInterface(methods, named) +} diff --git a/vendor/golang.org/x/tools/internal/gcimporter/newInterface11.go b/vendor/golang.org/x/tools/internal/gcimporter/newInterface11.go new file mode 100644 index 000000000..49984f40f --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/newInterface11.go @@ -0,0 +1,14 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.11 +// +build go1.11 + +package gcimporter + +import "go/types" + +func newInterface(methods []*types.Func, embeddeds []types.Type) *types.Interface { + return types.NewInterfaceType(methods, embeddeds) +} diff --git a/vendor/golang.org/x/tools/internal/gcimporter/support_go117.go b/vendor/golang.org/x/tools/internal/gcimporter/support_go117.go new file mode 100644 index 000000000..d892273ef --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/support_go117.go @@ -0,0 +1,16 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.18 +// +build !go1.18 + +package gcimporter + +import "go/types" + +const iexportVersion = iexportVersionGo1_11 + +func additionalPredeclared() []types.Type { + return nil +} diff --git a/vendor/golang.org/x/tools/internal/gcimporter/support_go118.go b/vendor/golang.org/x/tools/internal/gcimporter/support_go118.go new file mode 100644 index 000000000..edbe6ea70 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/support_go118.go @@ -0,0 +1,37 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 +// +build go1.18 + +package gcimporter + +import "go/types" + +const iexportVersion = iexportVersionGenerics + +// additionalPredeclared returns additional predeclared types in go.1.18. +func additionalPredeclared() []types.Type { + return []types.Type{ + // comparable + types.Universe.Lookup("comparable").Type(), + + // any + types.Universe.Lookup("any").Type(), + } +} + +// See cmd/compile/internal/types.SplitVargenSuffix. +func splitVargenSuffix(name string) (base, suffix string) { + i := len(name) + for i > 0 && name[i-1] >= '0' && name[i-1] <= '9' { + i-- + } + const dot = "·" + if i >= len(dot) && name[i-len(dot):i] == dot { + i -= len(dot) + return name[:i], name[i:] + } + return name, "" +} diff --git a/vendor/golang.org/x/tools/internal/gcimporter/unified_no.go b/vendor/golang.org/x/tools/internal/gcimporter/unified_no.go new file mode 100644 index 000000000..286bf4454 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/unified_no.go @@ -0,0 +1,10 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !(go1.18 && goexperiment.unified) +// +build !go1.18 !goexperiment.unified + +package gcimporter + +const unifiedIR = false diff --git a/vendor/golang.org/x/tools/internal/gcimporter/unified_yes.go b/vendor/golang.org/x/tools/internal/gcimporter/unified_yes.go new file mode 100644 index 000000000..b5d69ffbe --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/unified_yes.go @@ -0,0 +1,10 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 && goexperiment.unified +// +build go1.18,goexperiment.unified + +package gcimporter + +const unifiedIR = true diff --git a/vendor/golang.org/x/tools/internal/gcimporter/ureader_no.go b/vendor/golang.org/x/tools/internal/gcimporter/ureader_no.go new file mode 100644 index 000000000..8eb20729c --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/ureader_no.go @@ -0,0 +1,19 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.18 +// +build !go1.18 + +package gcimporter + +import ( + "fmt" + "go/token" + "go/types" +) + +func UImportData(fset *token.FileSet, imports map[string]*types.Package, data []byte, path string) (_ int, pkg *types.Package, err error) { + err = fmt.Errorf("go/tools compiled with a Go version earlier than 1.18 cannot read unified IR export data") + return +} diff --git a/vendor/golang.org/x/tools/internal/gcimporter/ureader_yes.go b/vendor/golang.org/x/tools/internal/gcimporter/ureader_yes.go new file mode 100644 index 000000000..b977435f6 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gcimporter/ureader_yes.go @@ -0,0 +1,728 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Derived from go/internal/gcimporter/ureader.go + +//go:build go1.18 +// +build go1.18 + +package gcimporter + +import ( + "fmt" + "go/token" + "go/types" + "sort" + "strings" + + "golang.org/x/tools/internal/pkgbits" +) + +// A pkgReader holds the shared state for reading a unified IR package +// description. +type pkgReader struct { + pkgbits.PkgDecoder + + fake fakeFileSet + + ctxt *types.Context + imports map[string]*types.Package // previously imported packages, indexed by path + + // lazily initialized arrays corresponding to the unified IR + // PosBase, Pkg, and Type sections, respectively. + posBases []string // position bases (i.e., file names) + pkgs []*types.Package + typs []types.Type + + // laterFns holds functions that need to be invoked at the end of + // import reading. + laterFns []func() + // laterFors is used in case of 'type A B' to ensure that B is processed before A. + laterFors map[types.Type]int + + // ifaces holds a list of constructed Interfaces, which need to have + // Complete called after importing is done. + ifaces []*types.Interface +} + +// later adds a function to be invoked at the end of import reading. +func (pr *pkgReader) later(fn func()) { + pr.laterFns = append(pr.laterFns, fn) +} + +// See cmd/compile/internal/noder.derivedInfo. +type derivedInfo struct { + idx pkgbits.Index + needed bool +} + +// See cmd/compile/internal/noder.typeInfo. +type typeInfo struct { + idx pkgbits.Index + derived bool +} + +func UImportData(fset *token.FileSet, imports map[string]*types.Package, data []byte, path string) (_ int, pkg *types.Package, err error) { + if !debug { + defer func() { + if x := recover(); x != nil { + err = fmt.Errorf("internal error in importing %q (%v); please report an issue", path, x) + } + }() + } + + s := string(data) + s = s[:strings.LastIndex(s, "\n$$\n")] + input := pkgbits.NewPkgDecoder(path, s) + pkg = readUnifiedPackage(fset, nil, imports, input) + return +} + +// laterFor adds a function to be invoked at the end of import reading, and records the type that function is finishing. +func (pr *pkgReader) laterFor(t types.Type, fn func()) { + if pr.laterFors == nil { + pr.laterFors = make(map[types.Type]int) + } + pr.laterFors[t] = len(pr.laterFns) + pr.laterFns = append(pr.laterFns, fn) +} + +// readUnifiedPackage reads a package description from the given +// unified IR export data decoder. +func readUnifiedPackage(fset *token.FileSet, ctxt *types.Context, imports map[string]*types.Package, input pkgbits.PkgDecoder) *types.Package { + pr := pkgReader{ + PkgDecoder: input, + + fake: fakeFileSet{ + fset: fset, + files: make(map[string]*fileInfo), + }, + + ctxt: ctxt, + imports: imports, + + posBases: make([]string, input.NumElems(pkgbits.RelocPosBase)), + pkgs: make([]*types.Package, input.NumElems(pkgbits.RelocPkg)), + typs: make([]types.Type, input.NumElems(pkgbits.RelocType)), + } + defer pr.fake.setLines() + + r := pr.newReader(pkgbits.RelocMeta, pkgbits.PublicRootIdx, pkgbits.SyncPublic) + pkg := r.pkg() + r.Bool() // has init + + for i, n := 0, r.Len(); i < n; i++ { + // As if r.obj(), but avoiding the Scope.Lookup call, + // to avoid eager loading of imports. + r.Sync(pkgbits.SyncObject) + assert(!r.Bool()) + r.p.objIdx(r.Reloc(pkgbits.RelocObj)) + assert(r.Len() == 0) + } + + r.Sync(pkgbits.SyncEOF) + + for _, fn := range pr.laterFns { + fn() + } + + for _, iface := range pr.ifaces { + iface.Complete() + } + + // Imports() of pkg are all of the transitive packages that were loaded. + var imps []*types.Package + for _, imp := range pr.pkgs { + if imp != nil && imp != pkg { + imps = append(imps, imp) + } + } + sort.Sort(byPath(imps)) + pkg.SetImports(imps) + + pkg.MarkComplete() + return pkg +} + +// A reader holds the state for reading a single unified IR element +// within a package. +type reader struct { + pkgbits.Decoder + + p *pkgReader + + dict *readerDict +} + +// A readerDict holds the state for type parameters that parameterize +// the current unified IR element. +type readerDict struct { + // bounds is a slice of typeInfos corresponding to the underlying + // bounds of the element's type parameters. + bounds []typeInfo + + // tparams is a slice of the constructed TypeParams for the element. + tparams []*types.TypeParam + + // devived is a slice of types derived from tparams, which may be + // instantiated while reading the current element. + derived []derivedInfo + derivedTypes []types.Type // lazily instantiated from derived +} + +func (pr *pkgReader) newReader(k pkgbits.RelocKind, idx pkgbits.Index, marker pkgbits.SyncMarker) *reader { + return &reader{ + Decoder: pr.NewDecoder(k, idx, marker), + p: pr, + } +} + +func (pr *pkgReader) tempReader(k pkgbits.RelocKind, idx pkgbits.Index, marker pkgbits.SyncMarker) *reader { + return &reader{ + Decoder: pr.TempDecoder(k, idx, marker), + p: pr, + } +} + +func (pr *pkgReader) retireReader(r *reader) { + pr.RetireDecoder(&r.Decoder) +} + +// @@@ Positions + +func (r *reader) pos() token.Pos { + r.Sync(pkgbits.SyncPos) + if !r.Bool() { + return token.NoPos + } + + // TODO(mdempsky): Delta encoding. + posBase := r.posBase() + line := r.Uint() + col := r.Uint() + return r.p.fake.pos(posBase, int(line), int(col)) +} + +func (r *reader) posBase() string { + return r.p.posBaseIdx(r.Reloc(pkgbits.RelocPosBase)) +} + +func (pr *pkgReader) posBaseIdx(idx pkgbits.Index) string { + if b := pr.posBases[idx]; b != "" { + return b + } + + var filename string + { + r := pr.tempReader(pkgbits.RelocPosBase, idx, pkgbits.SyncPosBase) + + // Within types2, position bases have a lot more details (e.g., + // keeping track of where //line directives appeared exactly). + // + // For go/types, we just track the file name. + + filename = r.String() + + if r.Bool() { // file base + // Was: "b = token.NewTrimmedFileBase(filename, true)" + } else { // line base + pos := r.pos() + line := r.Uint() + col := r.Uint() + + // Was: "b = token.NewLineBase(pos, filename, true, line, col)" + _, _, _ = pos, line, col + } + pr.retireReader(r) + } + b := filename + pr.posBases[idx] = b + return b +} + +// @@@ Packages + +func (r *reader) pkg() *types.Package { + r.Sync(pkgbits.SyncPkg) + return r.p.pkgIdx(r.Reloc(pkgbits.RelocPkg)) +} + +func (pr *pkgReader) pkgIdx(idx pkgbits.Index) *types.Package { + // TODO(mdempsky): Consider using some non-nil pointer to indicate + // the universe scope, so we don't need to keep re-reading it. + if pkg := pr.pkgs[idx]; pkg != nil { + return pkg + } + + pkg := pr.newReader(pkgbits.RelocPkg, idx, pkgbits.SyncPkgDef).doPkg() + pr.pkgs[idx] = pkg + return pkg +} + +func (r *reader) doPkg() *types.Package { + path := r.String() + switch path { + case "": + path = r.p.PkgPath() + case "builtin": + return nil // universe + case "unsafe": + return types.Unsafe + } + + if pkg := r.p.imports[path]; pkg != nil { + return pkg + } + + name := r.String() + + pkg := types.NewPackage(path, name) + r.p.imports[path] = pkg + + return pkg +} + +// @@@ Types + +func (r *reader) typ() types.Type { + return r.p.typIdx(r.typInfo(), r.dict) +} + +func (r *reader) typInfo() typeInfo { + r.Sync(pkgbits.SyncType) + if r.Bool() { + return typeInfo{idx: pkgbits.Index(r.Len()), derived: true} + } + return typeInfo{idx: r.Reloc(pkgbits.RelocType), derived: false} +} + +func (pr *pkgReader) typIdx(info typeInfo, dict *readerDict) types.Type { + idx := info.idx + var where *types.Type + if info.derived { + where = &dict.derivedTypes[idx] + idx = dict.derived[idx].idx + } else { + where = &pr.typs[idx] + } + + if typ := *where; typ != nil { + return typ + } + + var typ types.Type + { + r := pr.tempReader(pkgbits.RelocType, idx, pkgbits.SyncTypeIdx) + r.dict = dict + + typ = r.doTyp() + assert(typ != nil) + pr.retireReader(r) + } + // See comment in pkgReader.typIdx explaining how this happens. + if prev := *where; prev != nil { + return prev + } + + *where = typ + return typ +} + +func (r *reader) doTyp() (res types.Type) { + switch tag := pkgbits.CodeType(r.Code(pkgbits.SyncType)); tag { + default: + errorf("unhandled type tag: %v", tag) + panic("unreachable") + + case pkgbits.TypeBasic: + return types.Typ[r.Len()] + + case pkgbits.TypeNamed: + obj, targs := r.obj() + name := obj.(*types.TypeName) + if len(targs) != 0 { + t, _ := types.Instantiate(r.p.ctxt, name.Type(), targs, false) + return t + } + return name.Type() + + case pkgbits.TypeTypeParam: + return r.dict.tparams[r.Len()] + + case pkgbits.TypeArray: + len := int64(r.Uint64()) + return types.NewArray(r.typ(), len) + case pkgbits.TypeChan: + dir := types.ChanDir(r.Len()) + return types.NewChan(dir, r.typ()) + case pkgbits.TypeMap: + return types.NewMap(r.typ(), r.typ()) + case pkgbits.TypePointer: + return types.NewPointer(r.typ()) + case pkgbits.TypeSignature: + return r.signature(nil, nil, nil) + case pkgbits.TypeSlice: + return types.NewSlice(r.typ()) + case pkgbits.TypeStruct: + return r.structType() + case pkgbits.TypeInterface: + return r.interfaceType() + case pkgbits.TypeUnion: + return r.unionType() + } +} + +func (r *reader) structType() *types.Struct { + fields := make([]*types.Var, r.Len()) + var tags []string + for i := range fields { + pos := r.pos() + pkg, name := r.selector() + ftyp := r.typ() + tag := r.String() + embedded := r.Bool() + + fields[i] = types.NewField(pos, pkg, name, ftyp, embedded) + if tag != "" { + for len(tags) < i { + tags = append(tags, "") + } + tags = append(tags, tag) + } + } + return types.NewStruct(fields, tags) +} + +func (r *reader) unionType() *types.Union { + terms := make([]*types.Term, r.Len()) + for i := range terms { + terms[i] = types.NewTerm(r.Bool(), r.typ()) + } + return types.NewUnion(terms) +} + +func (r *reader) interfaceType() *types.Interface { + methods := make([]*types.Func, r.Len()) + embeddeds := make([]types.Type, r.Len()) + implicit := len(methods) == 0 && len(embeddeds) == 1 && r.Bool() + + for i := range methods { + pos := r.pos() + pkg, name := r.selector() + mtyp := r.signature(nil, nil, nil) + methods[i] = types.NewFunc(pos, pkg, name, mtyp) + } + + for i := range embeddeds { + embeddeds[i] = r.typ() + } + + iface := types.NewInterfaceType(methods, embeddeds) + if implicit { + iface.MarkImplicit() + } + + // We need to call iface.Complete(), but if there are any embedded + // defined types, then we may not have set their underlying + // interface type yet. So we need to defer calling Complete until + // after we've called SetUnderlying everywhere. + // + // TODO(mdempsky): After CL 424876 lands, it should be safe to call + // iface.Complete() immediately. + r.p.ifaces = append(r.p.ifaces, iface) + + return iface +} + +func (r *reader) signature(recv *types.Var, rtparams, tparams []*types.TypeParam) *types.Signature { + r.Sync(pkgbits.SyncSignature) + + params := r.params() + results := r.params() + variadic := r.Bool() + + return types.NewSignatureType(recv, rtparams, tparams, params, results, variadic) +} + +func (r *reader) params() *types.Tuple { + r.Sync(pkgbits.SyncParams) + + params := make([]*types.Var, r.Len()) + for i := range params { + params[i] = r.param() + } + + return types.NewTuple(params...) +} + +func (r *reader) param() *types.Var { + r.Sync(pkgbits.SyncParam) + + pos := r.pos() + pkg, name := r.localIdent() + typ := r.typ() + + return types.NewParam(pos, pkg, name, typ) +} + +// @@@ Objects + +func (r *reader) obj() (types.Object, []types.Type) { + r.Sync(pkgbits.SyncObject) + + assert(!r.Bool()) + + pkg, name := r.p.objIdx(r.Reloc(pkgbits.RelocObj)) + obj := pkgScope(pkg).Lookup(name) + + targs := make([]types.Type, r.Len()) + for i := range targs { + targs[i] = r.typ() + } + + return obj, targs +} + +func (pr *pkgReader) objIdx(idx pkgbits.Index) (*types.Package, string) { + + var objPkg *types.Package + var objName string + var tag pkgbits.CodeObj + { + rname := pr.tempReader(pkgbits.RelocName, idx, pkgbits.SyncObject1) + + objPkg, objName = rname.qualifiedIdent() + assert(objName != "") + + tag = pkgbits.CodeObj(rname.Code(pkgbits.SyncCodeObj)) + pr.retireReader(rname) + } + + if tag == pkgbits.ObjStub { + assert(objPkg == nil || objPkg == types.Unsafe) + return objPkg, objName + } + + // Ignore local types promoted to global scope (#55110). + if _, suffix := splitVargenSuffix(objName); suffix != "" { + return objPkg, objName + } + + if objPkg.Scope().Lookup(objName) == nil { + dict := pr.objDictIdx(idx) + + r := pr.newReader(pkgbits.RelocObj, idx, pkgbits.SyncObject1) + r.dict = dict + + declare := func(obj types.Object) { + objPkg.Scope().Insert(obj) + } + + switch tag { + default: + panic("weird") + + case pkgbits.ObjAlias: + pos := r.pos() + typ := r.typ() + declare(types.NewTypeName(pos, objPkg, objName, typ)) + + case pkgbits.ObjConst: + pos := r.pos() + typ := r.typ() + val := r.Value() + declare(types.NewConst(pos, objPkg, objName, typ, val)) + + case pkgbits.ObjFunc: + pos := r.pos() + tparams := r.typeParamNames() + sig := r.signature(nil, nil, tparams) + declare(types.NewFunc(pos, objPkg, objName, sig)) + + case pkgbits.ObjType: + pos := r.pos() + + obj := types.NewTypeName(pos, objPkg, objName, nil) + named := types.NewNamed(obj, nil, nil) + declare(obj) + + named.SetTypeParams(r.typeParamNames()) + + setUnderlying := func(underlying types.Type) { + // If the underlying type is an interface, we need to + // duplicate its methods so we can replace the receiver + // parameter's type (#49906). + if iface, ok := underlying.(*types.Interface); ok && iface.NumExplicitMethods() != 0 { + methods := make([]*types.Func, iface.NumExplicitMethods()) + for i := range methods { + fn := iface.ExplicitMethod(i) + sig := fn.Type().(*types.Signature) + + recv := types.NewVar(fn.Pos(), fn.Pkg(), "", named) + methods[i] = types.NewFunc(fn.Pos(), fn.Pkg(), fn.Name(), types.NewSignature(recv, sig.Params(), sig.Results(), sig.Variadic())) + } + + embeds := make([]types.Type, iface.NumEmbeddeds()) + for i := range embeds { + embeds[i] = iface.EmbeddedType(i) + } + + newIface := types.NewInterfaceType(methods, embeds) + r.p.ifaces = append(r.p.ifaces, newIface) + underlying = newIface + } + + named.SetUnderlying(underlying) + } + + // Since go.dev/cl/455279, we can assume rhs.Underlying() will + // always be non-nil. However, to temporarily support users of + // older snapshot releases, we continue to fallback to the old + // behavior for now. + // + // TODO(mdempsky): Remove fallback code and simplify after + // allowing time for snapshot users to upgrade. + rhs := r.typ() + if underlying := rhs.Underlying(); underlying != nil { + setUnderlying(underlying) + } else { + pk := r.p + pk.laterFor(named, func() { + // First be sure that the rhs is initialized, if it needs to be initialized. + delete(pk.laterFors, named) // prevent cycles + if i, ok := pk.laterFors[rhs]; ok { + f := pk.laterFns[i] + pk.laterFns[i] = func() {} // function is running now, so replace it with a no-op + f() // initialize RHS + } + setUnderlying(rhs.Underlying()) + }) + } + + for i, n := 0, r.Len(); i < n; i++ { + named.AddMethod(r.method()) + } + + case pkgbits.ObjVar: + pos := r.pos() + typ := r.typ() + declare(types.NewVar(pos, objPkg, objName, typ)) + } + } + + return objPkg, objName +} + +func (pr *pkgReader) objDictIdx(idx pkgbits.Index) *readerDict { + + var dict readerDict + + { + r := pr.tempReader(pkgbits.RelocObjDict, idx, pkgbits.SyncObject1) + if implicits := r.Len(); implicits != 0 { + errorf("unexpected object with %v implicit type parameter(s)", implicits) + } + + dict.bounds = make([]typeInfo, r.Len()) + for i := range dict.bounds { + dict.bounds[i] = r.typInfo() + } + + dict.derived = make([]derivedInfo, r.Len()) + dict.derivedTypes = make([]types.Type, len(dict.derived)) + for i := range dict.derived { + dict.derived[i] = derivedInfo{r.Reloc(pkgbits.RelocType), r.Bool()} + } + + pr.retireReader(r) + } + // function references follow, but reader doesn't need those + + return &dict +} + +func (r *reader) typeParamNames() []*types.TypeParam { + r.Sync(pkgbits.SyncTypeParamNames) + + // Note: This code assumes it only processes objects without + // implement type parameters. This is currently fine, because + // reader is only used to read in exported declarations, which are + // always package scoped. + + if len(r.dict.bounds) == 0 { + return nil + } + + // Careful: Type parameter lists may have cycles. To allow for this, + // we construct the type parameter list in two passes: first we + // create all the TypeNames and TypeParams, then we construct and + // set the bound type. + + r.dict.tparams = make([]*types.TypeParam, len(r.dict.bounds)) + for i := range r.dict.bounds { + pos := r.pos() + pkg, name := r.localIdent() + + tname := types.NewTypeName(pos, pkg, name, nil) + r.dict.tparams[i] = types.NewTypeParam(tname, nil) + } + + typs := make([]types.Type, len(r.dict.bounds)) + for i, bound := range r.dict.bounds { + typs[i] = r.p.typIdx(bound, r.dict) + } + + // TODO(mdempsky): This is subtle, elaborate further. + // + // We have to save tparams outside of the closure, because + // typeParamNames() can be called multiple times with the same + // dictionary instance. + // + // Also, this needs to happen later to make sure SetUnderlying has + // been called. + // + // TODO(mdempsky): Is it safe to have a single "later" slice or do + // we need to have multiple passes? See comments on CL 386002 and + // go.dev/issue/52104. + tparams := r.dict.tparams + r.p.later(func() { + for i, typ := range typs { + tparams[i].SetConstraint(typ) + } + }) + + return r.dict.tparams +} + +func (r *reader) method() *types.Func { + r.Sync(pkgbits.SyncMethod) + pos := r.pos() + pkg, name := r.selector() + + rparams := r.typeParamNames() + sig := r.signature(r.param(), rparams, nil) + + _ = r.pos() // TODO(mdempsky): Remove; this is a hacker for linker.go. + return types.NewFunc(pos, pkg, name, sig) +} + +func (r *reader) qualifiedIdent() (*types.Package, string) { return r.ident(pkgbits.SyncSym) } +func (r *reader) localIdent() (*types.Package, string) { return r.ident(pkgbits.SyncLocalIdent) } +func (r *reader) selector() (*types.Package, string) { return r.ident(pkgbits.SyncSelector) } + +func (r *reader) ident(marker pkgbits.SyncMarker) (*types.Package, string) { + r.Sync(marker) + return r.pkg(), r.String() +} + +// pkgScope returns pkg.Scope(). +// If pkg is nil, it returns types.Universe instead. +// +// TODO(mdempsky): Remove after x/tools can depend on Go 1.19. +func pkgScope(pkg *types.Package) *types.Scope { + if pkg != nil { + return pkg.Scope() + } + return types.Universe +} diff --git a/vendor/golang.org/x/tools/internal/gocommand/invoke.go b/vendor/golang.org/x/tools/internal/gocommand/invoke.go new file mode 100644 index 000000000..53cf66da0 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gocommand/invoke.go @@ -0,0 +1,462 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package gocommand is a helper for calling the go command. +package gocommand + +import ( + "bytes" + "context" + "errors" + "fmt" + "io" + "log" + "os" + "reflect" + "regexp" + "runtime" + "strconv" + "strings" + "sync" + "time" + + exec "golang.org/x/sys/execabs" + + "golang.org/x/tools/internal/event" + "golang.org/x/tools/internal/event/keys" + "golang.org/x/tools/internal/event/label" + "golang.org/x/tools/internal/event/tag" +) + +// An Runner will run go command invocations and serialize +// them if it sees a concurrency error. +type Runner struct { + // once guards the runner initialization. + once sync.Once + + // inFlight tracks available workers. + inFlight chan struct{} + + // serialized guards the ability to run a go command serially, + // to avoid deadlocks when claiming workers. + serialized chan struct{} +} + +const maxInFlight = 10 + +func (runner *Runner) initialize() { + runner.once.Do(func() { + runner.inFlight = make(chan struct{}, maxInFlight) + runner.serialized = make(chan struct{}, 1) + }) +} + +// 1.13: go: updates to go.mod needed, but contents have changed +// 1.14: go: updating go.mod: existing contents have changed since last read +var modConcurrencyError = regexp.MustCompile(`go:.*go.mod.*contents have changed`) + +// verb is an event label for the go command verb. +var verb = keys.NewString("verb", "go command verb") + +func invLabels(inv Invocation) []label.Label { + return []label.Label{verb.Of(inv.Verb), tag.Directory.Of(inv.WorkingDir)} +} + +// Run is a convenience wrapper around RunRaw. +// It returns only stdout and a "friendly" error. +func (runner *Runner) Run(ctx context.Context, inv Invocation) (*bytes.Buffer, error) { + ctx, done := event.Start(ctx, "gocommand.Runner.Run", invLabels(inv)...) + defer done() + + stdout, _, friendly, _ := runner.RunRaw(ctx, inv) + return stdout, friendly +} + +// RunPiped runs the invocation serially, always waiting for any concurrent +// invocations to complete first. +func (runner *Runner) RunPiped(ctx context.Context, inv Invocation, stdout, stderr io.Writer) error { + ctx, done := event.Start(ctx, "gocommand.Runner.RunPiped", invLabels(inv)...) + defer done() + + _, err := runner.runPiped(ctx, inv, stdout, stderr) + return err +} + +// RunRaw runs the invocation, serializing requests only if they fight over +// go.mod changes. +func (runner *Runner) RunRaw(ctx context.Context, inv Invocation) (*bytes.Buffer, *bytes.Buffer, error, error) { + ctx, done := event.Start(ctx, "gocommand.Runner.RunRaw", invLabels(inv)...) + defer done() + // Make sure the runner is always initialized. + runner.initialize() + + // First, try to run the go command concurrently. + stdout, stderr, friendlyErr, err := runner.runConcurrent(ctx, inv) + + // If we encounter a load concurrency error, we need to retry serially. + if friendlyErr == nil || !modConcurrencyError.MatchString(friendlyErr.Error()) { + return stdout, stderr, friendlyErr, err + } + event.Error(ctx, "Load concurrency error, will retry serially", err) + + // Run serially by calling runPiped. + stdout.Reset() + stderr.Reset() + friendlyErr, err = runner.runPiped(ctx, inv, stdout, stderr) + return stdout, stderr, friendlyErr, err +} + +func (runner *Runner) runConcurrent(ctx context.Context, inv Invocation) (*bytes.Buffer, *bytes.Buffer, error, error) { + // Wait for 1 worker to become available. + select { + case <-ctx.Done(): + return nil, nil, nil, ctx.Err() + case runner.inFlight <- struct{}{}: + defer func() { <-runner.inFlight }() + } + + stdout, stderr := &bytes.Buffer{}, &bytes.Buffer{} + friendlyErr, err := inv.runWithFriendlyError(ctx, stdout, stderr) + return stdout, stderr, friendlyErr, err +} + +func (runner *Runner) runPiped(ctx context.Context, inv Invocation, stdout, stderr io.Writer) (error, error) { + // Make sure the runner is always initialized. + runner.initialize() + + // Acquire the serialization lock. This avoids deadlocks between two + // runPiped commands. + select { + case <-ctx.Done(): + return nil, ctx.Err() + case runner.serialized <- struct{}{}: + defer func() { <-runner.serialized }() + } + + // Wait for all in-progress go commands to return before proceeding, + // to avoid load concurrency errors. + for i := 0; i < maxInFlight; i++ { + select { + case <-ctx.Done(): + return nil, ctx.Err() + case runner.inFlight <- struct{}{}: + // Make sure we always "return" any workers we took. + defer func() { <-runner.inFlight }() + } + } + + return inv.runWithFriendlyError(ctx, stdout, stderr) +} + +// An Invocation represents a call to the go command. +type Invocation struct { + Verb string + Args []string + BuildFlags []string + + // If ModFlag is set, the go command is invoked with -mod=ModFlag. + ModFlag string + + // If ModFile is set, the go command is invoked with -modfile=ModFile. + ModFile string + + // If Overlay is set, the go command is invoked with -overlay=Overlay. + Overlay string + + // If CleanEnv is set, the invocation will run only with the environment + // in Env, not starting with os.Environ. + CleanEnv bool + Env []string + WorkingDir string + Logf func(format string, args ...interface{}) +} + +func (i *Invocation) runWithFriendlyError(ctx context.Context, stdout, stderr io.Writer) (friendlyError error, rawError error) { + rawError = i.run(ctx, stdout, stderr) + if rawError != nil { + friendlyError = rawError + // Check for 'go' executable not being found. + if ee, ok := rawError.(*exec.Error); ok && ee.Err == exec.ErrNotFound { + friendlyError = fmt.Errorf("go command required, not found: %v", ee) + } + if ctx.Err() != nil { + friendlyError = ctx.Err() + } + friendlyError = fmt.Errorf("err: %v: stderr: %s", friendlyError, stderr) + } + return +} + +func (i *Invocation) run(ctx context.Context, stdout, stderr io.Writer) error { + log := i.Logf + if log == nil { + log = func(string, ...interface{}) {} + } + + goArgs := []string{i.Verb} + + appendModFile := func() { + if i.ModFile != "" { + goArgs = append(goArgs, "-modfile="+i.ModFile) + } + } + appendModFlag := func() { + if i.ModFlag != "" { + goArgs = append(goArgs, "-mod="+i.ModFlag) + } + } + appendOverlayFlag := func() { + if i.Overlay != "" { + goArgs = append(goArgs, "-overlay="+i.Overlay) + } + } + + switch i.Verb { + case "env", "version": + goArgs = append(goArgs, i.Args...) + case "mod": + // mod needs the sub-verb before flags. + goArgs = append(goArgs, i.Args[0]) + appendModFile() + goArgs = append(goArgs, i.Args[1:]...) + case "get": + goArgs = append(goArgs, i.BuildFlags...) + appendModFile() + goArgs = append(goArgs, i.Args...) + + default: // notably list and build. + goArgs = append(goArgs, i.BuildFlags...) + appendModFile() + appendModFlag() + appendOverlayFlag() + goArgs = append(goArgs, i.Args...) + } + cmd := exec.Command("go", goArgs...) + cmd.Stdout = stdout + cmd.Stderr = stderr + + // cmd.WaitDelay was added only in go1.20 (see #50436). + if waitDelay := reflect.ValueOf(cmd).Elem().FieldByName("WaitDelay"); waitDelay.IsValid() { + // https://go.dev/issue/59541: don't wait forever copying stderr + // after the command has exited. + // After CL 484741 we copy stdout manually, so we we'll stop reading that as + // soon as ctx is done. However, we also don't want to wait around forever + // for stderr. Give a much-longer-than-reasonable delay and then assume that + // something has wedged in the kernel or runtime. + waitDelay.Set(reflect.ValueOf(30 * time.Second)) + } + + // On darwin the cwd gets resolved to the real path, which breaks anything that + // expects the working directory to keep the original path, including the + // go command when dealing with modules. + // The Go stdlib has a special feature where if the cwd and the PWD are the + // same node then it trusts the PWD, so by setting it in the env for the child + // process we fix up all the paths returned by the go command. + if !i.CleanEnv { + cmd.Env = os.Environ() + } + cmd.Env = append(cmd.Env, i.Env...) + if i.WorkingDir != "" { + cmd.Env = append(cmd.Env, "PWD="+i.WorkingDir) + cmd.Dir = i.WorkingDir + } + + defer func(start time.Time) { log("%s for %v", time.Since(start), cmdDebugStr(cmd)) }(time.Now()) + + return runCmdContext(ctx, cmd) +} + +// DebugHangingGoCommands may be set by tests to enable additional +// instrumentation (including panics) for debugging hanging Go commands. +// +// See golang/go#54461 for details. +var DebugHangingGoCommands = false + +// runCmdContext is like exec.CommandContext except it sends os.Interrupt +// before os.Kill. +func runCmdContext(ctx context.Context, cmd *exec.Cmd) (err error) { + // If cmd.Stdout is not an *os.File, the exec package will create a pipe and + // copy it to the Writer in a goroutine until the process has finished and + // either the pipe reaches EOF or command's WaitDelay expires. + // + // However, the output from 'go list' can be quite large, and we don't want to + // keep reading (and allocating buffers) if we've already decided we don't + // care about the output. We don't want to wait for the process to finish, and + // we don't wait to wait for the WaitDelay to expire either. + // + // Instead, if cmd.Stdout requires a copying goroutine we explicitly replace + // it with a pipe (which is an *os.File), which we can close in order to stop + // copying output as soon as we realize we don't care about it. + var stdoutW *os.File + if cmd.Stdout != nil { + if _, ok := cmd.Stdout.(*os.File); !ok { + var stdoutR *os.File + stdoutR, stdoutW, err = os.Pipe() + if err != nil { + return err + } + prevStdout := cmd.Stdout + cmd.Stdout = stdoutW + + stdoutErr := make(chan error, 1) + go func() { + _, err := io.Copy(prevStdout, stdoutR) + if err != nil { + err = fmt.Errorf("copying stdout: %w", err) + } + stdoutErr <- err + }() + defer func() { + // We started a goroutine to copy a stdout pipe. + // Wait for it to finish, or terminate it if need be. + var err2 error + select { + case err2 = <-stdoutErr: + stdoutR.Close() + case <-ctx.Done(): + stdoutR.Close() + // Per https://pkg.go.dev/os#File.Close, the call to stdoutR.Close + // should cause the Read call in io.Copy to unblock and return + // immediately, but we still need to receive from stdoutErr to confirm + // that it has happened. + <-stdoutErr + err2 = ctx.Err() + } + if err == nil { + err = err2 + } + }() + + // Per https://pkg.go.dev/os/exec#Cmd, “If Stdout and Stderr are the + // same writer, and have a type that can be compared with ==, at most + // one goroutine at a time will call Write.” + // + // Since we're starting a goroutine that writes to cmd.Stdout, we must + // also update cmd.Stderr so that it still holds. + func() { + defer func() { recover() }() + if cmd.Stderr == prevStdout { + cmd.Stderr = cmd.Stdout + } + }() + } + } + + err = cmd.Start() + if stdoutW != nil { + // The child process has inherited the pipe file, + // so close the copy held in this process. + stdoutW.Close() + stdoutW = nil + } + if err != nil { + return err + } + + resChan := make(chan error, 1) + go func() { + resChan <- cmd.Wait() + }() + + // If we're interested in debugging hanging Go commands, stop waiting after a + // minute and panic with interesting information. + debug := DebugHangingGoCommands + if debug { + timer := time.NewTimer(1 * time.Minute) + defer timer.Stop() + select { + case err := <-resChan: + return err + case <-timer.C: + HandleHangingGoCommand(cmd.Process) + case <-ctx.Done(): + } + } else { + select { + case err := <-resChan: + return err + case <-ctx.Done(): + } + } + + // Cancelled. Interrupt and see if it ends voluntarily. + if err := cmd.Process.Signal(os.Interrupt); err == nil { + // (We used to wait only 1s but this proved + // fragile on loaded builder machines.) + timer := time.NewTimer(5 * time.Second) + defer timer.Stop() + select { + case err := <-resChan: + return err + case <-timer.C: + } + } + + // Didn't shut down in response to interrupt. Kill it hard. + // TODO(rfindley): per advice from bcmills@, it may be better to send SIGQUIT + // on certain platforms, such as unix. + if err := cmd.Process.Kill(); err != nil && !errors.Is(err, os.ErrProcessDone) && debug { + log.Printf("error killing the Go command: %v", err) + } + + return <-resChan +} + +func HandleHangingGoCommand(proc *os.Process) { + switch runtime.GOOS { + case "linux", "darwin", "freebsd", "netbsd": + fmt.Fprintln(os.Stderr, `DETECTED A HANGING GO COMMAND + +The gopls test runner has detected a hanging go command. In order to debug +this, the output of ps and lsof/fstat is printed below. + +See golang/go#54461 for more details.`) + + fmt.Fprintln(os.Stderr, "\nps axo ppid,pid,command:") + fmt.Fprintln(os.Stderr, "-------------------------") + psCmd := exec.Command("ps", "axo", "ppid,pid,command") + psCmd.Stdout = os.Stderr + psCmd.Stderr = os.Stderr + if err := psCmd.Run(); err != nil { + panic(fmt.Sprintf("running ps: %v", err)) + } + + listFiles := "lsof" + if runtime.GOOS == "freebsd" || runtime.GOOS == "netbsd" { + listFiles = "fstat" + } + + fmt.Fprintln(os.Stderr, "\n"+listFiles+":") + fmt.Fprintln(os.Stderr, "-----") + listFilesCmd := exec.Command(listFiles) + listFilesCmd.Stdout = os.Stderr + listFilesCmd.Stderr = os.Stderr + if err := listFilesCmd.Run(); err != nil { + panic(fmt.Sprintf("running %s: %v", listFiles, err)) + } + } + panic(fmt.Sprintf("detected hanging go command (pid %d): see golang/go#54461 for more details", proc.Pid)) +} + +func cmdDebugStr(cmd *exec.Cmd) string { + env := make(map[string]string) + for _, kv := range cmd.Env { + split := strings.SplitN(kv, "=", 2) + if len(split) == 2 { + k, v := split[0], split[1] + env[k] = v + } + } + + var args []string + for _, arg := range cmd.Args { + quoted := strconv.Quote(arg) + if quoted[1:len(quoted)-1] != arg || strings.Contains(arg, " ") { + args = append(args, quoted) + } else { + args = append(args, arg) + } + } + return fmt.Sprintf("GOROOT=%v GOPATH=%v GO111MODULE=%v GOPROXY=%v PWD=%v %v", env["GOROOT"], env["GOPATH"], env["GO111MODULE"], env["GOPROXY"], env["PWD"], strings.Join(args, " ")) +} diff --git a/vendor/golang.org/x/tools/internal/gocommand/vendor.go b/vendor/golang.org/x/tools/internal/gocommand/vendor.go new file mode 100644 index 000000000..2d3d408c0 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gocommand/vendor.go @@ -0,0 +1,109 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package gocommand + +import ( + "bytes" + "context" + "fmt" + "os" + "path/filepath" + "regexp" + "strings" + "time" + + "golang.org/x/mod/semver" +) + +// ModuleJSON holds information about a module. +type ModuleJSON struct { + Path string // module path + Version string // module version + Versions []string // available module versions (with -versions) + Replace *ModuleJSON // replaced by this module + Time *time.Time // time version was created + Update *ModuleJSON // available update, if any (with -u) + Main bool // is this the main module? + Indirect bool // is this module only an indirect dependency of main module? + Dir string // directory holding files for this module, if any + GoMod string // path to go.mod file used when loading this module, if any + GoVersion string // go version used in module +} + +var modFlagRegexp = regexp.MustCompile(`-mod[ =](\w+)`) + +// VendorEnabled reports whether vendoring is enabled. It takes a *Runner to execute Go commands +// with the supplied context.Context and Invocation. The Invocation can contain pre-defined fields, +// of which only Verb and Args are modified to run the appropriate Go command. +// Inspired by setDefaultBuildMod in modload/init.go +func VendorEnabled(ctx context.Context, inv Invocation, r *Runner) (bool, *ModuleJSON, error) { + mainMod, go114, err := getMainModuleAnd114(ctx, inv, r) + if err != nil { + return false, nil, err + } + + // We check the GOFLAGS to see if there is anything overridden or not. + inv.Verb = "env" + inv.Args = []string{"GOFLAGS"} + stdout, err := r.Run(ctx, inv) + if err != nil { + return false, nil, err + } + goflags := string(bytes.TrimSpace(stdout.Bytes())) + matches := modFlagRegexp.FindStringSubmatch(goflags) + var modFlag string + if len(matches) != 0 { + modFlag = matches[1] + } + // Don't override an explicit '-mod=' argument. + if modFlag == "vendor" { + return true, mainMod, nil + } else if modFlag != "" { + return false, nil, nil + } + if mainMod == nil || !go114 { + return false, nil, nil + } + // Check 1.14's automatic vendor mode. + if fi, err := os.Stat(filepath.Join(mainMod.Dir, "vendor")); err == nil && fi.IsDir() { + if mainMod.GoVersion != "" && semver.Compare("v"+mainMod.GoVersion, "v1.14") >= 0 { + // The Go version is at least 1.14, and a vendor directory exists. + // Set -mod=vendor by default. + return true, mainMod, nil + } + } + return false, nil, nil +} + +// getMainModuleAnd114 gets one of the main modules' information and whether the +// go command in use is 1.14+. This is the information needed to figure out +// if vendoring should be enabled. +func getMainModuleAnd114(ctx context.Context, inv Invocation, r *Runner) (*ModuleJSON, bool, error) { + const format = `{{.Path}} +{{.Dir}} +{{.GoMod}} +{{.GoVersion}} +{{range context.ReleaseTags}}{{if eq . "go1.14"}}{{.}}{{end}}{{end}} +` + inv.Verb = "list" + inv.Args = []string{"-m", "-f", format} + stdout, err := r.Run(ctx, inv) + if err != nil { + return nil, false, err + } + + lines := strings.Split(stdout.String(), "\n") + if len(lines) < 5 { + return nil, false, fmt.Errorf("unexpected stdout: %q", stdout.String()) + } + mod := &ModuleJSON{ + Path: lines[0], + Dir: lines[1], + GoMod: lines[2], + GoVersion: lines[3], + Main: true, + } + return mod, lines[4] == "go1.14", nil +} diff --git a/vendor/golang.org/x/tools/internal/gocommand/version.go b/vendor/golang.org/x/tools/internal/gocommand/version.go new file mode 100644 index 000000000..446c5846a --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gocommand/version.go @@ -0,0 +1,71 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package gocommand + +import ( + "context" + "fmt" + "regexp" + "strings" +) + +// GoVersion reports the minor version number of the highest release +// tag built into the go command on the PATH. +// +// Note that this may be higher than the version of the go tool used +// to build this application, and thus the versions of the standard +// go/{scanner,parser,ast,types} packages that are linked into it. +// In that case, callers should either downgrade to the version of +// go used to build the application, or report an error that the +// application is too old to use the go command on the PATH. +func GoVersion(ctx context.Context, inv Invocation, r *Runner) (int, error) { + inv.Verb = "list" + inv.Args = []string{"-e", "-f", `{{context.ReleaseTags}}`, `--`, `unsafe`} + inv.BuildFlags = nil // This is not a build command. + inv.ModFlag = "" + inv.ModFile = "" + inv.Env = append(inv.Env[:len(inv.Env):len(inv.Env)], "GO111MODULE=off") + + stdoutBytes, err := r.Run(ctx, inv) + if err != nil { + return 0, err + } + stdout := stdoutBytes.String() + if len(stdout) < 3 { + return 0, fmt.Errorf("bad ReleaseTags output: %q", stdout) + } + // Split up "[go1.1 go1.15]" and return highest go1.X value. + tags := strings.Fields(stdout[1 : len(stdout)-2]) + for i := len(tags) - 1; i >= 0; i-- { + var version int + if _, err := fmt.Sscanf(tags[i], "go1.%d", &version); err != nil { + continue + } + return version, nil + } + return 0, fmt.Errorf("no parseable ReleaseTags in %v", tags) +} + +// GoVersionOutput returns the complete output of the go version command. +func GoVersionOutput(ctx context.Context, inv Invocation, r *Runner) (string, error) { + inv.Verb = "version" + goVersion, err := r.Run(ctx, inv) + if err != nil { + return "", err + } + return goVersion.String(), nil +} + +// ParseGoVersionOutput extracts the Go version string +// from the output of the "go version" command. +// Given an unrecognized form, it returns an empty string. +func ParseGoVersionOutput(data string) string { + re := regexp.MustCompile(`^go version (go\S+|devel \S+)`) + m := re.FindStringSubmatch(data) + if len(m) != 2 { + return "" // unrecognized version + } + return m[1] +} diff --git a/vendor/golang.org/x/tools/internal/packagesinternal/packages.go b/vendor/golang.org/x/tools/internal/packagesinternal/packages.go new file mode 100644 index 000000000..d9950b1f0 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/packagesinternal/packages.go @@ -0,0 +1,30 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package packagesinternal exposes internal-only fields from go/packages. +package packagesinternal + +import ( + "golang.org/x/tools/internal/gocommand" +) + +var GetForTest = func(p interface{}) string { return "" } +var GetDepsErrors = func(p interface{}) []*PackageError { return nil } + +type PackageError struct { + ImportStack []string // shortest path from package named on command line to this one + Pos string // position of error (if present, file:line:col) + Err string // the error itself +} + +var GetGoCmdRunner = func(config interface{}) *gocommand.Runner { return nil } + +var SetGoCmdRunner = func(config interface{}, runner *gocommand.Runner) {} + +var TypecheckCgo int +var DepsErrors int // must be set as a LoadMode to call GetDepsErrors +var ForTest int // must be set as a LoadMode to call GetForTest + +var SetModFlag = func(config interface{}, value string) {} +var SetModFile = func(config interface{}, value string) {} diff --git a/vendor/golang.org/x/tools/internal/pkgbits/codes.go b/vendor/golang.org/x/tools/internal/pkgbits/codes.go new file mode 100644 index 000000000..f0cabde96 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/codes.go @@ -0,0 +1,77 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +// A Code is an enum value that can be encoded into bitstreams. +// +// Code types are preferable for enum types, because they allow +// Decoder to detect desyncs. +type Code interface { + // Marker returns the SyncMarker for the Code's dynamic type. + Marker() SyncMarker + + // Value returns the Code's ordinal value. + Value() int +} + +// A CodeVal distinguishes among go/constant.Value encodings. +type CodeVal int + +func (c CodeVal) Marker() SyncMarker { return SyncVal } +func (c CodeVal) Value() int { return int(c) } + +// Note: These values are public and cannot be changed without +// updating the go/types importers. + +const ( + ValBool CodeVal = iota + ValString + ValInt64 + ValBigInt + ValBigRat + ValBigFloat +) + +// A CodeType distinguishes among go/types.Type encodings. +type CodeType int + +func (c CodeType) Marker() SyncMarker { return SyncType } +func (c CodeType) Value() int { return int(c) } + +// Note: These values are public and cannot be changed without +// updating the go/types importers. + +const ( + TypeBasic CodeType = iota + TypeNamed + TypePointer + TypeSlice + TypeArray + TypeChan + TypeMap + TypeSignature + TypeStruct + TypeInterface + TypeUnion + TypeTypeParam +) + +// A CodeObj distinguishes among go/types.Object encodings. +type CodeObj int + +func (c CodeObj) Marker() SyncMarker { return SyncCodeObj } +func (c CodeObj) Value() int { return int(c) } + +// Note: These values are public and cannot be changed without +// updating the go/types importers. + +const ( + ObjAlias CodeObj = iota + ObjConst + ObjType + ObjFunc + ObjVar + ObjStub +) diff --git a/vendor/golang.org/x/tools/internal/pkgbits/decoder.go b/vendor/golang.org/x/tools/internal/pkgbits/decoder.go new file mode 100644 index 000000000..b92e8e6eb --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/decoder.go @@ -0,0 +1,517 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +import ( + "encoding/binary" + "errors" + "fmt" + "go/constant" + "go/token" + "io" + "math/big" + "os" + "runtime" + "strings" +) + +// A PkgDecoder provides methods for decoding a package's Unified IR +// export data. +type PkgDecoder struct { + // version is the file format version. + version uint32 + + // sync indicates whether the file uses sync markers. + sync bool + + // pkgPath is the package path for the package to be decoded. + // + // TODO(mdempsky): Remove; unneeded since CL 391014. + pkgPath string + + // elemData is the full data payload of the encoded package. + // Elements are densely and contiguously packed together. + // + // The last 8 bytes of elemData are the package fingerprint. + elemData string + + // elemEnds stores the byte-offset end positions of element + // bitstreams within elemData. + // + // For example, element I's bitstream data starts at elemEnds[I-1] + // (or 0, if I==0) and ends at elemEnds[I]. + // + // Note: elemEnds is indexed by absolute indices, not + // section-relative indices. + elemEnds []uint32 + + // elemEndsEnds stores the index-offset end positions of relocation + // sections within elemEnds. + // + // For example, section K's end positions start at elemEndsEnds[K-1] + // (or 0, if K==0) and end at elemEndsEnds[K]. + elemEndsEnds [numRelocs]uint32 + + scratchRelocEnt []RelocEnt +} + +// PkgPath returns the package path for the package +// +// TODO(mdempsky): Remove; unneeded since CL 391014. +func (pr *PkgDecoder) PkgPath() string { return pr.pkgPath } + +// SyncMarkers reports whether pr uses sync markers. +func (pr *PkgDecoder) SyncMarkers() bool { return pr.sync } + +// NewPkgDecoder returns a PkgDecoder initialized to read the Unified +// IR export data from input. pkgPath is the package path for the +// compilation unit that produced the export data. +// +// TODO(mdempsky): Remove pkgPath parameter; unneeded since CL 391014. +func NewPkgDecoder(pkgPath, input string) PkgDecoder { + pr := PkgDecoder{ + pkgPath: pkgPath, + } + + // TODO(mdempsky): Implement direct indexing of input string to + // avoid copying the position information. + + r := strings.NewReader(input) + + assert(binary.Read(r, binary.LittleEndian, &pr.version) == nil) + + switch pr.version { + default: + panic(fmt.Errorf("unsupported version: %v", pr.version)) + case 0: + // no flags + case 1: + var flags uint32 + assert(binary.Read(r, binary.LittleEndian, &flags) == nil) + pr.sync = flags&flagSyncMarkers != 0 + } + + assert(binary.Read(r, binary.LittleEndian, pr.elemEndsEnds[:]) == nil) + + pr.elemEnds = make([]uint32, pr.elemEndsEnds[len(pr.elemEndsEnds)-1]) + assert(binary.Read(r, binary.LittleEndian, pr.elemEnds[:]) == nil) + + pos, err := r.Seek(0, io.SeekCurrent) + assert(err == nil) + + pr.elemData = input[pos:] + assert(len(pr.elemData)-8 == int(pr.elemEnds[len(pr.elemEnds)-1])) + + return pr +} + +// NumElems returns the number of elements in section k. +func (pr *PkgDecoder) NumElems(k RelocKind) int { + count := int(pr.elemEndsEnds[k]) + if k > 0 { + count -= int(pr.elemEndsEnds[k-1]) + } + return count +} + +// TotalElems returns the total number of elements across all sections. +func (pr *PkgDecoder) TotalElems() int { + return len(pr.elemEnds) +} + +// Fingerprint returns the package fingerprint. +func (pr *PkgDecoder) Fingerprint() [8]byte { + var fp [8]byte + copy(fp[:], pr.elemData[len(pr.elemData)-8:]) + return fp +} + +// AbsIdx returns the absolute index for the given (section, index) +// pair. +func (pr *PkgDecoder) AbsIdx(k RelocKind, idx Index) int { + absIdx := int(idx) + if k > 0 { + absIdx += int(pr.elemEndsEnds[k-1]) + } + if absIdx >= int(pr.elemEndsEnds[k]) { + errorf("%v:%v is out of bounds; %v", k, idx, pr.elemEndsEnds) + } + return absIdx +} + +// DataIdx returns the raw element bitstream for the given (section, +// index) pair. +func (pr *PkgDecoder) DataIdx(k RelocKind, idx Index) string { + absIdx := pr.AbsIdx(k, idx) + + var start uint32 + if absIdx > 0 { + start = pr.elemEnds[absIdx-1] + } + end := pr.elemEnds[absIdx] + + return pr.elemData[start:end] +} + +// StringIdx returns the string value for the given string index. +func (pr *PkgDecoder) StringIdx(idx Index) string { + return pr.DataIdx(RelocString, idx) +} + +// NewDecoder returns a Decoder for the given (section, index) pair, +// and decodes the given SyncMarker from the element bitstream. +func (pr *PkgDecoder) NewDecoder(k RelocKind, idx Index, marker SyncMarker) Decoder { + r := pr.NewDecoderRaw(k, idx) + r.Sync(marker) + return r +} + +// TempDecoder returns a Decoder for the given (section, index) pair, +// and decodes the given SyncMarker from the element bitstream. +// If possible the Decoder should be RetireDecoder'd when it is no longer +// needed, this will avoid heap allocations. +func (pr *PkgDecoder) TempDecoder(k RelocKind, idx Index, marker SyncMarker) Decoder { + r := pr.TempDecoderRaw(k, idx) + r.Sync(marker) + return r +} + +func (pr *PkgDecoder) RetireDecoder(d *Decoder) { + pr.scratchRelocEnt = d.Relocs + d.Relocs = nil +} + +// NewDecoderRaw returns a Decoder for the given (section, index) pair. +// +// Most callers should use NewDecoder instead. +func (pr *PkgDecoder) NewDecoderRaw(k RelocKind, idx Index) Decoder { + r := Decoder{ + common: pr, + k: k, + Idx: idx, + } + + // TODO(mdempsky) r.data.Reset(...) after #44505 is resolved. + r.Data = *strings.NewReader(pr.DataIdx(k, idx)) + + r.Sync(SyncRelocs) + r.Relocs = make([]RelocEnt, r.Len()) + for i := range r.Relocs { + r.Sync(SyncReloc) + r.Relocs[i] = RelocEnt{RelocKind(r.Len()), Index(r.Len())} + } + + return r +} + +func (pr *PkgDecoder) TempDecoderRaw(k RelocKind, idx Index) Decoder { + r := Decoder{ + common: pr, + k: k, + Idx: idx, + } + + r.Data.Reset(pr.DataIdx(k, idx)) + r.Sync(SyncRelocs) + l := r.Len() + if cap(pr.scratchRelocEnt) >= l { + r.Relocs = pr.scratchRelocEnt[:l] + pr.scratchRelocEnt = nil + } else { + r.Relocs = make([]RelocEnt, l) + } + for i := range r.Relocs { + r.Sync(SyncReloc) + r.Relocs[i] = RelocEnt{RelocKind(r.Len()), Index(r.Len())} + } + + return r +} + +// A Decoder provides methods for decoding an individual element's +// bitstream data. +type Decoder struct { + common *PkgDecoder + + Relocs []RelocEnt + Data strings.Reader + + k RelocKind + Idx Index +} + +func (r *Decoder) checkErr(err error) { + if err != nil { + errorf("unexpected decoding error: %w", err) + } +} + +func (r *Decoder) rawUvarint() uint64 { + x, err := readUvarint(&r.Data) + r.checkErr(err) + return x +} + +// readUvarint is a type-specialized copy of encoding/binary.ReadUvarint. +// This avoids the interface conversion and thus has better escape properties, +// which flows up the stack. +func readUvarint(r *strings.Reader) (uint64, error) { + var x uint64 + var s uint + for i := 0; i < binary.MaxVarintLen64; i++ { + b, err := r.ReadByte() + if err != nil { + if i > 0 && err == io.EOF { + err = io.ErrUnexpectedEOF + } + return x, err + } + if b < 0x80 { + if i == binary.MaxVarintLen64-1 && b > 1 { + return x, overflow + } + return x | uint64(b)<> 1) + if ux&1 != 0 { + x = ^x + } + return x +} + +func (r *Decoder) rawReloc(k RelocKind, idx int) Index { + e := r.Relocs[idx] + assert(e.Kind == k) + return e.Idx +} + +// Sync decodes a sync marker from the element bitstream and asserts +// that it matches the expected marker. +// +// If r.common.sync is false, then Sync is a no-op. +func (r *Decoder) Sync(mWant SyncMarker) { + if !r.common.sync { + return + } + + pos, _ := r.Data.Seek(0, io.SeekCurrent) + mHave := SyncMarker(r.rawUvarint()) + writerPCs := make([]int, r.rawUvarint()) + for i := range writerPCs { + writerPCs[i] = int(r.rawUvarint()) + } + + if mHave == mWant { + return + } + + // There's some tension here between printing: + // + // (1) full file paths that tools can recognize (e.g., so emacs + // hyperlinks the "file:line" text for easy navigation), or + // + // (2) short file paths that are easier for humans to read (e.g., by + // omitting redundant or irrelevant details, so it's easier to + // focus on the useful bits that remain). + // + // The current formatting favors the former, as it seems more + // helpful in practice. But perhaps the formatting could be improved + // to better address both concerns. For example, use relative file + // paths if they would be shorter, or rewrite file paths to contain + // "$GOROOT" (like objabi.AbsFile does) if tools can be taught how + // to reliably expand that again. + + fmt.Printf("export data desync: package %q, section %v, index %v, offset %v\n", r.common.pkgPath, r.k, r.Idx, pos) + + fmt.Printf("\nfound %v, written at:\n", mHave) + if len(writerPCs) == 0 { + fmt.Printf("\t[stack trace unavailable; recompile package %q with -d=syncframes]\n", r.common.pkgPath) + } + for _, pc := range writerPCs { + fmt.Printf("\t%s\n", r.common.StringIdx(r.rawReloc(RelocString, pc))) + } + + fmt.Printf("\nexpected %v, reading at:\n", mWant) + var readerPCs [32]uintptr // TODO(mdempsky): Dynamically size? + n := runtime.Callers(2, readerPCs[:]) + for _, pc := range fmtFrames(readerPCs[:n]...) { + fmt.Printf("\t%s\n", pc) + } + + // We already printed a stack trace for the reader, so now we can + // simply exit. Printing a second one with panic or base.Fatalf + // would just be noise. + os.Exit(1) +} + +// Bool decodes and returns a bool value from the element bitstream. +func (r *Decoder) Bool() bool { + r.Sync(SyncBool) + x, err := r.Data.ReadByte() + r.checkErr(err) + assert(x < 2) + return x != 0 +} + +// Int64 decodes and returns an int64 value from the element bitstream. +func (r *Decoder) Int64() int64 { + r.Sync(SyncInt64) + return r.rawVarint() +} + +// Uint64 decodes and returns a uint64 value from the element bitstream. +func (r *Decoder) Uint64() uint64 { + r.Sync(SyncUint64) + return r.rawUvarint() +} + +// Len decodes and returns a non-negative int value from the element bitstream. +func (r *Decoder) Len() int { x := r.Uint64(); v := int(x); assert(uint64(v) == x); return v } + +// Int decodes and returns an int value from the element bitstream. +func (r *Decoder) Int() int { x := r.Int64(); v := int(x); assert(int64(v) == x); return v } + +// Uint decodes and returns a uint value from the element bitstream. +func (r *Decoder) Uint() uint { x := r.Uint64(); v := uint(x); assert(uint64(v) == x); return v } + +// Code decodes a Code value from the element bitstream and returns +// its ordinal value. It's the caller's responsibility to convert the +// result to an appropriate Code type. +// +// TODO(mdempsky): Ideally this method would have signature "Code[T +// Code] T" instead, but we don't allow generic methods and the +// compiler can't depend on generics yet anyway. +func (r *Decoder) Code(mark SyncMarker) int { + r.Sync(mark) + return r.Len() +} + +// Reloc decodes a relocation of expected section k from the element +// bitstream and returns an index to the referenced element. +func (r *Decoder) Reloc(k RelocKind) Index { + r.Sync(SyncUseReloc) + return r.rawReloc(k, r.Len()) +} + +// String decodes and returns a string value from the element +// bitstream. +func (r *Decoder) String() string { + r.Sync(SyncString) + return r.common.StringIdx(r.Reloc(RelocString)) +} + +// Strings decodes and returns a variable-length slice of strings from +// the element bitstream. +func (r *Decoder) Strings() []string { + res := make([]string, r.Len()) + for i := range res { + res[i] = r.String() + } + return res +} + +// Value decodes and returns a constant.Value from the element +// bitstream. +func (r *Decoder) Value() constant.Value { + r.Sync(SyncValue) + isComplex := r.Bool() + val := r.scalar() + if isComplex { + val = constant.BinaryOp(val, token.ADD, constant.MakeImag(r.scalar())) + } + return val +} + +func (r *Decoder) scalar() constant.Value { + switch tag := CodeVal(r.Code(SyncVal)); tag { + default: + panic(fmt.Errorf("unexpected scalar tag: %v", tag)) + + case ValBool: + return constant.MakeBool(r.Bool()) + case ValString: + return constant.MakeString(r.String()) + case ValInt64: + return constant.MakeInt64(r.Int64()) + case ValBigInt: + return constant.Make(r.bigInt()) + case ValBigRat: + num := r.bigInt() + denom := r.bigInt() + return constant.Make(new(big.Rat).SetFrac(num, denom)) + case ValBigFloat: + return constant.Make(r.bigFloat()) + } +} + +func (r *Decoder) bigInt() *big.Int { + v := new(big.Int).SetBytes([]byte(r.String())) + if r.Bool() { + v.Neg(v) + } + return v +} + +func (r *Decoder) bigFloat() *big.Float { + v := new(big.Float).SetPrec(512) + assert(v.UnmarshalText([]byte(r.String())) == nil) + return v +} + +// @@@ Helpers + +// TODO(mdempsky): These should probably be removed. I think they're a +// smell that the export data format is not yet quite right. + +// PeekPkgPath returns the package path for the specified package +// index. +func (pr *PkgDecoder) PeekPkgPath(idx Index) string { + var path string + { + r := pr.TempDecoder(RelocPkg, idx, SyncPkgDef) + path = r.String() + pr.RetireDecoder(&r) + } + if path == "" { + path = pr.pkgPath + } + return path +} + +// PeekObj returns the package path, object name, and CodeObj for the +// specified object index. +func (pr *PkgDecoder) PeekObj(idx Index) (string, string, CodeObj) { + var ridx Index + var name string + var rcode int + { + r := pr.TempDecoder(RelocName, idx, SyncObject1) + r.Sync(SyncSym) + r.Sync(SyncPkg) + ridx = r.Reloc(RelocPkg) + name = r.String() + rcode = r.Code(SyncCodeObj) + pr.RetireDecoder(&r) + } + + path := pr.PeekPkgPath(ridx) + assert(name != "") + + tag := CodeObj(rcode) + + return path, name, tag +} diff --git a/vendor/golang.org/x/tools/internal/pkgbits/doc.go b/vendor/golang.org/x/tools/internal/pkgbits/doc.go new file mode 100644 index 000000000..c8a2796b5 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/doc.go @@ -0,0 +1,32 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package pkgbits implements low-level coding abstractions for +// Unified IR's export data format. +// +// At a low-level, a package is a collection of bitstream elements. +// Each element has a "kind" and a dense, non-negative index. +// Elements can be randomly accessed given their kind and index. +// +// Individual elements are sequences of variable-length values (e.g., +// integers, booleans, strings, go/constant values, cross-references +// to other elements). Package pkgbits provides APIs for encoding and +// decoding these low-level values, but the details of mapping +// higher-level Go constructs into elements is left to higher-level +// abstractions. +// +// Elements may cross-reference each other with "relocations." For +// example, an element representing a pointer type has a relocation +// referring to the element type. +// +// Go constructs may be composed as a constellation of multiple +// elements. For example, a declared function may have one element to +// describe the object (e.g., its name, type, position), and a +// separate element to describe its function body. This allows readers +// some flexibility in efficiently seeking or re-reading data (e.g., +// inlining requires re-reading the function body for each inlined +// call, without needing to re-read the object-level details). +// +// This is a copy of internal/pkgbits in the Go implementation. +package pkgbits diff --git a/vendor/golang.org/x/tools/internal/pkgbits/encoder.go b/vendor/golang.org/x/tools/internal/pkgbits/encoder.go new file mode 100644 index 000000000..6482617a4 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/encoder.go @@ -0,0 +1,383 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +import ( + "bytes" + "crypto/md5" + "encoding/binary" + "go/constant" + "io" + "math/big" + "runtime" +) + +// currentVersion is the current version number. +// +// - v0: initial prototype +// +// - v1: adds the flags uint32 word +const currentVersion uint32 = 1 + +// A PkgEncoder provides methods for encoding a package's Unified IR +// export data. +type PkgEncoder struct { + // elems holds the bitstream for previously encoded elements. + elems [numRelocs][]string + + // stringsIdx maps previously encoded strings to their index within + // the RelocString section, to allow deduplication. That is, + // elems[RelocString][stringsIdx[s]] == s (if present). + stringsIdx map[string]Index + + // syncFrames is the number of frames to write at each sync + // marker. A negative value means sync markers are omitted. + syncFrames int +} + +// SyncMarkers reports whether pw uses sync markers. +func (pw *PkgEncoder) SyncMarkers() bool { return pw.syncFrames >= 0 } + +// NewPkgEncoder returns an initialized PkgEncoder. +// +// syncFrames is the number of caller frames that should be serialized +// at Sync points. Serializing additional frames results in larger +// export data files, but can help diagnosing desync errors in +// higher-level Unified IR reader/writer code. If syncFrames is +// negative, then sync markers are omitted entirely. +func NewPkgEncoder(syncFrames int) PkgEncoder { + return PkgEncoder{ + stringsIdx: make(map[string]Index), + syncFrames: syncFrames, + } +} + +// DumpTo writes the package's encoded data to out0 and returns the +// package fingerprint. +func (pw *PkgEncoder) DumpTo(out0 io.Writer) (fingerprint [8]byte) { + h := md5.New() + out := io.MultiWriter(out0, h) + + writeUint32 := func(x uint32) { + assert(binary.Write(out, binary.LittleEndian, x) == nil) + } + + writeUint32(currentVersion) + + var flags uint32 + if pw.SyncMarkers() { + flags |= flagSyncMarkers + } + writeUint32(flags) + + // Write elemEndsEnds. + var sum uint32 + for _, elems := range &pw.elems { + sum += uint32(len(elems)) + writeUint32(sum) + } + + // Write elemEnds. + sum = 0 + for _, elems := range &pw.elems { + for _, elem := range elems { + sum += uint32(len(elem)) + writeUint32(sum) + } + } + + // Write elemData. + for _, elems := range &pw.elems { + for _, elem := range elems { + _, err := io.WriteString(out, elem) + assert(err == nil) + } + } + + // Write fingerprint. + copy(fingerprint[:], h.Sum(nil)) + _, err := out0.Write(fingerprint[:]) + assert(err == nil) + + return +} + +// StringIdx adds a string value to the strings section, if not +// already present, and returns its index. +func (pw *PkgEncoder) StringIdx(s string) Index { + if idx, ok := pw.stringsIdx[s]; ok { + assert(pw.elems[RelocString][idx] == s) + return idx + } + + idx := Index(len(pw.elems[RelocString])) + pw.elems[RelocString] = append(pw.elems[RelocString], s) + pw.stringsIdx[s] = idx + return idx +} + +// NewEncoder returns an Encoder for a new element within the given +// section, and encodes the given SyncMarker as the start of the +// element bitstream. +func (pw *PkgEncoder) NewEncoder(k RelocKind, marker SyncMarker) Encoder { + e := pw.NewEncoderRaw(k) + e.Sync(marker) + return e +} + +// NewEncoderRaw returns an Encoder for a new element within the given +// section. +// +// Most callers should use NewEncoder instead. +func (pw *PkgEncoder) NewEncoderRaw(k RelocKind) Encoder { + idx := Index(len(pw.elems[k])) + pw.elems[k] = append(pw.elems[k], "") // placeholder + + return Encoder{ + p: pw, + k: k, + Idx: idx, + } +} + +// An Encoder provides methods for encoding an individual element's +// bitstream data. +type Encoder struct { + p *PkgEncoder + + Relocs []RelocEnt + RelocMap map[RelocEnt]uint32 + Data bytes.Buffer // accumulated element bitstream data + + encodingRelocHeader bool + + k RelocKind + Idx Index // index within relocation section +} + +// Flush finalizes the element's bitstream and returns its Index. +func (w *Encoder) Flush() Index { + var sb bytes.Buffer // TODO(mdempsky): strings.Builder after #44505 is resolved + + // Backup the data so we write the relocations at the front. + var tmp bytes.Buffer + io.Copy(&tmp, &w.Data) + + // TODO(mdempsky): Consider writing these out separately so they're + // easier to strip, along with function bodies, so that we can prune + // down to just the data that's relevant to go/types. + if w.encodingRelocHeader { + panic("encodingRelocHeader already true; recursive flush?") + } + w.encodingRelocHeader = true + w.Sync(SyncRelocs) + w.Len(len(w.Relocs)) + for _, rEnt := range w.Relocs { + w.Sync(SyncReloc) + w.Len(int(rEnt.Kind)) + w.Len(int(rEnt.Idx)) + } + + io.Copy(&sb, &w.Data) + io.Copy(&sb, &tmp) + w.p.elems[w.k][w.Idx] = sb.String() + + return w.Idx +} + +func (w *Encoder) checkErr(err error) { + if err != nil { + errorf("unexpected encoding error: %v", err) + } +} + +func (w *Encoder) rawUvarint(x uint64) { + var buf [binary.MaxVarintLen64]byte + n := binary.PutUvarint(buf[:], x) + _, err := w.Data.Write(buf[:n]) + w.checkErr(err) +} + +func (w *Encoder) rawVarint(x int64) { + // Zig-zag encode. + ux := uint64(x) << 1 + if x < 0 { + ux = ^ux + } + + w.rawUvarint(ux) +} + +func (w *Encoder) rawReloc(r RelocKind, idx Index) int { + e := RelocEnt{r, idx} + if w.RelocMap != nil { + if i, ok := w.RelocMap[e]; ok { + return int(i) + } + } else { + w.RelocMap = make(map[RelocEnt]uint32) + } + + i := len(w.Relocs) + w.RelocMap[e] = uint32(i) + w.Relocs = append(w.Relocs, e) + return i +} + +func (w *Encoder) Sync(m SyncMarker) { + if !w.p.SyncMarkers() { + return + } + + // Writing out stack frame string references requires working + // relocations, but writing out the relocations themselves involves + // sync markers. To prevent infinite recursion, we simply trim the + // stack frame for sync markers within the relocation header. + var frames []string + if !w.encodingRelocHeader && w.p.syncFrames > 0 { + pcs := make([]uintptr, w.p.syncFrames) + n := runtime.Callers(2, pcs) + frames = fmtFrames(pcs[:n]...) + } + + // TODO(mdempsky): Save space by writing out stack frames as a + // linked list so we can share common stack frames. + w.rawUvarint(uint64(m)) + w.rawUvarint(uint64(len(frames))) + for _, frame := range frames { + w.rawUvarint(uint64(w.rawReloc(RelocString, w.p.StringIdx(frame)))) + } +} + +// Bool encodes and writes a bool value into the element bitstream, +// and then returns the bool value. +// +// For simple, 2-alternative encodings, the idiomatic way to call Bool +// is something like: +// +// if w.Bool(x != 0) { +// // alternative #1 +// } else { +// // alternative #2 +// } +// +// For multi-alternative encodings, use Code instead. +func (w *Encoder) Bool(b bool) bool { + w.Sync(SyncBool) + var x byte + if b { + x = 1 + } + err := w.Data.WriteByte(x) + w.checkErr(err) + return b +} + +// Int64 encodes and writes an int64 value into the element bitstream. +func (w *Encoder) Int64(x int64) { + w.Sync(SyncInt64) + w.rawVarint(x) +} + +// Uint64 encodes and writes a uint64 value into the element bitstream. +func (w *Encoder) Uint64(x uint64) { + w.Sync(SyncUint64) + w.rawUvarint(x) +} + +// Len encodes and writes a non-negative int value into the element bitstream. +func (w *Encoder) Len(x int) { assert(x >= 0); w.Uint64(uint64(x)) } + +// Int encodes and writes an int value into the element bitstream. +func (w *Encoder) Int(x int) { w.Int64(int64(x)) } + +// Uint encodes and writes a uint value into the element bitstream. +func (w *Encoder) Uint(x uint) { w.Uint64(uint64(x)) } + +// Reloc encodes and writes a relocation for the given (section, +// index) pair into the element bitstream. +// +// Note: Only the index is formally written into the element +// bitstream, so bitstream decoders must know from context which +// section an encoded relocation refers to. +func (w *Encoder) Reloc(r RelocKind, idx Index) { + w.Sync(SyncUseReloc) + w.Len(w.rawReloc(r, idx)) +} + +// Code encodes and writes a Code value into the element bitstream. +func (w *Encoder) Code(c Code) { + w.Sync(c.Marker()) + w.Len(c.Value()) +} + +// String encodes and writes a string value into the element +// bitstream. +// +// Internally, strings are deduplicated by adding them to the strings +// section (if not already present), and then writing a relocation +// into the element bitstream. +func (w *Encoder) String(s string) { + w.Sync(SyncString) + w.Reloc(RelocString, w.p.StringIdx(s)) +} + +// Strings encodes and writes a variable-length slice of strings into +// the element bitstream. +func (w *Encoder) Strings(ss []string) { + w.Len(len(ss)) + for _, s := range ss { + w.String(s) + } +} + +// Value encodes and writes a constant.Value into the element +// bitstream. +func (w *Encoder) Value(val constant.Value) { + w.Sync(SyncValue) + if w.Bool(val.Kind() == constant.Complex) { + w.scalar(constant.Real(val)) + w.scalar(constant.Imag(val)) + } else { + w.scalar(val) + } +} + +func (w *Encoder) scalar(val constant.Value) { + switch v := constant.Val(val).(type) { + default: + errorf("unhandled %v (%v)", val, val.Kind()) + case bool: + w.Code(ValBool) + w.Bool(v) + case string: + w.Code(ValString) + w.String(v) + case int64: + w.Code(ValInt64) + w.Int64(v) + case *big.Int: + w.Code(ValBigInt) + w.bigInt(v) + case *big.Rat: + w.Code(ValBigRat) + w.bigInt(v.Num()) + w.bigInt(v.Denom()) + case *big.Float: + w.Code(ValBigFloat) + w.bigFloat(v) + } +} + +func (w *Encoder) bigInt(v *big.Int) { + b := v.Bytes() + w.String(string(b)) // TODO: More efficient encoding. + w.Bool(v.Sign() < 0) +} + +func (w *Encoder) bigFloat(v *big.Float) { + b := v.Append(nil, 'p', -1) + w.String(string(b)) // TODO: More efficient encoding. +} diff --git a/vendor/golang.org/x/tools/internal/pkgbits/flags.go b/vendor/golang.org/x/tools/internal/pkgbits/flags.go new file mode 100644 index 000000000..654222745 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/flags.go @@ -0,0 +1,9 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +const ( + flagSyncMarkers = 1 << iota // file format contains sync markers +) diff --git a/vendor/golang.org/x/tools/internal/pkgbits/frames_go1.go b/vendor/golang.org/x/tools/internal/pkgbits/frames_go1.go new file mode 100644 index 000000000..5294f6a63 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/frames_go1.go @@ -0,0 +1,21 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.7 +// +build !go1.7 + +// TODO(mdempsky): Remove after #44505 is resolved + +package pkgbits + +import "runtime" + +func walkFrames(pcs []uintptr, visit frameVisitor) { + for _, pc := range pcs { + fn := runtime.FuncForPC(pc) + file, line := fn.FileLine(pc) + + visit(file, line, fn.Name(), pc-fn.Entry()) + } +} diff --git a/vendor/golang.org/x/tools/internal/pkgbits/frames_go17.go b/vendor/golang.org/x/tools/internal/pkgbits/frames_go17.go new file mode 100644 index 000000000..2324ae7ad --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/frames_go17.go @@ -0,0 +1,28 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.7 +// +build go1.7 + +package pkgbits + +import "runtime" + +// walkFrames calls visit for each call frame represented by pcs. +// +// pcs should be a slice of PCs, as returned by runtime.Callers. +func walkFrames(pcs []uintptr, visit frameVisitor) { + if len(pcs) == 0 { + return + } + + frames := runtime.CallersFrames(pcs) + for { + frame, more := frames.Next() + visit(frame.File, frame.Line, frame.Function, frame.PC-frame.Entry) + if !more { + return + } + } +} diff --git a/vendor/golang.org/x/tools/internal/pkgbits/reloc.go b/vendor/golang.org/x/tools/internal/pkgbits/reloc.go new file mode 100644 index 000000000..fcdfb97ca --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/reloc.go @@ -0,0 +1,42 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +// A RelocKind indicates a particular section within a unified IR export. +type RelocKind int32 + +// An Index represents a bitstream element index within a particular +// section. +type Index int32 + +// A relocEnt (relocation entry) is an entry in an element's local +// reference table. +// +// TODO(mdempsky): Rename this too. +type RelocEnt struct { + Kind RelocKind + Idx Index +} + +// Reserved indices within the meta relocation section. +const ( + PublicRootIdx Index = 0 + PrivateRootIdx Index = 1 +) + +const ( + RelocString RelocKind = iota + RelocMeta + RelocPosBase + RelocPkg + RelocName + RelocType + RelocObj + RelocObjExt + RelocObjDict + RelocBody + + numRelocs = iota +) diff --git a/vendor/golang.org/x/tools/internal/pkgbits/support.go b/vendor/golang.org/x/tools/internal/pkgbits/support.go new file mode 100644 index 000000000..ad26d3b28 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/support.go @@ -0,0 +1,17 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +import "fmt" + +func assert(b bool) { + if !b { + panic("assertion failed") + } +} + +func errorf(format string, args ...interface{}) { + panic(fmt.Errorf(format, args...)) +} diff --git a/vendor/golang.org/x/tools/internal/pkgbits/sync.go b/vendor/golang.org/x/tools/internal/pkgbits/sync.go new file mode 100644 index 000000000..5bd51ef71 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/sync.go @@ -0,0 +1,113 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +import ( + "fmt" + "strings" +) + +// fmtFrames formats a backtrace for reporting reader/writer desyncs. +func fmtFrames(pcs ...uintptr) []string { + res := make([]string, 0, len(pcs)) + walkFrames(pcs, func(file string, line int, name string, offset uintptr) { + // Trim package from function name. It's just redundant noise. + name = strings.TrimPrefix(name, "cmd/compile/internal/noder.") + + res = append(res, fmt.Sprintf("%s:%v: %s +0x%v", file, line, name, offset)) + }) + return res +} + +type frameVisitor func(file string, line int, name string, offset uintptr) + +// SyncMarker is an enum type that represents markers that may be +// written to export data to ensure the reader and writer stay +// synchronized. +type SyncMarker int + +//go:generate stringer -type=SyncMarker -trimprefix=Sync + +const ( + _ SyncMarker = iota + + // Public markers (known to go/types importers). + + // Low-level coding markers. + SyncEOF + SyncBool + SyncInt64 + SyncUint64 + SyncString + SyncValue + SyncVal + SyncRelocs + SyncReloc + SyncUseReloc + + // Higher-level object and type markers. + SyncPublic + SyncPos + SyncPosBase + SyncObject + SyncObject1 + SyncPkg + SyncPkgDef + SyncMethod + SyncType + SyncTypeIdx + SyncTypeParamNames + SyncSignature + SyncParams + SyncParam + SyncCodeObj + SyncSym + SyncLocalIdent + SyncSelector + + // Private markers (only known to cmd/compile). + SyncPrivate + + SyncFuncExt + SyncVarExt + SyncTypeExt + SyncPragma + + SyncExprList + SyncExprs + SyncExpr + SyncExprType + SyncAssign + SyncOp + SyncFuncLit + SyncCompLit + + SyncDecl + SyncFuncBody + SyncOpenScope + SyncCloseScope + SyncCloseAnotherScope + SyncDeclNames + SyncDeclName + + SyncStmts + SyncBlockStmt + SyncIfStmt + SyncForStmt + SyncSwitchStmt + SyncRangeStmt + SyncCaseClause + SyncCommClause + SyncSelectStmt + SyncDecls + SyncLabeledStmt + SyncUseObjLocal + SyncAddLocal + SyncLinkname + SyncStmt1 + SyncStmtsEnd + SyncLabel + SyncOptLabel +) diff --git a/vendor/golang.org/x/tools/internal/pkgbits/syncmarker_string.go b/vendor/golang.org/x/tools/internal/pkgbits/syncmarker_string.go new file mode 100644 index 000000000..4a5b0ca5f --- /dev/null +++ b/vendor/golang.org/x/tools/internal/pkgbits/syncmarker_string.go @@ -0,0 +1,89 @@ +// Code generated by "stringer -type=SyncMarker -trimprefix=Sync"; DO NOT EDIT. + +package pkgbits + +import "strconv" + +func _() { + // An "invalid array index" compiler error signifies that the constant values have changed. + // Re-run the stringer command to generate them again. + var x [1]struct{} + _ = x[SyncEOF-1] + _ = x[SyncBool-2] + _ = x[SyncInt64-3] + _ = x[SyncUint64-4] + _ = x[SyncString-5] + _ = x[SyncValue-6] + _ = x[SyncVal-7] + _ = x[SyncRelocs-8] + _ = x[SyncReloc-9] + _ = x[SyncUseReloc-10] + _ = x[SyncPublic-11] + _ = x[SyncPos-12] + _ = x[SyncPosBase-13] + _ = x[SyncObject-14] + _ = x[SyncObject1-15] + _ = x[SyncPkg-16] + _ = x[SyncPkgDef-17] + _ = x[SyncMethod-18] + _ = x[SyncType-19] + _ = x[SyncTypeIdx-20] + _ = x[SyncTypeParamNames-21] + _ = x[SyncSignature-22] + _ = x[SyncParams-23] + _ = x[SyncParam-24] + _ = x[SyncCodeObj-25] + _ = x[SyncSym-26] + _ = x[SyncLocalIdent-27] + _ = x[SyncSelector-28] + _ = x[SyncPrivate-29] + _ = x[SyncFuncExt-30] + _ = x[SyncVarExt-31] + _ = x[SyncTypeExt-32] + _ = x[SyncPragma-33] + _ = x[SyncExprList-34] + _ = x[SyncExprs-35] + _ = x[SyncExpr-36] + _ = x[SyncExprType-37] + _ = x[SyncAssign-38] + _ = x[SyncOp-39] + _ = x[SyncFuncLit-40] + _ = x[SyncCompLit-41] + _ = x[SyncDecl-42] + _ = x[SyncFuncBody-43] + _ = x[SyncOpenScope-44] + _ = x[SyncCloseScope-45] + _ = x[SyncCloseAnotherScope-46] + _ = x[SyncDeclNames-47] + _ = x[SyncDeclName-48] + _ = x[SyncStmts-49] + _ = x[SyncBlockStmt-50] + _ = x[SyncIfStmt-51] + _ = x[SyncForStmt-52] + _ = x[SyncSwitchStmt-53] + _ = x[SyncRangeStmt-54] + _ = x[SyncCaseClause-55] + _ = x[SyncCommClause-56] + _ = x[SyncSelectStmt-57] + _ = x[SyncDecls-58] + _ = x[SyncLabeledStmt-59] + _ = x[SyncUseObjLocal-60] + _ = x[SyncAddLocal-61] + _ = x[SyncLinkname-62] + _ = x[SyncStmt1-63] + _ = x[SyncStmtsEnd-64] + _ = x[SyncLabel-65] + _ = x[SyncOptLabel-66] +} + +const _SyncMarker_name = "EOFBoolInt64Uint64StringValueValRelocsRelocUseRelocPublicPosPosBaseObjectObject1PkgPkgDefMethodTypeTypeIdxTypeParamNamesSignatureParamsParamCodeObjSymLocalIdentSelectorPrivateFuncExtVarExtTypeExtPragmaExprListExprsExprExprTypeAssignOpFuncLitCompLitDeclFuncBodyOpenScopeCloseScopeCloseAnotherScopeDeclNamesDeclNameStmtsBlockStmtIfStmtForStmtSwitchStmtRangeStmtCaseClauseCommClauseSelectStmtDeclsLabeledStmtUseObjLocalAddLocalLinknameStmt1StmtsEndLabelOptLabel" + +var _SyncMarker_index = [...]uint16{0, 3, 7, 12, 18, 24, 29, 32, 38, 43, 51, 57, 60, 67, 73, 80, 83, 89, 95, 99, 106, 120, 129, 135, 140, 147, 150, 160, 168, 175, 182, 188, 195, 201, 209, 214, 218, 226, 232, 234, 241, 248, 252, 260, 269, 279, 296, 305, 313, 318, 327, 333, 340, 350, 359, 369, 379, 389, 394, 405, 416, 424, 432, 437, 445, 450, 458} + +func (i SyncMarker) String() string { + i -= 1 + if i < 0 || i >= SyncMarker(len(_SyncMarker_index)-1) { + return "SyncMarker(" + strconv.FormatInt(int64(i+1), 10) + ")" + } + return _SyncMarker_name[_SyncMarker_index[i]:_SyncMarker_index[i+1]] +} diff --git a/vendor/golang.org/x/tools/internal/tokeninternal/tokeninternal.go b/vendor/golang.org/x/tools/internal/tokeninternal/tokeninternal.go new file mode 100644 index 000000000..7e638ec24 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/tokeninternal/tokeninternal.go @@ -0,0 +1,151 @@ +// Copyright 2023 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// package tokeninternal provides access to some internal features of the token +// package. +package tokeninternal + +import ( + "fmt" + "go/token" + "sort" + "sync" + "unsafe" +) + +// GetLines returns the table of line-start offsets from a token.File. +func GetLines(file *token.File) []int { + // token.File has a Lines method on Go 1.21 and later. + if file, ok := (interface{})(file).(interface{ Lines() []int }); ok { + return file.Lines() + } + + // This declaration must match that of token.File. + // This creates a risk of dependency skew. + // For now we check that the size of the two + // declarations is the same, on the (fragile) assumption + // that future changes would add fields. + type tokenFile119 struct { + _ string + _ int + _ int + mu sync.Mutex // we're not complete monsters + lines []int + _ []struct{} + } + type tokenFile118 struct { + _ *token.FileSet // deleted in go1.19 + tokenFile119 + } + + type uP = unsafe.Pointer + switch unsafe.Sizeof(*file) { + case unsafe.Sizeof(tokenFile118{}): + var ptr *tokenFile118 + *(*uP)(uP(&ptr)) = uP(file) + ptr.mu.Lock() + defer ptr.mu.Unlock() + return ptr.lines + + case unsafe.Sizeof(tokenFile119{}): + var ptr *tokenFile119 + *(*uP)(uP(&ptr)) = uP(file) + ptr.mu.Lock() + defer ptr.mu.Unlock() + return ptr.lines + + default: + panic("unexpected token.File size") + } +} + +// AddExistingFiles adds the specified files to the FileSet if they +// are not already present. It panics if any pair of files in the +// resulting FileSet would overlap. +func AddExistingFiles(fset *token.FileSet, files []*token.File) { + // Punch through the FileSet encapsulation. + type tokenFileSet struct { + // This type remained essentially consistent from go1.16 to go1.21. + mutex sync.RWMutex + base int + files []*token.File + _ *token.File // changed to atomic.Pointer[token.File] in go1.19 + } + + // If the size of token.FileSet changes, this will fail to compile. + const delta = int64(unsafe.Sizeof(tokenFileSet{})) - int64(unsafe.Sizeof(token.FileSet{})) + var _ [-delta * delta]int + + type uP = unsafe.Pointer + var ptr *tokenFileSet + *(*uP)(uP(&ptr)) = uP(fset) + ptr.mutex.Lock() + defer ptr.mutex.Unlock() + + // Merge and sort. + newFiles := append(ptr.files, files...) + sort.Slice(newFiles, func(i, j int) bool { + return newFiles[i].Base() < newFiles[j].Base() + }) + + // Reject overlapping files. + // Discard adjacent identical files. + out := newFiles[:0] + for i, file := range newFiles { + if i > 0 { + prev := newFiles[i-1] + if file == prev { + continue + } + if prev.Base()+prev.Size()+1 > file.Base() { + panic(fmt.Sprintf("file %s (%d-%d) overlaps with file %s (%d-%d)", + prev.Name(), prev.Base(), prev.Base()+prev.Size(), + file.Name(), file.Base(), file.Base()+file.Size())) + } + } + out = append(out, file) + } + newFiles = out + + ptr.files = newFiles + + // Advance FileSet.Base(). + if len(newFiles) > 0 { + last := newFiles[len(newFiles)-1] + newBase := last.Base() + last.Size() + 1 + if ptr.base < newBase { + ptr.base = newBase + } + } +} + +// FileSetFor returns a new FileSet containing a sequence of new Files with +// the same base, size, and line as the input files, for use in APIs that +// require a FileSet. +// +// Precondition: the input files must be non-overlapping, and sorted in order +// of their Base. +func FileSetFor(files ...*token.File) *token.FileSet { + fset := token.NewFileSet() + for _, f := range files { + f2 := fset.AddFile(f.Name(), f.Base(), f.Size()) + lines := GetLines(f) + f2.SetLines(lines) + } + return fset +} + +// CloneFileSet creates a new FileSet holding all files in fset. It does not +// create copies of the token.Files in fset: they are added to the resulting +// FileSet unmodified. +func CloneFileSet(fset *token.FileSet) *token.FileSet { + var files []*token.File + fset.Iterate(func(f *token.File) bool { + files = append(files, f) + return true + }) + newFileSet := token.NewFileSet() + AddExistingFiles(newFileSet, files) + return newFileSet +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/common.go b/vendor/golang.org/x/tools/internal/typeparams/common.go new file mode 100644 index 000000000..d0d0649fe --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/common.go @@ -0,0 +1,204 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package typeparams contains common utilities for writing tools that interact +// with generic Go code, as introduced with Go 1.18. +// +// Many of the types and functions in this package are proxies for the new APIs +// introduced in the standard library with Go 1.18. For example, the +// typeparams.Union type is an alias for go/types.Union, and the ForTypeSpec +// function returns the value of the go/ast.TypeSpec.TypeParams field. At Go +// versions older than 1.18 these helpers are implemented as stubs, allowing +// users of this package to write code that handles generic constructs inline, +// even if the Go version being used to compile does not support generics. +// +// Additionally, this package contains common utilities for working with the +// new generic constructs, to supplement the standard library APIs. Notably, +// the StructuralTerms API computes a minimal representation of the structural +// restrictions on a type parameter. +// +// An external version of these APIs is available in the +// golang.org/x/exp/typeparams module. +package typeparams + +import ( + "fmt" + "go/ast" + "go/token" + "go/types" +) + +// UnpackIndexExpr extracts data from AST nodes that represent index +// expressions. +// +// For an ast.IndexExpr, the resulting indices slice will contain exactly one +// index expression. For an ast.IndexListExpr (go1.18+), it may have a variable +// number of index expressions. +// +// For nodes that don't represent index expressions, the first return value of +// UnpackIndexExpr will be nil. +func UnpackIndexExpr(n ast.Node) (x ast.Expr, lbrack token.Pos, indices []ast.Expr, rbrack token.Pos) { + switch e := n.(type) { + case *ast.IndexExpr: + return e.X, e.Lbrack, []ast.Expr{e.Index}, e.Rbrack + case *IndexListExpr: + return e.X, e.Lbrack, e.Indices, e.Rbrack + } + return nil, token.NoPos, nil, token.NoPos +} + +// PackIndexExpr returns an *ast.IndexExpr or *ast.IndexListExpr, depending on +// the cardinality of indices. Calling PackIndexExpr with len(indices) == 0 +// will panic. +func PackIndexExpr(x ast.Expr, lbrack token.Pos, indices []ast.Expr, rbrack token.Pos) ast.Expr { + switch len(indices) { + case 0: + panic("empty indices") + case 1: + return &ast.IndexExpr{ + X: x, + Lbrack: lbrack, + Index: indices[0], + Rbrack: rbrack, + } + default: + return &IndexListExpr{ + X: x, + Lbrack: lbrack, + Indices: indices, + Rbrack: rbrack, + } + } +} + +// IsTypeParam reports whether t is a type parameter. +func IsTypeParam(t types.Type) bool { + _, ok := t.(*TypeParam) + return ok +} + +// OriginMethod returns the origin method associated with the method fn. +// For methods on a non-generic receiver base type, this is just +// fn. However, for methods with a generic receiver, OriginMethod returns the +// corresponding method in the method set of the origin type. +// +// As a special case, if fn is not a method (has no receiver), OriginMethod +// returns fn. +func OriginMethod(fn *types.Func) *types.Func { + recv := fn.Type().(*types.Signature).Recv() + if recv == nil { + return fn + } + base := recv.Type() + p, isPtr := base.(*types.Pointer) + if isPtr { + base = p.Elem() + } + named, isNamed := base.(*types.Named) + if !isNamed { + // Receiver is a *types.Interface. + return fn + } + if ForNamed(named).Len() == 0 { + // Receiver base has no type parameters, so we can avoid the lookup below. + return fn + } + orig := NamedTypeOrigin(named) + gfn, _, _ := types.LookupFieldOrMethod(orig, true, fn.Pkg(), fn.Name()) + + // This is a fix for a gopls crash (#60628) due to a go/types bug (#60634). In: + // package p + // type T *int + // func (*T) f() {} + // LookupFieldOrMethod(T, true, p, f)=nil, but NewMethodSet(*T)={(*T).f}. + // Here we make them consistent by force. + // (The go/types bug is general, but this workaround is reached only + // for generic T thanks to the early return above.) + if gfn == nil { + mset := types.NewMethodSet(types.NewPointer(orig)) + for i := 0; i < mset.Len(); i++ { + m := mset.At(i) + if m.Obj().Id() == fn.Id() { + gfn = m.Obj() + break + } + } + } + + // In golang/go#61196, we observe another crash, this time inexplicable. + if gfn == nil { + panic(fmt.Sprintf("missing origin method for %s.%s; named == origin: %t, named.NumMethods(): %d, origin.NumMethods(): %d", named, fn, named == orig, named.NumMethods(), orig.NumMethods())) + } + + return gfn.(*types.Func) +} + +// GenericAssignableTo is a generalization of types.AssignableTo that +// implements the following rule for uninstantiated generic types: +// +// If V and T are generic named types, then V is considered assignable to T if, +// for every possible instantation of V[A_1, ..., A_N], the instantiation +// T[A_1, ..., A_N] is valid and V[A_1, ..., A_N] implements T[A_1, ..., A_N]. +// +// If T has structural constraints, they must be satisfied by V. +// +// For example, consider the following type declarations: +// +// type Interface[T any] interface { +// Accept(T) +// } +// +// type Container[T any] struct { +// Element T +// } +// +// func (c Container[T]) Accept(t T) { c.Element = t } +// +// In this case, GenericAssignableTo reports that instantiations of Container +// are assignable to the corresponding instantiation of Interface. +func GenericAssignableTo(ctxt *Context, V, T types.Type) bool { + // If V and T are not both named, or do not have matching non-empty type + // parameter lists, fall back on types.AssignableTo. + + VN, Vnamed := V.(*types.Named) + TN, Tnamed := T.(*types.Named) + if !Vnamed || !Tnamed { + return types.AssignableTo(V, T) + } + + vtparams := ForNamed(VN) + ttparams := ForNamed(TN) + if vtparams.Len() == 0 || vtparams.Len() != ttparams.Len() || NamedTypeArgs(VN).Len() != 0 || NamedTypeArgs(TN).Len() != 0 { + return types.AssignableTo(V, T) + } + + // V and T have the same (non-zero) number of type params. Instantiate both + // with the type parameters of V. This must always succeed for V, and will + // succeed for T if and only if the type set of each type parameter of V is a + // subset of the type set of the corresponding type parameter of T, meaning + // that every instantiation of V corresponds to a valid instantiation of T. + + // Minor optimization: ensure we share a context across the two + // instantiations below. + if ctxt == nil { + ctxt = NewContext() + } + + var targs []types.Type + for i := 0; i < vtparams.Len(); i++ { + targs = append(targs, vtparams.At(i)) + } + + vinst, err := Instantiate(ctxt, V, targs, true) + if err != nil { + panic("type parameters should satisfy their own constraints") + } + + tinst, err := Instantiate(ctxt, T, targs, true) + if err != nil { + return false + } + + return types.AssignableTo(vinst, tinst) +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/coretype.go b/vendor/golang.org/x/tools/internal/typeparams/coretype.go new file mode 100644 index 000000000..993135ec9 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/coretype.go @@ -0,0 +1,122 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package typeparams + +import ( + "go/types" +) + +// CoreType returns the core type of T or nil if T does not have a core type. +// +// See https://go.dev/ref/spec#Core_types for the definition of a core type. +func CoreType(T types.Type) types.Type { + U := T.Underlying() + if _, ok := U.(*types.Interface); !ok { + return U // for non-interface types, + } + + terms, err := _NormalTerms(U) + if len(terms) == 0 || err != nil { + // len(terms) -> empty type set of interface. + // err != nil => U is invalid, exceeds complexity bounds, or has an empty type set. + return nil // no core type. + } + + U = terms[0].Type().Underlying() + var identical int // i in [0,identical) => Identical(U, terms[i].Type().Underlying()) + for identical = 1; identical < len(terms); identical++ { + if !types.Identical(U, terms[identical].Type().Underlying()) { + break + } + } + + if identical == len(terms) { + // https://go.dev/ref/spec#Core_types + // "There is a single type U which is the underlying type of all types in the type set of T" + return U + } + ch, ok := U.(*types.Chan) + if !ok { + return nil // no core type as identical < len(terms) and U is not a channel. + } + // https://go.dev/ref/spec#Core_types + // "the type chan E if T contains only bidirectional channels, or the type chan<- E or + // <-chan E depending on the direction of the directional channels present." + for chans := identical; chans < len(terms); chans++ { + curr, ok := terms[chans].Type().Underlying().(*types.Chan) + if !ok { + return nil + } + if !types.Identical(ch.Elem(), curr.Elem()) { + return nil // channel elements are not identical. + } + if ch.Dir() == types.SendRecv { + // ch is bidirectional. We can safely always use curr's direction. + ch = curr + } else if curr.Dir() != types.SendRecv && ch.Dir() != curr.Dir() { + // ch and curr are not bidirectional and not the same direction. + return nil + } + } + return ch +} + +// _NormalTerms returns a slice of terms representing the normalized structural +// type restrictions of a type, if any. +// +// For all types other than *types.TypeParam, *types.Interface, and +// *types.Union, this is just a single term with Tilde() == false and +// Type() == typ. For *types.TypeParam, *types.Interface, and *types.Union, see +// below. +// +// Structural type restrictions of a type parameter are created via +// non-interface types embedded in its constraint interface (directly, or via a +// chain of interface embeddings). For example, in the declaration type +// T[P interface{~int; m()}] int the structural restriction of the type +// parameter P is ~int. +// +// With interface embedding and unions, the specification of structural type +// restrictions may be arbitrarily complex. For example, consider the +// following: +// +// type A interface{ ~string|~[]byte } +// +// type B interface{ int|string } +// +// type C interface { ~string|~int } +// +// type T[P interface{ A|B; C }] int +// +// In this example, the structural type restriction of P is ~string|int: A|B +// expands to ~string|~[]byte|int|string, which reduces to ~string|~[]byte|int, +// which when intersected with C (~string|~int) yields ~string|int. +// +// _NormalTerms computes these expansions and reductions, producing a +// "normalized" form of the embeddings. A structural restriction is normalized +// if it is a single union containing no interface terms, and is minimal in the +// sense that removing any term changes the set of types satisfying the +// constraint. It is left as a proof for the reader that, modulo sorting, there +// is exactly one such normalized form. +// +// Because the minimal representation always takes this form, _NormalTerms +// returns a slice of tilde terms corresponding to the terms of the union in +// the normalized structural restriction. An error is returned if the type is +// invalid, exceeds complexity bounds, or has an empty type set. In the latter +// case, _NormalTerms returns ErrEmptyTypeSet. +// +// _NormalTerms makes no guarantees about the order of terms, except that it +// is deterministic. +func _NormalTerms(typ types.Type) ([]*Term, error) { + switch typ := typ.(type) { + case *TypeParam: + return StructuralTerms(typ) + case *Union: + return UnionTermSet(typ) + case *types.Interface: + return InterfaceTermSet(typ) + default: + return []*Term{NewTerm(false, typ)}, nil + } +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/enabled_go117.go b/vendor/golang.org/x/tools/internal/typeparams/enabled_go117.go new file mode 100644 index 000000000..18212390e --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/enabled_go117.go @@ -0,0 +1,12 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.18 +// +build !go1.18 + +package typeparams + +// Enabled reports whether type parameters are enabled in the current build +// environment. +const Enabled = false diff --git a/vendor/golang.org/x/tools/internal/typeparams/enabled_go118.go b/vendor/golang.org/x/tools/internal/typeparams/enabled_go118.go new file mode 100644 index 000000000..d67148823 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/enabled_go118.go @@ -0,0 +1,15 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 +// +build go1.18 + +package typeparams + +// Note: this constant is in a separate file as this is the only acceptable +// diff between the <1.18 API of this package and the 1.18 API. + +// Enabled reports whether type parameters are enabled in the current build +// environment. +const Enabled = true diff --git a/vendor/golang.org/x/tools/internal/typeparams/normalize.go b/vendor/golang.org/x/tools/internal/typeparams/normalize.go new file mode 100644 index 000000000..9c631b651 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/normalize.go @@ -0,0 +1,218 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package typeparams + +import ( + "errors" + "fmt" + "go/types" + "os" + "strings" +) + +//go:generate go run copytermlist.go + +const debug = false + +var ErrEmptyTypeSet = errors.New("empty type set") + +// StructuralTerms returns a slice of terms representing the normalized +// structural type restrictions of a type parameter, if any. +// +// Structural type restrictions of a type parameter are created via +// non-interface types embedded in its constraint interface (directly, or via a +// chain of interface embeddings). For example, in the declaration +// +// type T[P interface{~int; m()}] int +// +// the structural restriction of the type parameter P is ~int. +// +// With interface embedding and unions, the specification of structural type +// restrictions may be arbitrarily complex. For example, consider the +// following: +// +// type A interface{ ~string|~[]byte } +// +// type B interface{ int|string } +// +// type C interface { ~string|~int } +// +// type T[P interface{ A|B; C }] int +// +// In this example, the structural type restriction of P is ~string|int: A|B +// expands to ~string|~[]byte|int|string, which reduces to ~string|~[]byte|int, +// which when intersected with C (~string|~int) yields ~string|int. +// +// StructuralTerms computes these expansions and reductions, producing a +// "normalized" form of the embeddings. A structural restriction is normalized +// if it is a single union containing no interface terms, and is minimal in the +// sense that removing any term changes the set of types satisfying the +// constraint. It is left as a proof for the reader that, modulo sorting, there +// is exactly one such normalized form. +// +// Because the minimal representation always takes this form, StructuralTerms +// returns a slice of tilde terms corresponding to the terms of the union in +// the normalized structural restriction. An error is returned if the +// constraint interface is invalid, exceeds complexity bounds, or has an empty +// type set. In the latter case, StructuralTerms returns ErrEmptyTypeSet. +// +// StructuralTerms makes no guarantees about the order of terms, except that it +// is deterministic. +func StructuralTerms(tparam *TypeParam) ([]*Term, error) { + constraint := tparam.Constraint() + if constraint == nil { + return nil, fmt.Errorf("%s has nil constraint", tparam) + } + iface, _ := constraint.Underlying().(*types.Interface) + if iface == nil { + return nil, fmt.Errorf("constraint is %T, not *types.Interface", constraint.Underlying()) + } + return InterfaceTermSet(iface) +} + +// InterfaceTermSet computes the normalized terms for a constraint interface, +// returning an error if the term set cannot be computed or is empty. In the +// latter case, the error will be ErrEmptyTypeSet. +// +// See the documentation of StructuralTerms for more information on +// normalization. +func InterfaceTermSet(iface *types.Interface) ([]*Term, error) { + return computeTermSet(iface) +} + +// UnionTermSet computes the normalized terms for a union, returning an error +// if the term set cannot be computed or is empty. In the latter case, the +// error will be ErrEmptyTypeSet. +// +// See the documentation of StructuralTerms for more information on +// normalization. +func UnionTermSet(union *Union) ([]*Term, error) { + return computeTermSet(union) +} + +func computeTermSet(typ types.Type) ([]*Term, error) { + tset, err := computeTermSetInternal(typ, make(map[types.Type]*termSet), 0) + if err != nil { + return nil, err + } + if tset.terms.isEmpty() { + return nil, ErrEmptyTypeSet + } + if tset.terms.isAll() { + return nil, nil + } + var terms []*Term + for _, term := range tset.terms { + terms = append(terms, NewTerm(term.tilde, term.typ)) + } + return terms, nil +} + +// A termSet holds the normalized set of terms for a given type. +// +// The name termSet is intentionally distinct from 'type set': a type set is +// all types that implement a type (and includes method restrictions), whereas +// a term set just represents the structural restrictions on a type. +type termSet struct { + complete bool + terms termlist +} + +func indentf(depth int, format string, args ...interface{}) { + fmt.Fprintf(os.Stderr, strings.Repeat(".", depth)+format+"\n", args...) +} + +func computeTermSetInternal(t types.Type, seen map[types.Type]*termSet, depth int) (res *termSet, err error) { + if t == nil { + panic("nil type") + } + + if debug { + indentf(depth, "%s", t.String()) + defer func() { + if err != nil { + indentf(depth, "=> %s", err) + } else { + indentf(depth, "=> %s", res.terms.String()) + } + }() + } + + const maxTermCount = 100 + if tset, ok := seen[t]; ok { + if !tset.complete { + return nil, fmt.Errorf("cycle detected in the declaration of %s", t) + } + return tset, nil + } + + // Mark the current type as seen to avoid infinite recursion. + tset := new(termSet) + defer func() { + tset.complete = true + }() + seen[t] = tset + + switch u := t.Underlying().(type) { + case *types.Interface: + // The term set of an interface is the intersection of the term sets of its + // embedded types. + tset.terms = allTermlist + for i := 0; i < u.NumEmbeddeds(); i++ { + embedded := u.EmbeddedType(i) + if _, ok := embedded.Underlying().(*TypeParam); ok { + return nil, fmt.Errorf("invalid embedded type %T", embedded) + } + tset2, err := computeTermSetInternal(embedded, seen, depth+1) + if err != nil { + return nil, err + } + tset.terms = tset.terms.intersect(tset2.terms) + } + case *Union: + // The term set of a union is the union of term sets of its terms. + tset.terms = nil + for i := 0; i < u.Len(); i++ { + t := u.Term(i) + var terms termlist + switch t.Type().Underlying().(type) { + case *types.Interface: + tset2, err := computeTermSetInternal(t.Type(), seen, depth+1) + if err != nil { + return nil, err + } + terms = tset2.terms + case *TypeParam, *Union: + // A stand-alone type parameter or union is not permitted as union + // term. + return nil, fmt.Errorf("invalid union term %T", t) + default: + if t.Type() == types.Typ[types.Invalid] { + continue + } + terms = termlist{{t.Tilde(), t.Type()}} + } + tset.terms = tset.terms.union(terms) + if len(tset.terms) > maxTermCount { + return nil, fmt.Errorf("exceeded max term count %d", maxTermCount) + } + } + case *TypeParam: + panic("unreachable") + default: + // For all other types, the term set is just a single non-tilde term + // holding the type itself. + if u != types.Typ[types.Invalid] { + tset.terms = termlist{{false, t}} + } + } + return tset, nil +} + +// under is a facade for the go/types internal function of the same name. It is +// used by typeterm.go. +func under(t types.Type) types.Type { + return t.Underlying() +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/termlist.go b/vendor/golang.org/x/tools/internal/typeparams/termlist.go new file mode 100644 index 000000000..933106a23 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/termlist.go @@ -0,0 +1,163 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Code generated by copytermlist.go DO NOT EDIT. + +package typeparams + +import ( + "bytes" + "go/types" +) + +// A termlist represents the type set represented by the union +// t1 ∪ y2 ∪ ... tn of the type sets of the terms t1 to tn. +// A termlist is in normal form if all terms are disjoint. +// termlist operations don't require the operands to be in +// normal form. +type termlist []*term + +// allTermlist represents the set of all types. +// It is in normal form. +var allTermlist = termlist{new(term)} + +// String prints the termlist exactly (without normalization). +func (xl termlist) String() string { + if len(xl) == 0 { + return "∅" + } + var buf bytes.Buffer + for i, x := range xl { + if i > 0 { + buf.WriteString(" ∪ ") + } + buf.WriteString(x.String()) + } + return buf.String() +} + +// isEmpty reports whether the termlist xl represents the empty set of types. +func (xl termlist) isEmpty() bool { + // If there's a non-nil term, the entire list is not empty. + // If the termlist is in normal form, this requires at most + // one iteration. + for _, x := range xl { + if x != nil { + return false + } + } + return true +} + +// isAll reports whether the termlist xl represents the set of all types. +func (xl termlist) isAll() bool { + // If there's a 𝓤 term, the entire list is 𝓤. + // If the termlist is in normal form, this requires at most + // one iteration. + for _, x := range xl { + if x != nil && x.typ == nil { + return true + } + } + return false +} + +// norm returns the normal form of xl. +func (xl termlist) norm() termlist { + // Quadratic algorithm, but good enough for now. + // TODO(gri) fix asymptotic performance + used := make([]bool, len(xl)) + var rl termlist + for i, xi := range xl { + if xi == nil || used[i] { + continue + } + for j := i + 1; j < len(xl); j++ { + xj := xl[j] + if xj == nil || used[j] { + continue + } + if u1, u2 := xi.union(xj); u2 == nil { + // If we encounter a 𝓤 term, the entire list is 𝓤. + // Exit early. + // (Note that this is not just an optimization; + // if we continue, we may end up with a 𝓤 term + // and other terms and the result would not be + // in normal form.) + if u1.typ == nil { + return allTermlist + } + xi = u1 + used[j] = true // xj is now unioned into xi - ignore it in future iterations + } + } + rl = append(rl, xi) + } + return rl +} + +// union returns the union xl ∪ yl. +func (xl termlist) union(yl termlist) termlist { + return append(xl, yl...).norm() +} + +// intersect returns the intersection xl ∩ yl. +func (xl termlist) intersect(yl termlist) termlist { + if xl.isEmpty() || yl.isEmpty() { + return nil + } + + // Quadratic algorithm, but good enough for now. + // TODO(gri) fix asymptotic performance + var rl termlist + for _, x := range xl { + for _, y := range yl { + if r := x.intersect(y); r != nil { + rl = append(rl, r) + } + } + } + return rl.norm() +} + +// equal reports whether xl and yl represent the same type set. +func (xl termlist) equal(yl termlist) bool { + // TODO(gri) this should be more efficient + return xl.subsetOf(yl) && yl.subsetOf(xl) +} + +// includes reports whether t ∈ xl. +func (xl termlist) includes(t types.Type) bool { + for _, x := range xl { + if x.includes(t) { + return true + } + } + return false +} + +// supersetOf reports whether y ⊆ xl. +func (xl termlist) supersetOf(y *term) bool { + for _, x := range xl { + if y.subsetOf(x) { + return true + } + } + return false +} + +// subsetOf reports whether xl ⊆ yl. +func (xl termlist) subsetOf(yl termlist) bool { + if yl.isEmpty() { + return xl.isEmpty() + } + + // each term x of xl must be a subset of yl + for _, x := range xl { + if !yl.supersetOf(x) { + return false // x is not a subset yl + } + } + return true +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/typeparams_go117.go b/vendor/golang.org/x/tools/internal/typeparams/typeparams_go117.go new file mode 100644 index 000000000..7ed86e171 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/typeparams_go117.go @@ -0,0 +1,197 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.18 +// +build !go1.18 + +package typeparams + +import ( + "go/ast" + "go/token" + "go/types" +) + +func unsupported() { + panic("type parameters are unsupported at this go version") +} + +// IndexListExpr is a placeholder type, as type parameters are not supported at +// this Go version. Its methods panic on use. +type IndexListExpr struct { + ast.Expr + X ast.Expr // expression + Lbrack token.Pos // position of "[" + Indices []ast.Expr // index expressions + Rbrack token.Pos // position of "]" +} + +// ForTypeSpec returns an empty field list, as type parameters on not supported +// at this Go version. +func ForTypeSpec(*ast.TypeSpec) *ast.FieldList { + return nil +} + +// ForFuncType returns an empty field list, as type parameters are not +// supported at this Go version. +func ForFuncType(*ast.FuncType) *ast.FieldList { + return nil +} + +// TypeParam is a placeholder type, as type parameters are not supported at +// this Go version. Its methods panic on use. +type TypeParam struct{ types.Type } + +func (*TypeParam) Index() int { unsupported(); return 0 } +func (*TypeParam) Constraint() types.Type { unsupported(); return nil } +func (*TypeParam) Obj() *types.TypeName { unsupported(); return nil } + +// TypeParamList is a placeholder for an empty type parameter list. +type TypeParamList struct{} + +func (*TypeParamList) Len() int { return 0 } +func (*TypeParamList) At(int) *TypeParam { unsupported(); return nil } + +// TypeList is a placeholder for an empty type list. +type TypeList struct{} + +func (*TypeList) Len() int { return 0 } +func (*TypeList) At(int) types.Type { unsupported(); return nil } + +// NewTypeParam is unsupported at this Go version, and panics. +func NewTypeParam(name *types.TypeName, constraint types.Type) *TypeParam { + unsupported() + return nil +} + +// SetTypeParamConstraint is unsupported at this Go version, and panics. +func SetTypeParamConstraint(tparam *TypeParam, constraint types.Type) { + unsupported() +} + +// NewSignatureType calls types.NewSignature, panicking if recvTypeParams or +// typeParams is non-empty. +func NewSignatureType(recv *types.Var, recvTypeParams, typeParams []*TypeParam, params, results *types.Tuple, variadic bool) *types.Signature { + if len(recvTypeParams) != 0 || len(typeParams) != 0 { + panic("signatures cannot have type parameters at this Go version") + } + return types.NewSignature(recv, params, results, variadic) +} + +// ForSignature returns an empty slice. +func ForSignature(*types.Signature) *TypeParamList { + return nil +} + +// RecvTypeParams returns a nil slice. +func RecvTypeParams(sig *types.Signature) *TypeParamList { + return nil +} + +// IsComparable returns false, as no interfaces are type-restricted at this Go +// version. +func IsComparable(*types.Interface) bool { + return false +} + +// IsMethodSet returns true, as no interfaces are type-restricted at this Go +// version. +func IsMethodSet(*types.Interface) bool { + return true +} + +// IsImplicit returns false, as no interfaces are implicit at this Go version. +func IsImplicit(*types.Interface) bool { + return false +} + +// MarkImplicit does nothing, because this Go version does not have implicit +// interfaces. +func MarkImplicit(*types.Interface) {} + +// ForNamed returns an empty type parameter list, as type parameters are not +// supported at this Go version. +func ForNamed(*types.Named) *TypeParamList { + return nil +} + +// SetForNamed panics if tparams is non-empty. +func SetForNamed(_ *types.Named, tparams []*TypeParam) { + if len(tparams) > 0 { + unsupported() + } +} + +// NamedTypeArgs returns nil. +func NamedTypeArgs(*types.Named) *TypeList { + return nil +} + +// NamedTypeOrigin is the identity method at this Go version. +func NamedTypeOrigin(named *types.Named) *types.Named { + return named +} + +// Term holds information about a structural type restriction. +type Term struct { + tilde bool + typ types.Type +} + +func (m *Term) Tilde() bool { return m.tilde } +func (m *Term) Type() types.Type { return m.typ } +func (m *Term) String() string { + pre := "" + if m.tilde { + pre = "~" + } + return pre + m.typ.String() +} + +// NewTerm is unsupported at this Go version, and panics. +func NewTerm(tilde bool, typ types.Type) *Term { + return &Term{tilde, typ} +} + +// Union is a placeholder type, as type parameters are not supported at this Go +// version. Its methods panic on use. +type Union struct{ types.Type } + +func (*Union) Len() int { return 0 } +func (*Union) Term(i int) *Term { unsupported(); return nil } + +// NewUnion is unsupported at this Go version, and panics. +func NewUnion(terms []*Term) *Union { + unsupported() + return nil +} + +// InitInstanceInfo is a noop at this Go version. +func InitInstanceInfo(*types.Info) {} + +// Instance is a placeholder type, as type parameters are not supported at this +// Go version. +type Instance struct { + TypeArgs *TypeList + Type types.Type +} + +// GetInstances returns a nil map, as type parameters are not supported at this +// Go version. +func GetInstances(info *types.Info) map[*ast.Ident]Instance { return nil } + +// Context is a placeholder type, as type parameters are not supported at +// this Go version. +type Context struct{} + +// NewContext returns a placeholder Context instance. +func NewContext() *Context { + return &Context{} +} + +// Instantiate is unsupported on this Go version, and panics. +func Instantiate(ctxt *Context, typ types.Type, targs []types.Type, validate bool) (types.Type, error) { + unsupported() + return nil, nil +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/typeparams_go118.go b/vendor/golang.org/x/tools/internal/typeparams/typeparams_go118.go new file mode 100644 index 000000000..cf301af1d --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/typeparams_go118.go @@ -0,0 +1,151 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 +// +build go1.18 + +package typeparams + +import ( + "go/ast" + "go/types" +) + +// IndexListExpr is an alias for ast.IndexListExpr. +type IndexListExpr = ast.IndexListExpr + +// ForTypeSpec returns n.TypeParams. +func ForTypeSpec(n *ast.TypeSpec) *ast.FieldList { + if n == nil { + return nil + } + return n.TypeParams +} + +// ForFuncType returns n.TypeParams. +func ForFuncType(n *ast.FuncType) *ast.FieldList { + if n == nil { + return nil + } + return n.TypeParams +} + +// TypeParam is an alias for types.TypeParam +type TypeParam = types.TypeParam + +// TypeParamList is an alias for types.TypeParamList +type TypeParamList = types.TypeParamList + +// TypeList is an alias for types.TypeList +type TypeList = types.TypeList + +// NewTypeParam calls types.NewTypeParam. +func NewTypeParam(name *types.TypeName, constraint types.Type) *TypeParam { + return types.NewTypeParam(name, constraint) +} + +// SetTypeParamConstraint calls tparam.SetConstraint(constraint). +func SetTypeParamConstraint(tparam *TypeParam, constraint types.Type) { + tparam.SetConstraint(constraint) +} + +// NewSignatureType calls types.NewSignatureType. +func NewSignatureType(recv *types.Var, recvTypeParams, typeParams []*TypeParam, params, results *types.Tuple, variadic bool) *types.Signature { + return types.NewSignatureType(recv, recvTypeParams, typeParams, params, results, variadic) +} + +// ForSignature returns sig.TypeParams() +func ForSignature(sig *types.Signature) *TypeParamList { + return sig.TypeParams() +} + +// RecvTypeParams returns sig.RecvTypeParams(). +func RecvTypeParams(sig *types.Signature) *TypeParamList { + return sig.RecvTypeParams() +} + +// IsComparable calls iface.IsComparable(). +func IsComparable(iface *types.Interface) bool { + return iface.IsComparable() +} + +// IsMethodSet calls iface.IsMethodSet(). +func IsMethodSet(iface *types.Interface) bool { + return iface.IsMethodSet() +} + +// IsImplicit calls iface.IsImplicit(). +func IsImplicit(iface *types.Interface) bool { + return iface.IsImplicit() +} + +// MarkImplicit calls iface.MarkImplicit(). +func MarkImplicit(iface *types.Interface) { + iface.MarkImplicit() +} + +// ForNamed extracts the (possibly empty) type parameter object list from +// named. +func ForNamed(named *types.Named) *TypeParamList { + return named.TypeParams() +} + +// SetForNamed sets the type params tparams on n. Each tparam must be of +// dynamic type *types.TypeParam. +func SetForNamed(n *types.Named, tparams []*TypeParam) { + n.SetTypeParams(tparams) +} + +// NamedTypeArgs returns named.TypeArgs(). +func NamedTypeArgs(named *types.Named) *TypeList { + return named.TypeArgs() +} + +// NamedTypeOrigin returns named.Orig(). +func NamedTypeOrigin(named *types.Named) *types.Named { + return named.Origin() +} + +// Term is an alias for types.Term. +type Term = types.Term + +// NewTerm calls types.NewTerm. +func NewTerm(tilde bool, typ types.Type) *Term { + return types.NewTerm(tilde, typ) +} + +// Union is an alias for types.Union +type Union = types.Union + +// NewUnion calls types.NewUnion. +func NewUnion(terms []*Term) *Union { + return types.NewUnion(terms) +} + +// InitInstanceInfo initializes info to record information about type and +// function instances. +func InitInstanceInfo(info *types.Info) { + info.Instances = make(map[*ast.Ident]types.Instance) +} + +// Instance is an alias for types.Instance. +type Instance = types.Instance + +// GetInstances returns info.Instances. +func GetInstances(info *types.Info) map[*ast.Ident]Instance { + return info.Instances +} + +// Context is an alias for types.Context. +type Context = types.Context + +// NewContext calls types.NewContext. +func NewContext() *Context { + return types.NewContext() +} + +// Instantiate calls types.Instantiate. +func Instantiate(ctxt *Context, typ types.Type, targs []types.Type, validate bool) (types.Type, error) { + return types.Instantiate(ctxt, typ, targs, validate) +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/typeterm.go b/vendor/golang.org/x/tools/internal/typeparams/typeterm.go new file mode 100644 index 000000000..7ddee28d9 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/typeterm.go @@ -0,0 +1,170 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Code generated by copytermlist.go DO NOT EDIT. + +package typeparams + +import "go/types" + +// A term describes elementary type sets: +// +// ∅: (*term)(nil) == ∅ // set of no types (empty set) +// 𝓤: &term{} == 𝓤 // set of all types (𝓤niverse) +// T: &term{false, T} == {T} // set of type T +// ~t: &term{true, t} == {t' | under(t') == t} // set of types with underlying type t +// +type term struct { + tilde bool // valid if typ != nil + typ types.Type +} + +func (x *term) String() string { + switch { + case x == nil: + return "∅" + case x.typ == nil: + return "𝓤" + case x.tilde: + return "~" + x.typ.String() + default: + return x.typ.String() + } +} + +// equal reports whether x and y represent the same type set. +func (x *term) equal(y *term) bool { + // easy cases + switch { + case x == nil || y == nil: + return x == y + case x.typ == nil || y.typ == nil: + return x.typ == y.typ + } + // ∅ ⊂ x, y ⊂ 𝓤 + + return x.tilde == y.tilde && types.Identical(x.typ, y.typ) +} + +// union returns the union x ∪ y: zero, one, or two non-nil terms. +func (x *term) union(y *term) (_, _ *term) { + // easy cases + switch { + case x == nil && y == nil: + return nil, nil // ∅ ∪ ∅ == ∅ + case x == nil: + return y, nil // ∅ ∪ y == y + case y == nil: + return x, nil // x ∪ ∅ == x + case x.typ == nil: + return x, nil // 𝓤 ∪ y == 𝓤 + case y.typ == nil: + return y, nil // x ∪ 𝓤 == 𝓤 + } + // ∅ ⊂ x, y ⊂ 𝓤 + + if x.disjoint(y) { + return x, y // x ∪ y == (x, y) if x ∩ y == ∅ + } + // x.typ == y.typ + + // ~t ∪ ~t == ~t + // ~t ∪ T == ~t + // T ∪ ~t == ~t + // T ∪ T == T + if x.tilde || !y.tilde { + return x, nil + } + return y, nil +} + +// intersect returns the intersection x ∩ y. +func (x *term) intersect(y *term) *term { + // easy cases + switch { + case x == nil || y == nil: + return nil // ∅ ∩ y == ∅ and ∩ ∅ == ∅ + case x.typ == nil: + return y // 𝓤 ∩ y == y + case y.typ == nil: + return x // x ∩ 𝓤 == x + } + // ∅ ⊂ x, y ⊂ 𝓤 + + if x.disjoint(y) { + return nil // x ∩ y == ∅ if x ∩ y == ∅ + } + // x.typ == y.typ + + // ~t ∩ ~t == ~t + // ~t ∩ T == T + // T ∩ ~t == T + // T ∩ T == T + if !x.tilde || y.tilde { + return x + } + return y +} + +// includes reports whether t ∈ x. +func (x *term) includes(t types.Type) bool { + // easy cases + switch { + case x == nil: + return false // t ∈ ∅ == false + case x.typ == nil: + return true // t ∈ 𝓤 == true + } + // ∅ ⊂ x ⊂ 𝓤 + + u := t + if x.tilde { + u = under(u) + } + return types.Identical(x.typ, u) +} + +// subsetOf reports whether x ⊆ y. +func (x *term) subsetOf(y *term) bool { + // easy cases + switch { + case x == nil: + return true // ∅ ⊆ y == true + case y == nil: + return false // x ⊆ ∅ == false since x != ∅ + case y.typ == nil: + return true // x ⊆ 𝓤 == true + case x.typ == nil: + return false // 𝓤 ⊆ y == false since y != 𝓤 + } + // ∅ ⊂ x, y ⊂ 𝓤 + + if x.disjoint(y) { + return false // x ⊆ y == false if x ∩ y == ∅ + } + // x.typ == y.typ + + // ~t ⊆ ~t == true + // ~t ⊆ T == false + // T ⊆ ~t == true + // T ⊆ T == true + return !x.tilde || y.tilde +} + +// disjoint reports whether x ∩ y == ∅. +// x.typ and y.typ must not be nil. +func (x *term) disjoint(y *term) bool { + if debug && (x.typ == nil || y.typ == nil) { + panic("invalid argument(s)") + } + ux := x.typ + if y.tilde { + ux = under(ux) + } + uy := y.typ + if x.tilde { + uy = under(uy) + } + return !types.Identical(ux, uy) +} diff --git a/vendor/golang.org/x/tools/internal/typesinternal/errorcode.go b/vendor/golang.org/x/tools/internal/typesinternal/errorcode.go new file mode 100644 index 000000000..07484073a --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typesinternal/errorcode.go @@ -0,0 +1,1560 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package typesinternal + +//go:generate stringer -type=ErrorCode + +type ErrorCode int + +// This file defines the error codes that can be produced during type-checking. +// Collectively, these codes provide an identifier that may be used to +// implement special handling for certain types of errors. +// +// Error codes should be fine-grained enough that the exact nature of the error +// can be easily determined, but coarse enough that they are not an +// implementation detail of the type checking algorithm. As a rule-of-thumb, +// errors should be considered equivalent if there is a theoretical refactoring +// of the type checker in which they are emitted in exactly one place. For +// example, the type checker emits different error messages for "too many +// arguments" and "too few arguments", but one can imagine an alternative type +// checker where this check instead just emits a single "wrong number of +// arguments", so these errors should have the same code. +// +// Error code names should be as brief as possible while retaining accuracy and +// distinctiveness. In most cases names should start with an adjective +// describing the nature of the error (e.g. "invalid", "unused", "misplaced"), +// and end with a noun identifying the relevant language object. For example, +// "DuplicateDecl" or "InvalidSliceExpr". For brevity, naming follows the +// convention that "bad" implies a problem with syntax, and "invalid" implies a +// problem with types. + +const ( + // InvalidSyntaxTree occurs if an invalid syntax tree is provided + // to the type checker. It should never happen. + InvalidSyntaxTree ErrorCode = -1 +) + +const ( + _ ErrorCode = iota + + // Test is reserved for errors that only apply while in self-test mode. + Test + + /* package names */ + + // BlankPkgName occurs when a package name is the blank identifier "_". + // + // Per the spec: + // "The PackageName must not be the blank identifier." + BlankPkgName + + // MismatchedPkgName occurs when a file's package name doesn't match the + // package name already established by other files. + MismatchedPkgName + + // InvalidPkgUse occurs when a package identifier is used outside of a + // selector expression. + // + // Example: + // import "fmt" + // + // var _ = fmt + InvalidPkgUse + + /* imports */ + + // BadImportPath occurs when an import path is not valid. + BadImportPath + + // BrokenImport occurs when importing a package fails. + // + // Example: + // import "amissingpackage" + BrokenImport + + // ImportCRenamed occurs when the special import "C" is renamed. "C" is a + // pseudo-package, and must not be renamed. + // + // Example: + // import _ "C" + ImportCRenamed + + // UnusedImport occurs when an import is unused. + // + // Example: + // import "fmt" + // + // func main() {} + UnusedImport + + /* initialization */ + + // InvalidInitCycle occurs when an invalid cycle is detected within the + // initialization graph. + // + // Example: + // var x int = f() + // + // func f() int { return x } + InvalidInitCycle + + /* decls */ + + // DuplicateDecl occurs when an identifier is declared multiple times. + // + // Example: + // var x = 1 + // var x = 2 + DuplicateDecl + + // InvalidDeclCycle occurs when a declaration cycle is not valid. + // + // Example: + // import "unsafe" + // + // type T struct { + // a [n]int + // } + // + // var n = unsafe.Sizeof(T{}) + InvalidDeclCycle + + // InvalidTypeCycle occurs when a cycle in type definitions results in a + // type that is not well-defined. + // + // Example: + // import "unsafe" + // + // type T [unsafe.Sizeof(T{})]int + InvalidTypeCycle + + /* decls > const */ + + // InvalidConstInit occurs when a const declaration has a non-constant + // initializer. + // + // Example: + // var x int + // const _ = x + InvalidConstInit + + // InvalidConstVal occurs when a const value cannot be converted to its + // target type. + // + // TODO(findleyr): this error code and example are not very clear. Consider + // removing it. + // + // Example: + // const _ = 1 << "hello" + InvalidConstVal + + // InvalidConstType occurs when the underlying type in a const declaration + // is not a valid constant type. + // + // Example: + // const c *int = 4 + InvalidConstType + + /* decls > var (+ other variable assignment codes) */ + + // UntypedNilUse occurs when the predeclared (untyped) value nil is used to + // initialize a variable declared without an explicit type. + // + // Example: + // var x = nil + UntypedNilUse + + // WrongAssignCount occurs when the number of values on the right-hand side + // of an assignment or or initialization expression does not match the number + // of variables on the left-hand side. + // + // Example: + // var x = 1, 2 + WrongAssignCount + + // UnassignableOperand occurs when the left-hand side of an assignment is + // not assignable. + // + // Example: + // func f() { + // const c = 1 + // c = 2 + // } + UnassignableOperand + + // NoNewVar occurs when a short variable declaration (':=') does not declare + // new variables. + // + // Example: + // func f() { + // x := 1 + // x := 2 + // } + NoNewVar + + // MultiValAssignOp occurs when an assignment operation (+=, *=, etc) does + // not have single-valued left-hand or right-hand side. + // + // Per the spec: + // "In assignment operations, both the left- and right-hand expression lists + // must contain exactly one single-valued expression" + // + // Example: + // func f() int { + // x, y := 1, 2 + // x, y += 1 + // return x + y + // } + MultiValAssignOp + + // InvalidIfaceAssign occurs when a value of type T is used as an + // interface, but T does not implement a method of the expected interface. + // + // Example: + // type I interface { + // f() + // } + // + // type T int + // + // var x I = T(1) + InvalidIfaceAssign + + // InvalidChanAssign occurs when a chan assignment is invalid. + // + // Per the spec, a value x is assignable to a channel type T if: + // "x is a bidirectional channel value, T is a channel type, x's type V and + // T have identical element types, and at least one of V or T is not a + // defined type." + // + // Example: + // type T1 chan int + // type T2 chan int + // + // var x T1 + // // Invalid assignment because both types are named + // var _ T2 = x + InvalidChanAssign + + // IncompatibleAssign occurs when the type of the right-hand side expression + // in an assignment cannot be assigned to the type of the variable being + // assigned. + // + // Example: + // var x []int + // var _ int = x + IncompatibleAssign + + // UnaddressableFieldAssign occurs when trying to assign to a struct field + // in a map value. + // + // Example: + // func f() { + // m := make(map[string]struct{i int}) + // m["foo"].i = 42 + // } + UnaddressableFieldAssign + + /* decls > type (+ other type expression codes) */ + + // NotAType occurs when the identifier used as the underlying type in a type + // declaration or the right-hand side of a type alias does not denote a type. + // + // Example: + // var S = 2 + // + // type T S + NotAType + + // InvalidArrayLen occurs when an array length is not a constant value. + // + // Example: + // var n = 3 + // var _ = [n]int{} + InvalidArrayLen + + // BlankIfaceMethod occurs when a method name is '_'. + // + // Per the spec: + // "The name of each explicitly specified method must be unique and not + // blank." + // + // Example: + // type T interface { + // _(int) + // } + BlankIfaceMethod + + // IncomparableMapKey occurs when a map key type does not support the == and + // != operators. + // + // Per the spec: + // "The comparison operators == and != must be fully defined for operands of + // the key type; thus the key type must not be a function, map, or slice." + // + // Example: + // var x map[T]int + // + // type T []int + IncomparableMapKey + + // InvalidIfaceEmbed occurs when a non-interface type is embedded in an + // interface. + // + // Example: + // type T struct {} + // + // func (T) m() + // + // type I interface { + // T + // } + InvalidIfaceEmbed + + // InvalidPtrEmbed occurs when an embedded field is of the pointer form *T, + // and T itself is itself a pointer, an unsafe.Pointer, or an interface. + // + // Per the spec: + // "An embedded field must be specified as a type name T or as a pointer to + // a non-interface type name *T, and T itself may not be a pointer type." + // + // Example: + // type T *int + // + // type S struct { + // *T + // } + InvalidPtrEmbed + + /* decls > func and method */ + + // BadRecv occurs when a method declaration does not have exactly one + // receiver parameter. + // + // Example: + // func () _() {} + BadRecv + + // InvalidRecv occurs when a receiver type expression is not of the form T + // or *T, or T is a pointer type. + // + // Example: + // type T struct {} + // + // func (**T) m() {} + InvalidRecv + + // DuplicateFieldAndMethod occurs when an identifier appears as both a field + // and method name. + // + // Example: + // type T struct { + // m int + // } + // + // func (T) m() {} + DuplicateFieldAndMethod + + // DuplicateMethod occurs when two methods on the same receiver type have + // the same name. + // + // Example: + // type T struct {} + // func (T) m() {} + // func (T) m(i int) int { return i } + DuplicateMethod + + /* decls > special */ + + // InvalidBlank occurs when a blank identifier is used as a value or type. + // + // Per the spec: + // "The blank identifier may appear as an operand only on the left-hand side + // of an assignment." + // + // Example: + // var x = _ + InvalidBlank + + // InvalidIota occurs when the predeclared identifier iota is used outside + // of a constant declaration. + // + // Example: + // var x = iota + InvalidIota + + // MissingInitBody occurs when an init function is missing its body. + // + // Example: + // func init() + MissingInitBody + + // InvalidInitSig occurs when an init function declares parameters or + // results. + // + // Example: + // func init() int { return 1 } + InvalidInitSig + + // InvalidInitDecl occurs when init is declared as anything other than a + // function. + // + // Example: + // var init = 1 + InvalidInitDecl + + // InvalidMainDecl occurs when main is declared as anything other than a + // function, in a main package. + InvalidMainDecl + + /* exprs */ + + // TooManyValues occurs when a function returns too many values for the + // expression context in which it is used. + // + // Example: + // func ReturnTwo() (int, int) { + // return 1, 2 + // } + // + // var x = ReturnTwo() + TooManyValues + + // NotAnExpr occurs when a type expression is used where a value expression + // is expected. + // + // Example: + // type T struct {} + // + // func f() { + // T + // } + NotAnExpr + + /* exprs > const */ + + // TruncatedFloat occurs when a float constant is truncated to an integer + // value. + // + // Example: + // var _ int = 98.6 + TruncatedFloat + + // NumericOverflow occurs when a numeric constant overflows its target type. + // + // Example: + // var x int8 = 1000 + NumericOverflow + + /* exprs > operation */ + + // UndefinedOp occurs when an operator is not defined for the type(s) used + // in an operation. + // + // Example: + // var c = "a" - "b" + UndefinedOp + + // MismatchedTypes occurs when operand types are incompatible in a binary + // operation. + // + // Example: + // var a = "hello" + // var b = 1 + // var c = a - b + MismatchedTypes + + // DivByZero occurs when a division operation is provable at compile + // time to be a division by zero. + // + // Example: + // const divisor = 0 + // var x int = 1/divisor + DivByZero + + // NonNumericIncDec occurs when an increment or decrement operator is + // applied to a non-numeric value. + // + // Example: + // func f() { + // var c = "c" + // c++ + // } + NonNumericIncDec + + /* exprs > ptr */ + + // UnaddressableOperand occurs when the & operator is applied to an + // unaddressable expression. + // + // Example: + // var x = &1 + UnaddressableOperand + + // InvalidIndirection occurs when a non-pointer value is indirected via the + // '*' operator. + // + // Example: + // var x int + // var y = *x + InvalidIndirection + + /* exprs > [] */ + + // NonIndexableOperand occurs when an index operation is applied to a value + // that cannot be indexed. + // + // Example: + // var x = 1 + // var y = x[1] + NonIndexableOperand + + // InvalidIndex occurs when an index argument is not of integer type, + // negative, or out-of-bounds. + // + // Example: + // var s = [...]int{1,2,3} + // var x = s[5] + // + // Example: + // var s = []int{1,2,3} + // var _ = s[-1] + // + // Example: + // var s = []int{1,2,3} + // var i string + // var _ = s[i] + InvalidIndex + + // SwappedSliceIndices occurs when constant indices in a slice expression + // are decreasing in value. + // + // Example: + // var _ = []int{1,2,3}[2:1] + SwappedSliceIndices + + /* operators > slice */ + + // NonSliceableOperand occurs when a slice operation is applied to a value + // whose type is not sliceable, or is unaddressable. + // + // Example: + // var x = [...]int{1, 2, 3}[:1] + // + // Example: + // var x = 1 + // var y = 1[:1] + NonSliceableOperand + + // InvalidSliceExpr occurs when a three-index slice expression (a[x:y:z]) is + // applied to a string. + // + // Example: + // var s = "hello" + // var x = s[1:2:3] + InvalidSliceExpr + + /* exprs > shift */ + + // InvalidShiftCount occurs when the right-hand side of a shift operation is + // either non-integer, negative, or too large. + // + // Example: + // var ( + // x string + // y int = 1 << x + // ) + InvalidShiftCount + + // InvalidShiftOperand occurs when the shifted operand is not an integer. + // + // Example: + // var s = "hello" + // var x = s << 2 + InvalidShiftOperand + + /* exprs > chan */ + + // InvalidReceive occurs when there is a channel receive from a value that + // is either not a channel, or is a send-only channel. + // + // Example: + // func f() { + // var x = 1 + // <-x + // } + InvalidReceive + + // InvalidSend occurs when there is a channel send to a value that is not a + // channel, or is a receive-only channel. + // + // Example: + // func f() { + // var x = 1 + // x <- "hello!" + // } + InvalidSend + + /* exprs > literal */ + + // DuplicateLitKey occurs when an index is duplicated in a slice, array, or + // map literal. + // + // Example: + // var _ = []int{0:1, 0:2} + // + // Example: + // var _ = map[string]int{"a": 1, "a": 2} + DuplicateLitKey + + // MissingLitKey occurs when a map literal is missing a key expression. + // + // Example: + // var _ = map[string]int{1} + MissingLitKey + + // InvalidLitIndex occurs when the key in a key-value element of a slice or + // array literal is not an integer constant. + // + // Example: + // var i = 0 + // var x = []string{i: "world"} + InvalidLitIndex + + // OversizeArrayLit occurs when an array literal exceeds its length. + // + // Example: + // var _ = [2]int{1,2,3} + OversizeArrayLit + + // MixedStructLit occurs when a struct literal contains a mix of positional + // and named elements. + // + // Example: + // var _ = struct{i, j int}{i: 1, 2} + MixedStructLit + + // InvalidStructLit occurs when a positional struct literal has an incorrect + // number of values. + // + // Example: + // var _ = struct{i, j int}{1,2,3} + InvalidStructLit + + // MissingLitField occurs when a struct literal refers to a field that does + // not exist on the struct type. + // + // Example: + // var _ = struct{i int}{j: 2} + MissingLitField + + // DuplicateLitField occurs when a struct literal contains duplicated + // fields. + // + // Example: + // var _ = struct{i int}{i: 1, i: 2} + DuplicateLitField + + // UnexportedLitField occurs when a positional struct literal implicitly + // assigns an unexported field of an imported type. + UnexportedLitField + + // InvalidLitField occurs when a field name is not a valid identifier. + // + // Example: + // var _ = struct{i int}{1: 1} + InvalidLitField + + // UntypedLit occurs when a composite literal omits a required type + // identifier. + // + // Example: + // type outer struct{ + // inner struct { i int } + // } + // + // var _ = outer{inner: {1}} + UntypedLit + + // InvalidLit occurs when a composite literal expression does not match its + // type. + // + // Example: + // type P *struct{ + // x int + // } + // var _ = P {} + InvalidLit + + /* exprs > selector */ + + // AmbiguousSelector occurs when a selector is ambiguous. + // + // Example: + // type E1 struct { i int } + // type E2 struct { i int } + // type T struct { E1; E2 } + // + // var x T + // var _ = x.i + AmbiguousSelector + + // UndeclaredImportedName occurs when a package-qualified identifier is + // undeclared by the imported package. + // + // Example: + // import "go/types" + // + // var _ = types.NotAnActualIdentifier + UndeclaredImportedName + + // UnexportedName occurs when a selector refers to an unexported identifier + // of an imported package. + // + // Example: + // import "reflect" + // + // type _ reflect.flag + UnexportedName + + // UndeclaredName occurs when an identifier is not declared in the current + // scope. + // + // Example: + // var x T + UndeclaredName + + // MissingFieldOrMethod occurs when a selector references a field or method + // that does not exist. + // + // Example: + // type T struct {} + // + // var x = T{}.f + MissingFieldOrMethod + + /* exprs > ... */ + + // BadDotDotDotSyntax occurs when a "..." occurs in a context where it is + // not valid. + // + // Example: + // var _ = map[int][...]int{0: {}} + BadDotDotDotSyntax + + // NonVariadicDotDotDot occurs when a "..." is used on the final argument to + // a non-variadic function. + // + // Example: + // func printArgs(s []string) { + // for _, a := range s { + // println(a) + // } + // } + // + // func f() { + // s := []string{"a", "b", "c"} + // printArgs(s...) + // } + NonVariadicDotDotDot + + // MisplacedDotDotDot occurs when a "..." is used somewhere other than the + // final argument to a function call. + // + // Example: + // func printArgs(args ...int) { + // for _, a := range args { + // println(a) + // } + // } + // + // func f() { + // a := []int{1,2,3} + // printArgs(0, a...) + // } + MisplacedDotDotDot + + // InvalidDotDotDotOperand occurs when a "..." operator is applied to a + // single-valued operand. + // + // Example: + // func printArgs(args ...int) { + // for _, a := range args { + // println(a) + // } + // } + // + // func f() { + // a := 1 + // printArgs(a...) + // } + // + // Example: + // func args() (int, int) { + // return 1, 2 + // } + // + // func printArgs(args ...int) { + // for _, a := range args { + // println(a) + // } + // } + // + // func g() { + // printArgs(args()...) + // } + InvalidDotDotDotOperand + + // InvalidDotDotDot occurs when a "..." is used in a non-variadic built-in + // function. + // + // Example: + // var s = []int{1, 2, 3} + // var l = len(s...) + InvalidDotDotDot + + /* exprs > built-in */ + + // UncalledBuiltin occurs when a built-in function is used as a + // function-valued expression, instead of being called. + // + // Per the spec: + // "The built-in functions do not have standard Go types, so they can only + // appear in call expressions; they cannot be used as function values." + // + // Example: + // var _ = copy + UncalledBuiltin + + // InvalidAppend occurs when append is called with a first argument that is + // not a slice. + // + // Example: + // var _ = append(1, 2) + InvalidAppend + + // InvalidCap occurs when an argument to the cap built-in function is not of + // supported type. + // + // See https://golang.org/ref/spec#Lengthand_capacity for information on + // which underlying types are supported as arguments to cap and len. + // + // Example: + // var s = 2 + // var x = cap(s) + InvalidCap + + // InvalidClose occurs when close(...) is called with an argument that is + // not of channel type, or that is a receive-only channel. + // + // Example: + // func f() { + // var x int + // close(x) + // } + InvalidClose + + // InvalidCopy occurs when the arguments are not of slice type or do not + // have compatible type. + // + // See https://golang.org/ref/spec#Appendingand_copying_slices for more + // information on the type requirements for the copy built-in. + // + // Example: + // func f() { + // var x []int + // y := []int64{1,2,3} + // copy(x, y) + // } + InvalidCopy + + // InvalidComplex occurs when the complex built-in function is called with + // arguments with incompatible types. + // + // Example: + // var _ = complex(float32(1), float64(2)) + InvalidComplex + + // InvalidDelete occurs when the delete built-in function is called with a + // first argument that is not a map. + // + // Example: + // func f() { + // m := "hello" + // delete(m, "e") + // } + InvalidDelete + + // InvalidImag occurs when the imag built-in function is called with an + // argument that does not have complex type. + // + // Example: + // var _ = imag(int(1)) + InvalidImag + + // InvalidLen occurs when an argument to the len built-in function is not of + // supported type. + // + // See https://golang.org/ref/spec#Lengthand_capacity for information on + // which underlying types are supported as arguments to cap and len. + // + // Example: + // var s = 2 + // var x = len(s) + InvalidLen + + // SwappedMakeArgs occurs when make is called with three arguments, and its + // length argument is larger than its capacity argument. + // + // Example: + // var x = make([]int, 3, 2) + SwappedMakeArgs + + // InvalidMake occurs when make is called with an unsupported type argument. + // + // See https://golang.org/ref/spec#Makingslices_maps_and_channels for + // information on the types that may be created using make. + // + // Example: + // var x = make(int) + InvalidMake + + // InvalidReal occurs when the real built-in function is called with an + // argument that does not have complex type. + // + // Example: + // var _ = real(int(1)) + InvalidReal + + /* exprs > assertion */ + + // InvalidAssert occurs when a type assertion is applied to a + // value that is not of interface type. + // + // Example: + // var x = 1 + // var _ = x.(float64) + InvalidAssert + + // ImpossibleAssert occurs for a type assertion x.(T) when the value x of + // interface cannot have dynamic type T, due to a missing or mismatching + // method on T. + // + // Example: + // type T int + // + // func (t *T) m() int { return int(*t) } + // + // type I interface { m() int } + // + // var x I + // var _ = x.(T) + ImpossibleAssert + + /* exprs > conversion */ + + // InvalidConversion occurs when the argument type cannot be converted to the + // target. + // + // See https://golang.org/ref/spec#Conversions for the rules of + // convertibility. + // + // Example: + // var x float64 + // var _ = string(x) + InvalidConversion + + // InvalidUntypedConversion occurs when an there is no valid implicit + // conversion from an untyped value satisfying the type constraints of the + // context in which it is used. + // + // Example: + // var _ = 1 + "" + InvalidUntypedConversion + + /* offsetof */ + + // BadOffsetofSyntax occurs when unsafe.Offsetof is called with an argument + // that is not a selector expression. + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Offsetof(x) + BadOffsetofSyntax + + // InvalidOffsetof occurs when unsafe.Offsetof is called with a method + // selector, rather than a field selector, or when the field is embedded via + // a pointer. + // + // Per the spec: + // + // "If f is an embedded field, it must be reachable without pointer + // indirections through fields of the struct. " + // + // Example: + // import "unsafe" + // + // type T struct { f int } + // type S struct { *T } + // var s S + // var _ = unsafe.Offsetof(s.f) + // + // Example: + // import "unsafe" + // + // type S struct{} + // + // func (S) m() {} + // + // var s S + // var _ = unsafe.Offsetof(s.m) + InvalidOffsetof + + /* control flow > scope */ + + // UnusedExpr occurs when a side-effect free expression is used as a + // statement. Such a statement has no effect. + // + // Example: + // func f(i int) { + // i*i + // } + UnusedExpr + + // UnusedVar occurs when a variable is declared but unused. + // + // Example: + // func f() { + // x := 1 + // } + UnusedVar + + // MissingReturn occurs when a function with results is missing a return + // statement. + // + // Example: + // func f() int {} + MissingReturn + + // WrongResultCount occurs when a return statement returns an incorrect + // number of values. + // + // Example: + // func ReturnOne() int { + // return 1, 2 + // } + WrongResultCount + + // OutOfScopeResult occurs when the name of a value implicitly returned by + // an empty return statement is shadowed in a nested scope. + // + // Example: + // func factor(n int) (i int) { + // for i := 2; i < n; i++ { + // if n%i == 0 { + // return + // } + // } + // return 0 + // } + OutOfScopeResult + + /* control flow > if */ + + // InvalidCond occurs when an if condition is not a boolean expression. + // + // Example: + // func checkReturn(i int) { + // if i { + // panic("non-zero return") + // } + // } + InvalidCond + + /* control flow > for */ + + // InvalidPostDecl occurs when there is a declaration in a for-loop post + // statement. + // + // Example: + // func f() { + // for i := 0; i < 10; j := 0 {} + // } + InvalidPostDecl + + // InvalidChanRange occurs when a send-only channel used in a range + // expression. + // + // Example: + // func sum(c chan<- int) { + // s := 0 + // for i := range c { + // s += i + // } + // } + InvalidChanRange + + // InvalidIterVar occurs when two iteration variables are used while ranging + // over a channel. + // + // Example: + // func f(c chan int) { + // for k, v := range c { + // println(k, v) + // } + // } + InvalidIterVar + + // InvalidRangeExpr occurs when the type of a range expression is not array, + // slice, string, map, or channel. + // + // Example: + // func f(i int) { + // for j := range i { + // println(j) + // } + // } + InvalidRangeExpr + + /* control flow > switch */ + + // MisplacedBreak occurs when a break statement is not within a for, switch, + // or select statement of the innermost function definition. + // + // Example: + // func f() { + // break + // } + MisplacedBreak + + // MisplacedContinue occurs when a continue statement is not within a for + // loop of the innermost function definition. + // + // Example: + // func sumeven(n int) int { + // proceed := func() { + // continue + // } + // sum := 0 + // for i := 1; i <= n; i++ { + // if i % 2 != 0 { + // proceed() + // } + // sum += i + // } + // return sum + // } + MisplacedContinue + + // MisplacedFallthrough occurs when a fallthrough statement is not within an + // expression switch. + // + // Example: + // func typename(i interface{}) string { + // switch i.(type) { + // case int64: + // fallthrough + // case int: + // return "int" + // } + // return "unsupported" + // } + MisplacedFallthrough + + // DuplicateCase occurs when a type or expression switch has duplicate + // cases. + // + // Example: + // func printInt(i int) { + // switch i { + // case 1: + // println("one") + // case 1: + // println("One") + // } + // } + DuplicateCase + + // DuplicateDefault occurs when a type or expression switch has multiple + // default clauses. + // + // Example: + // func printInt(i int) { + // switch i { + // case 1: + // println("one") + // default: + // println("One") + // default: + // println("1") + // } + // } + DuplicateDefault + + // BadTypeKeyword occurs when a .(type) expression is used anywhere other + // than a type switch. + // + // Example: + // type I interface { + // m() + // } + // var t I + // var _ = t.(type) + BadTypeKeyword + + // InvalidTypeSwitch occurs when .(type) is used on an expression that is + // not of interface type. + // + // Example: + // func f(i int) { + // switch x := i.(type) {} + // } + InvalidTypeSwitch + + // InvalidExprSwitch occurs when a switch expression is not comparable. + // + // Example: + // func _() { + // var a struct{ _ func() } + // switch a /* ERROR cannot switch on a */ { + // } + // } + InvalidExprSwitch + + /* control flow > select */ + + // InvalidSelectCase occurs when a select case is not a channel send or + // receive. + // + // Example: + // func checkChan(c <-chan int) bool { + // select { + // case c: + // return true + // default: + // return false + // } + // } + InvalidSelectCase + + /* control flow > labels and jumps */ + + // UndeclaredLabel occurs when an undeclared label is jumped to. + // + // Example: + // func f() { + // goto L + // } + UndeclaredLabel + + // DuplicateLabel occurs when a label is declared more than once. + // + // Example: + // func f() int { + // L: + // L: + // return 1 + // } + DuplicateLabel + + // MisplacedLabel occurs when a break or continue label is not on a for, + // switch, or select statement. + // + // Example: + // func f() { + // L: + // a := []int{1,2,3} + // for _, e := range a { + // if e > 10 { + // break L + // } + // println(a) + // } + // } + MisplacedLabel + + // UnusedLabel occurs when a label is declared but not used. + // + // Example: + // func f() { + // L: + // } + UnusedLabel + + // JumpOverDecl occurs when a label jumps over a variable declaration. + // + // Example: + // func f() int { + // goto L + // x := 2 + // L: + // x++ + // return x + // } + JumpOverDecl + + // JumpIntoBlock occurs when a forward jump goes to a label inside a nested + // block. + // + // Example: + // func f(x int) { + // goto L + // if x > 0 { + // L: + // print("inside block") + // } + // } + JumpIntoBlock + + /* control flow > calls */ + + // InvalidMethodExpr occurs when a pointer method is called but the argument + // is not addressable. + // + // Example: + // type T struct {} + // + // func (*T) m() int { return 1 } + // + // var _ = T.m(T{}) + InvalidMethodExpr + + // WrongArgCount occurs when too few or too many arguments are passed by a + // function call. + // + // Example: + // func f(i int) {} + // var x = f() + WrongArgCount + + // InvalidCall occurs when an expression is called that is not of function + // type. + // + // Example: + // var x = "x" + // var y = x() + InvalidCall + + /* control flow > suspended */ + + // UnusedResults occurs when a restricted expression-only built-in function + // is suspended via go or defer. Such a suspension discards the results of + // these side-effect free built-in functions, and therefore is ineffectual. + // + // Example: + // func f(a []int) int { + // defer len(a) + // return i + // } + UnusedResults + + // InvalidDefer occurs when a deferred expression is not a function call, + // for example if the expression is a type conversion. + // + // Example: + // func f(i int) int { + // defer int32(i) + // return i + // } + InvalidDefer + + // InvalidGo occurs when a go expression is not a function call, for example + // if the expression is a type conversion. + // + // Example: + // func f(i int) int { + // go int32(i) + // return i + // } + InvalidGo + + // All codes below were added in Go 1.17. + + /* decl */ + + // BadDecl occurs when a declaration has invalid syntax. + BadDecl + + // RepeatedDecl occurs when an identifier occurs more than once on the left + // hand side of a short variable declaration. + // + // Example: + // func _() { + // x, y, y := 1, 2, 3 + // } + RepeatedDecl + + /* unsafe */ + + // InvalidUnsafeAdd occurs when unsafe.Add is called with a + // length argument that is not of integer type. + // + // Example: + // import "unsafe" + // + // var p unsafe.Pointer + // var _ = unsafe.Add(p, float64(1)) + InvalidUnsafeAdd + + // InvalidUnsafeSlice occurs when unsafe.Slice is called with a + // pointer argument that is not of pointer type or a length argument + // that is not of integer type, negative, or out of bounds. + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Slice(x, 1) + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Slice(&x, float64(1)) + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Slice(&x, -1) + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Slice(&x, uint64(1) << 63) + InvalidUnsafeSlice + + // All codes below were added in Go 1.18. + + /* features */ + + // UnsupportedFeature occurs when a language feature is used that is not + // supported at this Go version. + UnsupportedFeature + + /* type params */ + + // NotAGenericType occurs when a non-generic type is used where a generic + // type is expected: in type or function instantiation. + // + // Example: + // type T int + // + // var _ T[int] + NotAGenericType + + // WrongTypeArgCount occurs when a type or function is instantiated with an + // incorrent number of type arguments, including when a generic type or + // function is used without instantiation. + // + // Errors inolving failed type inference are assigned other error codes. + // + // Example: + // type T[p any] int + // + // var _ T[int, string] + // + // Example: + // func f[T any]() {} + // + // var x = f + WrongTypeArgCount + + // CannotInferTypeArgs occurs when type or function type argument inference + // fails to infer all type arguments. + // + // Example: + // func f[T any]() {} + // + // func _() { + // f() + // } + // + // Example: + // type N[P, Q any] struct{} + // + // var _ N[int] + CannotInferTypeArgs + + // InvalidTypeArg occurs when a type argument does not satisfy its + // corresponding type parameter constraints. + // + // Example: + // type T[P ~int] struct{} + // + // var _ T[string] + InvalidTypeArg // arguments? InferenceFailed + + // InvalidInstanceCycle occurs when an invalid cycle is detected + // within the instantiation graph. + // + // Example: + // func f[T any]() { f[*T]() } + InvalidInstanceCycle + + // InvalidUnion occurs when an embedded union or approximation element is + // not valid. + // + // Example: + // type _ interface { + // ~int | interface{ m() } + // } + InvalidUnion + + // MisplacedConstraintIface occurs when a constraint-type interface is used + // outside of constraint position. + // + // Example: + // type I interface { ~int } + // + // var _ I + MisplacedConstraintIface + + // InvalidMethodTypeParams occurs when methods have type parameters. + // + // It cannot be encountered with an AST parsed using go/parser. + InvalidMethodTypeParams + + // MisplacedTypeParam occurs when a type parameter is used in a place where + // it is not permitted. + // + // Example: + // type T[P any] P + // + // Example: + // type T[P any] struct{ *P } + MisplacedTypeParam + + // InvalidUnsafeSliceData occurs when unsafe.SliceData is called with + // an argument that is not of slice type. It also occurs if it is used + // in a package compiled for a language version before go1.20. + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.SliceData(x) + InvalidUnsafeSliceData + + // InvalidUnsafeString occurs when unsafe.String is called with + // a length argument that is not of integer type, negative, or + // out of bounds. It also occurs if it is used in a package + // compiled for a language version before go1.20. + // + // Example: + // import "unsafe" + // + // var b [10]byte + // var _ = unsafe.String(&b[0], -1) + InvalidUnsafeString + + // InvalidUnsafeStringData occurs if it is used in a package + // compiled for a language version before go1.20. + _ // not used anymore + +) diff --git a/vendor/golang.org/x/tools/internal/typesinternal/errorcode_string.go b/vendor/golang.org/x/tools/internal/typesinternal/errorcode_string.go new file mode 100644 index 000000000..15ecf7c5d --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typesinternal/errorcode_string.go @@ -0,0 +1,179 @@ +// Code generated by "stringer -type=ErrorCode"; DO NOT EDIT. + +package typesinternal + +import "strconv" + +func _() { + // An "invalid array index" compiler error signifies that the constant values have changed. + // Re-run the stringer command to generate them again. + var x [1]struct{} + _ = x[InvalidSyntaxTree - -1] + _ = x[Test-1] + _ = x[BlankPkgName-2] + _ = x[MismatchedPkgName-3] + _ = x[InvalidPkgUse-4] + _ = x[BadImportPath-5] + _ = x[BrokenImport-6] + _ = x[ImportCRenamed-7] + _ = x[UnusedImport-8] + _ = x[InvalidInitCycle-9] + _ = x[DuplicateDecl-10] + _ = x[InvalidDeclCycle-11] + _ = x[InvalidTypeCycle-12] + _ = x[InvalidConstInit-13] + _ = x[InvalidConstVal-14] + _ = x[InvalidConstType-15] + _ = x[UntypedNilUse-16] + _ = x[WrongAssignCount-17] + _ = x[UnassignableOperand-18] + _ = x[NoNewVar-19] + _ = x[MultiValAssignOp-20] + _ = x[InvalidIfaceAssign-21] + _ = x[InvalidChanAssign-22] + _ = x[IncompatibleAssign-23] + _ = x[UnaddressableFieldAssign-24] + _ = x[NotAType-25] + _ = x[InvalidArrayLen-26] + _ = x[BlankIfaceMethod-27] + _ = x[IncomparableMapKey-28] + _ = x[InvalidIfaceEmbed-29] + _ = x[InvalidPtrEmbed-30] + _ = x[BadRecv-31] + _ = x[InvalidRecv-32] + _ = x[DuplicateFieldAndMethod-33] + _ = x[DuplicateMethod-34] + _ = x[InvalidBlank-35] + _ = x[InvalidIota-36] + _ = x[MissingInitBody-37] + _ = x[InvalidInitSig-38] + _ = x[InvalidInitDecl-39] + _ = x[InvalidMainDecl-40] + _ = x[TooManyValues-41] + _ = x[NotAnExpr-42] + _ = x[TruncatedFloat-43] + _ = x[NumericOverflow-44] + _ = x[UndefinedOp-45] + _ = x[MismatchedTypes-46] + _ = x[DivByZero-47] + _ = x[NonNumericIncDec-48] + _ = x[UnaddressableOperand-49] + _ = x[InvalidIndirection-50] + _ = x[NonIndexableOperand-51] + _ = x[InvalidIndex-52] + _ = x[SwappedSliceIndices-53] + _ = x[NonSliceableOperand-54] + _ = x[InvalidSliceExpr-55] + _ = x[InvalidShiftCount-56] + _ = x[InvalidShiftOperand-57] + _ = x[InvalidReceive-58] + _ = x[InvalidSend-59] + _ = x[DuplicateLitKey-60] + _ = x[MissingLitKey-61] + _ = x[InvalidLitIndex-62] + _ = x[OversizeArrayLit-63] + _ = x[MixedStructLit-64] + _ = x[InvalidStructLit-65] + _ = x[MissingLitField-66] + _ = x[DuplicateLitField-67] + _ = x[UnexportedLitField-68] + _ = x[InvalidLitField-69] + _ = x[UntypedLit-70] + _ = x[InvalidLit-71] + _ = x[AmbiguousSelector-72] + _ = x[UndeclaredImportedName-73] + _ = x[UnexportedName-74] + _ = x[UndeclaredName-75] + _ = x[MissingFieldOrMethod-76] + _ = x[BadDotDotDotSyntax-77] + _ = x[NonVariadicDotDotDot-78] + _ = x[MisplacedDotDotDot-79] + _ = x[InvalidDotDotDotOperand-80] + _ = x[InvalidDotDotDot-81] + _ = x[UncalledBuiltin-82] + _ = x[InvalidAppend-83] + _ = x[InvalidCap-84] + _ = x[InvalidClose-85] + _ = x[InvalidCopy-86] + _ = x[InvalidComplex-87] + _ = x[InvalidDelete-88] + _ = x[InvalidImag-89] + _ = x[InvalidLen-90] + _ = x[SwappedMakeArgs-91] + _ = x[InvalidMake-92] + _ = x[InvalidReal-93] + _ = x[InvalidAssert-94] + _ = x[ImpossibleAssert-95] + _ = x[InvalidConversion-96] + _ = x[InvalidUntypedConversion-97] + _ = x[BadOffsetofSyntax-98] + _ = x[InvalidOffsetof-99] + _ = x[UnusedExpr-100] + _ = x[UnusedVar-101] + _ = x[MissingReturn-102] + _ = x[WrongResultCount-103] + _ = x[OutOfScopeResult-104] + _ = x[InvalidCond-105] + _ = x[InvalidPostDecl-106] + _ = x[InvalidChanRange-107] + _ = x[InvalidIterVar-108] + _ = x[InvalidRangeExpr-109] + _ = x[MisplacedBreak-110] + _ = x[MisplacedContinue-111] + _ = x[MisplacedFallthrough-112] + _ = x[DuplicateCase-113] + _ = x[DuplicateDefault-114] + _ = x[BadTypeKeyword-115] + _ = x[InvalidTypeSwitch-116] + _ = x[InvalidExprSwitch-117] + _ = x[InvalidSelectCase-118] + _ = x[UndeclaredLabel-119] + _ = x[DuplicateLabel-120] + _ = x[MisplacedLabel-121] + _ = x[UnusedLabel-122] + _ = x[JumpOverDecl-123] + _ = x[JumpIntoBlock-124] + _ = x[InvalidMethodExpr-125] + _ = x[WrongArgCount-126] + _ = x[InvalidCall-127] + _ = x[UnusedResults-128] + _ = x[InvalidDefer-129] + _ = x[InvalidGo-130] + _ = x[BadDecl-131] + _ = x[RepeatedDecl-132] + _ = x[InvalidUnsafeAdd-133] + _ = x[InvalidUnsafeSlice-134] + _ = x[UnsupportedFeature-135] + _ = x[NotAGenericType-136] + _ = x[WrongTypeArgCount-137] + _ = x[CannotInferTypeArgs-138] + _ = x[InvalidTypeArg-139] + _ = x[InvalidInstanceCycle-140] + _ = x[InvalidUnion-141] + _ = x[MisplacedConstraintIface-142] + _ = x[InvalidMethodTypeParams-143] + _ = x[MisplacedTypeParam-144] + _ = x[InvalidUnsafeSliceData-145] + _ = x[InvalidUnsafeString-146] +} + +const ( + _ErrorCode_name_0 = "InvalidSyntaxTree" + _ErrorCode_name_1 = "TestBlankPkgNameMismatchedPkgNameInvalidPkgUseBadImportPathBrokenImportImportCRenamedUnusedImportInvalidInitCycleDuplicateDeclInvalidDeclCycleInvalidTypeCycleInvalidConstInitInvalidConstValInvalidConstTypeUntypedNilUseWrongAssignCountUnassignableOperandNoNewVarMultiValAssignOpInvalidIfaceAssignInvalidChanAssignIncompatibleAssignUnaddressableFieldAssignNotATypeInvalidArrayLenBlankIfaceMethodIncomparableMapKeyInvalidIfaceEmbedInvalidPtrEmbedBadRecvInvalidRecvDuplicateFieldAndMethodDuplicateMethodInvalidBlankInvalidIotaMissingInitBodyInvalidInitSigInvalidInitDeclInvalidMainDeclTooManyValuesNotAnExprTruncatedFloatNumericOverflowUndefinedOpMismatchedTypesDivByZeroNonNumericIncDecUnaddressableOperandInvalidIndirectionNonIndexableOperandInvalidIndexSwappedSliceIndicesNonSliceableOperandInvalidSliceExprInvalidShiftCountInvalidShiftOperandInvalidReceiveInvalidSendDuplicateLitKeyMissingLitKeyInvalidLitIndexOversizeArrayLitMixedStructLitInvalidStructLitMissingLitFieldDuplicateLitFieldUnexportedLitFieldInvalidLitFieldUntypedLitInvalidLitAmbiguousSelectorUndeclaredImportedNameUnexportedNameUndeclaredNameMissingFieldOrMethodBadDotDotDotSyntaxNonVariadicDotDotDotMisplacedDotDotDotInvalidDotDotDotOperandInvalidDotDotDotUncalledBuiltinInvalidAppendInvalidCapInvalidCloseInvalidCopyInvalidComplexInvalidDeleteInvalidImagInvalidLenSwappedMakeArgsInvalidMakeInvalidRealInvalidAssertImpossibleAssertInvalidConversionInvalidUntypedConversionBadOffsetofSyntaxInvalidOffsetofUnusedExprUnusedVarMissingReturnWrongResultCountOutOfScopeResultInvalidCondInvalidPostDeclInvalidChanRangeInvalidIterVarInvalidRangeExprMisplacedBreakMisplacedContinueMisplacedFallthroughDuplicateCaseDuplicateDefaultBadTypeKeywordInvalidTypeSwitchInvalidExprSwitchInvalidSelectCaseUndeclaredLabelDuplicateLabelMisplacedLabelUnusedLabelJumpOverDeclJumpIntoBlockInvalidMethodExprWrongArgCountInvalidCallUnusedResultsInvalidDeferInvalidGoBadDeclRepeatedDeclInvalidUnsafeAddInvalidUnsafeSliceUnsupportedFeatureNotAGenericTypeWrongTypeArgCountCannotInferTypeArgsInvalidTypeArgInvalidInstanceCycleInvalidUnionMisplacedConstraintIfaceInvalidMethodTypeParamsMisplacedTypeParamInvalidUnsafeSliceDataInvalidUnsafeString" +) + +var ( + _ErrorCode_index_1 = [...]uint16{0, 4, 16, 33, 46, 59, 71, 85, 97, 113, 126, 142, 158, 174, 189, 205, 218, 234, 253, 261, 277, 295, 312, 330, 354, 362, 377, 393, 411, 428, 443, 450, 461, 484, 499, 511, 522, 537, 551, 566, 581, 594, 603, 617, 632, 643, 658, 667, 683, 703, 721, 740, 752, 771, 790, 806, 823, 842, 856, 867, 882, 895, 910, 926, 940, 956, 971, 988, 1006, 1021, 1031, 1041, 1058, 1080, 1094, 1108, 1128, 1146, 1166, 1184, 1207, 1223, 1238, 1251, 1261, 1273, 1284, 1298, 1311, 1322, 1332, 1347, 1358, 1369, 1382, 1398, 1415, 1439, 1456, 1471, 1481, 1490, 1503, 1519, 1535, 1546, 1561, 1577, 1591, 1607, 1621, 1638, 1658, 1671, 1687, 1701, 1718, 1735, 1752, 1767, 1781, 1795, 1806, 1818, 1831, 1848, 1861, 1872, 1885, 1897, 1906, 1913, 1925, 1941, 1959, 1977, 1992, 2009, 2028, 2042, 2062, 2074, 2098, 2121, 2139, 2161, 2180} +) + +func (i ErrorCode) String() string { + switch { + case i == -1: + return _ErrorCode_name_0 + case 1 <= i && i <= 146: + i -= 1 + return _ErrorCode_name_1[_ErrorCode_index_1[i]:_ErrorCode_index_1[i+1]] + default: + return "ErrorCode(" + strconv.FormatInt(int64(i), 10) + ")" + } +} diff --git a/vendor/golang.org/x/tools/internal/typesinternal/types.go b/vendor/golang.org/x/tools/internal/typesinternal/types.go new file mode 100644 index 000000000..66e8b099b --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typesinternal/types.go @@ -0,0 +1,68 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package typesinternal provides access to internal go/types APIs that are not +// yet exported. +package typesinternal + +import ( + "go/token" + "go/types" + "reflect" + "unsafe" + + "golang.org/x/tools/go/types/objectpath" +) + +func SetUsesCgo(conf *types.Config) bool { + v := reflect.ValueOf(conf).Elem() + + f := v.FieldByName("go115UsesCgo") + if !f.IsValid() { + f = v.FieldByName("UsesCgo") + if !f.IsValid() { + return false + } + } + + addr := unsafe.Pointer(f.UnsafeAddr()) + *(*bool)(addr) = true + + return true +} + +// ReadGo116ErrorData extracts additional information from types.Error values +// generated by Go version 1.16 and later: the error code, start position, and +// end position. If all positions are valid, start <= err.Pos <= end. +// +// If the data could not be read, the final result parameter will be false. +func ReadGo116ErrorData(err types.Error) (code ErrorCode, start, end token.Pos, ok bool) { + var data [3]int + // By coincidence all of these fields are ints, which simplifies things. + v := reflect.ValueOf(err) + for i, name := range []string{"go116code", "go116start", "go116end"} { + f := v.FieldByName(name) + if !f.IsValid() { + return 0, 0, 0, false + } + data[i] = int(f.Int()) + } + return ErrorCode(data[0]), token.Pos(data[1]), token.Pos(data[2]), true +} + +var SetGoVersion = func(conf *types.Config, version string) bool { return false } + +// SkipEncoderMethodSorting marks the encoder as not requiring sorted methods, +// as an optimization for gopls (which guarantees the order of parsed source files). +// +// TODO(golang/go#61443): eliminate this parameter one way or the other. +// +//go:linkname SkipEncoderMethodSorting golang.org/x/tools/go/types/objectpath.skipMethodSorting +func SkipEncoderMethodSorting(enc *objectpath.Encoder) + +// ObjectpathObject is like objectpath.Object, but allows suppressing method +// sorting (which is not necessary for gopls). +// +//go:linkname ObjectpathObject golang.org/x/tools/go/types/objectpath.object +func ObjectpathObject(pkg *types.Package, p objectpath.Path, skipMethodSorting bool) (types.Object, error) diff --git a/vendor/golang.org/x/tools/internal/typesinternal/types_118.go b/vendor/golang.org/x/tools/internal/typesinternal/types_118.go new file mode 100644 index 000000000..a42b072a6 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typesinternal/types_118.go @@ -0,0 +1,19 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 +// +build go1.18 + +package typesinternal + +import ( + "go/types" +) + +func init() { + SetGoVersion = func(conf *types.Config, version string) bool { + conf.GoVersion = version + return true + } +} diff --git a/vendor/google.golang.org/appengine/internal/api.go b/vendor/google.golang.org/appengine/internal/api.go index 721053c20..0569f5dd4 100644 --- a/vendor/google.golang.org/appengine/internal/api.go +++ b/vendor/google.golang.org/appengine/internal/api.go @@ -2,12 +2,14 @@ // Use of this source code is governed by the Apache 2.0 // license that can be found in the LICENSE file. +//go:build !appengine // +build !appengine package internal import ( "bytes" + "context" "errors" "fmt" "io/ioutil" @@ -24,7 +26,6 @@ import ( "time" "github.com/golang/protobuf/proto" - netcontext "golang.org/x/net/context" basepb "google.golang.org/appengine/internal/base" logpb "google.golang.org/appengine/internal/log" @@ -32,8 +33,7 @@ import ( ) const ( - apiPath = "/rpc_http" - defaultTicketSuffix = "/default.20150612t184001.0" + apiPath = "/rpc_http" ) var ( @@ -65,21 +65,22 @@ var ( IdleConnTimeout: 90 * time.Second, }, } - - defaultTicketOnce sync.Once - defaultTicket string - backgroundContextOnce sync.Once - backgroundContext netcontext.Context ) -func apiURL() *url.URL { +func apiURL(ctx context.Context) *url.URL { host, port := "appengine.googleapis.internal", "10001" if h := os.Getenv("API_HOST"); h != "" { host = h } + if hostOverride := ctx.Value(apiHostOverrideKey); hostOverride != nil { + host = hostOverride.(string) + } if p := os.Getenv("API_PORT"); p != "" { port = p } + if portOverride := ctx.Value(apiPortOverrideKey); portOverride != nil { + port = portOverride.(string) + } return &url.URL{ Scheme: "http", Host: host + ":" + port, @@ -87,82 +88,97 @@ func apiURL() *url.URL { } } -func handleHTTP(w http.ResponseWriter, r *http.Request) { - c := &context{ - req: r, - outHeader: w.Header(), - apiURL: apiURL(), - } - r = r.WithContext(withContext(r.Context(), c)) - c.req = r - - stopFlushing := make(chan int) +// Middleware wraps an http handler so that it can make GAE API calls +func Middleware(next http.Handler) http.Handler { + return handleHTTPMiddleware(executeRequestSafelyMiddleware(next)) +} - // Patch up RemoteAddr so it looks reasonable. - if addr := r.Header.Get(userIPHeader); addr != "" { - r.RemoteAddr = addr - } else if addr = r.Header.Get(remoteAddrHeader); addr != "" { - r.RemoteAddr = addr - } else { - // Should not normally reach here, but pick a sensible default anyway. - r.RemoteAddr = "127.0.0.1" - } - // The address in the headers will most likely be of these forms: - // 123.123.123.123 - // 2001:db8::1 - // net/http.Request.RemoteAddr is specified to be in "IP:port" form. - if _, _, err := net.SplitHostPort(r.RemoteAddr); err != nil { - // Assume the remote address is only a host; add a default port. - r.RemoteAddr = net.JoinHostPort(r.RemoteAddr, "80") - } +func handleHTTPMiddleware(next http.Handler) http.Handler { + return http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) { + c := &aeContext{ + req: r, + outHeader: w.Header(), + } + r = r.WithContext(withContext(r.Context(), c)) + c.req = r + + stopFlushing := make(chan int) + + // Patch up RemoteAddr so it looks reasonable. + if addr := r.Header.Get(userIPHeader); addr != "" { + r.RemoteAddr = addr + } else if addr = r.Header.Get(remoteAddrHeader); addr != "" { + r.RemoteAddr = addr + } else { + // Should not normally reach here, but pick a sensible default anyway. + r.RemoteAddr = "127.0.0.1" + } + // The address in the headers will most likely be of these forms: + // 123.123.123.123 + // 2001:db8::1 + // net/http.Request.RemoteAddr is specified to be in "IP:port" form. + if _, _, err := net.SplitHostPort(r.RemoteAddr); err != nil { + // Assume the remote address is only a host; add a default port. + r.RemoteAddr = net.JoinHostPort(r.RemoteAddr, "80") + } - // Start goroutine responsible for flushing app logs. - // This is done after adding c to ctx.m (and stopped before removing it) - // because flushing logs requires making an API call. - go c.logFlusher(stopFlushing) + if logToLogservice() { + // Start goroutine responsible for flushing app logs. + // This is done after adding c to ctx.m (and stopped before removing it) + // because flushing logs requires making an API call. + go c.logFlusher(stopFlushing) + } - executeRequestSafely(c, r) - c.outHeader = nil // make sure header changes aren't respected any more + next.ServeHTTP(c, r) + c.outHeader = nil // make sure header changes aren't respected any more - stopFlushing <- 1 // any logging beyond this point will be dropped + flushed := make(chan struct{}) + if logToLogservice() { + stopFlushing <- 1 // any logging beyond this point will be dropped - // Flush any pending logs asynchronously. - c.pendingLogs.Lock() - flushes := c.pendingLogs.flushes - if len(c.pendingLogs.lines) > 0 { - flushes++ - } - c.pendingLogs.Unlock() - flushed := make(chan struct{}) - go func() { - defer close(flushed) - // Force a log flush, because with very short requests we - // may not ever flush logs. - c.flushLog(true) - }() - w.Header().Set(logFlushHeader, strconv.Itoa(flushes)) + // Flush any pending logs asynchronously. + c.pendingLogs.Lock() + flushes := c.pendingLogs.flushes + if len(c.pendingLogs.lines) > 0 { + flushes++ + } + c.pendingLogs.Unlock() + go func() { + defer close(flushed) + // Force a log flush, because with very short requests we + // may not ever flush logs. + c.flushLog(true) + }() + w.Header().Set(logFlushHeader, strconv.Itoa(flushes)) + } - // Avoid nil Write call if c.Write is never called. - if c.outCode != 0 { - w.WriteHeader(c.outCode) - } - if c.outBody != nil { - w.Write(c.outBody) - } - // Wait for the last flush to complete before returning, - // otherwise the security ticket will not be valid. - <-flushed + // Avoid nil Write call if c.Write is never called. + if c.outCode != 0 { + w.WriteHeader(c.outCode) + } + if c.outBody != nil { + w.Write(c.outBody) + } + if logToLogservice() { + // Wait for the last flush to complete before returning, + // otherwise the security ticket will not be valid. + <-flushed + } + }) } -func executeRequestSafely(c *context, r *http.Request) { - defer func() { - if x := recover(); x != nil { - logf(c, 4, "%s", renderPanic(x)) // 4 == critical - c.outCode = 500 - } - }() +func executeRequestSafelyMiddleware(next http.Handler) http.Handler { + return http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) { + defer func() { + if x := recover(); x != nil { + c := w.(*aeContext) + logf(c, 4, "%s", renderPanic(x)) // 4 == critical + c.outCode = 500 + } + }() - http.DefaultServeMux.ServeHTTP(c, r) + next.ServeHTTP(w, r) + }) } func renderPanic(x interface{}) string { @@ -204,9 +220,9 @@ func renderPanic(x interface{}) string { return string(buf) } -// context represents the context of an in-flight HTTP request. +// aeContext represents the aeContext of an in-flight HTTP request. // It implements the appengine.Context and http.ResponseWriter interfaces. -type context struct { +type aeContext struct { req *http.Request outCode int @@ -218,8 +234,6 @@ type context struct { lines []*logpb.UserAppLogLine flushes int } - - apiURL *url.URL } var contextKey = "holds a *context" @@ -227,8 +241,8 @@ var contextKey = "holds a *context" // jointContext joins two contexts in a superficial way. // It takes values and timeouts from a base context, and only values from another context. type jointContext struct { - base netcontext.Context - valuesOnly netcontext.Context + base context.Context + valuesOnly context.Context } func (c jointContext) Deadline() (time.Time, bool) { @@ -252,94 +266,54 @@ func (c jointContext) Value(key interface{}) interface{} { // fromContext returns the App Engine context or nil if ctx is not // derived from an App Engine context. -func fromContext(ctx netcontext.Context) *context { - c, _ := ctx.Value(&contextKey).(*context) +func fromContext(ctx context.Context) *aeContext { + c, _ := ctx.Value(&contextKey).(*aeContext) return c } -func withContext(parent netcontext.Context, c *context) netcontext.Context { - ctx := netcontext.WithValue(parent, &contextKey, c) +func withContext(parent context.Context, c *aeContext) context.Context { + ctx := context.WithValue(parent, &contextKey, c) if ns := c.req.Header.Get(curNamespaceHeader); ns != "" { ctx = withNamespace(ctx, ns) } return ctx } -func toContext(c *context) netcontext.Context { - return withContext(netcontext.Background(), c) +func toContext(c *aeContext) context.Context { + return withContext(context.Background(), c) } -func IncomingHeaders(ctx netcontext.Context) http.Header { +func IncomingHeaders(ctx context.Context) http.Header { if c := fromContext(ctx); c != nil { return c.req.Header } return nil } -func ReqContext(req *http.Request) netcontext.Context { +func ReqContext(req *http.Request) context.Context { return req.Context() } -func WithContext(parent netcontext.Context, req *http.Request) netcontext.Context { +func WithContext(parent context.Context, req *http.Request) context.Context { return jointContext{ base: parent, valuesOnly: req.Context(), } } -// DefaultTicket returns a ticket used for background context or dev_appserver. -func DefaultTicket() string { - defaultTicketOnce.Do(func() { - if IsDevAppServer() { - defaultTicket = "testapp" + defaultTicketSuffix - return - } - appID := partitionlessAppID() - escAppID := strings.Replace(strings.Replace(appID, ":", "_", -1), ".", "_", -1) - majVersion := VersionID(nil) - if i := strings.Index(majVersion, "."); i > 0 { - majVersion = majVersion[:i] - } - defaultTicket = fmt.Sprintf("%s/%s.%s.%s", escAppID, ModuleName(nil), majVersion, InstanceID()) - }) - return defaultTicket -} - -func BackgroundContext() netcontext.Context { - backgroundContextOnce.Do(func() { - // Compute background security ticket. - ticket := DefaultTicket() - - c := &context{ - req: &http.Request{ - Header: http.Header{ - ticketHeader: []string{ticket}, - }, - }, - apiURL: apiURL(), - } - backgroundContext = toContext(c) - - // TODO(dsymonds): Wire up the shutdown handler to do a final flush. - go c.logFlusher(make(chan int)) - }) - - return backgroundContext -} - // RegisterTestRequest registers the HTTP request req for testing, such that -// any API calls are sent to the provided URL. It returns a closure to delete -// the registration. +// any API calls are sent to the provided URL. // It should only be used by aetest package. -func RegisterTestRequest(req *http.Request, apiURL *url.URL, decorate func(netcontext.Context) netcontext.Context) (*http.Request, func()) { - c := &context{ - req: req, - apiURL: apiURL, - } - ctx := withContext(decorate(req.Context()), c) - req = req.WithContext(ctx) - c.req = req - return req, func() {} +func RegisterTestRequest(req *http.Request, apiURL *url.URL, appID string) *http.Request { + ctx := req.Context() + ctx = withAPIHostOverride(ctx, apiURL.Hostname()) + ctx = withAPIPortOverride(ctx, apiURL.Port()) + ctx = WithAppIDOverride(ctx, appID) + + // use the unregistered request as a placeholder so that withContext can read the headers + c := &aeContext{req: req} + c.req = req.WithContext(withContext(ctx, c)) + return c.req } var errTimeout = &CallError{ @@ -348,7 +322,7 @@ var errTimeout = &CallError{ Timeout: true, } -func (c *context) Header() http.Header { return c.outHeader } +func (c *aeContext) Header() http.Header { return c.outHeader } // Copied from $GOROOT/src/pkg/net/http/transfer.go. Some response status // codes do not permit a response body (nor response entity headers such as @@ -365,7 +339,7 @@ func bodyAllowedForStatus(status int) bool { return true } -func (c *context) Write(b []byte) (int, error) { +func (c *aeContext) Write(b []byte) (int, error) { if c.outCode == 0 { c.WriteHeader(http.StatusOK) } @@ -376,7 +350,7 @@ func (c *context) Write(b []byte) (int, error) { return len(b), nil } -func (c *context) WriteHeader(code int) { +func (c *aeContext) WriteHeader(code int) { if c.outCode != 0 { logf(c, 3, "WriteHeader called multiple times on request.") // error level return @@ -384,10 +358,11 @@ func (c *context) WriteHeader(code int) { c.outCode = code } -func (c *context) post(body []byte, timeout time.Duration) (b []byte, err error) { +func post(ctx context.Context, body []byte, timeout time.Duration) (b []byte, err error) { + apiURL := apiURL(ctx) hreq := &http.Request{ Method: "POST", - URL: c.apiURL, + URL: apiURL, Header: http.Header{ apiEndpointHeader: apiEndpointHeaderValue, apiMethodHeader: apiMethodHeaderValue, @@ -396,13 +371,16 @@ func (c *context) post(body []byte, timeout time.Duration) (b []byte, err error) }, Body: ioutil.NopCloser(bytes.NewReader(body)), ContentLength: int64(len(body)), - Host: c.apiURL.Host, - } - if info := c.req.Header.Get(dapperHeader); info != "" { - hreq.Header.Set(dapperHeader, info) + Host: apiURL.Host, } - if info := c.req.Header.Get(traceHeader); info != "" { - hreq.Header.Set(traceHeader, info) + c := fromContext(ctx) + if c != nil { + if info := c.req.Header.Get(dapperHeader); info != "" { + hreq.Header.Set(dapperHeader, info) + } + if info := c.req.Header.Get(traceHeader); info != "" { + hreq.Header.Set(traceHeader, info) + } } tr := apiHTTPClient.Transport.(*http.Transport) @@ -444,7 +422,7 @@ func (c *context) post(body []byte, timeout time.Duration) (b []byte, err error) return hrespBody, nil } -func Call(ctx netcontext.Context, service, method string, in, out proto.Message) error { +func Call(ctx context.Context, service, method string, in, out proto.Message) error { if ns := NamespaceFromContext(ctx); ns != "" { if fn, ok := NamespaceMods[service]; ok { fn(in, ns) @@ -463,15 +441,11 @@ func Call(ctx netcontext.Context, service, method string, in, out proto.Message) } c := fromContext(ctx) - if c == nil { - // Give a good error message rather than a panic lower down. - return errNotAppEngineContext - } // Apply transaction modifications if we're in a transaction. if t := transactionFromContext(ctx); t != nil { if t.finished { - return errors.New("transaction context has expired") + return errors.New("transaction aeContext has expired") } applyTransaction(in, &t.transaction) } @@ -487,20 +461,13 @@ func Call(ctx netcontext.Context, service, method string, in, out proto.Message) return err } - ticket := c.req.Header.Get(ticketHeader) - // Use a test ticket under test environment. - if ticket == "" { - if appid := ctx.Value(&appIDOverrideKey); appid != nil { - ticket = appid.(string) + defaultTicketSuffix + ticket := "" + if c != nil { + ticket = c.req.Header.Get(ticketHeader) + if dri := c.req.Header.Get(devRequestIdHeader); IsDevAppServer() && dri != "" { + ticket = dri } } - // Fall back to use background ticket when the request ticket is not available in Flex or dev_appserver. - if ticket == "" { - ticket = DefaultTicket() - } - if dri := c.req.Header.Get(devRequestIdHeader); IsDevAppServer() && dri != "" { - ticket = dri - } req := &remotepb.Request{ ServiceName: &service, Method: &method, @@ -512,7 +479,7 @@ func Call(ctx netcontext.Context, service, method string, in, out proto.Message) return err } - hrespBody, err := c.post(hreqBody, timeout) + hrespBody, err := post(ctx, hreqBody, timeout) if err != nil { return err } @@ -549,11 +516,11 @@ func Call(ctx netcontext.Context, service, method string, in, out proto.Message) return proto.Unmarshal(res.Response, out) } -func (c *context) Request() *http.Request { +func (c *aeContext) Request() *http.Request { return c.req } -func (c *context) addLogLine(ll *logpb.UserAppLogLine) { +func (c *aeContext) addLogLine(ll *logpb.UserAppLogLine) { // Truncate long log lines. // TODO(dsymonds): Check if this is still necessary. const lim = 8 << 10 @@ -575,18 +542,20 @@ var logLevelName = map[int64]string{ 4: "CRITICAL", } -func logf(c *context, level int64, format string, args ...interface{}) { +func logf(c *aeContext, level int64, format string, args ...interface{}) { if c == nil { - panic("not an App Engine context") + panic("not an App Engine aeContext") } s := fmt.Sprintf(format, args...) s = strings.TrimRight(s, "\n") // Remove any trailing newline characters. - c.addLogLine(&logpb.UserAppLogLine{ - TimestampUsec: proto.Int64(time.Now().UnixNano() / 1e3), - Level: &level, - Message: &s, - }) - // Only duplicate log to stderr if not running on App Engine second generation + if logToLogservice() { + c.addLogLine(&logpb.UserAppLogLine{ + TimestampUsec: proto.Int64(time.Now().UnixNano() / 1e3), + Level: &level, + Message: &s, + }) + } + // Log to stdout if not deployed if !IsSecondGen() { log.Print(logLevelName[level] + ": " + s) } @@ -594,7 +563,7 @@ func logf(c *context, level int64, format string, args ...interface{}) { // flushLog attempts to flush any pending logs to the appserver. // It should not be called concurrently. -func (c *context) flushLog(force bool) (flushed bool) { +func (c *aeContext) flushLog(force bool) (flushed bool) { c.pendingLogs.Lock() // Grab up to 30 MB. We can get away with up to 32 MB, but let's be cautious. n, rem := 0, 30<<20 @@ -655,7 +624,7 @@ const ( forceFlushInterval = 60 * time.Second ) -func (c *context) logFlusher(stop <-chan int) { +func (c *aeContext) logFlusher(stop <-chan int) { lastFlush := time.Now() tick := time.NewTicker(flushInterval) for { @@ -673,6 +642,12 @@ func (c *context) logFlusher(stop <-chan int) { } } -func ContextForTesting(req *http.Request) netcontext.Context { - return toContext(&context{req: req}) +func ContextForTesting(req *http.Request) context.Context { + return toContext(&aeContext{req: req}) +} + +func logToLogservice() bool { + // TODO: replace logservice with json structured logs to $LOG_DIR/app.log.json + // where $LOG_DIR is /var/log in prod and some tmpdir in dev + return os.Getenv("LOG_TO_LOGSERVICE") != "0" } diff --git a/vendor/google.golang.org/appengine/internal/api_classic.go b/vendor/google.golang.org/appengine/internal/api_classic.go index f0f40b2e3..87c33c798 100644 --- a/vendor/google.golang.org/appengine/internal/api_classic.go +++ b/vendor/google.golang.org/appengine/internal/api_classic.go @@ -2,11 +2,13 @@ // Use of this source code is governed by the Apache 2.0 // license that can be found in the LICENSE file. +//go:build appengine // +build appengine package internal import ( + "context" "errors" "fmt" "net/http" @@ -17,20 +19,19 @@ import ( basepb "appengine_internal/base" "github.com/golang/protobuf/proto" - netcontext "golang.org/x/net/context" ) var contextKey = "holds an appengine.Context" // fromContext returns the App Engine context or nil if ctx is not // derived from an App Engine context. -func fromContext(ctx netcontext.Context) appengine.Context { +func fromContext(ctx context.Context) appengine.Context { c, _ := ctx.Value(&contextKey).(appengine.Context) return c } // This is only for classic App Engine adapters. -func ClassicContextFromContext(ctx netcontext.Context) (appengine.Context, error) { +func ClassicContextFromContext(ctx context.Context) (appengine.Context, error) { c := fromContext(ctx) if c == nil { return nil, errNotAppEngineContext @@ -38,8 +39,8 @@ func ClassicContextFromContext(ctx netcontext.Context) (appengine.Context, error return c, nil } -func withContext(parent netcontext.Context, c appengine.Context) netcontext.Context { - ctx := netcontext.WithValue(parent, &contextKey, c) +func withContext(parent context.Context, c appengine.Context) context.Context { + ctx := context.WithValue(parent, &contextKey, c) s := &basepb.StringProto{} c.Call("__go__", "GetNamespace", &basepb.VoidProto{}, s, nil) @@ -50,7 +51,7 @@ func withContext(parent netcontext.Context, c appengine.Context) netcontext.Cont return ctx } -func IncomingHeaders(ctx netcontext.Context) http.Header { +func IncomingHeaders(ctx context.Context) http.Header { if c := fromContext(ctx); c != nil { if req, ok := c.Request().(*http.Request); ok { return req.Header @@ -59,11 +60,11 @@ func IncomingHeaders(ctx netcontext.Context) http.Header { return nil } -func ReqContext(req *http.Request) netcontext.Context { - return WithContext(netcontext.Background(), req) +func ReqContext(req *http.Request) context.Context { + return WithContext(context.Background(), req) } -func WithContext(parent netcontext.Context, req *http.Request) netcontext.Context { +func WithContext(parent context.Context, req *http.Request) context.Context { c := appengine.NewContext(req) return withContext(parent, c) } @@ -83,11 +84,11 @@ func (t *testingContext) Call(service, method string, _, _ appengine_internal.Pr } func (t *testingContext) Request() interface{} { return t.req } -func ContextForTesting(req *http.Request) netcontext.Context { - return withContext(netcontext.Background(), &testingContext{req: req}) +func ContextForTesting(req *http.Request) context.Context { + return withContext(context.Background(), &testingContext{req: req}) } -func Call(ctx netcontext.Context, service, method string, in, out proto.Message) error { +func Call(ctx context.Context, service, method string, in, out proto.Message) error { if ns := NamespaceFromContext(ctx); ns != "" { if fn, ok := NamespaceMods[service]; ok { fn(in, ns) @@ -144,8 +145,8 @@ func Call(ctx netcontext.Context, service, method string, in, out proto.Message) return err } -func handleHTTP(w http.ResponseWriter, r *http.Request) { - panic("handleHTTP called; this should be impossible") +func Middleware(next http.Handler) http.Handler { + panic("Middleware called; this should be impossible") } func logf(c appengine.Context, level int64, format string, args ...interface{}) { diff --git a/vendor/google.golang.org/appengine/internal/api_common.go b/vendor/google.golang.org/appengine/internal/api_common.go index e0c0b214b..5b95c13d9 100644 --- a/vendor/google.golang.org/appengine/internal/api_common.go +++ b/vendor/google.golang.org/appengine/internal/api_common.go @@ -5,20 +5,26 @@ package internal import ( + "context" "errors" "os" "github.com/golang/protobuf/proto" - netcontext "golang.org/x/net/context" ) +type ctxKey string + +func (c ctxKey) String() string { + return "appengine context key: " + string(c) +} + var errNotAppEngineContext = errors.New("not an App Engine context") -type CallOverrideFunc func(ctx netcontext.Context, service, method string, in, out proto.Message) error +type CallOverrideFunc func(ctx context.Context, service, method string, in, out proto.Message) error var callOverrideKey = "holds []CallOverrideFunc" -func WithCallOverride(ctx netcontext.Context, f CallOverrideFunc) netcontext.Context { +func WithCallOverride(ctx context.Context, f CallOverrideFunc) context.Context { // We avoid appending to any existing call override // so we don't risk overwriting a popped stack below. var cofs []CallOverrideFunc @@ -26,10 +32,10 @@ func WithCallOverride(ctx netcontext.Context, f CallOverrideFunc) netcontext.Con cofs = append(cofs, uf...) } cofs = append(cofs, f) - return netcontext.WithValue(ctx, &callOverrideKey, cofs) + return context.WithValue(ctx, &callOverrideKey, cofs) } -func callOverrideFromContext(ctx netcontext.Context) (CallOverrideFunc, netcontext.Context, bool) { +func callOverrideFromContext(ctx context.Context) (CallOverrideFunc, context.Context, bool) { cofs, _ := ctx.Value(&callOverrideKey).([]CallOverrideFunc) if len(cofs) == 0 { return nil, nil, false @@ -37,7 +43,7 @@ func callOverrideFromContext(ctx netcontext.Context) (CallOverrideFunc, netconte // We found a list of overrides; grab the last, and reconstitute a // context that will hide it. f := cofs[len(cofs)-1] - ctx = netcontext.WithValue(ctx, &callOverrideKey, cofs[:len(cofs)-1]) + ctx = context.WithValue(ctx, &callOverrideKey, cofs[:len(cofs)-1]) return f, ctx, true } @@ -45,23 +51,35 @@ type logOverrideFunc func(level int64, format string, args ...interface{}) var logOverrideKey = "holds a logOverrideFunc" -func WithLogOverride(ctx netcontext.Context, f logOverrideFunc) netcontext.Context { - return netcontext.WithValue(ctx, &logOverrideKey, f) +func WithLogOverride(ctx context.Context, f logOverrideFunc) context.Context { + return context.WithValue(ctx, &logOverrideKey, f) } var appIDOverrideKey = "holds a string, being the full app ID" -func WithAppIDOverride(ctx netcontext.Context, appID string) netcontext.Context { - return netcontext.WithValue(ctx, &appIDOverrideKey, appID) +func WithAppIDOverride(ctx context.Context, appID string) context.Context { + return context.WithValue(ctx, &appIDOverrideKey, appID) +} + +var apiHostOverrideKey = ctxKey("holds a string, being the alternate API_HOST") + +func withAPIHostOverride(ctx context.Context, apiHost string) context.Context { + return context.WithValue(ctx, apiHostOverrideKey, apiHost) +} + +var apiPortOverrideKey = ctxKey("holds a string, being the alternate API_PORT") + +func withAPIPortOverride(ctx context.Context, apiPort string) context.Context { + return context.WithValue(ctx, apiPortOverrideKey, apiPort) } var namespaceKey = "holds the namespace string" -func withNamespace(ctx netcontext.Context, ns string) netcontext.Context { - return netcontext.WithValue(ctx, &namespaceKey, ns) +func withNamespace(ctx context.Context, ns string) context.Context { + return context.WithValue(ctx, &namespaceKey, ns) } -func NamespaceFromContext(ctx netcontext.Context) string { +func NamespaceFromContext(ctx context.Context) string { // If there's no namespace, return the empty string. ns, _ := ctx.Value(&namespaceKey).(string) return ns @@ -70,14 +88,14 @@ func NamespaceFromContext(ctx netcontext.Context) string { // FullyQualifiedAppID returns the fully-qualified application ID. // This may contain a partition prefix (e.g. "s~" for High Replication apps), // or a domain prefix (e.g. "example.com:"). -func FullyQualifiedAppID(ctx netcontext.Context) string { +func FullyQualifiedAppID(ctx context.Context) string { if id, ok := ctx.Value(&appIDOverrideKey).(string); ok { return id } return fullyQualifiedAppID(ctx) } -func Logf(ctx netcontext.Context, level int64, format string, args ...interface{}) { +func Logf(ctx context.Context, level int64, format string, args ...interface{}) { if f, ok := ctx.Value(&logOverrideKey).(logOverrideFunc); ok { f(level, format, args...) return @@ -90,7 +108,7 @@ func Logf(ctx netcontext.Context, level int64, format string, args ...interface{ } // NamespacedContext wraps a Context to support namespaces. -func NamespacedContext(ctx netcontext.Context, namespace string) netcontext.Context { +func NamespacedContext(ctx context.Context, namespace string) context.Context { return withNamespace(ctx, namespace) } diff --git a/vendor/google.golang.org/appengine/internal/identity.go b/vendor/google.golang.org/appengine/internal/identity.go index 9b4134e42..0f95aa91d 100644 --- a/vendor/google.golang.org/appengine/internal/identity.go +++ b/vendor/google.golang.org/appengine/internal/identity.go @@ -5,9 +5,8 @@ package internal import ( + "context" "os" - - netcontext "golang.org/x/net/context" ) var ( @@ -23,7 +22,7 @@ var ( // AppID is the implementation of the wrapper function of the same name in // ../identity.go. See that file for commentary. -func AppID(c netcontext.Context) string { +func AppID(c context.Context) string { return appID(FullyQualifiedAppID(c)) } @@ -35,7 +34,7 @@ func IsStandard() bool { return appengineStandard || IsSecondGen() } -// IsStandard is the implementation of the wrapper function of the same name in +// IsSecondGen is the implementation of the wrapper function of the same name in // ../appengine.go. See that file for commentary. func IsSecondGen() bool { // Second-gen runtimes set $GAE_ENV so we use that to check if we're on a second-gen runtime. diff --git a/vendor/google.golang.org/appengine/internal/identity_classic.go b/vendor/google.golang.org/appengine/internal/identity_classic.go index 4e979f45e..5ad3548bf 100644 --- a/vendor/google.golang.org/appengine/internal/identity_classic.go +++ b/vendor/google.golang.org/appengine/internal/identity_classic.go @@ -2,21 +2,22 @@ // Use of this source code is governed by the Apache 2.0 // license that can be found in the LICENSE file. +//go:build appengine // +build appengine package internal import ( - "appengine" + "context" - netcontext "golang.org/x/net/context" + "appengine" ) func init() { appengineStandard = true } -func DefaultVersionHostname(ctx netcontext.Context) string { +func DefaultVersionHostname(ctx context.Context) string { c := fromContext(ctx) if c == nil { panic(errNotAppEngineContext) @@ -24,12 +25,12 @@ func DefaultVersionHostname(ctx netcontext.Context) string { return appengine.DefaultVersionHostname(c) } -func Datacenter(_ netcontext.Context) string { return appengine.Datacenter() } -func ServerSoftware() string { return appengine.ServerSoftware() } -func InstanceID() string { return appengine.InstanceID() } -func IsDevAppServer() bool { return appengine.IsDevAppServer() } +func Datacenter(_ context.Context) string { return appengine.Datacenter() } +func ServerSoftware() string { return appengine.ServerSoftware() } +func InstanceID() string { return appengine.InstanceID() } +func IsDevAppServer() bool { return appengine.IsDevAppServer() } -func RequestID(ctx netcontext.Context) string { +func RequestID(ctx context.Context) string { c := fromContext(ctx) if c == nil { panic(errNotAppEngineContext) @@ -37,14 +38,14 @@ func RequestID(ctx netcontext.Context) string { return appengine.RequestID(c) } -func ModuleName(ctx netcontext.Context) string { +func ModuleName(ctx context.Context) string { c := fromContext(ctx) if c == nil { panic(errNotAppEngineContext) } return appengine.ModuleName(c) } -func VersionID(ctx netcontext.Context) string { +func VersionID(ctx context.Context) string { c := fromContext(ctx) if c == nil { panic(errNotAppEngineContext) @@ -52,7 +53,7 @@ func VersionID(ctx netcontext.Context) string { return appengine.VersionID(c) } -func fullyQualifiedAppID(ctx netcontext.Context) string { +func fullyQualifiedAppID(ctx context.Context) string { c := fromContext(ctx) if c == nil { panic(errNotAppEngineContext) diff --git a/vendor/google.golang.org/appengine/internal/identity_flex.go b/vendor/google.golang.org/appengine/internal/identity_flex.go index d5e2e7b5e..4201b6b58 100644 --- a/vendor/google.golang.org/appengine/internal/identity_flex.go +++ b/vendor/google.golang.org/appengine/internal/identity_flex.go @@ -2,6 +2,7 @@ // Use of this source code is governed by the Apache 2.0 // license that can be found in the LICENSE file. +//go:build appenginevm // +build appenginevm package internal diff --git a/vendor/google.golang.org/appengine/internal/identity_vm.go b/vendor/google.golang.org/appengine/internal/identity_vm.go index 5d8067263..18ddda3a4 100644 --- a/vendor/google.golang.org/appengine/internal/identity_vm.go +++ b/vendor/google.golang.org/appengine/internal/identity_vm.go @@ -2,17 +2,17 @@ // Use of this source code is governed by the Apache 2.0 // license that can be found in the LICENSE file. +//go:build !appengine // +build !appengine package internal import ( + "context" "log" "net/http" "os" "strings" - - netcontext "golang.org/x/net/context" ) // These functions are implementations of the wrapper functions @@ -24,7 +24,7 @@ const ( hDatacenter = "X-AppEngine-Datacenter" ) -func ctxHeaders(ctx netcontext.Context) http.Header { +func ctxHeaders(ctx context.Context) http.Header { c := fromContext(ctx) if c == nil { return nil @@ -32,15 +32,15 @@ func ctxHeaders(ctx netcontext.Context) http.Header { return c.Request().Header } -func DefaultVersionHostname(ctx netcontext.Context) string { +func DefaultVersionHostname(ctx context.Context) string { return ctxHeaders(ctx).Get(hDefaultVersionHostname) } -func RequestID(ctx netcontext.Context) string { +func RequestID(ctx context.Context) string { return ctxHeaders(ctx).Get(hRequestLogId) } -func Datacenter(ctx netcontext.Context) string { +func Datacenter(ctx context.Context) string { if dc := ctxHeaders(ctx).Get(hDatacenter); dc != "" { return dc } @@ -71,7 +71,7 @@ func ServerSoftware() string { // TODO(dsymonds): Remove the metadata fetches. -func ModuleName(_ netcontext.Context) string { +func ModuleName(_ context.Context) string { if s := os.Getenv("GAE_MODULE_NAME"); s != "" { return s } @@ -81,7 +81,7 @@ func ModuleName(_ netcontext.Context) string { return string(mustGetMetadata("instance/attributes/gae_backend_name")) } -func VersionID(_ netcontext.Context) string { +func VersionID(_ context.Context) string { if s1, s2 := os.Getenv("GAE_MODULE_VERSION"), os.Getenv("GAE_MINOR_VERSION"); s1 != "" && s2 != "" { return s1 + "." + s2 } @@ -112,7 +112,7 @@ func partitionlessAppID() string { return string(mustGetMetadata("instance/attributes/gae_project")) } -func fullyQualifiedAppID(_ netcontext.Context) string { +func fullyQualifiedAppID(_ context.Context) string { if s := os.Getenv("GAE_APPLICATION"); s != "" { return s } @@ -130,5 +130,5 @@ func fullyQualifiedAppID(_ netcontext.Context) string { } func IsDevAppServer() bool { - return os.Getenv("RUN_WITH_DEVAPPSERVER") != "" + return os.Getenv("RUN_WITH_DEVAPPSERVER") != "" || os.Getenv("GAE_ENV") == "localdev" } diff --git a/vendor/google.golang.org/appengine/internal/main.go b/vendor/google.golang.org/appengine/internal/main.go index 1e765312f..afd0ae84f 100644 --- a/vendor/google.golang.org/appengine/internal/main.go +++ b/vendor/google.golang.org/appengine/internal/main.go @@ -2,6 +2,7 @@ // Use of this source code is governed by the Apache 2.0 // license that can be found in the LICENSE file. +//go:build appengine // +build appengine package internal diff --git a/vendor/google.golang.org/appengine/internal/main_vm.go b/vendor/google.golang.org/appengine/internal/main_vm.go index ddb79a333..86a8caf06 100644 --- a/vendor/google.golang.org/appengine/internal/main_vm.go +++ b/vendor/google.golang.org/appengine/internal/main_vm.go @@ -2,6 +2,7 @@ // Use of this source code is governed by the Apache 2.0 // license that can be found in the LICENSE file. +//go:build !appengine // +build !appengine package internal @@ -29,7 +30,7 @@ func Main() { if IsDevAppServer() { host = "127.0.0.1" } - if err := http.ListenAndServe(host+":"+port, http.HandlerFunc(handleHTTP)); err != nil { + if err := http.ListenAndServe(host+":"+port, Middleware(http.DefaultServeMux)); err != nil { log.Fatalf("http.ListenAndServe: %v", err) } } diff --git a/vendor/google.golang.org/appengine/internal/transaction.go b/vendor/google.golang.org/appengine/internal/transaction.go index 9006ae653..2ae8ab9fa 100644 --- a/vendor/google.golang.org/appengine/internal/transaction.go +++ b/vendor/google.golang.org/appengine/internal/transaction.go @@ -7,11 +7,11 @@ package internal // This file implements hooks for applying datastore transactions. import ( + "context" "errors" "reflect" "github.com/golang/protobuf/proto" - netcontext "golang.org/x/net/context" basepb "google.golang.org/appengine/internal/base" pb "google.golang.org/appengine/internal/datastore" @@ -38,13 +38,13 @@ func applyTransaction(pb proto.Message, t *pb.Transaction) { var transactionKey = "used for *Transaction" -func transactionFromContext(ctx netcontext.Context) *transaction { +func transactionFromContext(ctx context.Context) *transaction { t, _ := ctx.Value(&transactionKey).(*transaction) return t } -func withTransaction(ctx netcontext.Context, t *transaction) netcontext.Context { - return netcontext.WithValue(ctx, &transactionKey, t) +func withTransaction(ctx context.Context, t *transaction) context.Context { + return context.WithValue(ctx, &transactionKey, t) } type transaction struct { @@ -54,7 +54,7 @@ type transaction struct { var ErrConcurrentTransaction = errors.New("internal: concurrent transaction") -func RunTransactionOnce(c netcontext.Context, f func(netcontext.Context) error, xg bool, readOnly bool, previousTransaction *pb.Transaction) (*pb.Transaction, error) { +func RunTransactionOnce(c context.Context, f func(context.Context) error, xg bool, readOnly bool, previousTransaction *pb.Transaction) (*pb.Transaction, error) { if transactionFromContext(c) != nil { return nil, errors.New("nested transactions are not supported") } diff --git a/vendor/google.golang.org/appengine/urlfetch/urlfetch.go b/vendor/google.golang.org/appengine/urlfetch/urlfetch.go index 6ffe1e6d9..6c0d72418 100644 --- a/vendor/google.golang.org/appengine/urlfetch/urlfetch.go +++ b/vendor/google.golang.org/appengine/urlfetch/urlfetch.go @@ -7,6 +7,7 @@ package urlfetch // import "google.golang.org/appengine/urlfetch" import ( + "context" "errors" "fmt" "io" @@ -18,7 +19,6 @@ import ( "time" "github.com/golang/protobuf/proto" - "golang.org/x/net/context" "google.golang.org/appengine/internal" pb "google.golang.org/appengine/internal/urlfetch" @@ -44,11 +44,10 @@ type Transport struct { var _ http.RoundTripper = (*Transport)(nil) // Client returns an *http.Client using a default urlfetch Transport. This -// client will have the default deadline of 5 seconds, and will check the -// validity of SSL certificates. +// client will check the validity of SSL certificates. // -// Any deadline of the provided context will be used for requests through this client; -// if the client does not have a deadline then a 5 second default is used. +// Any deadline of the provided context will be used for requests through this client. +// If the client does not have a deadline, then an App Engine default of 60 second is used. func Client(ctx context.Context) *http.Client { return &http.Client{ Transport: &Transport{ diff --git a/vendor/google.golang.org/genproto/googleapis/api/annotations/field_info.pb.go b/vendor/google.golang.org/genproto/googleapis/api/annotations/field_info.pb.go new file mode 100644 index 000000000..d02e6bbc8 --- /dev/null +++ b/vendor/google.golang.org/genproto/googleapis/api/annotations/field_info.pb.go @@ -0,0 +1,295 @@ +// Copyright 2023 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Code generated by protoc-gen-go. DO NOT EDIT. +// versions: +// protoc-gen-go v1.26.0 +// protoc v3.21.12 +// source: google/api/field_info.proto + +package annotations + +import ( + reflect "reflect" + sync "sync" + + protoreflect "google.golang.org/protobuf/reflect/protoreflect" + protoimpl "google.golang.org/protobuf/runtime/protoimpl" + descriptorpb "google.golang.org/protobuf/types/descriptorpb" +) + +const ( + // Verify that this generated code is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion) + // Verify that runtime/protoimpl is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20) +) + +// The standard format of a field value. The supported formats are all backed +// by either an RFC defined by the IETF or a Google-defined AIP. +type FieldInfo_Format int32 + +const ( + // Default, unspecified value. + FieldInfo_FORMAT_UNSPECIFIED FieldInfo_Format = 0 + // Universally Unique Identifier, version 4, value as defined by + // https://datatracker.ietf.org/doc/html/rfc4122. The value may be + // normalized to entirely lowercase letters. For example, the value + // `F47AC10B-58CC-0372-8567-0E02B2C3D479` would be normalized to + // `f47ac10b-58cc-0372-8567-0e02b2c3d479`. + FieldInfo_UUID4 FieldInfo_Format = 1 + // Internet Protocol v4 value as defined by [RFC + // 791](https://datatracker.ietf.org/doc/html/rfc791). The value may be + // condensed, with leading zeros in each octet stripped. For example, + // `001.022.233.040` would be condensed to `1.22.233.40`. + FieldInfo_IPV4 FieldInfo_Format = 2 + // Internet Protocol v6 value as defined by [RFC + // 2460](https://datatracker.ietf.org/doc/html/rfc2460). The value may be + // normalized to entirely lowercase letters, and zero-padded partial and + // empty octets. For example, the value `2001:DB8::` would be normalized to + // `2001:0db8:0:0`. + FieldInfo_IPV6 FieldInfo_Format = 3 + // An IP address in either v4 or v6 format as described by the individual + // values defined herein. See the comments on the IPV4 and IPV6 types for + // allowed normalizations of each. + FieldInfo_IPV4_OR_IPV6 FieldInfo_Format = 4 +) + +// Enum value maps for FieldInfo_Format. +var ( + FieldInfo_Format_name = map[int32]string{ + 0: "FORMAT_UNSPECIFIED", + 1: "UUID4", + 2: "IPV4", + 3: "IPV6", + 4: "IPV4_OR_IPV6", + } + FieldInfo_Format_value = map[string]int32{ + "FORMAT_UNSPECIFIED": 0, + "UUID4": 1, + "IPV4": 2, + "IPV6": 3, + "IPV4_OR_IPV6": 4, + } +) + +func (x FieldInfo_Format) Enum() *FieldInfo_Format { + p := new(FieldInfo_Format) + *p = x + return p +} + +func (x FieldInfo_Format) String() string { + return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x)) +} + +func (FieldInfo_Format) Descriptor() protoreflect.EnumDescriptor { + return file_google_api_field_info_proto_enumTypes[0].Descriptor() +} + +func (FieldInfo_Format) Type() protoreflect.EnumType { + return &file_google_api_field_info_proto_enumTypes[0] +} + +func (x FieldInfo_Format) Number() protoreflect.EnumNumber { + return protoreflect.EnumNumber(x) +} + +// Deprecated: Use FieldInfo_Format.Descriptor instead. +func (FieldInfo_Format) EnumDescriptor() ([]byte, []int) { + return file_google_api_field_info_proto_rawDescGZIP(), []int{0, 0} +} + +// Rich semantic information of an API field beyond basic typing. +type FieldInfo struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + // The standard format of a field value. This does not explicitly configure + // any API consumer, just documents the API's format for the field it is + // applied to. + Format FieldInfo_Format `protobuf:"varint,1,opt,name=format,proto3,enum=google.api.FieldInfo_Format" json:"format,omitempty"` +} + +func (x *FieldInfo) Reset() { + *x = FieldInfo{} + if protoimpl.UnsafeEnabled { + mi := &file_google_api_field_info_proto_msgTypes[0] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *FieldInfo) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*FieldInfo) ProtoMessage() {} + +func (x *FieldInfo) ProtoReflect() protoreflect.Message { + mi := &file_google_api_field_info_proto_msgTypes[0] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use FieldInfo.ProtoReflect.Descriptor instead. +func (*FieldInfo) Descriptor() ([]byte, []int) { + return file_google_api_field_info_proto_rawDescGZIP(), []int{0} +} + +func (x *FieldInfo) GetFormat() FieldInfo_Format { + if x != nil { + return x.Format + } + return FieldInfo_FORMAT_UNSPECIFIED +} + +var file_google_api_field_info_proto_extTypes = []protoimpl.ExtensionInfo{ + { + ExtendedType: (*descriptorpb.FieldOptions)(nil), + ExtensionType: (*FieldInfo)(nil), + Field: 291403980, + Name: "google.api.field_info", + Tag: "bytes,291403980,opt,name=field_info", + Filename: "google/api/field_info.proto", + }, +} + +// Extension fields to descriptorpb.FieldOptions. +var ( + // Rich semantic descriptor of an API field beyond the basic typing. + // + // Examples: + // + // string request_id = 1 [(google.api.field_info).format = UUID4]; + // string old_ip_address = 2 [(google.api.field_info).format = IPV4]; + // string new_ip_address = 3 [(google.api.field_info).format = IPV6]; + // string actual_ip_address = 4 [ + // (google.api.field_info).format = IPV4_OR_IPV6 + // ]; + // + // optional google.api.FieldInfo field_info = 291403980; + E_FieldInfo = &file_google_api_field_info_proto_extTypes[0] +) + +var File_google_api_field_info_proto protoreflect.FileDescriptor + +var file_google_api_field_info_proto_rawDesc = []byte{ + 0x0a, 0x1b, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2f, 0x61, 0x70, 0x69, 0x2f, 0x66, 0x69, 0x65, + 0x6c, 0x64, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x0a, 0x67, + 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x61, 0x70, 0x69, 0x1a, 0x20, 0x67, 0x6f, 0x6f, 0x67, 0x6c, + 0x65, 0x2f, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2f, 0x64, 0x65, 0x73, 0x63, 0x72, + 0x69, 0x70, 0x74, 0x6f, 0x72, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x94, 0x01, 0x0a, 0x09, + 0x46, 0x69, 0x65, 0x6c, 0x64, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x34, 0x0a, 0x06, 0x66, 0x6f, 0x72, + 0x6d, 0x61, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x1c, 0x2e, 0x67, 0x6f, 0x6f, 0x67, + 0x6c, 0x65, 0x2e, 0x61, 0x70, 0x69, 0x2e, 0x46, 0x69, 0x65, 0x6c, 0x64, 0x49, 0x6e, 0x66, 0x6f, + 0x2e, 0x46, 0x6f, 0x72, 0x6d, 0x61, 0x74, 0x52, 0x06, 0x66, 0x6f, 0x72, 0x6d, 0x61, 0x74, 0x22, + 0x51, 0x0a, 0x06, 0x46, 0x6f, 0x72, 0x6d, 0x61, 0x74, 0x12, 0x16, 0x0a, 0x12, 0x46, 0x4f, 0x52, + 0x4d, 0x41, 0x54, 0x5f, 0x55, 0x4e, 0x53, 0x50, 0x45, 0x43, 0x49, 0x46, 0x49, 0x45, 0x44, 0x10, + 0x00, 0x12, 0x09, 0x0a, 0x05, 0x55, 0x55, 0x49, 0x44, 0x34, 0x10, 0x01, 0x12, 0x08, 0x0a, 0x04, + 0x49, 0x50, 0x56, 0x34, 0x10, 0x02, 0x12, 0x08, 0x0a, 0x04, 0x49, 0x50, 0x56, 0x36, 0x10, 0x03, + 0x12, 0x10, 0x0a, 0x0c, 0x49, 0x50, 0x56, 0x34, 0x5f, 0x4f, 0x52, 0x5f, 0x49, 0x50, 0x56, 0x36, + 0x10, 0x04, 0x3a, 0x57, 0x0a, 0x0a, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x5f, 0x69, 0x6e, 0x66, 0x6f, + 0x12, 0x1d, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, + 0x75, 0x66, 0x2e, 0x46, 0x69, 0x65, 0x6c, 0x64, 0x4f, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, + 0xcc, 0xf1, 0xf9, 0x8a, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x15, 0x2e, 0x67, 0x6f, 0x6f, 0x67, + 0x6c, 0x65, 0x2e, 0x61, 0x70, 0x69, 0x2e, 0x46, 0x69, 0x65, 0x6c, 0x64, 0x49, 0x6e, 0x66, 0x6f, + 0x52, 0x09, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x49, 0x6e, 0x66, 0x6f, 0x42, 0x6c, 0x0a, 0x0e, 0x63, + 0x6f, 0x6d, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x61, 0x70, 0x69, 0x42, 0x0e, 0x46, + 0x69, 0x65, 0x6c, 0x64, 0x49, 0x6e, 0x66, 0x6f, 0x50, 0x72, 0x6f, 0x74, 0x6f, 0x50, 0x01, 0x5a, + 0x41, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x67, 0x6f, 0x6c, 0x61, 0x6e, 0x67, 0x2e, 0x6f, + 0x72, 0x67, 0x2f, 0x67, 0x65, 0x6e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x2f, 0x67, 0x6f, 0x6f, 0x67, + 0x6c, 0x65, 0x61, 0x70, 0x69, 0x73, 0x2f, 0x61, 0x70, 0x69, 0x2f, 0x61, 0x6e, 0x6e, 0x6f, 0x74, + 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x3b, 0x61, 0x6e, 0x6e, 0x6f, 0x74, 0x61, 0x74, 0x69, 0x6f, + 0x6e, 0x73, 0xa2, 0x02, 0x04, 0x47, 0x41, 0x50, 0x49, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, + 0x33, +} + +var ( + file_google_api_field_info_proto_rawDescOnce sync.Once + file_google_api_field_info_proto_rawDescData = file_google_api_field_info_proto_rawDesc +) + +func file_google_api_field_info_proto_rawDescGZIP() []byte { + file_google_api_field_info_proto_rawDescOnce.Do(func() { + file_google_api_field_info_proto_rawDescData = protoimpl.X.CompressGZIP(file_google_api_field_info_proto_rawDescData) + }) + return file_google_api_field_info_proto_rawDescData +} + +var file_google_api_field_info_proto_enumTypes = make([]protoimpl.EnumInfo, 1) +var file_google_api_field_info_proto_msgTypes = make([]protoimpl.MessageInfo, 1) +var file_google_api_field_info_proto_goTypes = []interface{}{ + (FieldInfo_Format)(0), // 0: google.api.FieldInfo.Format + (*FieldInfo)(nil), // 1: google.api.FieldInfo + (*descriptorpb.FieldOptions)(nil), // 2: google.protobuf.FieldOptions +} +var file_google_api_field_info_proto_depIdxs = []int32{ + 0, // 0: google.api.FieldInfo.format:type_name -> google.api.FieldInfo.Format + 2, // 1: google.api.field_info:extendee -> google.protobuf.FieldOptions + 1, // 2: google.api.field_info:type_name -> google.api.FieldInfo + 3, // [3:3] is the sub-list for method output_type + 3, // [3:3] is the sub-list for method input_type + 2, // [2:3] is the sub-list for extension type_name + 1, // [1:2] is the sub-list for extension extendee + 0, // [0:1] is the sub-list for field type_name +} + +func init() { file_google_api_field_info_proto_init() } +func file_google_api_field_info_proto_init() { + if File_google_api_field_info_proto != nil { + return + } + if !protoimpl.UnsafeEnabled { + file_google_api_field_info_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*FieldInfo); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + } + type x struct{} + out := protoimpl.TypeBuilder{ + File: protoimpl.DescBuilder{ + GoPackagePath: reflect.TypeOf(x{}).PkgPath(), + RawDescriptor: file_google_api_field_info_proto_rawDesc, + NumEnums: 1, + NumMessages: 1, + NumExtensions: 1, + NumServices: 0, + }, + GoTypes: file_google_api_field_info_proto_goTypes, + DependencyIndexes: file_google_api_field_info_proto_depIdxs, + EnumInfos: file_google_api_field_info_proto_enumTypes, + MessageInfos: file_google_api_field_info_proto_msgTypes, + ExtensionInfos: file_google_api_field_info_proto_extTypes, + }.Build() + File_google_api_field_info_proto = out.File + file_google_api_field_info_proto_rawDesc = nil + file_google_api_field_info_proto_goTypes = nil + file_google_api_field_info_proto_depIdxs = nil +} diff --git a/vendor/google.golang.org/grpc/balancer_conn_wrappers.go b/vendor/google.golang.org/grpc/balancer_wrapper.go similarity index 57% rename from vendor/google.golang.org/grpc/balancer_conn_wrappers.go rename to vendor/google.golang.org/grpc/balancer_wrapper.go index a4411c22b..b5e30cff0 100644 --- a/vendor/google.golang.org/grpc/balancer_conn_wrappers.go +++ b/vendor/google.golang.org/grpc/balancer_wrapper.go @@ -32,21 +32,13 @@ import ( "google.golang.org/grpc/resolver" ) -type ccbMode int - -const ( - ccbModeActive = iota - ccbModeIdle - ccbModeClosed - ccbModeExitingIdle -) - // ccBalancerWrapper sits between the ClientConn and the Balancer. // // ccBalancerWrapper implements methods corresponding to the ones on the // balancer.Balancer interface. The ClientConn is free to call these methods // concurrently and the ccBalancerWrapper ensures that calls from the ClientConn -// to the Balancer happen synchronously and in order. +// to the Balancer happen in order by performing them in the serializer, without +// any mutexes held. // // ccBalancerWrapper also implements the balancer.ClientConn interface and is // passed to the Balancer implementations. It invokes unexported methods on the @@ -57,87 +49,75 @@ const ( type ccBalancerWrapper struct { // The following fields are initialized when the wrapper is created and are // read-only afterwards, and therefore can be accessed without a mutex. - cc *ClientConn - opts balancer.BuildOptions + cc *ClientConn + opts balancer.BuildOptions + serializer *grpcsync.CallbackSerializer + serializerCancel context.CancelFunc - // Outgoing (gRPC --> balancer) calls are guaranteed to execute in a - // mutually exclusive manner as they are scheduled in the serializer. Fields - // accessed *only* in these serializer callbacks, can therefore be accessed - // without a mutex. - balancer *gracefulswitch.Balancer + // The following fields are only accessed within the serializer or during + // initialization. curBalancerName string + balancer *gracefulswitch.Balancer - // mu guards access to the below fields. Access to the serializer and its - // cancel function needs to be mutex protected because they are overwritten - // when the wrapper exits idle mode. - mu sync.Mutex - serializer *grpcsync.CallbackSerializer // To serialize all outoing calls. - serializerCancel context.CancelFunc // To close the seralizer at close/enterIdle time. - mode ccbMode // Tracks the current mode of the wrapper. + // The following field is protected by mu. Caller must take cc.mu before + // taking mu. + mu sync.Mutex + closed bool } -// newCCBalancerWrapper creates a new balancer wrapper. The underlying balancer -// is not created until the switchTo() method is invoked. -func newCCBalancerWrapper(cc *ClientConn, bopts balancer.BuildOptions) *ccBalancerWrapper { - ctx, cancel := context.WithCancel(context.Background()) +// newCCBalancerWrapper creates a new balancer wrapper in idle state. The +// underlying balancer is not created until the switchTo() method is invoked. +func newCCBalancerWrapper(cc *ClientConn) *ccBalancerWrapper { + ctx, cancel := context.WithCancel(cc.ctx) ccb := &ccBalancerWrapper{ - cc: cc, - opts: bopts, + cc: cc, + opts: balancer.BuildOptions{ + DialCreds: cc.dopts.copts.TransportCredentials, + CredsBundle: cc.dopts.copts.CredsBundle, + Dialer: cc.dopts.copts.Dialer, + Authority: cc.authority, + CustomUserAgent: cc.dopts.copts.UserAgent, + ChannelzParentID: cc.channelzID, + Target: cc.parsedTarget, + }, serializer: grpcsync.NewCallbackSerializer(ctx), serializerCancel: cancel, } - ccb.balancer = gracefulswitch.NewBalancer(ccb, bopts) + ccb.balancer = gracefulswitch.NewBalancer(ccb, ccb.opts) return ccb } // updateClientConnState is invoked by grpc to push a ClientConnState update to -// the underlying balancer. +// the underlying balancer. This is always executed from the serializer, so +// it is safe to call into the balancer here. func (ccb *ccBalancerWrapper) updateClientConnState(ccs *balancer.ClientConnState) error { - ccb.mu.Lock() - errCh := make(chan error, 1) - // Here and everywhere else where Schedule() is called, it is done with the - // lock held. But the lock guards only the scheduling part. The actual - // callback is called asynchronously without the lock being held. - ok := ccb.serializer.Schedule(func(_ context.Context) { - errCh <- ccb.balancer.UpdateClientConnState(*ccs) + errCh := make(chan error) + ok := ccb.serializer.Schedule(func(ctx context.Context) { + defer close(errCh) + if ctx.Err() != nil || ccb.balancer == nil { + return + } + err := ccb.balancer.UpdateClientConnState(*ccs) + if logger.V(2) && err != nil { + logger.Infof("error from balancer.UpdateClientConnState: %v", err) + } + errCh <- err }) if !ok { - // If we are unable to schedule a function with the serializer, it - // indicates that it has been closed. A serializer is only closed when - // the wrapper is closed or is in idle. - ccb.mu.Unlock() - return fmt.Errorf("grpc: cannot send state update to a closed or idle balancer") - } - ccb.mu.Unlock() - - // We get here only if the above call to Schedule succeeds, in which case it - // is guaranteed that the scheduled function will run. Therefore it is safe - // to block on this channel. - err := <-errCh - if logger.V(2) && err != nil { - logger.Infof("error from balancer.UpdateClientConnState: %v", err) + return nil } - return err -} - -// updateSubConnState is invoked by grpc to push a subConn state update to the -// underlying balancer. -func (ccb *ccBalancerWrapper) updateSubConnState(sc balancer.SubConn, s connectivity.State, err error) { - ccb.mu.Lock() - ccb.serializer.Schedule(func(_ context.Context) { - // Even though it is optional for balancers, gracefulswitch ensures - // opts.StateListener is set, so this cannot ever be nil. - sc.(*acBalancerWrapper).stateListener(balancer.SubConnState{ConnectivityState: s, ConnectionError: err}) - }) - ccb.mu.Unlock() + return <-errCh } +// resolverError is invoked by grpc to push a resolver error to the underlying +// balancer. The call to the balancer is executed from the serializer. func (ccb *ccBalancerWrapper) resolverError(err error) { - ccb.mu.Lock() - ccb.serializer.Schedule(func(_ context.Context) { + ccb.serializer.Schedule(func(ctx context.Context) { + if ctx.Err() != nil || ccb.balancer == nil { + return + } ccb.balancer.ResolverError(err) }) - ccb.mu.Unlock() } // switchTo is invoked by grpc to instruct the balancer wrapper to switch to the @@ -151,8 +131,10 @@ func (ccb *ccBalancerWrapper) resolverError(err error) { // the ccBalancerWrapper keeps track of the current LB policy name, and skips // the graceful balancer switching process if the name does not change. func (ccb *ccBalancerWrapper) switchTo(name string) { - ccb.mu.Lock() - ccb.serializer.Schedule(func(_ context.Context) { + ccb.serializer.Schedule(func(ctx context.Context) { + if ctx.Err() != nil || ccb.balancer == nil { + return + } // TODO: Other languages use case-sensitive balancer registries. We should // switch as well. See: https://github.com/grpc/grpc-go/issues/5288. if strings.EqualFold(ccb.curBalancerName, name) { @@ -160,7 +142,6 @@ func (ccb *ccBalancerWrapper) switchTo(name string) { } ccb.buildLoadBalancingPolicy(name) }) - ccb.mu.Unlock() } // buildLoadBalancingPolicy performs the following: @@ -187,115 +168,49 @@ func (ccb *ccBalancerWrapper) buildLoadBalancingPolicy(name string) { ccb.curBalancerName = builder.Name() } +// close initiates async shutdown of the wrapper. cc.mu must be held when +// calling this function. To determine the wrapper has finished shutting down, +// the channel should block on ccb.serializer.Done() without cc.mu held. func (ccb *ccBalancerWrapper) close() { - channelz.Info(logger, ccb.cc.channelzID, "ccBalancerWrapper: closing") - ccb.closeBalancer(ccbModeClosed) -} - -// enterIdleMode is invoked by grpc when the channel enters idle mode upon -// expiry of idle_timeout. This call blocks until the balancer is closed. -func (ccb *ccBalancerWrapper) enterIdleMode() { - channelz.Info(logger, ccb.cc.channelzID, "ccBalancerWrapper: entering idle mode") - ccb.closeBalancer(ccbModeIdle) -} - -// closeBalancer is invoked when the channel is being closed or when it enters -// idle mode upon expiry of idle_timeout. -func (ccb *ccBalancerWrapper) closeBalancer(m ccbMode) { ccb.mu.Lock() - if ccb.mode == ccbModeClosed || ccb.mode == ccbModeIdle { - ccb.mu.Unlock() - return - } - - ccb.mode = m - done := ccb.serializer.Done() - b := ccb.balancer - ok := ccb.serializer.Schedule(func(_ context.Context) { - // Close the serializer to ensure that no more calls from gRPC are sent - // to the balancer. - ccb.serializerCancel() - // Empty the current balancer name because we don't have a balancer - // anymore and also so that we act on the next call to switchTo by - // creating a new balancer specified by the new resolver. - ccb.curBalancerName = "" - }) - if !ok { - ccb.mu.Unlock() - return - } + ccb.closed = true ccb.mu.Unlock() - - // Give enqueued callbacks a chance to finish before closing the balancer. - <-done - b.Close() -} - -// exitIdleMode is invoked by grpc when the channel exits idle mode either -// because of an RPC or because of an invocation of the Connect() API. This -// recreates the balancer that was closed previously when entering idle mode. -// -// If the channel is not in idle mode, we know for a fact that we are here as a -// result of the user calling the Connect() method on the ClientConn. In this -// case, we can simply forward the call to the underlying balancer, instructing -// it to reconnect to the backends. -func (ccb *ccBalancerWrapper) exitIdleMode() { - ccb.mu.Lock() - if ccb.mode == ccbModeClosed { - // Request to exit idle is a no-op when wrapper is already closed. - ccb.mu.Unlock() - return - } - - if ccb.mode == ccbModeIdle { - // Recreate the serializer which was closed when we entered idle. - ctx, cancel := context.WithCancel(context.Background()) - ccb.serializer = grpcsync.NewCallbackSerializer(ctx) - ccb.serializerCancel = cancel - } - - // The ClientConn guarantees that mutual exclusion between close() and - // exitIdleMode(), and since we just created a new serializer, we can be - // sure that the below function will be scheduled. - done := make(chan struct{}) - ccb.serializer.Schedule(func(_ context.Context) { - defer close(done) - - ccb.mu.Lock() - defer ccb.mu.Unlock() - - if ccb.mode != ccbModeIdle { - ccb.balancer.ExitIdle() + channelz.Info(logger, ccb.cc.channelzID, "ccBalancerWrapper: closing") + ccb.serializer.Schedule(func(context.Context) { + if ccb.balancer == nil { return } - - // Gracefulswitch balancer does not support a switchTo operation after - // being closed. Hence we need to create a new one here. - ccb.balancer = gracefulswitch.NewBalancer(ccb, ccb.opts) - ccb.mode = ccbModeActive - channelz.Info(logger, ccb.cc.channelzID, "ccBalancerWrapper: exiting idle mode") - + ccb.balancer.Close() + ccb.balancer = nil }) - ccb.mu.Unlock() - - <-done + ccb.serializerCancel() } -func (ccb *ccBalancerWrapper) isIdleOrClosed() bool { - ccb.mu.Lock() - defer ccb.mu.Unlock() - return ccb.mode == ccbModeIdle || ccb.mode == ccbModeClosed +// exitIdle invokes the balancer's exitIdle method in the serializer. +func (ccb *ccBalancerWrapper) exitIdle() { + ccb.serializer.Schedule(func(ctx context.Context) { + if ctx.Err() != nil || ccb.balancer == nil { + return + } + ccb.balancer.ExitIdle() + }) } func (ccb *ccBalancerWrapper) NewSubConn(addrs []resolver.Address, opts balancer.NewSubConnOptions) (balancer.SubConn, error) { - if ccb.isIdleOrClosed() { - return nil, fmt.Errorf("grpc: cannot create SubConn when balancer is closed or idle") + ccb.cc.mu.Lock() + defer ccb.cc.mu.Unlock() + + ccb.mu.Lock() + if ccb.closed { + ccb.mu.Unlock() + return nil, fmt.Errorf("balancer is being closed; no new SubConns allowed") } + ccb.mu.Unlock() if len(addrs) == 0 { return nil, fmt.Errorf("grpc: cannot create SubConn with empty address list") } - ac, err := ccb.cc.newAddrConn(addrs, opts) + ac, err := ccb.cc.newAddrConnLocked(addrs, opts) if err != nil { channelz.Warningf(logger, ccb.cc.channelzID, "acBalancerWrapper: NewSubConn: failed to newAddrConn: %v", err) return nil, err @@ -316,10 +231,6 @@ func (ccb *ccBalancerWrapper) RemoveSubConn(sc balancer.SubConn) { } func (ccb *ccBalancerWrapper) UpdateAddresses(sc balancer.SubConn, addrs []resolver.Address) { - if ccb.isIdleOrClosed() { - return - } - acbw, ok := sc.(*acBalancerWrapper) if !ok { return @@ -328,25 +239,39 @@ func (ccb *ccBalancerWrapper) UpdateAddresses(sc balancer.SubConn, addrs []resol } func (ccb *ccBalancerWrapper) UpdateState(s balancer.State) { - if ccb.isIdleOrClosed() { + ccb.cc.mu.Lock() + defer ccb.cc.mu.Unlock() + + ccb.mu.Lock() + if ccb.closed { + ccb.mu.Unlock() return } - + ccb.mu.Unlock() // Update picker before updating state. Even though the ordering here does // not matter, it can lead to multiple calls of Pick in the common start-up // case where we wait for ready and then perform an RPC. If the picker is // updated later, we could call the "connecting" picker when the state is // updated, and then call the "ready" picker after the picker gets updated. - ccb.cc.blockingpicker.updatePicker(s.Picker) + + // Note that there is no need to check if the balancer wrapper was closed, + // as we know the graceful switch LB policy will not call cc if it has been + // closed. + ccb.cc.pickerWrapper.updatePicker(s.Picker) ccb.cc.csMgr.updateState(s.ConnectivityState) } func (ccb *ccBalancerWrapper) ResolveNow(o resolver.ResolveNowOptions) { - if ccb.isIdleOrClosed() { + ccb.cc.mu.RLock() + defer ccb.cc.mu.RUnlock() + + ccb.mu.Lock() + if ccb.closed { + ccb.mu.Unlock() return } - - ccb.cc.resolveNow(o) + ccb.mu.Unlock() + ccb.cc.resolveNowLocked(o) } func (ccb *ccBalancerWrapper) Target() string { @@ -364,6 +289,20 @@ type acBalancerWrapper struct { producers map[balancer.ProducerBuilder]*refCountedProducer } +// updateState is invoked by grpc to push a subConn state update to the +// underlying balancer. +func (acbw *acBalancerWrapper) updateState(s connectivity.State, err error) { + acbw.ccb.serializer.Schedule(func(ctx context.Context) { + if ctx.Err() != nil || acbw.ccb.balancer == nil { + return + } + // Even though it is optional for balancers, gracefulswitch ensures + // opts.StateListener is set, so this cannot ever be nil. + // TODO: delete this comment when UpdateSubConnState is removed. + acbw.stateListener(balancer.SubConnState{ConnectivityState: s, ConnectionError: err}) + }) +} + func (acbw *acBalancerWrapper) String() string { return fmt.Sprintf("SubConn(id:%d)", acbw.ac.channelzID.Int()) } @@ -377,20 +316,7 @@ func (acbw *acBalancerWrapper) Connect() { } func (acbw *acBalancerWrapper) Shutdown() { - ccb := acbw.ccb - if ccb.isIdleOrClosed() { - // It it safe to ignore this call when the balancer is closed or in idle - // because the ClientConn takes care of closing the connections. - // - // Not returning early from here when the balancer is closed or in idle - // leads to a deadlock though, because of the following sequence of - // calls when holding cc.mu: - // cc.exitIdleMode --> ccb.enterIdleMode --> gsw.Close --> - // ccb.RemoveAddrConn --> cc.removeAddrConn - return - } - - ccb.cc.removeAddrConn(acbw.ac, errConnDrain) + acbw.ccb.cc.removeAddrConn(acbw.ac, errConnDrain) } // NewStream begins a streaming RPC on the addrConn. If the addrConn is not diff --git a/vendor/google.golang.org/grpc/clientconn.go b/vendor/google.golang.org/grpc/clientconn.go index 429c389e4..e6f2625b6 100644 --- a/vendor/google.golang.org/grpc/clientconn.go +++ b/vendor/google.golang.org/grpc/clientconn.go @@ -33,9 +33,7 @@ import ( "google.golang.org/grpc/balancer/base" "google.golang.org/grpc/codes" "google.golang.org/grpc/connectivity" - "google.golang.org/grpc/credentials" "google.golang.org/grpc/internal" - "google.golang.org/grpc/internal/backoff" "google.golang.org/grpc/internal/channelz" "google.golang.org/grpc/internal/grpcsync" "google.golang.org/grpc/internal/idle" @@ -48,9 +46,9 @@ import ( "google.golang.org/grpc/status" _ "google.golang.org/grpc/balancer/roundrobin" // To register roundrobin. - _ "google.golang.org/grpc/internal/resolver/dns" // To register dns resolver. _ "google.golang.org/grpc/internal/resolver/passthrough" // To register passthrough resolver. _ "google.golang.org/grpc/internal/resolver/unix" // To register unix resolver. + _ "google.golang.org/grpc/resolver/dns" // To register dns resolver. ) const ( @@ -119,23 +117,8 @@ func (dcs *defaultConfigSelector) SelectConfig(rpcInfo iresolver.RPCInfo) (*ires }, nil } -// DialContext creates a client connection to the given target. By default, it's -// a non-blocking dial (the function won't wait for connections to be -// established, and connecting happens in the background). To make it a blocking -// dial, use WithBlock() dial option. -// -// In the non-blocking case, the ctx does not act against the connection. It -// only controls the setup steps. -// -// In the blocking case, ctx can be used to cancel or expire the pending -// connection. Once this function returns, the cancellation and expiration of -// ctx will be noop. Users should call ClientConn.Close to terminate all the -// pending operations after this function returns. -// -// The target name syntax is defined in -// https://github.com/grpc/grpc/blob/master/doc/naming.md. -// e.g. to use dns resolver, a "dns:///" prefix should be applied to the target. -func DialContext(ctx context.Context, target string, opts ...DialOption) (conn *ClientConn, err error) { +// newClient returns a new client in idle mode. +func newClient(target string, opts ...DialOption) (conn *ClientConn, err error) { cc := &ClientConn{ target: target, conns: make(map[*addrConn]struct{}), @@ -143,23 +126,11 @@ func DialContext(ctx context.Context, target string, opts ...DialOption) (conn * czData: new(channelzData), } - // We start the channel off in idle mode, but kick it out of idle at the end - // of this method, instead of waiting for the first RPC. Other gRPC - // implementations do wait for the first RPC to kick the channel out of - // idle. But doing so would be a major behavior change for our users who are - // used to seeing the channel active after Dial. - // - // Taking this approach of kicking it out of idle at the end of this method - // allows us to share the code between channel creation and exiting idle - // mode. This will also make it easy for us to switch to starting the - // channel off in idle, if at all we ever get to do that. - cc.idlenessState = ccIdlenessStateIdle - cc.retryThrottler.Store((*retryThrottler)(nil)) cc.safeConfigSelector.UpdateConfigSelector(&defaultConfigSelector{nil}) cc.ctx, cc.cancel = context.WithCancel(context.Background()) - cc.exitIdleCond = sync.NewCond(&cc.mu) + // Apply dial options. disableGlobalOpts := false for _, opt := range opts { if _, ok := opt.(*disableGlobalDialOptions); ok { @@ -177,21 +148,9 @@ func DialContext(ctx context.Context, target string, opts ...DialOption) (conn * for _, opt := range opts { opt.apply(&cc.dopts) } - chainUnaryClientInterceptors(cc) chainStreamClientInterceptors(cc) - defer func() { - if err != nil { - cc.Close() - } - }() - - // Register ClientConn with channelz. - cc.channelzRegistration(target) - - cc.csMgr = newConnectivityStateManager(cc.ctx, cc.channelzID) - if err := cc.validateTransportCredentials(); err != nil { return nil, err } @@ -205,10 +164,80 @@ func DialContext(ctx context.Context, target string, opts ...DialOption) (conn * } cc.mkp = cc.dopts.copts.KeepaliveParams - if cc.dopts.copts.UserAgent != "" { - cc.dopts.copts.UserAgent += " " + grpcUA - } else { - cc.dopts.copts.UserAgent = grpcUA + // Register ClientConn with channelz. + cc.channelzRegistration(target) + + // TODO: Ideally it should be impossible to error from this function after + // channelz registration. This will require removing some channelz logs + // from the following functions that can error. Errors can be returned to + // the user, and successful logs can be emitted here, after the checks have + // passed and channelz is subsequently registered. + + // Determine the resolver to use. + if err := cc.parseTargetAndFindResolver(); err != nil { + channelz.RemoveEntry(cc.channelzID) + return nil, err + } + if err = cc.determineAuthority(); err != nil { + channelz.RemoveEntry(cc.channelzID) + return nil, err + } + + cc.csMgr = newConnectivityStateManager(cc.ctx, cc.channelzID) + cc.pickerWrapper = newPickerWrapper(cc.dopts.copts.StatsHandlers) + + cc.initIdleStateLocked() // Safe to call without the lock, since nothing else has a reference to cc. + cc.idlenessMgr = idle.NewManager((*idler)(cc), cc.dopts.idleTimeout) + return cc, nil +} + +// DialContext creates a client connection to the given target. By default, it's +// a non-blocking dial (the function won't wait for connections to be +// established, and connecting happens in the background). To make it a blocking +// dial, use WithBlock() dial option. +// +// In the non-blocking case, the ctx does not act against the connection. It +// only controls the setup steps. +// +// In the blocking case, ctx can be used to cancel or expire the pending +// connection. Once this function returns, the cancellation and expiration of +// ctx will be noop. Users should call ClientConn.Close to terminate all the +// pending operations after this function returns. +// +// The target name syntax is defined in +// https://github.com/grpc/grpc/blob/master/doc/naming.md. +// e.g. to use dns resolver, a "dns:///" prefix should be applied to the target. +func DialContext(ctx context.Context, target string, opts ...DialOption) (conn *ClientConn, err error) { + cc, err := newClient(target, opts...) + if err != nil { + return nil, err + } + + // We start the channel off in idle mode, but kick it out of idle now, + // instead of waiting for the first RPC. Other gRPC implementations do wait + // for the first RPC to kick the channel out of idle. But doing so would be + // a major behavior change for our users who are used to seeing the channel + // active after Dial. + // + // Taking this approach of kicking it out of idle at the end of this method + // allows us to share the code between channel creation and exiting idle + // mode. This will also make it easy for us to switch to starting the + // channel off in idle, i.e. by making newClient exported. + + defer func() { + if err != nil { + cc.Close() + } + }() + + // This creates the name resolver, load balancer, etc. + if err := cc.idlenessMgr.ExitIdleMode(); err != nil { + return nil, err + } + + // Return now for non-blocking dials. + if !cc.dopts.block { + return cc, nil } if cc.dopts.timeout > 0 { @@ -231,49 +260,6 @@ func DialContext(ctx context.Context, target string, opts ...DialOption) (conn * } }() - if cc.dopts.bs == nil { - cc.dopts.bs = backoff.DefaultExponential - } - - // Determine the resolver to use. - if err := cc.parseTargetAndFindResolver(); err != nil { - return nil, err - } - if err = cc.determineAuthority(); err != nil { - return nil, err - } - - if cc.dopts.scChan != nil { - // Blocking wait for the initial service config. - select { - case sc, ok := <-cc.dopts.scChan: - if ok { - cc.sc = &sc - cc.safeConfigSelector.UpdateConfigSelector(&defaultConfigSelector{&sc}) - } - case <-ctx.Done(): - return nil, ctx.Err() - } - } - if cc.dopts.scChan != nil { - go cc.scWatcher() - } - - // This creates the name resolver, load balancer, blocking picker etc. - if err := cc.exitIdleMode(); err != nil { - return nil, err - } - - // Configure idleness support with configured idle timeout or default idle - // timeout duration. Idleness can be explicitly disabled by the user, by - // setting the dial option to 0. - cc.idlenessMgr = idle.NewManager(idle.ManagerOptions{Enforcer: (*idler)(cc), Timeout: cc.dopts.idleTimeout, Logger: logger}) - - // Return early for non-blocking dials. - if !cc.dopts.block { - return cc, nil - } - // A blocking dial blocks until the clientConn is ready. for { s := cc.GetState() @@ -320,8 +306,8 @@ func (cc *ClientConn) addTraceEvent(msg string) { type idler ClientConn -func (i *idler) EnterIdleMode() error { - return (*ClientConn)(i).enterIdleMode() +func (i *idler) EnterIdleMode() { + (*ClientConn)(i).enterIdleMode() } func (i *idler) ExitIdleMode() error { @@ -329,117 +315,71 @@ func (i *idler) ExitIdleMode() error { } // exitIdleMode moves the channel out of idle mode by recreating the name -// resolver and load balancer. -func (cc *ClientConn) exitIdleMode() error { +// resolver and load balancer. This should never be called directly; use +// cc.idlenessMgr.ExitIdleMode instead. +func (cc *ClientConn) exitIdleMode() (err error) { cc.mu.Lock() if cc.conns == nil { cc.mu.Unlock() return errConnClosing } - if cc.idlenessState != ccIdlenessStateIdle { - channelz.Infof(logger, cc.channelzID, "ClientConn asked to exit idle mode, current mode is %v", cc.idlenessState) - cc.mu.Unlock() - return nil - } - - defer func() { - // When Close() and exitIdleMode() race against each other, one of the - // following two can happen: - // - Close() wins the race and runs first. exitIdleMode() runs after, and - // sees that the ClientConn is already closed and hence returns early. - // - exitIdleMode() wins the race and runs first and recreates the balancer - // and releases the lock before recreating the resolver. If Close() runs - // in this window, it will wait for exitIdleMode to complete. - // - // We achieve this synchronization using the below condition variable. - cc.mu.Lock() - cc.idlenessState = ccIdlenessStateActive - cc.exitIdleCond.Signal() - cc.mu.Unlock() - }() - - cc.idlenessState = ccIdlenessStateExitingIdle - exitedIdle := false - if cc.blockingpicker == nil { - cc.blockingpicker = newPickerWrapper(cc.dopts.copts.StatsHandlers) - } else { - cc.blockingpicker.exitIdleMode() - exitedIdle = true - } - - var credsClone credentials.TransportCredentials - if creds := cc.dopts.copts.TransportCredentials; creds != nil { - credsClone = creds.Clone() - } - if cc.balancerWrapper == nil { - cc.balancerWrapper = newCCBalancerWrapper(cc, balancer.BuildOptions{ - DialCreds: credsClone, - CredsBundle: cc.dopts.copts.CredsBundle, - Dialer: cc.dopts.copts.Dialer, - Authority: cc.authority, - CustomUserAgent: cc.dopts.copts.UserAgent, - ChannelzParentID: cc.channelzID, - Target: cc.parsedTarget, - }) - } else { - cc.balancerWrapper.exitIdleMode() - } - cc.firstResolveEvent = grpcsync.NewEvent() cc.mu.Unlock() // This needs to be called without cc.mu because this builds a new resolver - // which might update state or report error inline which needs to be handled - // by cc.updateResolverState() which also grabs cc.mu. - if err := cc.initResolverWrapper(credsClone); err != nil { + // which might update state or report error inline, which would then need to + // acquire cc.mu. + if err := cc.resolverWrapper.start(); err != nil { return err } - if exitedIdle { - cc.addTraceEvent("exiting idle mode") - } + cc.addTraceEvent("exiting idle mode") return nil } +// initIdleStateLocked initializes common state to how it should be while idle. +func (cc *ClientConn) initIdleStateLocked() { + cc.resolverWrapper = newCCResolverWrapper(cc) + cc.balancerWrapper = newCCBalancerWrapper(cc) + cc.firstResolveEvent = grpcsync.NewEvent() + // cc.conns == nil is a proxy for the ClientConn being closed. So, instead + // of setting it to nil here, we recreate the map. This also means that we + // don't have to do this when exiting idle mode. + cc.conns = make(map[*addrConn]struct{}) +} + // enterIdleMode puts the channel in idle mode, and as part of it shuts down the -// name resolver, load balancer and any subchannels. -func (cc *ClientConn) enterIdleMode() error { +// name resolver, load balancer, and any subchannels. This should never be +// called directly; use cc.idlenessMgr.EnterIdleMode instead. +func (cc *ClientConn) enterIdleMode() { cc.mu.Lock() - defer cc.mu.Unlock() if cc.conns == nil { - return ErrClientConnClosing - } - if cc.idlenessState != ccIdlenessStateActive { - channelz.Warningf(logger, cc.channelzID, "ClientConn asked to enter idle mode, current mode is %v", cc.idlenessState) - return nil + cc.mu.Unlock() + return } - // cc.conns == nil is a proxy for the ClientConn being closed. So, instead - // of setting it to nil here, we recreate the map. This also means that we - // don't have to do this when exiting idle mode. conns := cc.conns - cc.conns = make(map[*addrConn]struct{}) - // TODO: Currently, we close the resolver wrapper upon entering idle mode - // and create a new one upon exiting idle mode. This means that the - // `cc.resolverWrapper` field would be overwritten everytime we exit idle - // mode. While this means that we need to hold `cc.mu` when accessing - // `cc.resolverWrapper`, it makes the code simpler in the wrapper. We should - // try to do the same for the balancer and picker wrappers too. - cc.resolverWrapper.close() - cc.blockingpicker.enterIdleMode() - cc.balancerWrapper.enterIdleMode() + rWrapper := cc.resolverWrapper + rWrapper.close() + cc.pickerWrapper.reset() + bWrapper := cc.balancerWrapper + bWrapper.close() cc.csMgr.updateState(connectivity.Idle) - cc.idlenessState = ccIdlenessStateIdle cc.addTraceEvent("entering idle mode") - go func() { - for ac := range conns { - ac.tearDown(errConnIdling) - } - }() + cc.initIdleStateLocked() - return nil + cc.mu.Unlock() + + // Block until the name resolver and LB policy are closed. + <-rWrapper.serializer.Done() + <-bWrapper.serializer.Done() + + // Close all subchannels after the LB policy is closed. + for ac := range conns { + ac.tearDown(errConnIdling) + } } // validateTransportCredentials performs a series of checks on the configured @@ -649,66 +589,35 @@ type ClientConn struct { dopts dialOptions // Default and user specified dial options. channelzID *channelz.Identifier // Channelz identifier for the channel. resolverBuilder resolver.Builder // See parseTargetAndFindResolver(). - balancerWrapper *ccBalancerWrapper // Uses gracefulswitch.balancer underneath. - idlenessMgr idle.Manager + idlenessMgr *idle.Manager // The following provide their own synchronization, and therefore don't // require cc.mu to be held to access them. csMgr *connectivityStateManager - blockingpicker *pickerWrapper + pickerWrapper *pickerWrapper safeConfigSelector iresolver.SafeConfigSelector czData *channelzData retryThrottler atomic.Value // Updated from service config. - // firstResolveEvent is used to track whether the name resolver sent us at - // least one update. RPCs block on this event. - firstResolveEvent *grpcsync.Event - // mu protects the following fields. // TODO: split mu so the same mutex isn't used for everything. mu sync.RWMutex - resolverWrapper *ccResolverWrapper // Initialized in Dial; cleared in Close. + resolverWrapper *ccResolverWrapper // Always recreated whenever entering idle to simplify Close. + balancerWrapper *ccBalancerWrapper // Always recreated whenever entering idle to simplify Close. sc *ServiceConfig // Latest service config received from the resolver. conns map[*addrConn]struct{} // Set to nil on close. mkp keepalive.ClientParameters // May be updated upon receipt of a GoAway. - idlenessState ccIdlenessState // Tracks idleness state of the channel. - exitIdleCond *sync.Cond // Signalled when channel exits idle. + // firstResolveEvent is used to track whether the name resolver sent us at + // least one update. RPCs block on this event. May be accessed without mu + // if we know we cannot be asked to enter idle mode while accessing it (e.g. + // when the idle manager has already been closed, or if we are already + // entering idle mode). + firstResolveEvent *grpcsync.Event lceMu sync.Mutex // protects lastConnectionError lastConnectionError error } -// ccIdlenessState tracks the idleness state of the channel. -// -// Channels start off in `active` and move to `idle` after a period of -// inactivity. When moving back to `active` upon an incoming RPC, they -// transition through `exiting_idle`. This state is useful for synchronization -// with Close(). -// -// This state tracking is mostly for self-protection. The idlenessManager is -// expected to keep track of the state as well, and is expected not to call into -// the ClientConn unnecessarily. -type ccIdlenessState int8 - -const ( - ccIdlenessStateActive ccIdlenessState = iota - ccIdlenessStateIdle - ccIdlenessStateExitingIdle -) - -func (s ccIdlenessState) String() string { - switch s { - case ccIdlenessStateActive: - return "active" - case ccIdlenessStateIdle: - return "idle" - case ccIdlenessStateExitingIdle: - return "exitingIdle" - default: - return "unknown" - } -} - // WaitForStateChange waits until the connectivity.State of ClientConn changes from sourceState or // ctx expires. A true value is returned in former case and false in latter. // @@ -748,29 +657,15 @@ func (cc *ClientConn) GetState() connectivity.State { // Notice: This API is EXPERIMENTAL and may be changed or removed in a later // release. func (cc *ClientConn) Connect() { - cc.exitIdleMode() + if err := cc.idlenessMgr.ExitIdleMode(); err != nil { + cc.addTraceEvent(err.Error()) + return + } // If the ClientConn was not in idle mode, we need to call ExitIdle on the // LB policy so that connections can be created. - cc.balancerWrapper.exitIdleMode() -} - -func (cc *ClientConn) scWatcher() { - for { - select { - case sc, ok := <-cc.dopts.scChan: - if !ok { - return - } - cc.mu.Lock() - // TODO: load balance policy runtime change is ignored. - // We may revisit this decision in the future. - cc.sc = &sc - cc.safeConfigSelector.UpdateConfigSelector(&defaultConfigSelector{&sc}) - cc.mu.Unlock() - case <-cc.ctx.Done(): - return - } - } + cc.mu.Lock() + cc.balancerWrapper.exitIdle() + cc.mu.Unlock() } // waitForResolvedAddrs blocks until the resolver has provided addresses or the @@ -804,11 +699,11 @@ func init() { internal.SubscribeToConnectivityStateChanges = func(cc *ClientConn, s grpcsync.Subscriber) func() { return cc.csMgr.pubSub.Subscribe(s) } - internal.EnterIdleModeForTesting = func(cc *ClientConn) error { - return cc.enterIdleMode() + internal.EnterIdleModeForTesting = func(cc *ClientConn) { + cc.idlenessMgr.EnterIdleModeForTesting() } internal.ExitIdleModeForTesting = func(cc *ClientConn) error { - return cc.exitIdleMode() + return cc.idlenessMgr.ExitIdleMode() } } @@ -824,9 +719,8 @@ func (cc *ClientConn) maybeApplyDefaultServiceConfig(addrs []resolver.Address) { } } -func (cc *ClientConn) updateResolverState(s resolver.State, err error) error { +func (cc *ClientConn) updateResolverStateAndUnlock(s resolver.State, err error) error { defer cc.firstResolveEvent.Fire() - cc.mu.Lock() // Check if the ClientConn is already closed. Some fields (e.g. // balancerWrapper) are set to nil when closing the ClientConn, and could // cause nil pointer panic if we don't have this check. @@ -872,7 +766,7 @@ func (cc *ClientConn) updateResolverState(s resolver.State, err error) error { if cc.sc == nil { // Apply the failing LB only if we haven't received valid service config // from the name resolver in the past. - cc.applyFailingLB(s.ServiceConfig) + cc.applyFailingLBLocked(s.ServiceConfig) cc.mu.Unlock() return ret } @@ -894,15 +788,13 @@ func (cc *ClientConn) updateResolverState(s resolver.State, err error) error { return ret } -// applyFailingLB is akin to configuring an LB policy on the channel which +// applyFailingLBLocked is akin to configuring an LB policy on the channel which // always fails RPCs. Here, an actual LB policy is not configured, but an always // erroring picker is configured, which returns errors with information about // what was invalid in the received service config. A config selector with no // service config is configured, and the connectivity state of the channel is // set to TransientFailure. -// -// Caller must hold cc.mu. -func (cc *ClientConn) applyFailingLB(sc *serviceconfig.ParseResult) { +func (cc *ClientConn) applyFailingLBLocked(sc *serviceconfig.ParseResult) { var err error if sc.Err != nil { err = status.Errorf(codes.Unavailable, "error parsing service config: %v", sc.Err) @@ -910,14 +802,10 @@ func (cc *ClientConn) applyFailingLB(sc *serviceconfig.ParseResult) { err = status.Errorf(codes.Unavailable, "illegal service config type: %T", sc.Config) } cc.safeConfigSelector.UpdateConfigSelector(&defaultConfigSelector{nil}) - cc.blockingpicker.updatePicker(base.NewErrPicker(err)) + cc.pickerWrapper.updatePicker(base.NewErrPicker(err)) cc.csMgr.updateState(connectivity.TransientFailure) } -func (cc *ClientConn) handleSubConnStateChange(sc balancer.SubConn, s connectivity.State, err error) { - cc.balancerWrapper.updateSubConnState(sc, s, err) -} - // Makes a copy of the input addresses slice and clears out the balancer // attributes field. Addresses are passed during subconn creation and address // update operations. In both cases, we will clear the balancer attributes by @@ -932,10 +820,14 @@ func copyAddressesWithoutBalancerAttributes(in []resolver.Address) []resolver.Ad return out } -// newAddrConn creates an addrConn for addrs and adds it to cc.conns. +// newAddrConnLocked creates an addrConn for addrs and adds it to cc.conns. // // Caller needs to make sure len(addrs) > 0. -func (cc *ClientConn) newAddrConn(addrs []resolver.Address, opts balancer.NewSubConnOptions) (*addrConn, error) { +func (cc *ClientConn) newAddrConnLocked(addrs []resolver.Address, opts balancer.NewSubConnOptions) (*addrConn, error) { + if cc.conns == nil { + return nil, ErrClientConnClosing + } + ac := &addrConn{ state: connectivity.Idle, cc: cc, @@ -947,12 +839,6 @@ func (cc *ClientConn) newAddrConn(addrs []resolver.Address, opts balancer.NewSub stateChan: make(chan struct{}), } ac.ctx, ac.cancel = context.WithCancel(cc.ctx) - // Track ac in cc. This needs to be done before any getTransport(...) is called. - cc.mu.Lock() - defer cc.mu.Unlock() - if cc.conns == nil { - return nil, ErrClientConnClosing - } var err error ac.channelzID, err = channelz.RegisterSubChannel(ac, cc.channelzID, "") @@ -968,6 +854,7 @@ func (cc *ClientConn) newAddrConn(addrs []resolver.Address, opts balancer.NewSub }, }) + // Track ac in cc. This needs to be done before any getTransport(...) is called. cc.conns[ac] = struct{}{} return ac, nil } @@ -1174,7 +1061,7 @@ func (cc *ClientConn) healthCheckConfig() *healthCheckConfig { } func (cc *ClientConn) getTransport(ctx context.Context, failfast bool, method string) (transport.ClientTransport, balancer.PickResult, error) { - return cc.blockingpicker.pick(ctx, failfast, balancer.PickInfo{ + return cc.pickerWrapper.pick(ctx, failfast, balancer.PickInfo{ Ctx: ctx, FullMethodName: method, }) @@ -1216,12 +1103,12 @@ func (cc *ClientConn) applyServiceConfigAndBalancer(sc *ServiceConfig, configSel func (cc *ClientConn) resolveNow(o resolver.ResolveNowOptions) { cc.mu.RLock() - r := cc.resolverWrapper + cc.resolverWrapper.resolveNow(o) cc.mu.RUnlock() - if r == nil { - return - } - go r.resolveNow(o) +} + +func (cc *ClientConn) resolveNowLocked(o resolver.ResolveNowOptions) { + cc.resolverWrapper.resolveNow(o) } // ResetConnectBackoff wakes up all subchannels in transient failure and causes @@ -1253,40 +1140,32 @@ func (cc *ClientConn) Close() error { <-cc.csMgr.pubSub.Done() }() + // Prevent calls to enter/exit idle immediately, and ensure we are not + // currently entering/exiting idle mode. + cc.idlenessMgr.Close() + cc.mu.Lock() if cc.conns == nil { cc.mu.Unlock() return ErrClientConnClosing } - for cc.idlenessState == ccIdlenessStateExitingIdle { - cc.exitIdleCond.Wait() - } - conns := cc.conns cc.conns = nil cc.csMgr.updateState(connectivity.Shutdown) - pWrapper := cc.blockingpicker - rWrapper := cc.resolverWrapper - bWrapper := cc.balancerWrapper - idlenessMgr := cc.idlenessMgr + // We can safely unlock and continue to access all fields now as + // cc.conns==nil, preventing any further operations on cc. cc.mu.Unlock() + cc.resolverWrapper.close() // The order of closing matters here since the balancer wrapper assumes the // picker is closed before it is closed. - if pWrapper != nil { - pWrapper.close() - } - if bWrapper != nil { - bWrapper.close() - } - if rWrapper != nil { - rWrapper.close() - } - if idlenessMgr != nil { - idlenessMgr.Close() - } + cc.pickerWrapper.close() + cc.balancerWrapper.close() + + <-cc.resolverWrapper.serializer.Done() + <-cc.balancerWrapper.serializer.Done() for ac := range conns { ac.tearDown(ErrClientConnClosing) @@ -1307,7 +1186,7 @@ type addrConn struct { cc *ClientConn dopts dialOptions - acbw balancer.SubConn + acbw *acBalancerWrapper scopts balancer.NewSubConnOptions // transport is set when there's a viable transport (note: ac state may not be READY as LB channel @@ -1345,7 +1224,7 @@ func (ac *addrConn) updateConnectivityState(s connectivity.State, lastErr error) } else { channelz.Infof(logger, ac.channelzID, "Subchannel Connectivity change to %v, last error: %s", s, lastErr) } - ac.cc.handleSubConnStateChange(ac.acbw, s, lastErr) + ac.acbw.updateState(s, lastErr) } // adjustParams updates parameters used to create transports upon @@ -1849,7 +1728,7 @@ func (cc *ClientConn) parseTargetAndFindResolver() error { if err != nil { channelz.Infof(logger, cc.channelzID, "dial target %q parse failed: %v", cc.target, err) } else { - channelz.Infof(logger, cc.channelzID, "parsed dial target is: %+v", parsedTarget) + channelz.Infof(logger, cc.channelzID, "parsed dial target is: %#v", parsedTarget) rb = cc.getResolver(parsedTarget.URL.Scheme) if rb != nil { cc.parsedTarget = parsedTarget @@ -2007,32 +1886,3 @@ func (cc *ClientConn) determineAuthority() error { channelz.Infof(logger, cc.channelzID, "Channel authority set to %q", cc.authority) return nil } - -// initResolverWrapper creates a ccResolverWrapper, which builds the name -// resolver. This method grabs the lock to assign the newly built resolver -// wrapper to the cc.resolverWrapper field. -func (cc *ClientConn) initResolverWrapper(creds credentials.TransportCredentials) error { - rw, err := newCCResolverWrapper(cc, ccResolverWrapperOpts{ - target: cc.parsedTarget, - builder: cc.resolverBuilder, - bOpts: resolver.BuildOptions{ - DisableServiceConfig: cc.dopts.disableServiceConfig, - DialCreds: creds, - CredsBundle: cc.dopts.copts.CredsBundle, - Dialer: cc.dopts.copts.Dialer, - }, - channelzID: cc.channelzID, - }) - if err != nil { - return fmt.Errorf("failed to build resolver: %v", err) - } - // Resolver implementations may report state update or error inline when - // built (or right after), and this is handled in cc.updateResolverState. - // Also, an error from the resolver might lead to a re-resolution request - // from the balancer, which is handled in resolveNow() where - // `cc.resolverWrapper` is accessed. Hence, we need to hold the lock here. - cc.mu.Lock() - cc.resolverWrapper = rw - cc.mu.Unlock() - return nil -} diff --git a/vendor/google.golang.org/grpc/codes/codes.go b/vendor/google.golang.org/grpc/codes/codes.go index 11b106182..08476ad1f 100644 --- a/vendor/google.golang.org/grpc/codes/codes.go +++ b/vendor/google.golang.org/grpc/codes/codes.go @@ -25,7 +25,13 @@ import ( "strconv" ) -// A Code is an unsigned 32-bit error code as defined in the gRPC spec. +// A Code is a status code defined according to the [gRPC documentation]. +// +// Only the codes defined as consts in this package are valid codes. Do not use +// other code values. Behavior of other codes is implementation-specific and +// interoperability between implementations is not guaranteed. +// +// [gRPC documentation]: https://github.com/grpc/grpc/blob/master/doc/statuscodes.md type Code uint32 const ( diff --git a/vendor/google.golang.org/grpc/credentials/tls.go b/vendor/google.golang.org/grpc/credentials/tls.go index 877b7cd21..5dafd34ed 100644 --- a/vendor/google.golang.org/grpc/credentials/tls.go +++ b/vendor/google.golang.org/grpc/credentials/tls.go @@ -44,10 +44,25 @@ func (t TLSInfo) AuthType() string { return "tls" } +// cipherSuiteLookup returns the string version of a TLS cipher suite ID. +func cipherSuiteLookup(cipherSuiteID uint16) string { + for _, s := range tls.CipherSuites() { + if s.ID == cipherSuiteID { + return s.Name + } + } + for _, s := range tls.InsecureCipherSuites() { + if s.ID == cipherSuiteID { + return s.Name + } + } + return fmt.Sprintf("unknown ID: %v", cipherSuiteID) +} + // GetSecurityValue returns security info requested by channelz. func (t TLSInfo) GetSecurityValue() ChannelzSecurityValue { v := &TLSChannelzSecurityValue{ - StandardName: cipherSuiteLookup[t.State.CipherSuite], + StandardName: cipherSuiteLookup(t.State.CipherSuite), } // Currently there's no way to get LocalCertificate info from tls package. if len(t.State.PeerCertificates) > 0 { @@ -138,10 +153,39 @@ func (c *tlsCreds) OverrideServerName(serverNameOverride string) error { return nil } +// The following cipher suites are forbidden for use with HTTP/2 by +// https://datatracker.ietf.org/doc/html/rfc7540#appendix-A +var tls12ForbiddenCipherSuites = map[uint16]struct{}{ + tls.TLS_RSA_WITH_AES_128_CBC_SHA: {}, + tls.TLS_RSA_WITH_AES_256_CBC_SHA: {}, + tls.TLS_RSA_WITH_AES_128_GCM_SHA256: {}, + tls.TLS_RSA_WITH_AES_256_GCM_SHA384: {}, + tls.TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA: {}, + tls.TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA: {}, + tls.TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA: {}, + tls.TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: {}, +} + // NewTLS uses c to construct a TransportCredentials based on TLS. func NewTLS(c *tls.Config) TransportCredentials { tc := &tlsCreds{credinternal.CloneTLSConfig(c)} tc.config.NextProtos = credinternal.AppendH2ToNextProtos(tc.config.NextProtos) + // If the user did not configure a MinVersion and did not configure a + // MaxVersion < 1.2, use MinVersion=1.2, which is required by + // https://datatracker.ietf.org/doc/html/rfc7540#section-9.2 + if tc.config.MinVersion == 0 && (tc.config.MaxVersion == 0 || tc.config.MaxVersion >= tls.VersionTLS12) { + tc.config.MinVersion = tls.VersionTLS12 + } + // If the user did not configure CipherSuites, use all "secure" cipher + // suites reported by the TLS package, but remove some explicitly forbidden + // by https://datatracker.ietf.org/doc/html/rfc7540#appendix-A + if tc.config.CipherSuites == nil { + for _, cs := range tls.CipherSuites() { + if _, ok := tls12ForbiddenCipherSuites[cs.ID]; !ok { + tc.config.CipherSuites = append(tc.config.CipherSuites, cs.ID) + } + } + } return tc } @@ -205,32 +249,3 @@ type TLSChannelzSecurityValue struct { LocalCertificate []byte RemoteCertificate []byte } - -var cipherSuiteLookup = map[uint16]string{ - tls.TLS_RSA_WITH_RC4_128_SHA: "TLS_RSA_WITH_RC4_128_SHA", - tls.TLS_RSA_WITH_3DES_EDE_CBC_SHA: "TLS_RSA_WITH_3DES_EDE_CBC_SHA", - tls.TLS_RSA_WITH_AES_128_CBC_SHA: "TLS_RSA_WITH_AES_128_CBC_SHA", - tls.TLS_RSA_WITH_AES_256_CBC_SHA: "TLS_RSA_WITH_AES_256_CBC_SHA", - tls.TLS_RSA_WITH_AES_128_GCM_SHA256: "TLS_RSA_WITH_AES_128_GCM_SHA256", - tls.TLS_RSA_WITH_AES_256_GCM_SHA384: "TLS_RSA_WITH_AES_256_GCM_SHA384", - tls.TLS_ECDHE_ECDSA_WITH_RC4_128_SHA: "TLS_ECDHE_ECDSA_WITH_RC4_128_SHA", - tls.TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA: "TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA", - tls.TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA: "TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA", - tls.TLS_ECDHE_RSA_WITH_RC4_128_SHA: "TLS_ECDHE_RSA_WITH_RC4_128_SHA", - tls.TLS_ECDHE_RSA_WITH_3DES_EDE_CBC_SHA: "TLS_ECDHE_RSA_WITH_3DES_EDE_CBC_SHA", - tls.TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA: "TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA", - tls.TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: "TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA", - tls.TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256: "TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256", - tls.TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256: "TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256", - tls.TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384: "TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384", - tls.TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384: "TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384", - tls.TLS_FALLBACK_SCSV: "TLS_FALLBACK_SCSV", - tls.TLS_RSA_WITH_AES_128_CBC_SHA256: "TLS_RSA_WITH_AES_128_CBC_SHA256", - tls.TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256: "TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256", - tls.TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256: "TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256", - tls.TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305: "TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305", - tls.TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305: "TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305", - tls.TLS_AES_128_GCM_SHA256: "TLS_AES_128_GCM_SHA256", - tls.TLS_AES_256_GCM_SHA384: "TLS_AES_256_GCM_SHA384", - tls.TLS_CHACHA20_POLY1305_SHA256: "TLS_CHACHA20_POLY1305_SHA256", -} diff --git a/vendor/google.golang.org/grpc/dialoptions.go b/vendor/google.golang.org/grpc/dialoptions.go index cfc9fd85e..ba2426180 100644 --- a/vendor/google.golang.org/grpc/dialoptions.go +++ b/vendor/google.golang.org/grpc/dialoptions.go @@ -46,6 +46,7 @@ func init() { internal.WithBinaryLogger = withBinaryLogger internal.JoinDialOptions = newJoinDialOption internal.DisableGlobalDialOptions = newDisableGlobalDialOptions + internal.WithRecvBufferPool = withRecvBufferPool } // dialOptions configure a Dial call. dialOptions are set by the DialOption @@ -63,7 +64,6 @@ type dialOptions struct { block bool returnLastError bool timeout time.Duration - scChan <-chan ServiceConfig authority string binaryLogger binarylog.Logger copts transport.ConnectOptions @@ -250,19 +250,6 @@ func WithDecompressor(dc Decompressor) DialOption { }) } -// WithServiceConfig returns a DialOption which has a channel to read the -// service configuration. -// -// Deprecated: service config should be received through name resolver or via -// WithDefaultServiceConfig, as specified at -// https://github.com/grpc/grpc/blob/master/doc/service_config.md. Will be -// removed in a future 1.x release. -func WithServiceConfig(c <-chan ServiceConfig) DialOption { - return newFuncDialOption(func(o *dialOptions) { - o.scChan = c - }) -} - // WithConnectParams configures the ClientConn to use the provided ConnectParams // for creating and maintaining connections to servers. // @@ -413,6 +400,17 @@ func WithTimeout(d time.Duration) DialOption { // connections. If FailOnNonTempDialError() is set to true, and an error is // returned by f, gRPC checks the error's Temporary() method to decide if it // should try to reconnect to the network address. +// +// Note: All supported releases of Go (as of December 2023) override the OS +// defaults for TCP keepalive time and interval to 15s. To enable TCP keepalive +// with OS defaults for keepalive time and interval, use a net.Dialer that sets +// the KeepAlive field to a negative value, and sets the SO_KEEPALIVE socket +// option to true from the Control field. For a concrete example of how to do +// this, see internal.NetDialerWithTCPKeepalive(). +// +// For more information, please see [issue 23459] in the Go github repo. +// +// [issue 23459]: https://github.com/golang/go/issues/23459 func WithContextDialer(f func(context.Context, string) (net.Conn, error)) DialOption { return newFuncDialOption(func(o *dialOptions) { o.copts.Dialer = f @@ -487,7 +485,7 @@ func FailOnNonTempDialError(f bool) DialOption { // the RPCs. func WithUserAgent(s string) DialOption { return newFuncDialOption(func(o *dialOptions) { - o.copts.UserAgent = s + o.copts.UserAgent = s + " " + grpcUA }) } @@ -637,14 +635,16 @@ func withHealthCheckFunc(f internal.HealthChecker) DialOption { func defaultDialOptions() dialOptions { return dialOptions{ - healthCheckFunc: internal.HealthCheckFunc, copts: transport.ConnectOptions{ - WriteBufferSize: defaultWriteBufSize, ReadBufferSize: defaultReadBufSize, + WriteBufferSize: defaultWriteBufSize, UseProxy: true, + UserAgent: grpcUA, }, - recvBufferPool: nopBufferPool{}, - idleTimeout: 30 * time.Minute, + bs: internalbackoff.DefaultExponential, + healthCheckFunc: internal.HealthCheckFunc, + idleTimeout: 30 * time.Minute, + recvBufferPool: nopBufferPool{}, } } @@ -705,11 +705,13 @@ func WithIdleTimeout(d time.Duration) DialOption { // options are used: WithStatsHandler, EnableTracing, or binary logging. In such // cases, the shared buffer pool will be ignored. // -// # Experimental -// -// Notice: This API is EXPERIMENTAL and may be changed or removed in a -// later release. +// Deprecated: use experimental.WithRecvBufferPool instead. Will be deleted in +// v1.60.0 or later. func WithRecvBufferPool(bufferPool SharedBufferPool) DialOption { + return withRecvBufferPool(bufferPool) +} + +func withRecvBufferPool(bufferPool SharedBufferPool) DialOption { return newFuncDialOption(func(o *dialOptions) { o.recvBufferPool = bufferPool }) diff --git a/vendor/google.golang.org/grpc/internal/buffer/unbounded.go b/vendor/google.golang.org/grpc/internal/buffer/unbounded.go index 4399c3df4..11f91668a 100644 --- a/vendor/google.golang.org/grpc/internal/buffer/unbounded.go +++ b/vendor/google.golang.org/grpc/internal/buffer/unbounded.go @@ -18,7 +18,10 @@ // Package buffer provides an implementation of an unbounded buffer. package buffer -import "sync" +import ( + "errors" + "sync" +) // Unbounded is an implementation of an unbounded buffer which does not use // extra goroutines. This is typically used for passing updates from one entity @@ -36,6 +39,7 @@ import "sync" type Unbounded struct { c chan any closed bool + closing bool mu sync.Mutex backlog []any } @@ -45,32 +49,32 @@ func NewUnbounded() *Unbounded { return &Unbounded{c: make(chan any, 1)} } +var errBufferClosed = errors.New("Put called on closed buffer.Unbounded") + // Put adds t to the unbounded buffer. -func (b *Unbounded) Put(t any) { +func (b *Unbounded) Put(t any) error { b.mu.Lock() defer b.mu.Unlock() - if b.closed { - return + if b.closing { + return errBufferClosed } if len(b.backlog) == 0 { select { case b.c <- t: - return + return nil default: } } b.backlog = append(b.backlog, t) + return nil } -// Load sends the earliest buffered data, if any, onto the read channel -// returned by Get(). Users are expected to call this every time they read a +// Load sends the earliest buffered data, if any, onto the read channel returned +// by Get(). Users are expected to call this every time they successfully read a // value from the read channel. func (b *Unbounded) Load() { b.mu.Lock() defer b.mu.Unlock() - if b.closed { - return - } if len(b.backlog) > 0 { select { case b.c <- b.backlog[0]: @@ -78,6 +82,8 @@ func (b *Unbounded) Load() { b.backlog = b.backlog[1:] default: } + } else if b.closing && !b.closed { + close(b.c) } } @@ -88,18 +94,23 @@ func (b *Unbounded) Load() { // send the next buffered value onto the channel if there is any. // // If the unbounded buffer is closed, the read channel returned by this method -// is closed. +// is closed after all data is drained. func (b *Unbounded) Get() <-chan any { return b.c } -// Close closes the unbounded buffer. +// Close closes the unbounded buffer. No subsequent data may be Put(), and the +// channel returned from Get() will be closed after all the data is read and +// Load() is called for the final time. func (b *Unbounded) Close() { b.mu.Lock() defer b.mu.Unlock() - if b.closed { + if b.closing { return } - b.closed = true - close(b.c) + b.closing = true + if len(b.backlog) == 0 { + b.closed = true + close(b.c) + } } diff --git a/vendor/google.golang.org/grpc/internal/channelz/funcs.go b/vendor/google.golang.org/grpc/internal/channelz/funcs.go index 5395e7752..fc094f344 100644 --- a/vendor/google.golang.org/grpc/internal/channelz/funcs.go +++ b/vendor/google.golang.org/grpc/internal/channelz/funcs.go @@ -31,6 +31,7 @@ import ( "time" "google.golang.org/grpc/grpclog" + "google.golang.org/grpc/internal" ) const ( @@ -58,6 +59,12 @@ func TurnOn() { } } +func init() { + internal.ChannelzTurnOffForTesting = func() { + atomic.StoreInt32(&curState, 0) + } +} + // IsOn returns whether channelz data collection is on. func IsOn() bool { return atomic.LoadInt32(&curState) == 1 diff --git a/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go b/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go index 3cf10ddfb..685a3cb41 100644 --- a/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go +++ b/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go @@ -36,9 +36,6 @@ var ( // "GRPC_RING_HASH_CAP". This does not override the default bounds // checking which NACKs configs specifying ring sizes > 8*1024*1024 (~8M). RingHashCap = uint64FromEnv("GRPC_RING_HASH_CAP", 4096, 1, 8*1024*1024) - // PickFirstLBConfig is set if we should support configuration of the - // pick_first LB policy. - PickFirstLBConfig = boolFromEnv("GRPC_EXPERIMENTAL_PICKFIRST_LB_CONFIG", true) // LeastRequestLB is set if we should support the least_request_experimental // LB policy, which can be enabled by setting the environment variable // "GRPC_EXPERIMENTAL_ENABLE_LEAST_REQUEST" to "true". diff --git a/vendor/google.golang.org/grpc/internal/envconfig/xds.go b/vendor/google.golang.org/grpc/internal/envconfig/xds.go index 02b4b6a1c..29f234acb 100644 --- a/vendor/google.golang.org/grpc/internal/envconfig/xds.go +++ b/vendor/google.golang.org/grpc/internal/envconfig/xds.go @@ -50,46 +50,7 @@ var ( // // When both bootstrap FileName and FileContent are set, FileName is used. XDSBootstrapFileContent = os.Getenv(XDSBootstrapFileContentEnv) - // XDSRingHash indicates whether ring hash support is enabled, which can be - // disabled by setting the environment variable - // "GRPC_XDS_EXPERIMENTAL_ENABLE_RING_HASH" to "false". - XDSRingHash = boolFromEnv("GRPC_XDS_EXPERIMENTAL_ENABLE_RING_HASH", true) - // XDSClientSideSecurity is used to control processing of security - // configuration on the client-side. - // - // Note that there is no env var protection for the server-side because we - // have a brand new API on the server-side and users explicitly need to use - // the new API to get security integration on the server. - XDSClientSideSecurity = boolFromEnv("GRPC_XDS_EXPERIMENTAL_SECURITY_SUPPORT", true) - // XDSAggregateAndDNS indicates whether processing of aggregated cluster and - // DNS cluster is enabled, which can be disabled by setting the environment - // variable "GRPC_XDS_EXPERIMENTAL_ENABLE_AGGREGATE_AND_LOGICAL_DNS_CLUSTER" - // to "false". - XDSAggregateAndDNS = boolFromEnv("GRPC_XDS_EXPERIMENTAL_ENABLE_AGGREGATE_AND_LOGICAL_DNS_CLUSTER", true) - - // XDSRBAC indicates whether xDS configured RBAC HTTP Filter is enabled, - // which can be disabled by setting the environment variable - // "GRPC_XDS_EXPERIMENTAL_RBAC" to "false". - XDSRBAC = boolFromEnv("GRPC_XDS_EXPERIMENTAL_RBAC", true) - // XDSOutlierDetection indicates whether outlier detection support is - // enabled, which can be disabled by setting the environment variable - // "GRPC_EXPERIMENTAL_ENABLE_OUTLIER_DETECTION" to "false". - XDSOutlierDetection = boolFromEnv("GRPC_EXPERIMENTAL_ENABLE_OUTLIER_DETECTION", true) - // XDSFederation indicates whether federation support is enabled, which can - // be enabled by setting the environment variable - // "GRPC_EXPERIMENTAL_XDS_FEDERATION" to "true". - XDSFederation = boolFromEnv("GRPC_EXPERIMENTAL_XDS_FEDERATION", true) - - // XDSRLS indicates whether processing of Cluster Specifier plugins and - // support for the RLS CLuster Specifier is enabled, which can be disabled by - // setting the environment variable "GRPC_EXPERIMENTAL_XDS_RLS_LB" to - // "false". - XDSRLS = boolFromEnv("GRPC_EXPERIMENTAL_XDS_RLS_LB", true) // C2PResolverTestOnlyTrafficDirectorURI is the TD URI for testing. C2PResolverTestOnlyTrafficDirectorURI = os.Getenv("GRPC_TEST_ONLY_GOOGLE_C2P_RESOLVER_TRAFFIC_DIRECTOR_URI") - // XDSCustomLBPolicy indicates whether Custom LB Policies are enabled, which - // can be disabled by setting the environment variable - // "GRPC_EXPERIMENTAL_XDS_CUSTOM_LB_CONFIG" to "false". - XDSCustomLBPolicy = boolFromEnv("GRPC_EXPERIMENTAL_XDS_CUSTOM_LB_CONFIG", true) ) diff --git a/vendor/google.golang.org/grpc/internal/experimental.go b/vendor/google.golang.org/grpc/internal/experimental.go new file mode 100644 index 000000000..7f7044e17 --- /dev/null +++ b/vendor/google.golang.org/grpc/internal/experimental.go @@ -0,0 +1,28 @@ +/* + * Copyright 2023 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package internal + +var ( + // WithRecvBufferPool is implemented by the grpc package and returns a dial + // option to configure a shared buffer pool for a grpc.ClientConn. + WithRecvBufferPool any // func (grpc.SharedBufferPool) grpc.DialOption + + // RecvBufferPool is implemented by the grpc package and returns a server + // option to configure a shared buffer pool for a grpc.Server. + RecvBufferPool any // func (grpc.SharedBufferPool) grpc.ServerOption +) diff --git a/vendor/google.golang.org/grpc/internal/grpcsync/callback_serializer.go b/vendor/google.golang.org/grpc/internal/grpcsync/callback_serializer.go index 900917dbe..f7f40a16a 100644 --- a/vendor/google.golang.org/grpc/internal/grpcsync/callback_serializer.go +++ b/vendor/google.golang.org/grpc/internal/grpcsync/callback_serializer.go @@ -20,7 +20,6 @@ package grpcsync import ( "context" - "sync" "google.golang.org/grpc/internal/buffer" ) @@ -38,8 +37,6 @@ type CallbackSerializer struct { done chan struct{} callbacks *buffer.Unbounded - closedMu sync.Mutex - closed bool } // NewCallbackSerializer returns a new CallbackSerializer instance. The provided @@ -65,56 +62,34 @@ func NewCallbackSerializer(ctx context.Context) *CallbackSerializer { // callbacks to be executed by the serializer. It is not possible to add // callbacks once the context passed to NewCallbackSerializer is cancelled. func (cs *CallbackSerializer) Schedule(f func(ctx context.Context)) bool { - cs.closedMu.Lock() - defer cs.closedMu.Unlock() - - if cs.closed { - return false - } - cs.callbacks.Put(f) - return true + return cs.callbacks.Put(f) == nil } func (cs *CallbackSerializer) run(ctx context.Context) { - var backlog []func(context.Context) - defer close(cs.done) + + // TODO: when Go 1.21 is the oldest supported version, this loop and Close + // can be replaced with: + // + // context.AfterFunc(ctx, cs.callbacks.Close) for ctx.Err() == nil { select { case <-ctx.Done(): // Do nothing here. Next iteration of the for loop will not happen, // since ctx.Err() would be non-nil. - case callback, ok := <-cs.callbacks.Get(): - if !ok { - return - } + case cb := <-cs.callbacks.Get(): cs.callbacks.Load() - callback.(func(ctx context.Context))(ctx) + cb.(func(context.Context))(ctx) } } - // Fetch pending callbacks if any, and execute them before returning from - // this method and closing cs.done. - cs.closedMu.Lock() - cs.closed = true - backlog = cs.fetchPendingCallbacks() + // Close the buffer to prevent new callbacks from being added. cs.callbacks.Close() - cs.closedMu.Unlock() - for _, b := range backlog { - b(ctx) - } -} -func (cs *CallbackSerializer) fetchPendingCallbacks() []func(context.Context) { - var backlog []func(context.Context) - for { - select { - case b := <-cs.callbacks.Get(): - backlog = append(backlog, b.(func(context.Context))) - cs.callbacks.Load() - default: - return backlog - } + // Run all pending callbacks. + for cb := range cs.callbacks.Get() { + cs.callbacks.Load() + cb.(func(context.Context))(ctx) } } diff --git a/vendor/google.golang.org/grpc/internal/idle/idle.go b/vendor/google.golang.org/grpc/internal/idle/idle.go index 6c272476e..fe49cb74c 100644 --- a/vendor/google.golang.org/grpc/internal/idle/idle.go +++ b/vendor/google.golang.org/grpc/internal/idle/idle.go @@ -26,8 +26,6 @@ import ( "sync" "sync/atomic" "time" - - "google.golang.org/grpc/grpclog" ) // For overriding in unit tests. @@ -39,27 +37,12 @@ var timeAfterFunc = func(d time.Duration, f func()) *time.Timer { // and exit from idle mode. type Enforcer interface { ExitIdleMode() error - EnterIdleMode() error -} - -// Manager defines the functionality required to track RPC activity on a -// channel. -type Manager interface { - OnCallBegin() error - OnCallEnd() - Close() + EnterIdleMode() } -type noopManager struct{} - -func (noopManager) OnCallBegin() error { return nil } -func (noopManager) OnCallEnd() {} -func (noopManager) Close() {} - -// manager implements the Manager interface. It uses atomic operations to -// synchronize access to shared state and a mutex to guarantee mutual exclusion -// in a critical section. -type manager struct { +// Manager implements idleness detection and calls the configured Enforcer to +// enter/exit idle mode when appropriate. Must be created by NewManager. +type Manager struct { // State accessed atomically. lastCallEndTime int64 // Unix timestamp in nanos; time when the most recent RPC completed. activeCallsCount int32 // Count of active RPCs; -math.MaxInt32 means channel is idle or is trying to get there. @@ -69,8 +52,7 @@ type manager struct { // Can be accessed without atomics or mutex since these are set at creation // time and read-only after that. enforcer Enforcer // Functionality provided by grpc.ClientConn. - timeout int64 // Idle timeout duration nanos stored as an int64. - logger grpclog.LoggerV2 + timeout time.Duration // idleMu is used to guarantee mutual exclusion in two scenarios: // - Opposing intentions: @@ -88,57 +70,48 @@ type manager struct { timer *time.Timer } -// ManagerOptions is a collection of options used by -// NewManager. -type ManagerOptions struct { - Enforcer Enforcer - Timeout time.Duration - Logger grpclog.LoggerV2 +// NewManager creates a new idleness manager implementation for the +// given idle timeout. It begins in idle mode. +func NewManager(enforcer Enforcer, timeout time.Duration) *Manager { + return &Manager{ + enforcer: enforcer, + timeout: timeout, + actuallyIdle: true, + activeCallsCount: -math.MaxInt32, + } } -// NewManager creates a new idleness manager implementation for the -// given idle timeout. -func NewManager(opts ManagerOptions) Manager { - if opts.Timeout == 0 { - return noopManager{} +// resetIdleTimerLocked resets the idle timer to the given duration. Called +// when exiting idle mode or when the timer fires and we need to reset it. +func (m *Manager) resetIdleTimerLocked(d time.Duration) { + if m.isClosed() || m.timeout == 0 || m.actuallyIdle { + return } - m := &manager{ - enforcer: opts.Enforcer, - timeout: int64(opts.Timeout), - logger: opts.Logger, + // It is safe to ignore the return value from Reset() because this method is + // only ever called from the timer callback or when exiting idle mode. + if m.timer != nil { + m.timer.Stop() } - m.timer = timeAfterFunc(opts.Timeout, m.handleIdleTimeout) - return m + m.timer = timeAfterFunc(d, m.handleIdleTimeout) } -// resetIdleTimer resets the idle timer to the given duration. This method -// should only be called from the timer callback. -func (m *manager) resetIdleTimer(d time.Duration) { +func (m *Manager) resetIdleTimer(d time.Duration) { m.idleMu.Lock() defer m.idleMu.Unlock() - - if m.timer == nil { - // Only close sets timer to nil. We are done. - return - } - - // It is safe to ignore the return value from Reset() because this method is - // only ever called from the timer callback, which means the timer has - // already fired. - m.timer.Reset(d) + m.resetIdleTimerLocked(d) } // handleIdleTimeout is the timer callback that is invoked upon expiry of the // configured idle timeout. The channel is considered inactive if there are no // ongoing calls and no RPC activity since the last time the timer fired. -func (m *manager) handleIdleTimeout() { +func (m *Manager) handleIdleTimeout() { if m.isClosed() { return } if atomic.LoadInt32(&m.activeCallsCount) > 0 { - m.resetIdleTimer(time.Duration(m.timeout)) + m.resetIdleTimer(m.timeout) return } @@ -148,24 +121,12 @@ func (m *manager) handleIdleTimeout() { // Set the timer to fire after a duration of idle timeout, calculated // from the time the most recent RPC completed. atomic.StoreInt32(&m.activeSinceLastTimerCheck, 0) - m.resetIdleTimer(time.Duration(atomic.LoadInt64(&m.lastCallEndTime) + m.timeout - time.Now().UnixNano())) + m.resetIdleTimer(time.Duration(atomic.LoadInt64(&m.lastCallEndTime)-time.Now().UnixNano()) + m.timeout) return } - // This CAS operation is extremely likely to succeed given that there has - // been no activity since the last time we were here. Setting the - // activeCallsCount to -math.MaxInt32 indicates to OnCallBegin() that the - // channel is either in idle mode or is trying to get there. - if !atomic.CompareAndSwapInt32(&m.activeCallsCount, 0, -math.MaxInt32) { - // This CAS operation can fail if an RPC started after we checked for - // activity at the top of this method, or one was ongoing from before - // the last time we were here. In both case, reset the timer and return. - m.resetIdleTimer(time.Duration(m.timeout)) - return - } - - // Now that we've set the active calls count to -math.MaxInt32, it's time to - // actually move to idle mode. + // Now that we've checked that there has been no activity, attempt to enter + // idle mode, which is very likely to succeed. if m.tryEnterIdleMode() { // Successfully entered idle mode. No timer needed until we exit idle. return @@ -174,8 +135,7 @@ func (m *manager) handleIdleTimeout() { // Failed to enter idle mode due to a concurrent RPC that kept the channel // active, or because of an error from the channel. Undo the attempt to // enter idle, and reset the timer to try again later. - atomic.AddInt32(&m.activeCallsCount, math.MaxInt32) - m.resetIdleTimer(time.Duration(m.timeout)) + m.resetIdleTimer(m.timeout) } // tryEnterIdleMode instructs the channel to enter idle mode. But before @@ -185,36 +145,49 @@ func (m *manager) handleIdleTimeout() { // Return value indicates whether or not the channel moved to idle mode. // // Holds idleMu which ensures mutual exclusion with exitIdleMode. -func (m *manager) tryEnterIdleMode() bool { +func (m *Manager) tryEnterIdleMode() bool { + // Setting the activeCallsCount to -math.MaxInt32 indicates to OnCallBegin() + // that the channel is either in idle mode or is trying to get there. + if !atomic.CompareAndSwapInt32(&m.activeCallsCount, 0, -math.MaxInt32) { + // This CAS operation can fail if an RPC started after we checked for + // activity in the timer handler, or one was ongoing from before the + // last time the timer fired, or if a test is attempting to enter idle + // mode without checking. In all cases, abort going into idle mode. + return false + } + // N.B. if we fail to enter idle mode after this, we must re-add + // math.MaxInt32 to m.activeCallsCount. + m.idleMu.Lock() defer m.idleMu.Unlock() if atomic.LoadInt32(&m.activeCallsCount) != -math.MaxInt32 { // We raced and lost to a new RPC. Very rare, but stop entering idle. + atomic.AddInt32(&m.activeCallsCount, math.MaxInt32) return false } if atomic.LoadInt32(&m.activeSinceLastTimerCheck) == 1 { - // An very short RPC could have come in (and also finished) after we + // A very short RPC could have come in (and also finished) after we // checked for calls count and activity in handleIdleTimeout(), but // before the CAS operation. So, we need to check for activity again. + atomic.AddInt32(&m.activeCallsCount, math.MaxInt32) return false } - // No new RPCs have come in since we last set the active calls count value - // -math.MaxInt32 in the timer callback. And since we have the lock, it is - // safe to enter idle mode now. - if err := m.enforcer.EnterIdleMode(); err != nil { - m.logger.Errorf("Failed to enter idle mode: %v", err) - return false - } - - // Successfully entered idle mode. + // No new RPCs have come in since we set the active calls count value to + // -math.MaxInt32. And since we have the lock, it is safe to enter idle mode + // unconditionally now. + m.enforcer.EnterIdleMode() m.actuallyIdle = true return true } +func (m *Manager) EnterIdleModeForTesting() { + m.tryEnterIdleMode() +} + // OnCallBegin is invoked at the start of every RPC. -func (m *manager) OnCallBegin() error { +func (m *Manager) OnCallBegin() error { if m.isClosed() { return nil } @@ -227,7 +200,7 @@ func (m *manager) OnCallBegin() error { // Channel is either in idle mode or is in the process of moving to idle // mode. Attempt to exit idle mode to allow this RPC. - if err := m.exitIdleMode(); err != nil { + if err := m.ExitIdleMode(); err != nil { // Undo the increment to calls count, and return an error causing the // RPC to fail. atomic.AddInt32(&m.activeCallsCount, -1) @@ -238,28 +211,30 @@ func (m *manager) OnCallBegin() error { return nil } -// exitIdleMode instructs the channel to exit idle mode. -// -// Holds idleMu which ensures mutual exclusion with tryEnterIdleMode. -func (m *manager) exitIdleMode() error { +// ExitIdleMode instructs m to call the enforcer's ExitIdleMode and update m's +// internal state. +func (m *Manager) ExitIdleMode() error { + // Holds idleMu which ensures mutual exclusion with tryEnterIdleMode. m.idleMu.Lock() defer m.idleMu.Unlock() - if !m.actuallyIdle { - // This can happen in two scenarios: + if m.isClosed() || !m.actuallyIdle { + // This can happen in three scenarios: // - handleIdleTimeout() set the calls count to -math.MaxInt32 and called // tryEnterIdleMode(). But before the latter could grab the lock, an RPC // came in and OnCallBegin() noticed that the calls count is negative. // - Channel is in idle mode, and multiple new RPCs come in at the same // time, all of them notice a negative calls count in OnCallBegin and get // here. The first one to get the lock would got the channel to exit idle. + // - Channel is not in idle mode, and the user calls Connect which calls + // m.ExitIdleMode. // - // Either way, nothing to do here. + // In any case, there is nothing to do here. return nil } if err := m.enforcer.ExitIdleMode(); err != nil { - return fmt.Errorf("channel failed to exit idle mode: %v", err) + return fmt.Errorf("failed to exit idle mode: %w", err) } // Undo the idle entry process. This also respects any new RPC attempts. @@ -267,12 +242,12 @@ func (m *manager) exitIdleMode() error { m.actuallyIdle = false // Start a new timer to fire after the configured idle timeout. - m.timer = timeAfterFunc(time.Duration(m.timeout), m.handleIdleTimeout) + m.resetIdleTimerLocked(m.timeout) return nil } // OnCallEnd is invoked at the end of every RPC. -func (m *manager) OnCallEnd() { +func (m *Manager) OnCallEnd() { if m.isClosed() { return } @@ -287,15 +262,17 @@ func (m *manager) OnCallEnd() { atomic.AddInt32(&m.activeCallsCount, -1) } -func (m *manager) isClosed() bool { +func (m *Manager) isClosed() bool { return atomic.LoadInt32(&m.closed) == 1 } -func (m *manager) Close() { +func (m *Manager) Close() { atomic.StoreInt32(&m.closed, 1) m.idleMu.Lock() - m.timer.Stop() - m.timer = nil + if m.timer != nil { + m.timer.Stop() + m.timer = nil + } m.idleMu.Unlock() } diff --git a/vendor/google.golang.org/grpc/internal/internal.go b/vendor/google.golang.org/grpc/internal/internal.go index 0d94c63e0..2549fe8e3 100644 --- a/vendor/google.golang.org/grpc/internal/internal.go +++ b/vendor/google.golang.org/grpc/internal/internal.go @@ -73,6 +73,11 @@ var ( // xDS-enabled server invokes this method on a grpc.Server when a particular // listener moves to "not-serving" mode. DrainServerTransports any // func(*grpc.Server, string) + // IsRegisteredMethod returns whether the passed in method is registered as + // a method on the server. + IsRegisteredMethod any // func(*grpc.Server, string) bool + // ServerFromContext returns the server from the context. + ServerFromContext any // func(context.Context) *grpc.Server // AddGlobalServerOptions adds an array of ServerOption that will be // effective globally for newly created servers. The priority will be: 1. // user-provided; 2. this method; 3. default values. @@ -177,10 +182,12 @@ var ( GRPCResolverSchemeExtraMetadata string = "xds" // EnterIdleModeForTesting gets the ClientConn to enter IDLE mode. - EnterIdleModeForTesting any // func(*grpc.ClientConn) error + EnterIdleModeForTesting any // func(*grpc.ClientConn) // ExitIdleModeForTesting gets the ClientConn to exit IDLE mode. ExitIdleModeForTesting any // func(*grpc.ClientConn) error + + ChannelzTurnOffForTesting func() ) // HealthChecker defines the signature of the client-side LB channel health checking function. diff --git a/vendor/google.golang.org/grpc/internal/resolver/dns/dns_resolver.go b/vendor/google.golang.org/grpc/internal/resolver/dns/dns_resolver.go index 99e1e5b36..b66dcb213 100644 --- a/vendor/google.golang.org/grpc/internal/resolver/dns/dns_resolver.go +++ b/vendor/google.golang.org/grpc/internal/resolver/dns/dns_resolver.go @@ -23,7 +23,6 @@ package dns import ( "context" "encoding/json" - "errors" "fmt" "net" "os" @@ -37,6 +36,7 @@ import ( "google.golang.org/grpc/internal/backoff" "google.golang.org/grpc/internal/envconfig" "google.golang.org/grpc/internal/grpcrand" + "google.golang.org/grpc/internal/resolver/dns/internal" "google.golang.org/grpc/resolver" "google.golang.org/grpc/serviceconfig" ) @@ -47,15 +47,11 @@ var EnableSRVLookups = false var logger = grpclog.Component("dns") -// Globals to stub out in tests. TODO: Perhaps these two can be combined into a -// single variable for testing the resolver? -var ( - newTimer = time.NewTimer - newTimerDNSResRate = time.NewTimer -) - func init() { resolver.Register(NewBuilder()) + internal.TimeAfterFunc = time.After + internal.NewNetResolver = newNetResolver + internal.AddressDialer = addressDialer } const ( @@ -70,23 +66,6 @@ const ( txtAttribute = "grpc_config=" ) -var ( - errMissingAddr = errors.New("dns resolver: missing address") - - // Addresses ending with a colon that is supposed to be the separator - // between host and port is not allowed. E.g. "::" is a valid address as - // it is an IPv6 address (host only) and "[::]:" is invalid as it ends with - // a colon as the host and port separator - errEndsWithColon = errors.New("dns resolver: missing port after port-separator colon") -) - -var ( - defaultResolver netResolver = net.DefaultResolver - // To prevent excessive re-resolution, we enforce a rate limit on DNS - // resolution requests. - minDNSResRate = 30 * time.Second -) - var addressDialer = func(address string) func(context.Context, string, string) (net.Conn, error) { return func(ctx context.Context, network, _ string) (net.Conn, error) { var dialer net.Dialer @@ -94,7 +73,11 @@ var addressDialer = func(address string) func(context.Context, string, string) ( } } -var newNetResolver = func(authority string) (netResolver, error) { +var newNetResolver = func(authority string) (internal.NetResolver, error) { + if authority == "" { + return net.DefaultResolver, nil + } + host, port, err := parseTarget(authority, defaultDNSSvrPort) if err != nil { return nil, err @@ -104,7 +87,7 @@ var newNetResolver = func(authority string) (netResolver, error) { return &net.Resolver{ PreferGo: true, - Dial: addressDialer(authorityWithPort), + Dial: internal.AddressDialer(authorityWithPort), }, nil } @@ -142,13 +125,9 @@ func (b *dnsBuilder) Build(target resolver.Target, cc resolver.ClientConn, opts disableServiceConfig: opts.DisableServiceConfig, } - if target.URL.Host == "" { - d.resolver = defaultResolver - } else { - d.resolver, err = newNetResolver(target.URL.Host) - if err != nil { - return nil, err - } + d.resolver, err = internal.NewNetResolver(target.URL.Host) + if err != nil { + return nil, err } d.wg.Add(1) @@ -161,12 +140,6 @@ func (b *dnsBuilder) Scheme() string { return "dns" } -type netResolver interface { - LookupHost(ctx context.Context, host string) (addrs []string, err error) - LookupSRV(ctx context.Context, service, proto, name string) (cname string, addrs []*net.SRV, err error) - LookupTXT(ctx context.Context, name string) (txts []string, err error) -} - // deadResolver is a resolver that does nothing. type deadResolver struct{} @@ -178,7 +151,7 @@ func (deadResolver) Close() {} type dnsResolver struct { host string port string - resolver netResolver + resolver internal.NetResolver ctx context.Context cancel context.CancelFunc cc resolver.ClientConn @@ -223,29 +196,27 @@ func (d *dnsResolver) watcher() { err = d.cc.UpdateState(*state) } - var timer *time.Timer + var waitTime time.Duration if err == nil { // Success resolving, wait for the next ResolveNow. However, also wait 30 // seconds at the very least to prevent constantly re-resolving. backoffIndex = 1 - timer = newTimerDNSResRate(minDNSResRate) + waitTime = internal.MinResolutionRate select { case <-d.ctx.Done(): - timer.Stop() return case <-d.rn: } } else { // Poll on an error found in DNS Resolver or an error received from // ClientConn. - timer = newTimer(backoff.DefaultExponential.Backoff(backoffIndex)) + waitTime = backoff.DefaultExponential.Backoff(backoffIndex) backoffIndex++ } select { case <-d.ctx.Done(): - timer.Stop() return - case <-timer.C: + case <-internal.TimeAfterFunc(waitTime): } } } @@ -387,7 +358,7 @@ func formatIP(addr string) (addrIP string, ok bool) { // target: ":80" defaultPort: "443" returns host: "localhost", port: "80" func parseTarget(target, defaultPort string) (host, port string, err error) { if target == "" { - return "", "", errMissingAddr + return "", "", internal.ErrMissingAddr } if ip := net.ParseIP(target); ip != nil { // target is an IPv4 or IPv6(without brackets) address @@ -397,7 +368,7 @@ func parseTarget(target, defaultPort string) (host, port string, err error) { if port == "" { // If the port field is empty (target ends with colon), e.g. "[::1]:", // this is an error. - return "", "", errEndsWithColon + return "", "", internal.ErrEndsWithColon } // target has port, i.e ipv4-host:port, [ipv6-host]:port, host-name:port if host == "" { diff --git a/vendor/google.golang.org/grpc/internal/resolver/dns/internal/internal.go b/vendor/google.golang.org/grpc/internal/resolver/dns/internal/internal.go new file mode 100644 index 000000000..c7fc557d0 --- /dev/null +++ b/vendor/google.golang.org/grpc/internal/resolver/dns/internal/internal.go @@ -0,0 +1,70 @@ +/* + * + * Copyright 2023 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +// Package internal contains functionality internal to the dns resolver package. +package internal + +import ( + "context" + "errors" + "net" + "time" +) + +// NetResolver groups the methods on net.Resolver that are used by the DNS +// resolver implementation. This allows the default net.Resolver instance to be +// overidden from tests. +type NetResolver interface { + LookupHost(ctx context.Context, host string) (addrs []string, err error) + LookupSRV(ctx context.Context, service, proto, name string) (cname string, addrs []*net.SRV, err error) + LookupTXT(ctx context.Context, name string) (txts []string, err error) +} + +var ( + // ErrMissingAddr is the error returned when building a DNS resolver when + // the provided target name is empty. + ErrMissingAddr = errors.New("dns resolver: missing address") + + // ErrEndsWithColon is the error returned when building a DNS resolver when + // the provided target name ends with a colon that is supposed to be the + // separator between host and port. E.g. "::" is a valid address as it is + // an IPv6 address (host only) and "[::]:" is invalid as it ends with a + // colon as the host and port separator + ErrEndsWithColon = errors.New("dns resolver: missing port after port-separator colon") +) + +// The following vars are overridden from tests. +var ( + // MinResolutionRate is the minimum rate at which re-resolutions are + // allowed. This helps to prevent excessive re-resolution. + MinResolutionRate = 30 * time.Second + + // TimeAfterFunc is used by the DNS resolver to wait for the given duration + // to elapse. In non-test code, this is implemented by time.After. In test + // code, this can be used to control the amount of time the resolver is + // blocked waiting for the duration to elapse. + TimeAfterFunc func(time.Duration) <-chan time.Time + + // NewNetResolver returns the net.Resolver instance for the given target. + NewNetResolver func(string) (NetResolver, error) + + // AddressDialer is the dialer used to dial the DNS server. It accepts the + // Host portion of the URL corresponding to the user's dial target and + // returns a dial function. + AddressDialer func(address string) func(context.Context, string, string) (net.Conn, error) +) diff --git a/vendor/google.golang.org/grpc/internal/tcp_keepalive_nonunix.go b/vendor/google.golang.org/grpc/internal/tcp_keepalive_nonunix.go new file mode 100644 index 000000000..aeffd3e1c --- /dev/null +++ b/vendor/google.golang.org/grpc/internal/tcp_keepalive_nonunix.go @@ -0,0 +1,29 @@ +//go:build !unix + +/* + * Copyright 2023 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package internal + +import ( + "net" +) + +// NetDialerWithTCPKeepalive returns a vanilla net.Dialer on non-unix platforms. +func NetDialerWithTCPKeepalive() *net.Dialer { + return &net.Dialer{} +} diff --git a/vendor/google.golang.org/grpc/internal/tcp_keepalive_unix.go b/vendor/google.golang.org/grpc/internal/tcp_keepalive_unix.go new file mode 100644 index 000000000..078137b7f --- /dev/null +++ b/vendor/google.golang.org/grpc/internal/tcp_keepalive_unix.go @@ -0,0 +1,54 @@ +//go:build unix + +/* + * Copyright 2023 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package internal + +import ( + "net" + "syscall" + "time" + + "golang.org/x/sys/unix" +) + +// NetDialerWithTCPKeepalive returns a net.Dialer that enables TCP keepalives on +// the underlying connection with OS default values for keepalive parameters. +// +// TODO: Once https://github.com/golang/go/issues/62254 lands, and the +// appropriate Go version becomes less than our least supported Go version, we +// should look into using the new API to make things more straightforward. +func NetDialerWithTCPKeepalive() *net.Dialer { + return &net.Dialer{ + // Setting a negative value here prevents the Go stdlib from overriding + // the values of TCP keepalive time and interval. It also prevents the + // Go stdlib from enabling TCP keepalives by default. + KeepAlive: time.Duration(-1), + // This method is called after the underlying network socket is created, + // but before dialing the socket (or calling its connect() method). The + // combination of unconditionally enabling TCP keepalives here, and + // disabling the overriding of TCP keepalive parameters by setting the + // KeepAlive field to a negative value above, results in OS defaults for + // the TCP keealive interval and time parameters. + Control: func(_, _ string, c syscall.RawConn) error { + return c.Control(func(fd uintptr) { + unix.SetsockoptInt(int(fd), unix.SOL_SOCKET, unix.SO_KEEPALIVE, 1) + }) + }, + } +} diff --git a/vendor/google.golang.org/grpc/internal/transport/handler_server.go b/vendor/google.golang.org/grpc/internal/transport/handler_server.go index 17f7a21b5..a9d70e2a1 100644 --- a/vendor/google.golang.org/grpc/internal/transport/handler_server.go +++ b/vendor/google.golang.org/grpc/internal/transport/handler_server.go @@ -75,11 +75,25 @@ func NewServerHandlerTransport(w http.ResponseWriter, r *http.Request, stats []s return nil, errors.New(msg) } + var localAddr net.Addr + if la := r.Context().Value(http.LocalAddrContextKey); la != nil { + localAddr, _ = la.(net.Addr) + } + var authInfo credentials.AuthInfo + if r.TLS != nil { + authInfo = credentials.TLSInfo{State: *r.TLS, CommonAuthInfo: credentials.CommonAuthInfo{SecurityLevel: credentials.PrivacyAndIntegrity}} + } + p := peer.Peer{ + Addr: strAddr(r.RemoteAddr), + LocalAddr: localAddr, + AuthInfo: authInfo, + } st := &serverHandlerTransport{ rw: w, req: r, closedCh: make(chan struct{}), writes: make(chan func()), + peer: p, contentType: contentType, contentSubtype: contentSubtype, stats: stats, @@ -134,6 +148,8 @@ type serverHandlerTransport struct { headerMD metadata.MD + peer peer.Peer + closeOnce sync.Once closedCh chan struct{} // closed on Close @@ -165,7 +181,13 @@ func (ht *serverHandlerTransport) Close(err error) { }) } -func (ht *serverHandlerTransport) RemoteAddr() net.Addr { return strAddr(ht.req.RemoteAddr) } +func (ht *serverHandlerTransport) Peer() *peer.Peer { + return &peer.Peer{ + Addr: ht.peer.Addr, + LocalAddr: ht.peer.LocalAddr, + AuthInfo: ht.peer.AuthInfo, + } +} // strAddr is a net.Addr backed by either a TCP "ip:port" string, or // the empty string if unknown. @@ -347,10 +369,8 @@ func (ht *serverHandlerTransport) WriteHeader(s *Stream, md metadata.MD) error { return err } -func (ht *serverHandlerTransport) HandleStreams(startStream func(*Stream)) { +func (ht *serverHandlerTransport) HandleStreams(ctx context.Context, startStream func(*Stream)) { // With this transport type there will be exactly 1 stream: this HTTP request. - - ctx := ht.req.Context() var cancel context.CancelFunc if ht.timeoutSet { ctx, cancel = context.WithTimeout(ctx, ht.timeout) @@ -370,34 +390,19 @@ func (ht *serverHandlerTransport) HandleStreams(startStream func(*Stream)) { ht.Close(errors.New("request is done processing")) }() + ctx = metadata.NewIncomingContext(ctx, ht.headerMD) req := ht.req - s := &Stream{ - id: 0, // irrelevant - requestRead: func(int) {}, - cancel: cancel, - buf: newRecvBuffer(), - st: ht, - method: req.URL.Path, - recvCompress: req.Header.Get("grpc-encoding"), - contentSubtype: ht.contentSubtype, - } - pr := &peer.Peer{ - Addr: ht.RemoteAddr(), - } - if req.TLS != nil { - pr.AuthInfo = credentials.TLSInfo{State: *req.TLS, CommonAuthInfo: credentials.CommonAuthInfo{SecurityLevel: credentials.PrivacyAndIntegrity}} - } - ctx = metadata.NewIncomingContext(ctx, ht.headerMD) - s.ctx = peer.NewContext(ctx, pr) - for _, sh := range ht.stats { - s.ctx = sh.TagRPC(s.ctx, &stats.RPCTagInfo{FullMethodName: s.method}) - inHeader := &stats.InHeader{ - FullMethod: s.method, - RemoteAddr: ht.RemoteAddr(), - Compression: s.recvCompress, - } - sh.HandleRPC(s.ctx, inHeader) + id: 0, // irrelevant + ctx: ctx, + requestRead: func(int) {}, + cancel: cancel, + buf: newRecvBuffer(), + st: ht, + method: req.URL.Path, + recvCompress: req.Header.Get("grpc-encoding"), + contentSubtype: ht.contentSubtype, + headerWireLength: 0, // won't have access to header wire length until golang/go#18997. } s.trReader = &transportReader{ reader: &recvBufferReader{ctx: s.ctx, ctxDone: s.ctx.Done(), recv: s.buf, freeBuffer: func(*bytes.Buffer) {}}, diff --git a/vendor/google.golang.org/grpc/internal/transport/http2_client.go b/vendor/google.golang.org/grpc/internal/transport/http2_client.go index d6f5c4935..59f67655a 100644 --- a/vendor/google.golang.org/grpc/internal/transport/http2_client.go +++ b/vendor/google.golang.org/grpc/internal/transport/http2_client.go @@ -36,6 +36,7 @@ import ( "golang.org/x/net/http2/hpack" "google.golang.org/grpc/codes" "google.golang.org/grpc/credentials" + "google.golang.org/grpc/internal" "google.golang.org/grpc/internal/channelz" icredentials "google.golang.org/grpc/internal/credentials" "google.golang.org/grpc/internal/grpclog" @@ -43,7 +44,7 @@ import ( "google.golang.org/grpc/internal/grpcutil" imetadata "google.golang.org/grpc/internal/metadata" istatus "google.golang.org/grpc/internal/status" - "google.golang.org/grpc/internal/syscall" + isyscall "google.golang.org/grpc/internal/syscall" "google.golang.org/grpc/internal/transport/networktype" "google.golang.org/grpc/keepalive" "google.golang.org/grpc/metadata" @@ -176,7 +177,7 @@ func dial(ctx context.Context, fn func(context.Context, string) (net.Conn, error if networkType == "tcp" && useProxy { return proxyDial(ctx, address, grpcUA) } - return (&net.Dialer{}).DialContext(ctx, networkType, address) + return internal.NetDialerWithTCPKeepalive().DialContext(ctx, networkType, address) } func isTemporary(err error) bool { @@ -262,7 +263,7 @@ func newHTTP2Client(connectCtx, ctx context.Context, addr resolver.Address, opts } keepaliveEnabled := false if kp.Time != infinity { - if err = syscall.SetTCPUserTimeout(conn, kp.Timeout); err != nil { + if err = isyscall.SetTCPUserTimeout(conn, kp.Timeout); err != nil { return nil, connectionErrorf(false, err, "transport: failed to set TCP_USER_TIMEOUT: %v", err) } keepaliveEnabled = true @@ -493,8 +494,9 @@ func (t *http2Client) newStream(ctx context.Context, callHdr *CallHdr) *Stream { func (t *http2Client) getPeer() *peer.Peer { return &peer.Peer{ - Addr: t.remoteAddr, - AuthInfo: t.authInfo, // Can be nil + Addr: t.remoteAddr, + AuthInfo: t.authInfo, // Can be nil + LocalAddr: t.localAddr, } } diff --git a/vendor/google.golang.org/grpc/internal/transport/http2_server.go b/vendor/google.golang.org/grpc/internal/transport/http2_server.go index 6fa1eb419..680c9eba0 100644 --- a/vendor/google.golang.org/grpc/internal/transport/http2_server.go +++ b/vendor/google.golang.org/grpc/internal/transport/http2_server.go @@ -68,18 +68,15 @@ var serverConnectionCounter uint64 // http2Server implements the ServerTransport interface with HTTP2. type http2Server struct { - lastRead int64 // Keep this field 64-bit aligned. Accessed atomically. - ctx context.Context - done chan struct{} - conn net.Conn - loopy *loopyWriter - readerDone chan struct{} // sync point to enable testing. - writerDone chan struct{} // sync point to enable testing. - remoteAddr net.Addr - localAddr net.Addr - authInfo credentials.AuthInfo // auth info about the connection - inTapHandle tap.ServerInHandle - framer *framer + lastRead int64 // Keep this field 64-bit aligned. Accessed atomically. + done chan struct{} + conn net.Conn + loopy *loopyWriter + readerDone chan struct{} // sync point to enable testing. + loopyWriterDone chan struct{} + peer peer.Peer + inTapHandle tap.ServerInHandle + framer *framer // The max number of concurrent streams. maxStreams uint32 // controlBuf delivers all the control related tasks (e.g., window @@ -243,16 +240,18 @@ func NewServerTransport(conn net.Conn, config *ServerConfig) (_ ServerTransport, } done := make(chan struct{}) + peer := peer.Peer{ + Addr: conn.RemoteAddr(), + LocalAddr: conn.LocalAddr(), + AuthInfo: authInfo, + } t := &http2Server{ - ctx: setConnection(context.Background(), rawConn), done: done, conn: conn, - remoteAddr: conn.RemoteAddr(), - localAddr: conn.LocalAddr(), - authInfo: authInfo, + peer: peer, framer: framer, readerDone: make(chan struct{}), - writerDone: make(chan struct{}), + loopyWriterDone: make(chan struct{}), maxStreams: config.MaxStreams, inTapHandle: config.InTapHandle, fc: &trInFlow{limit: uint32(icwz)}, @@ -267,8 +266,6 @@ func NewServerTransport(conn net.Conn, config *ServerConfig) (_ ServerTransport, bufferPool: newBufferPool(), } t.logger = prefixLoggerForServerTransport(t) - // Add peer information to the http2server context. - t.ctx = peer.NewContext(t.ctx, t.getPeer()) t.controlBuf = newControlBuffer(t.done) if dynamicWindow { @@ -277,15 +274,7 @@ func NewServerTransport(conn net.Conn, config *ServerConfig) (_ ServerTransport, updateFlowControl: t.updateFlowControl, } } - for _, sh := range t.stats { - t.ctx = sh.TagConn(t.ctx, &stats.ConnTagInfo{ - RemoteAddr: t.remoteAddr, - LocalAddr: t.localAddr, - }) - connBegin := &stats.ConnBegin{} - sh.HandleConn(t.ctx, connBegin) - } - t.channelzID, err = channelz.RegisterNormalSocket(t, config.ChannelzParentID, fmt.Sprintf("%s -> %s", t.remoteAddr, t.localAddr)) + t.channelzID, err = channelz.RegisterNormalSocket(t, config.ChannelzParentID, fmt.Sprintf("%s -> %s", t.peer.Addr, t.peer.LocalAddr)) if err != nil { return nil, err } @@ -334,7 +323,7 @@ func NewServerTransport(conn net.Conn, config *ServerConfig) (_ ServerTransport, t.loopy = newLoopyWriter(serverSide, t.framer, t.controlBuf, t.bdpEst, t.conn, t.logger) t.loopy.ssGoAwayHandler = t.outgoingGoAwayHandler t.loopy.run() - close(t.writerDone) + close(t.loopyWriterDone) }() go t.keepalive() return t, nil @@ -342,7 +331,7 @@ func NewServerTransport(conn net.Conn, config *ServerConfig) (_ ServerTransport, // operateHeaders takes action on the decoded headers. Returns an error if fatal // error encountered and transport needs to close, otherwise returns nil. -func (t *http2Server) operateHeaders(frame *http2.MetaHeadersFrame, handle func(*Stream)) error { +func (t *http2Server) operateHeaders(ctx context.Context, frame *http2.MetaHeadersFrame, handle func(*Stream)) error { // Acquire max stream ID lock for entire duration t.maxStreamMu.Lock() defer t.maxStreamMu.Unlock() @@ -369,10 +358,11 @@ func (t *http2Server) operateHeaders(frame *http2.MetaHeadersFrame, handle func( buf := newRecvBuffer() s := &Stream{ - id: streamID, - st: t, - buf: buf, - fc: &inFlow{limit: uint32(t.initialWindowSize)}, + id: streamID, + st: t, + buf: buf, + fc: &inFlow{limit: uint32(t.initialWindowSize)}, + headerWireLength: int(frame.Header().Length), } var ( // if false, content-type was missing or invalid @@ -511,9 +501,9 @@ func (t *http2Server) operateHeaders(frame *http2.MetaHeadersFrame, handle func( s.state = streamReadDone } if timeoutSet { - s.ctx, s.cancel = context.WithTimeout(t.ctx, timeout) + s.ctx, s.cancel = context.WithTimeout(ctx, timeout) } else { - s.ctx, s.cancel = context.WithCancel(t.ctx) + s.ctx, s.cancel = context.WithCancel(ctx) } // Attach the received metadata to the context. @@ -592,18 +582,6 @@ func (t *http2Server) operateHeaders(frame *http2.MetaHeadersFrame, handle func( s.requestRead = func(n int) { t.adjustWindow(s, uint32(n)) } - for _, sh := range t.stats { - s.ctx = sh.TagRPC(s.ctx, &stats.RPCTagInfo{FullMethodName: s.method}) - inHeader := &stats.InHeader{ - FullMethod: s.method, - RemoteAddr: t.remoteAddr, - LocalAddr: t.localAddr, - Compression: s.recvCompress, - WireLength: int(frame.Header().Length), - Header: mdata.Copy(), - } - sh.HandleRPC(s.ctx, inHeader) - } s.ctxDone = s.ctx.Done() s.wq = newWriteQuota(defaultWriteQuota, s.ctxDone) s.trReader = &transportReader{ @@ -629,8 +607,11 @@ func (t *http2Server) operateHeaders(frame *http2.MetaHeadersFrame, handle func( // HandleStreams receives incoming streams using the given handler. This is // typically run in a separate goroutine. // traceCtx attaches trace to ctx and returns the new context. -func (t *http2Server) HandleStreams(handle func(*Stream)) { - defer close(t.readerDone) +func (t *http2Server) HandleStreams(ctx context.Context, handle func(*Stream)) { + defer func() { + <-t.loopyWriterDone + close(t.readerDone) + }() for { t.controlBuf.throttle() frame, err := t.framer.fr.ReadFrame() @@ -664,7 +645,7 @@ func (t *http2Server) HandleStreams(handle func(*Stream)) { } switch frame := frame.(type) { case *http2.MetaHeadersFrame: - if err := t.operateHeaders(frame, handle); err != nil { + if err := t.operateHeaders(ctx, frame, handle); err != nil { t.Close(err) break } @@ -1242,10 +1223,6 @@ func (t *http2Server) Close(err error) { for _, s := range streams { s.cancel() } - for _, sh := range t.stats { - connEnd := &stats.ConnEnd{} - sh.HandleConn(t.ctx, connEnd) - } } // deleteStream deletes the stream s from transport's active streams. @@ -1311,10 +1288,6 @@ func (t *http2Server) closeStream(s *Stream, rst bool, rstCode http2.ErrCode, eo }) } -func (t *http2Server) RemoteAddr() net.Addr { - return t.remoteAddr -} - func (t *http2Server) Drain(debugData string) { t.mu.Lock() defer t.mu.Unlock() @@ -1397,11 +1370,11 @@ func (t *http2Server) ChannelzMetric() *channelz.SocketInternalMetric { LastMessageReceivedTimestamp: time.Unix(0, atomic.LoadInt64(&t.czData.lastMsgRecvTime)), LocalFlowControlWindow: int64(t.fc.getSize()), SocketOptions: channelz.GetSocketOption(t.conn), - LocalAddr: t.localAddr, - RemoteAddr: t.remoteAddr, + LocalAddr: t.peer.LocalAddr, + RemoteAddr: t.peer.Addr, // RemoteName : } - if au, ok := t.authInfo.(credentials.ChannelzSecurityInfo); ok { + if au, ok := t.peer.AuthInfo.(credentials.ChannelzSecurityInfo); ok { s.Security = au.GetSecurityValue() } s.RemoteFlowControlWindow = t.getOutFlowWindow() @@ -1433,10 +1406,12 @@ func (t *http2Server) getOutFlowWindow() int64 { } } -func (t *http2Server) getPeer() *peer.Peer { +// Peer returns the peer of the transport. +func (t *http2Server) Peer() *peer.Peer { return &peer.Peer{ - Addr: t.remoteAddr, - AuthInfo: t.authInfo, // Can be nil + Addr: t.peer.Addr, + LocalAddr: t.peer.LocalAddr, + AuthInfo: t.peer.AuthInfo, // Can be nil } } @@ -1461,6 +1436,6 @@ func GetConnection(ctx context.Context) net.Conn { // SetConnection adds the connection to the context to be able to get // information about the destination ip and port for an incoming RPC. This also // allows any unary or streaming interceptors to see the connection. -func setConnection(ctx context.Context, conn net.Conn) context.Context { +func SetConnection(ctx context.Context, conn net.Conn) context.Context { return context.WithValue(ctx, connectionKey{}, conn) } diff --git a/vendor/google.golang.org/grpc/internal/transport/proxy.go b/vendor/google.golang.org/grpc/internal/transport/proxy.go index 415961987..24fa10325 100644 --- a/vendor/google.golang.org/grpc/internal/transport/proxy.go +++ b/vendor/google.golang.org/grpc/internal/transport/proxy.go @@ -28,6 +28,8 @@ import ( "net/http" "net/http/httputil" "net/url" + + "google.golang.org/grpc/internal" ) const proxyAuthHeaderKey = "Proxy-Authorization" @@ -112,7 +114,7 @@ func doHTTPConnectHandshake(ctx context.Context, conn net.Conn, backendAddr stri // proxyDial dials, connecting to a proxy first if necessary. Checks if a proxy // is necessary, dials, does the HTTP CONNECT handshake, and returns the // connection. -func proxyDial(ctx context.Context, addr string, grpcUA string) (conn net.Conn, err error) { +func proxyDial(ctx context.Context, addr string, grpcUA string) (net.Conn, error) { newAddr := addr proxyURL, err := mapAddress(addr) if err != nil { @@ -122,15 +124,15 @@ func proxyDial(ctx context.Context, addr string, grpcUA string) (conn net.Conn, newAddr = proxyURL.Host } - conn, err = (&net.Dialer{}).DialContext(ctx, "tcp", newAddr) + conn, err := internal.NetDialerWithTCPKeepalive().DialContext(ctx, "tcp", newAddr) if err != nil { - return + return nil, err } - if proxyURL != nil { + if proxyURL == nil { // proxy is disabled if proxyURL is nil. - conn, err = doHTTPConnectHandshake(ctx, conn, addr, proxyURL, grpcUA) + return conn, err } - return + return doHTTPConnectHandshake(ctx, conn, addr, proxyURL, grpcUA) } func sendHTTPRequest(ctx context.Context, req *http.Request, conn net.Conn) error { diff --git a/vendor/google.golang.org/grpc/internal/transport/transport.go b/vendor/google.golang.org/grpc/internal/transport/transport.go index aac056e72..b7b8fec18 100644 --- a/vendor/google.golang.org/grpc/internal/transport/transport.go +++ b/vendor/google.golang.org/grpc/internal/transport/transport.go @@ -37,6 +37,7 @@ import ( "google.golang.org/grpc/internal/channelz" "google.golang.org/grpc/keepalive" "google.golang.org/grpc/metadata" + "google.golang.org/grpc/peer" "google.golang.org/grpc/resolver" "google.golang.org/grpc/stats" "google.golang.org/grpc/status" @@ -265,7 +266,8 @@ type Stream struct { // headerValid indicates whether a valid header was received. Only // meaningful after headerChan is closed (always call waitOnHeader() before // reading its value). Not valid on server side. - headerValid bool + headerValid bool + headerWireLength int // Only set on server side. // hdrMu protects header and trailer metadata on the server-side. hdrMu sync.Mutex @@ -425,6 +427,12 @@ func (s *Stream) Context() context.Context { return s.ctx } +// SetContext sets the context of the stream. This will be deleted once the +// stats handler callouts all move to gRPC layer. +func (s *Stream) SetContext(ctx context.Context) { + s.ctx = ctx +} + // Method returns the method for the stream. func (s *Stream) Method() string { return s.method @@ -437,6 +445,12 @@ func (s *Stream) Status() *status.Status { return s.status } +// HeaderWireLength returns the size of the headers of the stream as received +// from the wire. Valid only on the server. +func (s *Stream) HeaderWireLength() int { + return s.headerWireLength +} + // SetHeader sets the header metadata. This can be called multiple times. // Server side only. // This should not be called in parallel to other data writes. @@ -698,7 +712,7 @@ type ClientTransport interface { // Write methods for a given Stream will be called serially. type ServerTransport interface { // HandleStreams receives incoming streams using the given handler. - HandleStreams(func(*Stream)) + HandleStreams(context.Context, func(*Stream)) // WriteHeader sends the header metadata for the given stream. // WriteHeader may not be called on all streams. @@ -717,8 +731,8 @@ type ServerTransport interface { // handlers will be terminated asynchronously. Close(err error) - // RemoteAddr returns the remote network address. - RemoteAddr() net.Addr + // Peer returns the peer of the server transport. + Peer() *peer.Peer // Drain notifies the client this ServerTransport stops accepting new RPCs. Drain(debugData string) diff --git a/vendor/google.golang.org/grpc/metadata/metadata.go b/vendor/google.golang.org/grpc/metadata/metadata.go index a2cdcaf12..494468257 100644 --- a/vendor/google.golang.org/grpc/metadata/metadata.go +++ b/vendor/google.golang.org/grpc/metadata/metadata.go @@ -153,14 +153,16 @@ func Join(mds ...MD) MD { type mdIncomingKey struct{} type mdOutgoingKey struct{} -// NewIncomingContext creates a new context with incoming md attached. +// NewIncomingContext creates a new context with incoming md attached. md must +// not be modified after calling this function. func NewIncomingContext(ctx context.Context, md MD) context.Context { return context.WithValue(ctx, mdIncomingKey{}, md) } // NewOutgoingContext creates a new context with outgoing md attached. If used // in conjunction with AppendToOutgoingContext, NewOutgoingContext will -// overwrite any previously-appended metadata. +// overwrite any previously-appended metadata. md must not be modified after +// calling this function. func NewOutgoingContext(ctx context.Context, md MD) context.Context { return context.WithValue(ctx, mdOutgoingKey{}, rawMD{md: md}) } @@ -203,7 +205,8 @@ func FromIncomingContext(ctx context.Context) (MD, bool) { } // ValueFromIncomingContext returns the metadata value corresponding to the metadata -// key from the incoming metadata if it exists. Key must be lower-case. +// key from the incoming metadata if it exists. Keys are matched in a case insensitive +// manner. // // # Experimental // @@ -219,17 +222,16 @@ func ValueFromIncomingContext(ctx context.Context, key string) []string { return copyOf(v) } for k, v := range md { - // We need to manually convert all keys to lower case, because MD is a - // map, and there's no guarantee that the MD attached to the context is - // created using our helper functions. - if strings.ToLower(k) == key { + // Case insenitive comparison: MD is a map, and there's no guarantee + // that the MD attached to the context is created using our helper + // functions. + if strings.EqualFold(k, key) { return copyOf(v) } } return nil } -// the returned slice must not be modified in place func copyOf(v []string) []string { vals := make([]string, len(v)) copy(vals, v) diff --git a/vendor/google.golang.org/grpc/peer/peer.go b/vendor/google.golang.org/grpc/peer/peer.go index e01d219ff..a821ff9b2 100644 --- a/vendor/google.golang.org/grpc/peer/peer.go +++ b/vendor/google.golang.org/grpc/peer/peer.go @@ -32,6 +32,8 @@ import ( type Peer struct { // Addr is the peer address. Addr net.Addr + // LocalAddr is the local address. + LocalAddr net.Addr // AuthInfo is the authentication information of the transport. // It is nil if there is no transport security being used. AuthInfo credentials.AuthInfo diff --git a/vendor/google.golang.org/grpc/picker_wrapper.go b/vendor/google.golang.org/grpc/picker_wrapper.go index 236837f41..bf56faa76 100644 --- a/vendor/google.golang.org/grpc/picker_wrapper.go +++ b/vendor/google.golang.org/grpc/picker_wrapper.go @@ -37,7 +37,6 @@ import ( type pickerWrapper struct { mu sync.Mutex done bool - idle bool blockingCh chan struct{} picker balancer.Picker statsHandlers []stats.Handler // to record blocking picker calls @@ -53,11 +52,7 @@ func newPickerWrapper(statsHandlers []stats.Handler) *pickerWrapper { // updatePicker is called by UpdateBalancerState. It unblocks all blocked pick. func (pw *pickerWrapper) updatePicker(p balancer.Picker) { pw.mu.Lock() - if pw.done || pw.idle { - // There is a small window where a picker update from the LB policy can - // race with the channel going to idle mode. If the picker is idle here, - // it is because the channel asked it to do so, and therefore it is sage - // to ignore the update from the LB policy. + if pw.done { pw.mu.Unlock() return } @@ -210,23 +205,15 @@ func (pw *pickerWrapper) close() { close(pw.blockingCh) } -func (pw *pickerWrapper) enterIdleMode() { - pw.mu.Lock() - defer pw.mu.Unlock() - if pw.done { - return - } - pw.idle = true -} - -func (pw *pickerWrapper) exitIdleMode() { +// reset clears the pickerWrapper and prepares it for being used again when idle +// mode is exited. +func (pw *pickerWrapper) reset() { pw.mu.Lock() defer pw.mu.Unlock() if pw.done { return } pw.blockingCh = make(chan struct{}) - pw.idle = false } // dropError is a wrapper error that indicates the LB policy wishes to drop the diff --git a/vendor/google.golang.org/grpc/pickfirst.go b/vendor/google.golang.org/grpc/pickfirst.go index 2e9cf66b4..5128f9364 100644 --- a/vendor/google.golang.org/grpc/pickfirst.go +++ b/vendor/google.golang.org/grpc/pickfirst.go @@ -25,7 +25,6 @@ import ( "google.golang.org/grpc/balancer" "google.golang.org/grpc/connectivity" - "google.golang.org/grpc/internal/envconfig" internalgrpclog "google.golang.org/grpc/internal/grpclog" "google.golang.org/grpc/internal/grpcrand" "google.golang.org/grpc/internal/pretty" @@ -65,19 +64,6 @@ type pfConfig struct { } func (*pickfirstBuilder) ParseConfig(js json.RawMessage) (serviceconfig.LoadBalancingConfig, error) { - if !envconfig.PickFirstLBConfig { - // Prior to supporting loadbalancing configuration, the pick_first LB - // policy did not implement the balancer.ConfigParser interface. This - // meant that if a non-empty configuration was passed to it, the service - // config unmarshaling code would throw a warning log, but would - // continue using the pick_first LB policy. The code below ensures the - // same behavior is retained if the env var is not set. - if string(js) != "{}" { - logger.Warningf("Ignoring non-empty balancer configuration %q for the pick_first LB policy", string(js)) - } - return nil, nil - } - var cfg pfConfig if err := json.Unmarshal(js, &cfg); err != nil { return nil, fmt.Errorf("pickfirst: unable to unmarshal LB policy config: %s, error: %v", string(js), err) diff --git a/vendor/google.golang.org/grpc/resolver/dns/dns_resolver.go b/vendor/google.golang.org/grpc/resolver/dns/dns_resolver.go new file mode 100644 index 000000000..14aa6f20a --- /dev/null +++ b/vendor/google.golang.org/grpc/resolver/dns/dns_resolver.go @@ -0,0 +1,36 @@ +/* + * + * Copyright 2018 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +// Package dns implements a dns resolver to be installed as the default resolver +// in grpc. +// +// Deprecated: this package is imported by grpc and should not need to be +// imported directly by users. +package dns + +import ( + "google.golang.org/grpc/internal/resolver/dns" + "google.golang.org/grpc/resolver" +) + +// NewBuilder creates a dnsBuilder which is used to factory DNS resolvers. +// +// Deprecated: import grpc and use resolver.Get("dns") instead. +func NewBuilder() resolver.Builder { + return dns.NewBuilder() +} diff --git a/vendor/google.golang.org/grpc/resolver/manual/manual.go b/vendor/google.golang.org/grpc/resolver/manual/manual.go index 0a4262342..f2efa2a2c 100644 --- a/vendor/google.golang.org/grpc/resolver/manual/manual.go +++ b/vendor/google.golang.org/grpc/resolver/manual/manual.go @@ -78,12 +78,12 @@ func (r *Resolver) InitialState(s resolver.State) { func (r *Resolver) Build(target resolver.Target, cc resolver.ClientConn, opts resolver.BuildOptions) (resolver.Resolver, error) { r.BuildCallback(target, cc, opts) r.mu.Lock() + defer r.mu.Unlock() r.CC = cc if r.lastSeenState != nil { err := r.CC.UpdateState(*r.lastSeenState) go r.UpdateStateCallback(err) } - r.mu.Unlock() return r, nil } @@ -105,15 +105,22 @@ func (r *Resolver) Close() { // UpdateState calls CC.UpdateState. func (r *Resolver) UpdateState(s resolver.State) { r.mu.Lock() - err := r.CC.UpdateState(s) + defer r.mu.Unlock() + var err error + if r.CC == nil { + panic("cannot update state as grpc.Dial with resolver has not been called") + } + err = r.CC.UpdateState(s) r.lastSeenState = &s - r.mu.Unlock() r.UpdateStateCallback(err) } // ReportError calls CC.ReportError. func (r *Resolver) ReportError(err error) { r.mu.Lock() + defer r.mu.Unlock() + if r.CC == nil { + panic("cannot report error as grpc.Dial with resolver has not been called") + } r.CC.ReportError(err) - r.mu.Unlock() } diff --git a/vendor/google.golang.org/grpc/resolver/map.go b/vendor/google.golang.org/grpc/resolver/map.go index 804be887d..ada5b9bb7 100644 --- a/vendor/google.golang.org/grpc/resolver/map.go +++ b/vendor/google.golang.org/grpc/resolver/map.go @@ -136,3 +136,116 @@ func (a *AddressMap) Values() []any { } return ret } + +type endpointNode struct { + addrs map[string]struct{} +} + +// Equal returns whether the unordered set of addrs are the same between the +// endpoint nodes. +func (en *endpointNode) Equal(en2 *endpointNode) bool { + if len(en.addrs) != len(en2.addrs) { + return false + } + for addr := range en.addrs { + if _, ok := en2.addrs[addr]; !ok { + return false + } + } + return true +} + +func toEndpointNode(endpoint Endpoint) endpointNode { + en := make(map[string]struct{}) + for _, addr := range endpoint.Addresses { + en[addr.Addr] = struct{}{} + } + return endpointNode{ + addrs: en, + } +} + +// EndpointMap is a map of endpoints to arbitrary values keyed on only the +// unordered set of address strings within an endpoint. This map is not thread +// safe, thus it is unsafe to access concurrently. Must be created via +// NewEndpointMap; do not construct directly. +type EndpointMap struct { + endpoints map[*endpointNode]any +} + +// NewEndpointMap creates a new EndpointMap. +func NewEndpointMap() *EndpointMap { + return &EndpointMap{ + endpoints: make(map[*endpointNode]any), + } +} + +// Get returns the value for the address in the map, if present. +func (em *EndpointMap) Get(e Endpoint) (value any, ok bool) { + en := toEndpointNode(e) + if endpoint := em.find(en); endpoint != nil { + return em.endpoints[endpoint], true + } + return nil, false +} + +// Set updates or adds the value to the address in the map. +func (em *EndpointMap) Set(e Endpoint, value any) { + en := toEndpointNode(e) + if endpoint := em.find(en); endpoint != nil { + em.endpoints[endpoint] = value + return + } + em.endpoints[&en] = value +} + +// Len returns the number of entries in the map. +func (em *EndpointMap) Len() int { + return len(em.endpoints) +} + +// Keys returns a slice of all current map keys, as endpoints specifying the +// addresses present in the endpoint keys, in which uniqueness is determined by +// the unordered set of addresses. Thus, endpoint information returned is not +// the full endpoint data (drops duplicated addresses and attributes) but can be +// used for EndpointMap accesses. +func (em *EndpointMap) Keys() []Endpoint { + ret := make([]Endpoint, 0, len(em.endpoints)) + for en := range em.endpoints { + var endpoint Endpoint + for addr := range en.addrs { + endpoint.Addresses = append(endpoint.Addresses, Address{Addr: addr}) + } + ret = append(ret, endpoint) + } + return ret +} + +// Values returns a slice of all current map values. +func (em *EndpointMap) Values() []any { + ret := make([]any, 0, len(em.endpoints)) + for _, val := range em.endpoints { + ret = append(ret, val) + } + return ret +} + +// find returns a pointer to the endpoint node in em if the endpoint node is +// already present. If not found, nil is returned. The comparisons are done on +// the unordered set of addresses within an endpoint. +func (em EndpointMap) find(e endpointNode) *endpointNode { + for endpoint := range em.endpoints { + if e.Equal(endpoint) { + return endpoint + } + } + return nil +} + +// Delete removes the specified endpoint from the map. +func (em *EndpointMap) Delete(e Endpoint) { + en := toEndpointNode(e) + if entry := em.find(en); entry != nil { + delete(em.endpoints, entry) + } +} diff --git a/vendor/google.golang.org/grpc/resolver/resolver.go b/vendor/google.golang.org/grpc/resolver/resolver.go index 11384e228..bd1c7d01b 100644 --- a/vendor/google.golang.org/grpc/resolver/resolver.go +++ b/vendor/google.golang.org/grpc/resolver/resolver.go @@ -240,11 +240,6 @@ type ClientConn interface { // // Deprecated: Use UpdateState instead. NewAddress(addresses []Address) - // NewServiceConfig is called by resolver to notify ClientConn a new - // service config. The service config should be provided as a json string. - // - // Deprecated: Use UpdateState instead. - NewServiceConfig(serviceConfig string) // ParseServiceConfig parses the provided service config and returns an // object that provides the parsed config. ParseServiceConfig(serviceConfigJSON string) *serviceconfig.ParseResult @@ -286,6 +281,11 @@ func (t Target) Endpoint() string { return strings.TrimPrefix(endpoint, "/") } +// String returns a string representation of Target. +func (t Target) String() string { + return t.URL.String() +} + // Builder creates a resolver that will be used to watch name resolution updates. type Builder interface { // Build creates a new resolver for the given target. diff --git a/vendor/google.golang.org/grpc/resolver_conn_wrapper.go b/vendor/google.golang.org/grpc/resolver_conn_wrapper.go deleted file mode 100644 index d68330560..000000000 --- a/vendor/google.golang.org/grpc/resolver_conn_wrapper.go +++ /dev/null @@ -1,247 +0,0 @@ -/* - * - * Copyright 2017 gRPC authors. - * - * Licensed under the Apache License, Version 2.0 (the "License"); - * you may not use this file except in compliance with the License. - * You may obtain a copy of the License at - * - * http://www.apache.org/licenses/LICENSE-2.0 - * - * Unless required by applicable law or agreed to in writing, software - * distributed under the License is distributed on an "AS IS" BASIS, - * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. - * See the License for the specific language governing permissions and - * limitations under the License. - * - */ - -package grpc - -import ( - "context" - "strings" - "sync" - - "google.golang.org/grpc/balancer" - "google.golang.org/grpc/internal/channelz" - "google.golang.org/grpc/internal/grpcsync" - "google.golang.org/grpc/internal/pretty" - "google.golang.org/grpc/resolver" - "google.golang.org/grpc/serviceconfig" -) - -// resolverStateUpdater wraps the single method used by ccResolverWrapper to -// report a state update from the actual resolver implementation. -type resolverStateUpdater interface { - updateResolverState(s resolver.State, err error) error -} - -// ccResolverWrapper is a wrapper on top of cc for resolvers. -// It implements resolver.ClientConn interface. -type ccResolverWrapper struct { - // The following fields are initialized when the wrapper is created and are - // read-only afterwards, and therefore can be accessed without a mutex. - cc resolverStateUpdater - channelzID *channelz.Identifier - ignoreServiceConfig bool - opts ccResolverWrapperOpts - serializer *grpcsync.CallbackSerializer // To serialize all incoming calls. - serializerCancel context.CancelFunc // To close the serializer, accessed only from close(). - - // All incoming (resolver --> gRPC) calls are guaranteed to execute in a - // mutually exclusive manner as they are scheduled on the serializer. - // Fields accessed *only* in these serializer callbacks, can therefore be - // accessed without a mutex. - curState resolver.State - - // mu guards access to the below fields. - mu sync.Mutex - closed bool - resolver resolver.Resolver // Accessed only from outgoing calls. -} - -// ccResolverWrapperOpts wraps the arguments to be passed when creating a new -// ccResolverWrapper. -type ccResolverWrapperOpts struct { - target resolver.Target // User specified dial target to resolve. - builder resolver.Builder // Resolver builder to use. - bOpts resolver.BuildOptions // Resolver build options to use. - channelzID *channelz.Identifier // Channelz identifier for the channel. -} - -// newCCResolverWrapper uses the resolver.Builder to build a Resolver and -// returns a ccResolverWrapper object which wraps the newly built resolver. -func newCCResolverWrapper(cc resolverStateUpdater, opts ccResolverWrapperOpts) (*ccResolverWrapper, error) { - ctx, cancel := context.WithCancel(context.Background()) - ccr := &ccResolverWrapper{ - cc: cc, - channelzID: opts.channelzID, - ignoreServiceConfig: opts.bOpts.DisableServiceConfig, - opts: opts, - serializer: grpcsync.NewCallbackSerializer(ctx), - serializerCancel: cancel, - } - - // Cannot hold the lock at build time because the resolver can send an - // update or error inline and these incoming calls grab the lock to schedule - // a callback in the serializer. - r, err := opts.builder.Build(opts.target, ccr, opts.bOpts) - if err != nil { - cancel() - return nil, err - } - - // Any error reported by the resolver at build time that leads to a - // re-resolution request from the balancer is dropped by grpc until we - // return from this function. So, we don't have to handle pending resolveNow - // requests here. - ccr.mu.Lock() - ccr.resolver = r - ccr.mu.Unlock() - - return ccr, nil -} - -func (ccr *ccResolverWrapper) resolveNow(o resolver.ResolveNowOptions) { - ccr.mu.Lock() - defer ccr.mu.Unlock() - - // ccr.resolver field is set only after the call to Build() returns. But in - // the process of building, the resolver may send an error update which when - // propagated to the balancer may result in a re-resolution request. - if ccr.closed || ccr.resolver == nil { - return - } - ccr.resolver.ResolveNow(o) -} - -func (ccr *ccResolverWrapper) close() { - ccr.mu.Lock() - if ccr.closed { - ccr.mu.Unlock() - return - } - - channelz.Info(logger, ccr.channelzID, "Closing the name resolver") - - // Close the serializer to ensure that no more calls from the resolver are - // handled, before actually closing the resolver. - ccr.serializerCancel() - ccr.closed = true - r := ccr.resolver - ccr.mu.Unlock() - - // Give enqueued callbacks a chance to finish. - <-ccr.serializer.Done() - - // Spawn a goroutine to close the resolver (since it may block trying to - // cleanup all allocated resources) and return early. - go r.Close() -} - -// serializerScheduleLocked is a convenience method to schedule a function to be -// run on the serializer while holding ccr.mu. -func (ccr *ccResolverWrapper) serializerScheduleLocked(f func(context.Context)) { - ccr.mu.Lock() - ccr.serializer.Schedule(f) - ccr.mu.Unlock() -} - -// UpdateState is called by resolver implementations to report new state to gRPC -// which includes addresses and service config. -func (ccr *ccResolverWrapper) UpdateState(s resolver.State) error { - errCh := make(chan error, 1) - if s.Endpoints == nil { - s.Endpoints = make([]resolver.Endpoint, 0, len(s.Addresses)) - for _, a := range s.Addresses { - ep := resolver.Endpoint{Addresses: []resolver.Address{a}, Attributes: a.BalancerAttributes} - ep.Addresses[0].BalancerAttributes = nil - s.Endpoints = append(s.Endpoints, ep) - } - } - ok := ccr.serializer.Schedule(func(context.Context) { - ccr.addChannelzTraceEvent(s) - ccr.curState = s - if err := ccr.cc.updateResolverState(ccr.curState, nil); err == balancer.ErrBadResolverState { - errCh <- balancer.ErrBadResolverState - return - } - errCh <- nil - }) - if !ok { - // The only time when Schedule() fail to add the callback to the - // serializer is when the serializer is closed, and this happens only - // when the resolver wrapper is closed. - return nil - } - return <-errCh -} - -// ReportError is called by resolver implementations to report errors -// encountered during name resolution to gRPC. -func (ccr *ccResolverWrapper) ReportError(err error) { - ccr.serializerScheduleLocked(func(_ context.Context) { - channelz.Warningf(logger, ccr.channelzID, "ccResolverWrapper: reporting error to cc: %v", err) - ccr.cc.updateResolverState(resolver.State{}, err) - }) -} - -// NewAddress is called by the resolver implementation to send addresses to -// gRPC. -func (ccr *ccResolverWrapper) NewAddress(addrs []resolver.Address) { - ccr.serializerScheduleLocked(func(_ context.Context) { - ccr.addChannelzTraceEvent(resolver.State{Addresses: addrs, ServiceConfig: ccr.curState.ServiceConfig}) - ccr.curState.Addresses = addrs - ccr.cc.updateResolverState(ccr.curState, nil) - }) -} - -// NewServiceConfig is called by the resolver implementation to send service -// configs to gRPC. -func (ccr *ccResolverWrapper) NewServiceConfig(sc string) { - ccr.serializerScheduleLocked(func(_ context.Context) { - channelz.Infof(logger, ccr.channelzID, "ccResolverWrapper: got new service config: %s", sc) - if ccr.ignoreServiceConfig { - channelz.Info(logger, ccr.channelzID, "Service config lookups disabled; ignoring config") - return - } - scpr := parseServiceConfig(sc) - if scpr.Err != nil { - channelz.Warningf(logger, ccr.channelzID, "ccResolverWrapper: error parsing service config: %v", scpr.Err) - return - } - ccr.addChannelzTraceEvent(resolver.State{Addresses: ccr.curState.Addresses, ServiceConfig: scpr}) - ccr.curState.ServiceConfig = scpr - ccr.cc.updateResolverState(ccr.curState, nil) - }) -} - -// ParseServiceConfig is called by resolver implementations to parse a JSON -// representation of the service config. -func (ccr *ccResolverWrapper) ParseServiceConfig(scJSON string) *serviceconfig.ParseResult { - return parseServiceConfig(scJSON) -} - -// addChannelzTraceEvent adds a channelz trace event containing the new -// state received from resolver implementations. -func (ccr *ccResolverWrapper) addChannelzTraceEvent(s resolver.State) { - var updates []string - var oldSC, newSC *ServiceConfig - var oldOK, newOK bool - if ccr.curState.ServiceConfig != nil { - oldSC, oldOK = ccr.curState.ServiceConfig.Config.(*ServiceConfig) - } - if s.ServiceConfig != nil { - newSC, newOK = s.ServiceConfig.Config.(*ServiceConfig) - } - if oldOK != newOK || (oldOK && newOK && oldSC.rawJSONString != newSC.rawJSONString) { - updates = append(updates, "service config updated") - } - if len(ccr.curState.Addresses) > 0 && len(s.Addresses) == 0 { - updates = append(updates, "resolver returned an empty address list") - } else if len(ccr.curState.Addresses) == 0 && len(s.Addresses) > 0 { - updates = append(updates, "resolver returned new addresses") - } - channelz.Infof(logger, ccr.channelzID, "Resolver state updated: %s (%v)", pretty.ToJSON(s), strings.Join(updates, "; ")) -} diff --git a/vendor/google.golang.org/grpc/resolver_wrapper.go b/vendor/google.golang.org/grpc/resolver_wrapper.go new file mode 100644 index 000000000..c79bab121 --- /dev/null +++ b/vendor/google.golang.org/grpc/resolver_wrapper.go @@ -0,0 +1,197 @@ +/* + * + * Copyright 2017 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package grpc + +import ( + "context" + "strings" + "sync" + + "google.golang.org/grpc/internal/channelz" + "google.golang.org/grpc/internal/grpcsync" + "google.golang.org/grpc/internal/pretty" + "google.golang.org/grpc/resolver" + "google.golang.org/grpc/serviceconfig" +) + +// ccResolverWrapper is a wrapper on top of cc for resolvers. +// It implements resolver.ClientConn interface. +type ccResolverWrapper struct { + // The following fields are initialized when the wrapper is created and are + // read-only afterwards, and therefore can be accessed without a mutex. + cc *ClientConn + ignoreServiceConfig bool + serializer *grpcsync.CallbackSerializer + serializerCancel context.CancelFunc + + resolver resolver.Resolver // only accessed within the serializer + + // The following fields are protected by mu. Caller must take cc.mu before + // taking mu. + mu sync.Mutex + curState resolver.State + closed bool +} + +// newCCResolverWrapper initializes the ccResolverWrapper. It can only be used +// after calling start, which builds the resolver. +func newCCResolverWrapper(cc *ClientConn) *ccResolverWrapper { + ctx, cancel := context.WithCancel(cc.ctx) + return &ccResolverWrapper{ + cc: cc, + ignoreServiceConfig: cc.dopts.disableServiceConfig, + serializer: grpcsync.NewCallbackSerializer(ctx), + serializerCancel: cancel, + } +} + +// start builds the name resolver using the resolver.Builder in cc and returns +// any error encountered. It must always be the first operation performed on +// any newly created ccResolverWrapper, except that close may be called instead. +func (ccr *ccResolverWrapper) start() error { + errCh := make(chan error) + ccr.serializer.Schedule(func(ctx context.Context) { + if ctx.Err() != nil { + return + } + opts := resolver.BuildOptions{ + DisableServiceConfig: ccr.cc.dopts.disableServiceConfig, + DialCreds: ccr.cc.dopts.copts.TransportCredentials, + CredsBundle: ccr.cc.dopts.copts.CredsBundle, + Dialer: ccr.cc.dopts.copts.Dialer, + } + var err error + ccr.resolver, err = ccr.cc.resolverBuilder.Build(ccr.cc.parsedTarget, ccr, opts) + errCh <- err + }) + return <-errCh +} + +func (ccr *ccResolverWrapper) resolveNow(o resolver.ResolveNowOptions) { + ccr.serializer.Schedule(func(ctx context.Context) { + if ctx.Err() != nil || ccr.resolver == nil { + return + } + ccr.resolver.ResolveNow(o) + }) +} + +// close initiates async shutdown of the wrapper. To determine the wrapper has +// finished shutting down, the channel should block on ccr.serializer.Done() +// without cc.mu held. +func (ccr *ccResolverWrapper) close() { + channelz.Info(logger, ccr.cc.channelzID, "Closing the name resolver") + ccr.mu.Lock() + ccr.closed = true + ccr.mu.Unlock() + + ccr.serializer.Schedule(func(context.Context) { + if ccr.resolver == nil { + return + } + ccr.resolver.Close() + ccr.resolver = nil + }) + ccr.serializerCancel() +} + +// UpdateState is called by resolver implementations to report new state to gRPC +// which includes addresses and service config. +func (ccr *ccResolverWrapper) UpdateState(s resolver.State) error { + ccr.cc.mu.Lock() + ccr.mu.Lock() + if ccr.closed { + ccr.mu.Unlock() + ccr.cc.mu.Unlock() + return nil + } + if s.Endpoints == nil { + s.Endpoints = make([]resolver.Endpoint, 0, len(s.Addresses)) + for _, a := range s.Addresses { + ep := resolver.Endpoint{Addresses: []resolver.Address{a}, Attributes: a.BalancerAttributes} + ep.Addresses[0].BalancerAttributes = nil + s.Endpoints = append(s.Endpoints, ep) + } + } + ccr.addChannelzTraceEvent(s) + ccr.curState = s + ccr.mu.Unlock() + return ccr.cc.updateResolverStateAndUnlock(s, nil) +} + +// ReportError is called by resolver implementations to report errors +// encountered during name resolution to gRPC. +func (ccr *ccResolverWrapper) ReportError(err error) { + ccr.cc.mu.Lock() + ccr.mu.Lock() + if ccr.closed { + ccr.mu.Unlock() + ccr.cc.mu.Unlock() + return + } + ccr.mu.Unlock() + channelz.Warningf(logger, ccr.cc.channelzID, "ccResolverWrapper: reporting error to cc: %v", err) + ccr.cc.updateResolverStateAndUnlock(resolver.State{}, err) +} + +// NewAddress is called by the resolver implementation to send addresses to +// gRPC. +func (ccr *ccResolverWrapper) NewAddress(addrs []resolver.Address) { + ccr.cc.mu.Lock() + ccr.mu.Lock() + if ccr.closed { + ccr.mu.Unlock() + ccr.cc.mu.Unlock() + return + } + s := resolver.State{Addresses: addrs, ServiceConfig: ccr.curState.ServiceConfig} + ccr.addChannelzTraceEvent(s) + ccr.curState = s + ccr.mu.Unlock() + ccr.cc.updateResolverStateAndUnlock(s, nil) +} + +// ParseServiceConfig is called by resolver implementations to parse a JSON +// representation of the service config. +func (ccr *ccResolverWrapper) ParseServiceConfig(scJSON string) *serviceconfig.ParseResult { + return parseServiceConfig(scJSON) +} + +// addChannelzTraceEvent adds a channelz trace event containing the new +// state received from resolver implementations. +func (ccr *ccResolverWrapper) addChannelzTraceEvent(s resolver.State) { + var updates []string + var oldSC, newSC *ServiceConfig + var oldOK, newOK bool + if ccr.curState.ServiceConfig != nil { + oldSC, oldOK = ccr.curState.ServiceConfig.Config.(*ServiceConfig) + } + if s.ServiceConfig != nil { + newSC, newOK = s.ServiceConfig.Config.(*ServiceConfig) + } + if oldOK != newOK || (oldOK && newOK && oldSC.rawJSONString != newSC.rawJSONString) { + updates = append(updates, "service config updated") + } + if len(ccr.curState.Addresses) > 0 && len(s.Addresses) == 0 { + updates = append(updates, "resolver returned an empty address list") + } else if len(ccr.curState.Addresses) == 0 && len(s.Addresses) > 0 { + updates = append(updates, "resolver returned new addresses") + } + channelz.Infof(logger, ccr.cc.channelzID, "Resolver state updated: %s (%v)", pretty.ToJSON(s), strings.Join(updates, "; ")) +} diff --git a/vendor/google.golang.org/grpc/server.go b/vendor/google.golang.org/grpc/server.go index 8f60d4214..2fa694d55 100644 --- a/vendor/google.golang.org/grpc/server.go +++ b/vendor/google.golang.org/grpc/server.go @@ -70,6 +70,10 @@ func init() { internal.GetServerCredentials = func(srv *Server) credentials.TransportCredentials { return srv.opts.creds } + internal.IsRegisteredMethod = func(srv *Server, method string) bool { + return srv.isRegisteredMethod(method) + } + internal.ServerFromContext = serverFromContext internal.DrainServerTransports = func(srv *Server, addr string) { srv.drainServerTransports(addr) } @@ -81,6 +85,7 @@ func init() { } internal.BinaryLogger = binaryLogger internal.JoinServerOptions = newJoinServerOption + internal.RecvBufferPool = recvBufferPool } var statusOK = status.New(codes.OK, "") @@ -578,11 +583,13 @@ func NumStreamWorkers(numServerWorkers uint32) ServerOption { // options are used: StatsHandler, EnableTracing, or binary logging. In such // cases, the shared buffer pool will be ignored. // -// # Experimental -// -// Notice: This API is EXPERIMENTAL and may be changed or removed in a -// later release. +// Deprecated: use experimental.WithRecvBufferPool instead. Will be deleted in +// v1.60.0 or later. func RecvBufferPool(bufferPool SharedBufferPool) ServerOption { + return recvBufferPool(bufferPool) +} + +func recvBufferPool(bufferPool SharedBufferPool) ServerOption { return newFuncServerOption(func(o *serverOptions) { o.recvBufferPool = bufferPool }) @@ -806,6 +813,18 @@ func (l *listenSocket) Close() error { // Serve returns when lis.Accept fails with fatal errors. lis will be closed when // this method returns. // Serve will return a non-nil error unless Stop or GracefulStop is called. +// +// Note: All supported releases of Go (as of December 2023) override the OS +// defaults for TCP keepalive time and interval to 15s. To enable TCP keepalive +// with OS defaults for keepalive time and interval, callers need to do the +// following two things: +// - pass a net.Listener created by calling the Listen method on a +// net.ListenConfig with the `KeepAlive` field set to a negative value. This +// will result in the Go standard library not overriding OS defaults for TCP +// keepalive interval and time. But this will also result in the Go standard +// library not enabling TCP keepalives by default. +// - override the Accept method on the passed in net.Listener and set the +// SO_KEEPALIVE socket option to enable TCP keepalives, with OS defaults. func (s *Server) Serve(lis net.Listener) error { s.mu.Lock() s.printf("serving") @@ -917,7 +936,7 @@ func (s *Server) handleRawConn(lisAddr string, rawConn net.Conn) { return } go func() { - s.serveStreams(st) + s.serveStreams(context.Background(), st, rawConn) s.removeConn(lisAddr, st) }() } @@ -971,18 +990,29 @@ func (s *Server) newHTTP2Transport(c net.Conn) transport.ServerTransport { return st } -func (s *Server) serveStreams(st transport.ServerTransport) { - defer st.Close(errors.New("finished serving streams for the server transport")) - var wg sync.WaitGroup +func (s *Server) serveStreams(ctx context.Context, st transport.ServerTransport, rawConn net.Conn) { + ctx = transport.SetConnection(ctx, rawConn) + ctx = peer.NewContext(ctx, st.Peer()) + for _, sh := range s.opts.statsHandlers { + ctx = sh.TagConn(ctx, &stats.ConnTagInfo{ + RemoteAddr: st.Peer().Addr, + LocalAddr: st.Peer().LocalAddr, + }) + sh.HandleConn(ctx, &stats.ConnBegin{}) + } - streamQuota := newHandlerQuota(s.opts.maxConcurrentStreams) - st.HandleStreams(func(stream *transport.Stream) { - wg.Add(1) + defer func() { + st.Close(errors.New("finished serving streams for the server transport")) + for _, sh := range s.opts.statsHandlers { + sh.HandleConn(ctx, &stats.ConnEnd{}) + } + }() + streamQuota := newHandlerQuota(s.opts.maxConcurrentStreams) + st.HandleStreams(ctx, func(stream *transport.Stream) { streamQuota.acquire() f := func() { defer streamQuota.release() - defer wg.Done() s.handleStream(st, stream) } @@ -996,7 +1026,6 @@ func (s *Server) serveStreams(st transport.ServerTransport) { } go f() }) - wg.Wait() } var _ http.Handler = (*Server)(nil) @@ -1040,7 +1069,7 @@ func (s *Server) ServeHTTP(w http.ResponseWriter, r *http.Request) { return } defer s.removeConn(listenerAddressForServeHTTP, st) - s.serveStreams(st) + s.serveStreams(r.Context(), st, nil) } func (s *Server) addConn(addr string, st transport.ServerTransport) bool { @@ -1689,6 +1718,7 @@ func (s *Server) processStreamingRPC(ctx context.Context, t transport.ServerTran func (s *Server) handleStream(t transport.ServerTransport, stream *transport.Stream) { ctx := stream.Context() + ctx = contextWithServer(ctx, s) var ti *traceInfo if EnableTracing { tr := trace.New("grpc.Recv."+methodFamily(stream.Method()), stream.Method()) @@ -1697,7 +1727,7 @@ func (s *Server) handleStream(t transport.ServerTransport, stream *transport.Str tr: tr, firstLine: firstLine{ client: false, - remoteAddr: t.RemoteAddr(), + remoteAddr: t.Peer().Addr, }, } if dl, ok := ctx.Deadline(); ok { @@ -1731,6 +1761,22 @@ func (s *Server) handleStream(t transport.ServerTransport, stream *transport.Str service := sm[:pos] method := sm[pos+1:] + md, _ := metadata.FromIncomingContext(ctx) + for _, sh := range s.opts.statsHandlers { + ctx = sh.TagRPC(ctx, &stats.RPCTagInfo{FullMethodName: stream.Method()}) + sh.HandleRPC(ctx, &stats.InHeader{ + FullMethod: stream.Method(), + RemoteAddr: t.Peer().Addr, + LocalAddr: t.Peer().LocalAddr, + Compression: stream.RecvCompress(), + WireLength: stream.HeaderWireLength(), + Header: md, + }) + } + // To have calls in stream callouts work. Will delete once all stats handler + // calls come from the gRPC layer. + stream.SetContext(ctx) + srv, knownService := s.services[service] if knownService { if md, ok := srv.methods[method]; ok { @@ -1820,62 +1866,64 @@ func ServerTransportStreamFromContext(ctx context.Context) ServerTransportStream // pending RPCs on the client side will get notified by connection // errors. func (s *Server) Stop() { - s.quit.Fire() + s.stop(false) +} - defer func() { - s.serveWG.Wait() - s.done.Fire() - }() +// GracefulStop stops the gRPC server gracefully. It stops the server from +// accepting new connections and RPCs and blocks until all the pending RPCs are +// finished. +func (s *Server) GracefulStop() { + s.stop(true) +} + +func (s *Server) stop(graceful bool) { + s.quit.Fire() + defer s.done.Fire() s.channelzRemoveOnce.Do(func() { channelz.RemoveEntry(s.channelzID) }) s.mu.Lock() - listeners := s.lis - s.lis = nil - conns := s.conns - s.conns = nil - // interrupt GracefulStop if Stop and GracefulStop are called concurrently. - s.cv.Broadcast() + s.closeListenersLocked() + // Wait for serving threads to be ready to exit. Only then can we be sure no + // new conns will be created. s.mu.Unlock() + s.serveWG.Wait() - for lis := range listeners { - lis.Close() - } - for _, cs := range conns { - for st := range cs { - st.Close(errors.New("Server.Stop called")) - } + s.mu.Lock() + defer s.mu.Unlock() + + if graceful { + s.drainAllServerTransportsLocked() + } else { + s.closeServerTransportsLocked() } + if s.opts.numServerWorkers > 0 { s.stopServerWorkers() } - s.mu.Lock() + for len(s.conns) != 0 { + s.cv.Wait() + } + s.conns = nil + if s.events != nil { s.events.Finish() s.events = nil } - s.mu.Unlock() } -// GracefulStop stops the gRPC server gracefully. It stops the server from -// accepting new connections and RPCs and blocks until all the pending RPCs are -// finished. -func (s *Server) GracefulStop() { - s.quit.Fire() - defer s.done.Fire() - - s.channelzRemoveOnce.Do(func() { channelz.RemoveEntry(s.channelzID) }) - s.mu.Lock() - if s.conns == nil { - s.mu.Unlock() - return +// s.mu must be held by the caller. +func (s *Server) closeServerTransportsLocked() { + for _, conns := range s.conns { + for st := range conns { + st.Close(errors.New("Server.Stop called")) + } } +} - for lis := range s.lis { - lis.Close() - } - s.lis = nil +// s.mu must be held by the caller. +func (s *Server) drainAllServerTransportsLocked() { if !s.drain { for _, conns := range s.conns { for st := range conns { @@ -1884,22 +1932,14 @@ func (s *Server) GracefulStop() { } s.drain = true } +} - // Wait for serving threads to be ready to exit. Only then can we be sure no - // new conns will be created. - s.mu.Unlock() - s.serveWG.Wait() - s.mu.Lock() - - for len(s.conns) != 0 { - s.cv.Wait() - } - s.conns = nil - if s.events != nil { - s.events.Finish() - s.events = nil +// s.mu must be held by the caller. +func (s *Server) closeListenersLocked() { + for lis := range s.lis { + lis.Close() } - s.mu.Unlock() + s.lis = nil } // contentSubtype must be lowercase @@ -1913,11 +1953,50 @@ func (s *Server) getCodec(contentSubtype string) baseCodec { } codec := encoding.GetCodec(contentSubtype) if codec == nil { + logger.Warningf("Unsupported codec %q. Defaulting to %q for now. This will start to fail in future releases.", contentSubtype, proto.Name) return encoding.GetCodec(proto.Name) } return codec } +type serverKey struct{} + +// serverFromContext gets the Server from the context. +func serverFromContext(ctx context.Context) *Server { + s, _ := ctx.Value(serverKey{}).(*Server) + return s +} + +// contextWithServer sets the Server in the context. +func contextWithServer(ctx context.Context, server *Server) context.Context { + return context.WithValue(ctx, serverKey{}, server) +} + +// isRegisteredMethod returns whether the passed in method is registered as a +// method on the server. /service/method and service/method will match if the +// service and method are registered on the server. +func (s *Server) isRegisteredMethod(serviceMethod string) bool { + if serviceMethod != "" && serviceMethod[0] == '/' { + serviceMethod = serviceMethod[1:] + } + pos := strings.LastIndex(serviceMethod, "/") + if pos == -1 { // Invalid method name syntax. + return false + } + service := serviceMethod[:pos] + method := serviceMethod[pos+1:] + srv, knownService := s.services[service] + if knownService { + if _, ok := srv.methods[method]; ok { + return true + } + if _, ok := srv.streams[method]; ok { + return true + } + } + return false +} + // SetHeader sets the header metadata to be sent from the server to the client. // The context provided must be the context passed to the server's handler. // diff --git a/vendor/google.golang.org/grpc/version.go b/vendor/google.golang.org/grpc/version.go index 6d2cadd79..a04793aeb 100644 --- a/vendor/google.golang.org/grpc/version.go +++ b/vendor/google.golang.org/grpc/version.go @@ -19,4 +19,4 @@ package grpc // Version is the current grpc version. -const Version = "1.59.0" +const Version = "1.60.0" diff --git a/vendor/google.golang.org/grpc/vet.sh b/vendor/google.golang.org/grpc/vet.sh index bb480f1f9..896dc38f5 100644 --- a/vendor/google.golang.org/grpc/vet.sh +++ b/vendor/google.golang.org/grpc/vet.sh @@ -35,7 +35,6 @@ if [[ "$1" = "-install" ]]; then # Install the pinned versions as defined in module tools. pushd ./test/tools go install \ - golang.org/x/lint/golint \ golang.org/x/tools/cmd/goimports \ honnef.co/go/tools/cmd/staticcheck \ github.com/client9/misspell/cmd/misspell @@ -77,12 +76,16 @@ fi not grep 'func Test[^(]' *_test.go not grep 'func Test[^(]' test/*.go +# - Check for typos in test function names +git grep 'func (s) ' -- "*_test.go" | not grep -v 'func (s) Test' +git grep 'func [A-Z]' -- "*_test.go" | not grep -v 'func Test\|Benchmark\|Example' + # - Do not import x/net/context. not git grep -l 'x/net/context' -- "*.go" # - Do not import math/rand for real library code. Use internal/grpcrand for # thread safety. -git grep -l '"math/rand"' -- "*.go" 2>&1 | not grep -v '^examples\|^stress\|grpcrand\|^benchmark\|wrr_test' +git grep -l '"math/rand"' -- "*.go" 2>&1 | not grep -v '^examples\|^interop/stress\|grpcrand\|^benchmark\|wrr_test' # - Do not use "interface{}"; use "any" instead. git grep -l 'interface{}' -- "*.go" 2>&1 | not grep -v '\.pb\.go\|protoc-gen-go-grpc' @@ -94,15 +97,14 @@ git grep -l -e 'grpclog.I' --or -e 'grpclog.W' --or -e 'grpclog.E' --or -e 'grpc not git grep "\(import \|^\s*\)\"github.com/golang/protobuf/ptypes/" -- "*.go" # - Ensure all usages of grpc_testing package are renamed when importing. -not git grep "\(import \|^\s*\)\"google.golang.org/grpc/interop/grpc_testing" -- "*.go" +not git grep "\(import \|^\s*\)\"google.golang.org/grpc/interop/grpc_testing" -- "*.go" # - Ensure all xds proto imports are renamed to *pb or *grpc. git grep '"github.com/envoyproxy/go-control-plane/envoy' -- '*.go' ':(exclude)*.pb.go' | not grep -v 'pb "\|grpc "' misspell -error . -# - gofmt, goimports, golint (with exceptions for generated code), go vet, -# go mod tidy. +# - gofmt, goimports, go vet, go mod tidy. # Perform these checks on each module inside gRPC. for MOD_FILE in $(find . -name 'go.mod'); do MOD_DIR=$(dirname ${MOD_FILE}) @@ -110,7 +112,6 @@ for MOD_FILE in $(find . -name 'go.mod'); do go vet -all ./... | fail_on_output gofmt -s -d -l . 2>&1 | fail_on_output goimports -l . 2>&1 | not grep -vE "\.pb\.go" - golint ./... 2>&1 | not grep -vE "/grpc_testing_not_regenerate/.*\.pb\.go:" go mod tidy -compat=1.19 git status --porcelain 2>&1 | fail_on_output || \ @@ -119,94 +120,73 @@ for MOD_FILE in $(find . -name 'go.mod'); do done # - Collection of static analysis checks -# -# TODO(dfawley): don't use deprecated functions in examples or first-party -# plugins. -# TODO(dfawley): enable ST1019 (duplicate imports) but allow for protobufs. SC_OUT="$(mktemp)" -staticcheck -go 1.19 -checks 'inherit,-ST1015,-ST1019,-SA1019' ./... > "${SC_OUT}" || true -# Error if anything other than deprecation warnings are printed. -not grep -v "is deprecated:.*SA1019" "${SC_OUT}" -# Only ignore the following deprecated types/fields/functions. -not grep -Fv '.CredsBundle -.HeaderMap -.Metadata is deprecated: use Attributes -.NewAddress -.NewServiceConfig -.Type is deprecated: use Attributes -BuildVersion is deprecated -balancer.ErrTransientFailure -balancer.Picker -extDesc.Filename is deprecated -github.com/golang/protobuf/jsonpb is deprecated -grpc.CallCustomCodec -grpc.Code -grpc.Compressor -grpc.CustomCodec -grpc.Decompressor -grpc.MaxMsgSize -grpc.MethodConfig -grpc.NewGZIPCompressor -grpc.NewGZIPDecompressor -grpc.RPCCompressor -grpc.RPCDecompressor -grpc.ServiceConfig -grpc.WithCompressor -grpc.WithDecompressor -grpc.WithDialer -grpc.WithMaxMsgSize -grpc.WithServiceConfig -grpc.WithTimeout -http.CloseNotifier -info.SecurityVersion -proto is deprecated -proto.InternalMessageInfo is deprecated -proto.EnumName is deprecated -proto.ErrInternalBadWireType is deprecated -proto.FileDescriptor is deprecated -proto.Marshaler is deprecated -proto.MessageType is deprecated -proto.RegisterEnum is deprecated -proto.RegisterFile is deprecated -proto.RegisterType is deprecated -proto.RegisterExtension is deprecated -proto.RegisteredExtension is deprecated -proto.RegisteredExtensions is deprecated -proto.RegisterMapType is deprecated -proto.Unmarshaler is deprecated +staticcheck -go 1.19 -checks 'all' ./... > "${SC_OUT}" || true + +# Error for anything other than checks that need exclusions. +grep -v "(ST1000)" "${SC_OUT}" | grep -v "(SA1019)" | grep -v "(ST1003)" | not grep -v "(ST1019)\|\(other import of\)" + +# Exclude underscore checks for generated code. +grep "(ST1003)" "${SC_OUT}" | not grep -v '\(.pb.go:\)\|\(code_string_test.go:\)' + +# Error for duplicate imports not including grpc protos. +grep "(ST1019)\|\(other import of\)" "${SC_OUT}" | not grep -Fv 'XXXXX PleaseIgnoreUnused +channelz/grpc_channelz_v1" +go-control-plane/envoy +grpclb/grpc_lb_v1" +health/grpc_health_v1" +interop/grpc_testing" +orca/v3" +proto/grpc_gcp" +proto/grpc_lookup_v1" +reflection/grpc_reflection_v1" +reflection/grpc_reflection_v1alpha" +XXXXX PleaseIgnoreUnused' + +# Error for any package comments not in generated code. +grep "(ST1000)" "${SC_OUT}" | not grep -v "\.pb\.go:" + +# Only ignore the following deprecated types/fields/functions and exclude +# generated code. +grep "(SA1019)" "${SC_OUT}" | not grep -Fv 'XXXXX PleaseIgnoreUnused +XXXXX Protobuf related deprecation errors: +"github.com/golang/protobuf +.pb.go: +: ptypes. +proto.RegisterType +XXXXX gRPC internal usage deprecation errors: +"google.golang.org/grpc +: grpc. +: v1alpha. +: v1alphareflectionpb. +BalancerAttributes is deprecated: +CredsBundle is deprecated: +Metadata is deprecated: use Attributes instead. +NewSubConn is deprecated: +OverrideServerName is deprecated: +RemoveSubConn is deprecated: +SecurityVersion is deprecated: Target is deprecated: Use the Target field in the BuildOptions instead. -xxx_messageInfo_ -' "${SC_OUT}" - -# - special golint on package comments. -lint_package_comment_per_package() { - # Number of files in this go package. - fileCount=$(go list -f '{{len .GoFiles}}' $1) - if [ ${fileCount} -eq 0 ]; then - return 0 - fi - # Number of package errors generated by golint. - lintPackageCommentErrorsCount=$(golint --min_confidence 0 $1 | grep -c "should have a package comment") - # golint complains about every file that's missing the package comment. If the - # number of files for this package is greater than the number of errors, there's - # at least one file with package comment, good. Otherwise, fail. - if [ ${fileCount} -le ${lintPackageCommentErrorsCount} ]; then - echo "Package $1 (with ${fileCount} files) is missing package comment" - return 1 - fi -} -lint_package_comment() { - set +ex - - count=0 - for i in $(go list ./...); do - lint_package_comment_per_package "$i" - ((count += $?)) - done - - set -ex - return $count -} -lint_package_comment +UpdateAddresses is deprecated: +UpdateSubConnState is deprecated: +balancer.ErrTransientFailure is deprecated: +grpc/reflection/v1alpha/reflection.proto +XXXXX xDS deprecated fields we support +.ExactMatch +.PrefixMatch +.SafeRegexMatch +.SuffixMatch +GetContainsMatch +GetExactMatch +GetMatchSubjectAltNames +GetPrefixMatch +GetSafeRegexMatch +GetSuffixMatch +GetTlsCertificateCertificateProviderInstance +GetValidationContextCertificateProviderInstance +XXXXX TODO: Remove the below deprecation usages: +CloseNotifier +Roots.Subjects +XXXXX PleaseIgnoreUnused' echo SUCCESS diff --git a/vendor/modules.txt b/vendor/modules.txt index 9c7ac14d4..5e2c3d0bb 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -5,14 +5,16 @@ github.com/Azure/go-ansiterm/winterm # github.com/JeffAshton/win_pdh v0.0.0-20161109143554-76bb4ee9f0ab ## explicit github.com/JeffAshton/win_pdh -# github.com/Microsoft/go-winio v0.4.17 -## explicit; go 1.12 +# github.com/Microsoft/go-winio v0.6.1 +## explicit; go 1.17 github.com/Microsoft/go-winio +github.com/Microsoft/go-winio/internal/fs +github.com/Microsoft/go-winio/internal/socket +github.com/Microsoft/go-winio/internal/stringbuffer github.com/Microsoft/go-winio/pkg/guid -github.com/Microsoft/go-winio/pkg/security github.com/Microsoft/go-winio/vhd -# github.com/Microsoft/hcsshim v0.8.25 -## explicit; go 1.13 +# github.com/Microsoft/hcsshim v0.11.4 +## explicit; go 1.18 github.com/Microsoft/hcsshim github.com/Microsoft/hcsshim/computestorage github.com/Microsoft/hcsshim/internal/cow @@ -22,12 +24,17 @@ github.com/Microsoft/hcsshim/internal/hcs/schema2 github.com/Microsoft/hcsshim/internal/hcserror github.com/Microsoft/hcsshim/internal/hns github.com/Microsoft/hcsshim/internal/interop +github.com/Microsoft/hcsshim/internal/jobobject github.com/Microsoft/hcsshim/internal/log github.com/Microsoft/hcsshim/internal/logfields github.com/Microsoft/hcsshim/internal/longpath +github.com/Microsoft/hcsshim/internal/memory github.com/Microsoft/hcsshim/internal/mergemaps github.com/Microsoft/hcsshim/internal/oc +github.com/Microsoft/hcsshim/internal/protocol/guestrequest +github.com/Microsoft/hcsshim/internal/queue github.com/Microsoft/hcsshim/internal/safefile +github.com/Microsoft/hcsshim/internal/security github.com/Microsoft/hcsshim/internal/timeout github.com/Microsoft/hcsshim/internal/vmcompute github.com/Microsoft/hcsshim/internal/wclayer @@ -60,9 +67,12 @@ github.com/cenkalti/backoff/v4 # github.com/cespare/xxhash/v2 v2.2.0 ## explicit; go 1.11 github.com/cespare/xxhash/v2 -# github.com/containerd/cgroups v1.0.1 -## explicit; go 1.13 +# github.com/containerd/cgroups v1.1.0 +## explicit; go 1.17 github.com/containerd/cgroups/stats/v1 +# github.com/containerd/containerd v1.6.23 +## explicit; go 1.18 +github.com/containerd/containerd/errdefs # github.com/containernetworking/cni v1.1.2 ## explicit; go 1.14 github.com/containernetworking/cni/libcni @@ -130,7 +140,7 @@ github.com/docker/go-units ## explicit github.com/emicklei/go-restful github.com/emicklei/go-restful/log -# github.com/emicklei/go-restful/v3 v3.9.0 +# github.com/emicklei/go-restful/v3 v3.10.1 ## explicit; go 1.13 github.com/emicklei/go-restful/v3 github.com/emicklei/go-restful/v3/log @@ -228,9 +238,10 @@ github.com/google/go-cmp/cmp/internal/diff github.com/google/go-cmp/cmp/internal/flags github.com/google/go-cmp/cmp/internal/function github.com/google/go-cmp/cmp/internal/value -# github.com/google/gofuzz v1.1.0 +# github.com/google/gofuzz v1.2.0 ## explicit; go 1.12 github.com/google/gofuzz +github.com/google/gofuzz/bytesource # github.com/google/uuid v1.3.1 ## explicit github.com/google/uuid @@ -244,8 +255,8 @@ github.com/grpc-ecosystem/go-grpc-prometheus github.com/grpc-ecosystem/grpc-gateway/v2/internal/httprule github.com/grpc-ecosystem/grpc-gateway/v2/runtime github.com/grpc-ecosystem/grpc-gateway/v2/utilities -# github.com/imdario/mergo v0.3.7 -## explicit +# github.com/imdario/mergo v0.3.12 +## explicit; go 1.13 github.com/imdario/mergo # github.com/inconshreveable/mousetrap v1.1.0 ## explicit; go 1.18 @@ -314,7 +325,7 @@ github.com/opencontainers/runc/libcontainer/utils # github.com/opencontainers/runtime-spec v1.0.3-0.20220909204839-494a5a6aca78 ## explicit github.com/opencontainers/runtime-spec/specs-go -# github.com/opencontainers/selinux v1.10.0 +# github.com/opencontainers/selinux v1.10.1 ## explicit; go 1.13 github.com/opencontainers/selinux/go-selinux github.com/opencontainers/selinux/pkg/pwalk @@ -366,7 +377,7 @@ github.com/stretchr/objx github.com/stretchr/testify/assert github.com/stretchr/testify/mock github.com/stretchr/testify/require -# github.com/vishvananda/netlink v1.1.0 +# github.com/vishvananda/netlink v1.2.1-beta.2 ## explicit; go 1.12 github.com/vishvananda/netlink github.com/vishvananda/netlink/nl @@ -479,6 +490,9 @@ go.uber.org/zap/zapgrpc ## explicit; go 1.17 golang.org/x/crypto/cryptobyte golang.org/x/crypto/cryptobyte/asn1 +# golang.org/x/mod v0.12.0 +## explicit; go 1.17 +golang.org/x/mod/semver # golang.org/x/net v0.17.0 ## explicit; go 1.17 golang.org/x/net/context @@ -491,7 +505,7 @@ golang.org/x/net/internal/timeseries golang.org/x/net/proxy golang.org/x/net/trace golang.org/x/net/websocket -# golang.org/x/oauth2 v0.11.0 +# golang.org/x/oauth2 v0.13.0 ## explicit; go 1.18 golang.org/x/oauth2 golang.org/x/oauth2/internal @@ -499,8 +513,9 @@ golang.org/x/oauth2/internal ## explicit; go 1.18 golang.org/x/sync/errgroup golang.org/x/sync/singleflight -# golang.org/x/sys v0.14.0 +# golang.org/x/sys v0.15.0 ## explicit; go 1.18 +golang.org/x/sys/execabs golang.org/x/sys/plan9 golang.org/x/sys/unix golang.org/x/sys/windows @@ -518,7 +533,26 @@ golang.org/x/text/width # golang.org/x/time v0.3.0 ## explicit golang.org/x/time/rate -# google.golang.org/appengine v1.6.7 +# golang.org/x/tools v0.12.0 +## explicit; go 1.18 +golang.org/x/tools/cmd/stringer +golang.org/x/tools/go/gcexportdata +golang.org/x/tools/go/internal/packagesdriver +golang.org/x/tools/go/packages +golang.org/x/tools/go/types/objectpath +golang.org/x/tools/internal/event +golang.org/x/tools/internal/event/core +golang.org/x/tools/internal/event/keys +golang.org/x/tools/internal/event/label +golang.org/x/tools/internal/event/tag +golang.org/x/tools/internal/gcimporter +golang.org/x/tools/internal/gocommand +golang.org/x/tools/internal/packagesinternal +golang.org/x/tools/internal/pkgbits +golang.org/x/tools/internal/tokeninternal +golang.org/x/tools/internal/typeparams +golang.org/x/tools/internal/typesinternal +# google.golang.org/appengine v1.6.8 ## explicit; go 1.11 google.golang.org/appengine/internal google.golang.org/appengine/internal/base @@ -527,20 +561,20 @@ google.golang.org/appengine/internal/log google.golang.org/appengine/internal/remote_api google.golang.org/appengine/internal/urlfetch google.golang.org/appengine/urlfetch -# google.golang.org/genproto v0.0.0-20230822172742-b8732ec3820d +# google.golang.org/genproto v0.0.0-20231002182017-d307bd883b97 ## explicit; go 1.19 google.golang.org/genproto/internal -# google.golang.org/genproto/googleapis/api v0.0.0-20230822172742-b8732ec3820d +# google.golang.org/genproto/googleapis/api v0.0.0-20231002182017-d307bd883b97 ## explicit; go 1.19 google.golang.org/genproto/googleapis/api google.golang.org/genproto/googleapis/api/annotations google.golang.org/genproto/googleapis/api/expr/v1alpha1 google.golang.org/genproto/googleapis/api/httpbody -# google.golang.org/genproto/googleapis/rpc v0.0.0-20230822172742-b8732ec3820d +# google.golang.org/genproto/googleapis/rpc v0.0.0-20231002182017-d307bd883b97 ## explicit; go 1.19 google.golang.org/genproto/googleapis/rpc/errdetails google.golang.org/genproto/googleapis/rpc/status -# google.golang.org/grpc v1.59.0 +# google.golang.org/grpc v1.60.0 ## explicit; go 1.19 google.golang.org/grpc google.golang.org/grpc/attributes @@ -578,6 +612,7 @@ google.golang.org/grpc/internal/metadata google.golang.org/grpc/internal/pretty google.golang.org/grpc/internal/resolver google.golang.org/grpc/internal/resolver/dns +google.golang.org/grpc/internal/resolver/dns/internal google.golang.org/grpc/internal/resolver/passthrough google.golang.org/grpc/internal/resolver/unix google.golang.org/grpc/internal/serviceconfig @@ -589,6 +624,7 @@ google.golang.org/grpc/keepalive google.golang.org/grpc/metadata google.golang.org/grpc/peer google.golang.org/grpc/resolver +google.golang.org/grpc/resolver/dns google.golang.org/grpc/resolver/manual google.golang.org/grpc/serviceconfig google.golang.org/grpc/stats @@ -1152,7 +1188,7 @@ k8s.io/component-base/version ## explicit; go 1.19 k8s.io/component-helpers/node/util/sysctl k8s.io/component-helpers/node/util/sysctl/testing -# k8s.io/cri-api v0.22.8 => k8s.io/cri-api v0.22.8 +# k8s.io/cri-api v0.25.0 => k8s.io/cri-api v0.22.8 ## explicit; go 1.16 k8s.io/cri-api/pkg/apis/runtime/v1 k8s.io/cri-api/pkg/apis/runtime/v1alpha2